builder: fx-team_snowleopard-debug_test-mochitest-devtools-chrome-6 slave: t-snow-r4-0100 starttime: 1446162633.0 results: success (0) buildid: 20151029154349 builduid: 705c0d3b109c4819a82566c573f99661 revision: 8e4fa465e2c6ab3cdf67db304a35135c7be55c08 ========= Started set props: master (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.004412) ========= master: http://buildbot-master107.bb.releng.scl3.mozilla.com:8201/ ========= Finished set props: master (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.004998) ========= ========= Started set props: basedir (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.005372) ========= bash -c pwd in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'pwd'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False /builds/slave/test program finished with exit code 0 elapsedTime=0.009357 basedir: '/builds/slave/test' ========= Finished set props: basedir (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.087057) ========= ========= Started downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.087505) ========= ========= Finished downloading to buildprops.json (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.162039) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.162393) ========= rm -rf properties in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'properties'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False program finished with exit code 0 elapsedTime=0.025980 ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.214508) ========= ========= Started set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.214938) ========= script_repo_url: https://hg.mozilla.org/build/mozharness ========= Finished set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.215471) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.215835) ========= bash -c 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False --2015-10-29 16:50:33-- https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py Resolving hg.mozilla.org... 63.245.215.25, 63.245.215.102 Connecting to hg.mozilla.org|63.245.215.25|:443... connected. HTTP request sent, awaiting response... 200 Script output follows Length: 12141 (12K) [text/x-python] Saving to: `archiver_client.py' 0K .......... . 100% 609M=0s 2015-10-29 16:50:33 (609 MB/s) - `archiver_client.py' saved [12141/12141] program finished with exit code 0 elapsedTime=0.234003 ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.474599) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.474967) ========= rm -rf scripts in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'scripts'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False program finished with exit code 0 elapsedTime=0.242400 ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:33.736831) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 1 secs) (at 2015-10-29 16:50:33.737263) ========= bash -c 'python archiver_client.py mozharness --repo integration/fx-team --rev 8e4fa465e2c6ab3cdf67db304a35135c7be55c08 --destination scripts --debug' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', u'python archiver_client.py mozharness --repo integration/fx-team --rev 8e4fa465e2c6ab3cdf67db304a35135c7be55c08 --destination scripts --debug'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False 2015-10-29 16:50:33,862 truncating revision to first 12 chars 2015-10-29 16:50:33,862 Setting DEBUG logging. 2015-10-29 16:50:33,862 attempt 1/10 2015-10-29 16:50:33,862 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/integration/fx-team/8e4fa465e2c6?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness 2015-10-29 16:50:34,821 unpacking tar archive at: fx-team-8e4fa465e2c6/testing/mozharness/ program finished with exit code 0 elapsedTime=1.304329 ========= Finished 'bash -c ...' (results: 0, elapsed: 1 secs) (at 2015-10-29 16:50:35.063554) ========= ========= Started downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:35.064076) ========= ========= Finished downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:35.087604) ========= ========= Started tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:35.088073) ========= TinderboxPrint: script_revlink: https://hg.mozilla.org/build/mozharness/rev/production ========= Finished tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-10-29 16:50:35.088670) ========= ========= Started '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 17 mins, 14 secs) (at 2015-10-29 16:50:35.089009) ========= /tools/buildbot/bin/python scripts/scripts/desktop_unittest.py --cfg unittests/mac_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 6 --blob-upload-branch fx-team --download-symbols true in dir /builds/slave/test/. (timeout 1800 secs) (maxTime 4800 secs) watching logfiles {} argv: ['/tools/buildbot/bin/python', 'scripts/scripts/desktop_unittest.py', '--cfg', 'unittests/mac_unittest.py', '--mochitest-suite', 'mochitest-devtools-chrome-chunked', '--total-chunks', '8', '--this-chunk', '6', '--blob-upload-branch', 'fx-team', '--download-symbols', 'true'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld MOZ_HIDE_RESULTS_TABLE=1 MOZ_NO_REMOTE=1 NO_EM_RESTART=1 NO_FAIL_ON_TEST_ERRORS=1 PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PROPERTIES_FILE=/builds/slave/test/buildprops.json PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 XPCOM_DEBUG_BREAK=warn __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False 16:50:35 INFO - MultiFileLogger online at 20151029 16:50:35 in /builds/slave/test 16:50:35 INFO - Run as scripts/scripts/desktop_unittest.py --cfg unittests/mac_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 6 --blob-upload-branch fx-team --download-symbols true 16:50:35 INFO - Dumping config to /builds/slave/test/logs/localconfig.json. 16:50:35 INFO - {'all_cppunittest_suites': {'cppunittest': ('tests/cppunittest',)}, 16:50:35 INFO - 'all_gtest_suites': {'gtest': ()}, 16:50:35 INFO - 'all_jittest_suites': {'jittest': ()}, 16:50:35 INFO - 'all_mochitest_suites': {'a11y': ('--a11y',), 16:50:35 INFO - 'browser-chrome': ('--browser-chrome',), 16:50:35 INFO - 'browser-chrome-addons': ('--browser-chrome', 16:50:35 INFO - '--chunk-by-runtime', 16:50:35 INFO - '--tag=addons'), 16:50:35 INFO - 'browser-chrome-chunked': ('--browser-chrome', 16:50:35 INFO - '--chunk-by-runtime'), 16:50:35 INFO - 'chrome': ('--chrome',), 16:50:35 INFO - 'chrome-chunked': ('--chrome', '--chunk-by-dir=4'), 16:50:35 INFO - 'jetpack-addon': ('--jetpack-addon',), 16:50:35 INFO - 'jetpack-package': ('--jetpack-package',), 16:50:35 INFO - 'mochitest-devtools-chrome': ('--browser-chrome', 16:50:35 INFO - '--subsuite=devtools'), 16:50:35 INFO - 'mochitest-devtools-chrome-chunked': ('--browser-chrome', 16:50:35 INFO - '--subsuite=devtools', 16:50:35 INFO - '--chunk-by-runtime'), 16:50:35 INFO - 'mochitest-gl': ('--subsuite=webgl',), 16:50:35 INFO - 'mochitest-push': ('--subsuite=push',), 16:50:35 INFO - 'plain': (), 16:50:35 INFO - 'plain-chunked': ('--chunk-by-dir=4',)}, 16:50:35 INFO - 'all_mozbase_suites': {'mozbase': ()}, 16:50:35 INFO - 'all_reftest_suites': {'crashtest': {'options': ('--suite=crashtest',), 16:50:35 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 16:50:35 INFO - 'crashtest-ipc': {'options': ('--suite=crashtest', 16:50:35 INFO - '--setpref=browser.tabs.remote=true', 16:50:35 INFO - '--setpref=browser.tabs.remote.autostart=true', 16:50:35 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 16:50:35 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 16:50:35 INFO - 'jsreftest': {'options': ('--extra-profile-file=tests/jsreftest/tests/user.js',), 16:50:35 INFO - 'tests': ('tests/jsreftest/tests/jstests.list',)}, 16:50:35 INFO - 'reftest': {'options': ('--suite=reftest',), 16:50:35 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}, 16:50:35 INFO - 'reftest-ipc': {'options': ('--suite=reftest', 16:50:35 INFO - '--setpref=browser.tabs.remote=true', 16:50:35 INFO - '--setpref=browser.tabs.remote.autostart=true', 16:50:35 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 16:50:35 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest-sanity/reftest.list',)}}, 16:50:35 INFO - 'all_webapprt_suites': {'chrome': ('--webapprt-chrome', 16:50:35 INFO - '--browser-arg=-test-mode'), 16:50:35 INFO - 'content': ('--webapprt-content',)}, 16:50:35 INFO - 'all_xpcshell_suites': {'xpcshell': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 16:50:35 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 16:50:35 INFO - 'tests': ()}, 16:50:35 INFO - 'xpcshell-addons': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 16:50:35 INFO - '--tag=addons', 16:50:35 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 16:50:35 INFO - 'tests': ()}}, 16:50:35 INFO - 'append_to_log': False, 16:50:35 INFO - 'base_work_dir': '/builds/slave/test', 16:50:35 INFO - 'blob_upload_branch': 'fx-team', 16:50:35 INFO - 'blob_uploader_auth_file': '/builds/slave/test/oauth.txt', 16:50:35 INFO - 'buildbot_json_path': 'buildprops.json', 16:50:35 INFO - 'buildbot_max_log_size': 52428800, 16:50:35 INFO - 'code_coverage': False, 16:50:35 INFO - 'config_files': ('unittests/mac_unittest.py',), 16:50:35 INFO - 'default_blob_upload_servers': ('https://blobupload.elasticbeanstalk.com',), 16:50:35 INFO - 'download_minidump_stackwalk': True, 16:50:35 INFO - 'download_symbols': 'true', 16:50:35 INFO - 'e10s': False, 16:50:35 INFO - 'exe_suffix': '', 16:50:35 INFO - 'exes': {'python': '/tools/buildbot/bin/python', 16:50:35 INFO - 'tooltool.py': '/tools/tooltool.py', 16:50:35 INFO - 'virtualenv': ('/tools/buildbot/bin/python', 16:50:35 INFO - '/tools/misc-python/virtualenv.py')}, 16:50:35 INFO - 'find_links': ('http://pypi.pvt.build.mozilla.org/pub', 16:50:35 INFO - 'http://pypi.pub.build.mozilla.org/pub'), 16:50:35 INFO - 'installer_path': '/builds/slave/test/installer.dmg', 16:50:35 INFO - 'log_level': 'info', 16:50:35 INFO - 'log_to_console': True, 16:50:35 INFO - 'minidump_save_path': '%(abs_work_dir)s/../minidumps', 16:50:35 INFO - 'minidump_stackwalk_path': 'macosx64-minidump_stackwalk', 16:50:35 INFO - 'minidump_tooltool_manifest_path': 'config/tooltool-manifests/macosx64/releng.manifest', 16:50:35 INFO - 'minimum_tests_zip_dirs': ('bin/*', 16:50:35 INFO - 'certs/*', 16:50:35 INFO - 'modules/*', 16:50:35 INFO - 'mozbase/*', 16:50:35 INFO - 'config/*'), 16:50:35 INFO - 'no_random': False, 16:50:35 INFO - 'opt_config_files': (), 16:50:35 INFO - 'pip_index': False, 16:50:35 INFO - 'preflight_run_cmd_suites': ({'architectures': ('32bit', '64bit'), 16:50:35 INFO - 'cmd': ('xset', 's', 'off', 's', 'reset'), 16:50:35 INFO - 'enabled': False, 16:50:35 INFO - 'halt_on_failure': False, 16:50:35 INFO - 'name': 'disable_screen_saver'}, 16:50:35 INFO - {'architectures': ('32bit',), 16:50:35 INFO - 'cmd': ('python', 16:50:35 INFO - '../scripts/external_tools/mouse_and_screen_resolution.py', 16:50:35 INFO - '--configuration-url', 16:50:35 INFO - 'https://hg.mozilla.org/%(branch)s/raw-file/%(revision)s/testing/machine-configuration.json'), 16:50:35 INFO - 'enabled': False, 16:50:35 INFO - 'halt_on_failure': True, 16:50:35 INFO - 'name': 'run mouse & screen adjustment script'}), 16:50:35 INFO - 'require_test_zip': True, 16:50:35 INFO - 'run_all_suites': False, 16:50:35 INFO - 'run_cmd_checks_enabled': True, 16:50:35 INFO - 'run_file_names': {'cppunittest': 'runcppunittests.py', 16:50:35 INFO - 'gtest': 'rungtests.py', 16:50:35 INFO - 'jittest': 'jit_test.py', 16:50:35 INFO - 'mochitest': 'runtests.py', 16:50:35 INFO - 'mozbase': 'test.py', 16:50:35 INFO - 'mozmill': 'runtestlist.py', 16:50:35 INFO - 'reftest': 'runreftest.py', 16:50:35 INFO - 'webapprt': 'runtests.py', 16:50:35 INFO - 'xpcshell': 'runxpcshelltests.py'}, 16:50:35 INFO - 'specific_tests_zip_dirs': {'cppunittest': ('cppunittest/*',), 16:50:35 INFO - 'gtest': ('gtest/*',), 16:50:35 INFO - 'jittest': ('jit-test/*',), 16:50:35 INFO - 'mochitest': ('mochitest/*',), 16:50:35 INFO - 'mozbase': ('mozbase/*',), 16:50:35 INFO - 'mozmill': ('mozmill/*',), 16:50:35 INFO - 'reftest': ('reftest/*', 'jsreftest/*'), 16:50:35 INFO - 'webapprt': ('mochitest/*',), 16:50:35 INFO - 'xpcshell': ('xpcshell/*',)}, 16:50:35 INFO - 'specified_mochitest_suites': ('mochitest-devtools-chrome-chunked',), 16:50:35 INFO - 'strict_content_sandbox': False, 16:50:35 INFO - 'suite_definitions': {'cppunittest': {'options': ('--symbols-path=%(symbols_path)s', 16:50:35 INFO - '--xre-path=%(abs_res_dir)s'), 16:50:35 INFO - 'run_filename': 'runcppunittests.py', 16:50:35 INFO - 'testsdir': 'cppunittest'}, 16:50:35 INFO - 'gtest': {'options': ('--xre-path=%(abs_res_dir)s', 16:50:35 INFO - '--cwd=%(gtest_dir)s', 16:50:35 INFO - '--symbols-path=%(symbols_path)s', 16:50:35 INFO - '%(binary_path)s'), 16:50:35 INFO - 'run_filename': 'rungtests.py'}, 16:50:35 INFO - 'jittest': {'options': ('tests/bin/js', 16:50:35 INFO - '--no-slow', 16:50:35 INFO - '--no-progress', 16:50:35 INFO - '--format=automation', 16:50:35 INFO - '--jitflags=all'), 16:50:35 INFO - 'run_filename': 'jit_test.py', 16:50:35 INFO - 'testsdir': 'jit-test/jit-test'}, 16:50:35 INFO - 'mochitest': {'options': ('--appname=%(binary_path)s', 16:50:35 INFO - '--utility-path=tests/bin', 16:50:35 INFO - '--extra-profile-file=tests/bin/plugins', 16:50:35 INFO - '--symbols-path=%(symbols_path)s', 16:50:35 INFO - '--certificate-path=tests/certs', 16:50:35 INFO - '--quiet', 16:50:35 INFO - '--log-raw=%(raw_log_file)s', 16:50:35 INFO - '--log-errorsummary=%(error_summary_file)s', 16:50:35 INFO - '--screenshot-on-fail'), 16:50:35 INFO - 'run_filename': 'runtests.py', 16:50:35 INFO - 'testsdir': 'mochitest'}, 16:50:35 INFO - 'mozbase': {'options': ('-b', '%(binary_path)s'), 16:50:35 INFO - 'run_filename': 'test.py', 16:50:35 INFO - 'testsdir': 'mozbase'}, 16:50:35 INFO - 'mozmill': {'options': ('--binary=%(binary_path)s', 16:50:35 INFO - '--testing-modules-dir=test/modules', 16:50:35 INFO - '--symbols-path=%(symbols_path)s'), 16:50:35 INFO - 'run_filename': 'runtestlist.py', 16:50:35 INFO - 'testsdir': 'mozmill'}, 16:50:35 INFO - 'reftest': {'options': ('--appname=%(binary_path)s', 16:50:35 INFO - '--utility-path=tests/bin', 16:50:35 INFO - '--extra-profile-file=tests/bin/plugins', 16:50:35 INFO - '--symbols-path=%(symbols_path)s'), 16:50:35 INFO - 'run_filename': 'runreftest.py', 16:50:35 INFO - 'testsdir': 'reftest'}, 16:50:35 INFO - 'webapprt': {'options': ('--app=%(app_path)s', 16:50:35 INFO - '--xre-path=%(abs_res_dir)s', 16:50:35 INFO - '--utility-path=tests/bin', 16:50:35 INFO - '--extra-profile-file=tests/bin/plugins', 16:50:35 INFO - '--symbols-path=%(symbols_path)s', 16:50:35 INFO - '--certificate-path=tests/certs', 16:50:35 INFO - '--console-level=INFO', 16:50:35 INFO - '--testing-modules-dir=tests/modules', 16:50:35 INFO - '--quiet'), 16:50:35 INFO - 'run_filename': 'runtests.py', 16:50:35 INFO - 'testsdir': 'mochitest'}, 16:50:35 INFO - 'xpcshell': {'options': ('--symbols-path=%(symbols_path)s', 16:50:35 INFO - '--test-plugin-path=%(test_plugin_path)s', 16:50:35 INFO - '--log-raw=%(raw_log_file)s', 16:50:35 INFO - '--log-errorsummary=%(error_summary_file)s', 16:50:35 INFO - '--utility-path=tests/bin'), 16:50:35 INFO - 'run_filename': 'runxpcshelltests.py', 16:50:35 INFO - 'testsdir': 'xpcshell'}}, 16:50:35 INFO - 'this_chunk': '6', 16:50:35 INFO - 'tooltool_cache': '/builds/tooltool_cache', 16:50:35 INFO - 'total_chunks': '8', 16:50:35 INFO - 'vcs_output_timeout': 1000, 16:50:35 INFO - 'virtualenv_path': 'venv', 16:50:35 INFO - 'volatile_config': {'actions': None, 'add_actions': None, 'no_actions': None}, 16:50:35 INFO - 'work_dir': 'build', 16:50:35 INFO - 'xpcshell_name': 'xpcshell'} 16:50:35 INFO - ##### 16:50:35 INFO - ##### Running clobber step. 16:50:35 INFO - ##### 16:50:35 INFO - Running pre-action listener: _resource_record_pre_action 16:50:35 INFO - Running main action method: clobber 16:50:35 INFO - rmtree: /builds/slave/test/build 16:50:35 INFO - retry: Calling rmtree with args: ('/builds/slave/test/build',), kwargs: {}, attempt #1 16:50:40 INFO - Running post-action listener: _resource_record_post_action 16:50:40 INFO - ##### 16:50:40 INFO - ##### Running read-buildbot-config step. 16:50:40 INFO - ##### 16:50:40 INFO - Running pre-action listener: _resource_record_pre_action 16:50:40 INFO - Running main action method: read_buildbot_config 16:50:40 INFO - Using buildbot properties: 16:50:40 INFO - { 16:50:40 INFO - "properties": { 16:50:40 INFO - "buildnumber": 63, 16:50:40 INFO - "product": "firefox", 16:50:40 INFO - "script_repo_revision": "production", 16:50:40 INFO - "branch": "fx-team", 16:50:40 INFO - "repository": "", 16:50:40 INFO - "buildername": "Rev4 MacOSX Snow Leopard 10.6 fx-team debug test mochitest-devtools-chrome-6", 16:50:40 INFO - "buildid": "20151029154349", 16:50:40 INFO - "slavename": "t-snow-r4-0100", 16:50:40 INFO - "pgo_build": "False", 16:50:40 INFO - "basedir": "/builds/slave/test", 16:50:40 INFO - "project": "", 16:50:40 INFO - "platform": "macosx64", 16:50:40 INFO - "master": "http://buildbot-master107.bb.releng.scl3.mozilla.com:8201/", 16:50:40 INFO - "slavebuilddir": "test", 16:50:40 INFO - "scheduler": "tests-fx-team-snowleopard-debug-unittest", 16:50:40 INFO - "repo_path": "integration/fx-team", 16:50:40 INFO - "moz_repo_path": "", 16:50:40 INFO - "stage_platform": "macosx64", 16:50:40 INFO - "builduid": "705c0d3b109c4819a82566c573f99661", 16:50:40 INFO - "revision": "8e4fa465e2c6ab3cdf67db304a35135c7be55c08" 16:50:40 INFO - }, 16:50:40 INFO - "sourcestamp": { 16:50:40 INFO - "repository": "", 16:50:40 INFO - "hasPatch": false, 16:50:40 INFO - "project": "", 16:50:40 INFO - "branch": "fx-team-macosx64-debug-unittest", 16:50:40 INFO - "changes": [ 16:50:40 INFO - { 16:50:40 INFO - "category": null, 16:50:40 INFO - "files": [ 16:50:40 INFO - { 16:50:40 INFO - "url": null, 16:50:40 INFO - "name": "https://queue.taskcluster.net/v1/task/Hviq-YjXTn6ryrFqEh3-Mw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg" 16:50:40 INFO - }, 16:50:40 INFO - { 16:50:40 INFO - "url": null, 16:50:40 INFO - "name": "https://queue.taskcluster.net/v1/task/Hviq-YjXTn6ryrFqEh3-Mw/artifacts/public/build/test_packages.json" 16:50:40 INFO - } 16:50:40 INFO - ], 16:50:40 INFO - "repository": "", 16:50:40 INFO - "rev": "43d5e54e94ef66e564da7793a5aa1bb3fbc8526c", 16:50:40 INFO - "who": "mozilla@noorenberghe.ca", 16:50:40 INFO - "when": 1446162426, 16:50:40 INFO - "number": 6596438, 16:50:40 INFO - "comments": "Bug 1216271 - Display a notification upon upgrade for users who currently allow notifications for at least one site. r=MattN", 16:50:40 INFO - "project": "", 16:50:40 INFO - "at": "Thu 29 Oct 2015 16:47:06", 16:50:40 INFO - "branch": "fx-team-macosx64-debug-unittest", 16:50:40 INFO - "revlink": "", 16:50:40 INFO - "properties": [ 16:50:40 INFO - [ 16:50:40 INFO - "buildid", 16:50:40 INFO - "20151029153414", 16:50:40 INFO - "Change" 16:50:40 INFO - ], 16:50:40 INFO - [ 16:50:40 INFO - "builduid", 16:50:40 INFO - "f69ccc7c4c04484192f74fc1f2750986", 16:50:40 INFO - "Change" 16:50:40 INFO - ], 16:50:40 INFO - [ 16:50:40 INFO - "pgo_build", 16:50:40 INFO - "False", 16:50:40 INFO - "Change" 16:50:40 INFO - ] 16:50:40 INFO - ], 16:50:40 INFO - "revision": "43d5e54e94ef66e564da7793a5aa1bb3fbc8526c" 16:50:40 INFO - }, 16:50:40 INFO - { 16:50:40 INFO - "category": null, 16:50:40 INFO - "files": [ 16:50:40 INFO - { 16:50:40 INFO - "url": null, 16:50:40 INFO - "name": "https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg" 16:50:40 INFO - }, 16:50:40 INFO - { 16:50:40 INFO - "url": null, 16:50:40 INFO - "name": "https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json" 16:50:40 INFO - } 16:50:40 INFO - ], 16:50:40 INFO - "repository": "", 16:50:40 INFO - "rev": "8e4fa465e2c6ab3cdf67db304a35135c7be55c08", 16:50:40 INFO - "who": "bgrinstead@mozilla.com", 16:50:40 INFO - "when": 1446162518, 16:50:40 INFO - "number": 6596445, 16:50:40 INFO - "comments": "Bug 1207107 - Remove old strings for aboutCertError;r=dao", 16:50:40 INFO - "project": "", 16:50:40 INFO - "at": "Thu 29 Oct 2015 16:48:38", 16:50:40 INFO - "branch": "fx-team-macosx64-debug-unittest", 16:50:40 INFO - "revlink": "", 16:50:40 INFO - "properties": [ 16:50:40 INFO - [ 16:50:40 INFO - "buildid", 16:50:40 INFO - "20151029154349", 16:50:40 INFO - "Change" 16:50:40 INFO - ], 16:50:40 INFO - [ 16:50:40 INFO - "builduid", 16:50:40 INFO - "705c0d3b109c4819a82566c573f99661", 16:50:40 INFO - "Change" 16:50:40 INFO - ], 16:50:40 INFO - [ 16:50:40 INFO - "pgo_build", 16:50:40 INFO - "False", 16:50:40 INFO - "Change" 16:50:40 INFO - ] 16:50:40 INFO - ], 16:50:40 INFO - "revision": "8e4fa465e2c6ab3cdf67db304a35135c7be55c08" 16:50:40 INFO - } 16:50:40 INFO - ], 16:50:40 INFO - "revision": "8e4fa465e2c6ab3cdf67db304a35135c7be55c08" 16:50:40 INFO - } 16:50:40 INFO - } 16:50:40 INFO - Found installer url https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg. 16:50:40 INFO - Found a test packages url https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json. 16:50:40 INFO - Running post-action listener: _resource_record_post_action 16:50:40 INFO - ##### 16:50:40 INFO - ##### Running download-and-extract step. 16:50:40 INFO - ##### 16:50:40 INFO - Running pre-action listener: _resource_record_pre_action 16:50:40 INFO - Running main action method: download_and_extract 16:50:40 INFO - mkdir: /builds/slave/test/build/tests 16:50:40 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:50:40 INFO - https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json matches https://queue.taskcluster.net 16:50:40 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json 16:50:40 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json 16:50:40 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json to /builds/slave/test/build/test_packages.json 16:50:40 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/test_packages.json', 'file_name': '/builds/slave/test/build/test_packages.json'}, attempt #1 16:50:42 INFO - Downloaded 1183 bytes. 16:50:42 INFO - Reading from file /builds/slave/test/build/test_packages.json 16:50:42 INFO - Using the following test package requirements: 16:50:42 INFO - {u'common': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 16:50:42 INFO - u'cppunittest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.cppunittest.tests.zip'], 16:50:42 INFO - u'jittest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'jsshell-mac64.zip'], 16:50:42 INFO - u'mochitest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.mochitest.tests.zip'], 16:50:42 INFO - u'mozbase': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 16:50:42 INFO - u'reftest': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.reftest.tests.zip'], 16:50:42 INFO - u'talos': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.talos.tests.zip'], 16:50:42 INFO - u'web-platform': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.web-platform.tests.zip'], 16:50:42 INFO - u'webapprt': [u'firefox-45.0a1.en-US.mac64.common.tests.zip'], 16:50:42 INFO - u'xpcshell': [u'firefox-45.0a1.en-US.mac64.common.tests.zip', 16:50:42 INFO - u'firefox-45.0a1.en-US.mac64.xpcshell.tests.zip']} 16:50:42 INFO - Downloading packages: [u'firefox-45.0a1.en-US.mac64.common.tests.zip', u'firefox-45.0a1.en-US.mac64.mochitest.tests.zip'] for test suite category: mochitest 16:50:42 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:50:42 INFO - https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip matches https://queue.taskcluster.net 16:50:42 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip 16:50:42 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip 16:50:42 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip 16:50:42 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip'}, attempt #1 16:50:43 INFO - Downloaded 17343091 bytes. 16:50:43 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 16:50:43 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 16:50:43 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 16:50:44 INFO - caution: filename not matched: mochitest/* 16:50:44 INFO - Return code: 11 16:50:44 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:50:44 INFO - https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip matches https://queue.taskcluster.net 16:50:44 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 16:50:44 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 16:50:44 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip 16:50:44 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip'}, attempt #1 16:50:46 INFO - Downloaded 61817321 bytes. 16:50:46 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 16:50:46 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 16:50:46 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.mac64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 16:50:55 INFO - caution: filename not matched: bin/* 16:50:55 INFO - caution: filename not matched: certs/* 16:50:55 INFO - caution: filename not matched: modules/* 16:50:55 INFO - caution: filename not matched: mozbase/* 16:50:55 INFO - caution: filename not matched: config/* 16:50:55 INFO - Return code: 11 16:50:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:50:55 INFO - https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg matches https://queue.taskcluster.net 16:50:55 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 16:50:55 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 16:50:55 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg to /builds/slave/test/installer.dmg 16:50:55 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg', 'file_name': '/builds/slave/test/installer.dmg'}, attempt #1 16:50:58 INFO - Downloaded 68269740 bytes. 16:50:58 INFO - Setting buildbot property build_url to https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 16:50:58 INFO - mkdir: /builds/slave/test/properties 16:50:58 INFO - Writing buildbot properties ['build_url'] to /builds/slave/test/properties/build_url 16:50:58 INFO - Writing to file /builds/slave/test/properties/build_url 16:50:58 INFO - Contents: 16:50:58 INFO - build_url:https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg 16:50:58 INFO - mkdir: /builds/slave/test/build/symbols 16:50:58 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:50:58 INFO - https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip matches https://queue.taskcluster.net 16:50:58 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:50:58 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:50:58 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip to /builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:50:58 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.scl3.mozilla.com/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip', 'file_name': '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip'}, attempt #1 16:51:02 INFO - Downloaded 54256313 bytes. 16:51:02 INFO - Setting buildbot property symbols_url to https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:51:02 INFO - Writing buildbot properties ['symbols_url'] to /builds/slave/test/properties/symbols_url 16:51:02 INFO - Writing to file /builds/slave/test/properties/symbols_url 16:51:02 INFO - Contents: 16:51:02 INFO - symbols_url:https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:51:02 INFO - Running command: ['unzip', '-q', '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip'] in /builds/slave/test/build/symbols 16:51:02 INFO - Copy/paste: unzip -q /builds/slave/test/build/symbols/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip 16:51:07 INFO - Return code: 0 16:51:07 INFO - Running post-action listener: _resource_record_post_action 16:51:07 INFO - Running post-action listener: set_extra_try_arguments 16:51:07 INFO - ##### 16:51:07 INFO - ##### Running create-virtualenv step. 16:51:07 INFO - ##### 16:51:07 INFO - Running pre-action listener: _install_mozbase 16:51:07 INFO - Running pre-action listener: _pre_create_virtualenv 16:51:07 INFO - Running pre-action listener: _resource_record_pre_action 16:51:07 INFO - Running main action method: create_virtualenv 16:51:07 INFO - Creating virtualenv /builds/slave/test/build/venv 16:51:07 INFO - Running command: ['/tools/buildbot/bin/python', '/tools/misc-python/virtualenv.py', '--no-site-packages', '--distribute', '/builds/slave/test/build/venv'] in /builds/slave/test/build 16:51:07 INFO - Copy/paste: /tools/buildbot/bin/python /tools/misc-python/virtualenv.py --no-site-packages --distribute /builds/slave/test/build/venv 16:51:07 INFO - The --no-site-packages flag is deprecated; it is now the default behavior. 16:51:07 INFO - Using real prefix '/tools/python27' 16:51:07 INFO - New python executable in /builds/slave/test/build/venv/bin/python 16:51:09 INFO - Installing distribute.............................................................................................................................................................................................done. 16:51:13 INFO - Installing pip.................done. 16:51:13 INFO - Return code: 0 16:51:13 INFO - Installing psutil>=0.7.1 into virtualenv /builds/slave/test/build/venv 16:51:13 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:13 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:13 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:13 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:13 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:13 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:13 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:13 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1'] in /builds/slave/test/build 16:51:13 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil>=0.7.1 16:51:13 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:13 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:13 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:13 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:13 INFO - 'HOME': '/Users/cltbld', 16:51:13 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:13 INFO - 'LOGNAME': 'cltbld', 16:51:13 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:13 INFO - 'MOZ_NO_REMOTE': '1', 16:51:13 INFO - 'NO_EM_RESTART': '1', 16:51:13 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:13 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:13 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:13 INFO - 'PWD': '/builds/slave/test', 16:51:13 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:13 INFO - 'SHELL': '/bin/bash', 16:51:13 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:13 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:13 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:13 INFO - 'USER': 'cltbld', 16:51:13 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:13 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:13 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:13 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:13 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:13 INFO - Downloading/unpacking psutil>=0.7.1 16:51:13 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:13 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:13 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:13 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:13 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:13 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:17 INFO - Creating supposed download cache at /builds/slave/test/build/venv/cache 16:51:17 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fpsutil-3.1.1-cp27-none-macosx_10_4_x86_64.whl 16:51:17 INFO - Installing collected packages: psutil 16:51:17 INFO - Successfully installed psutil 16:51:17 INFO - Cleaning up... 16:51:17 INFO - Return code: 0 16:51:17 INFO - Installing mozsystemmonitor==0.0.0 into virtualenv /builds/slave/test/build/venv 16:51:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:17 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:17 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:17 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:17 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:17 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:17 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:17 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0'] in /builds/slave/test/build 16:51:17 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mozsystemmonitor==0.0.0 16:51:17 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:17 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:17 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:17 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:17 INFO - 'HOME': '/Users/cltbld', 16:51:17 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:17 INFO - 'LOGNAME': 'cltbld', 16:51:17 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:17 INFO - 'MOZ_NO_REMOTE': '1', 16:51:17 INFO - 'NO_EM_RESTART': '1', 16:51:17 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:17 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:17 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:17 INFO - 'PWD': '/builds/slave/test', 16:51:17 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:17 INFO - 'SHELL': '/bin/bash', 16:51:17 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:17 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:17 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:17 INFO - 'USER': 'cltbld', 16:51:17 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:17 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:17 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:17 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:17 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:17 INFO - Downloading/unpacking mozsystemmonitor==0.0.0 16:51:17 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:17 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:17 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:17 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:17 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:17 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:21 INFO - Downloading mozsystemmonitor-0.0.tar.gz 16:51:21 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmozsystemmonitor-0.0.tar.gz 16:51:21 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mozsystemmonitor/setup.py) egg_info for package mozsystemmonitor 16:51:21 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil>=0.7.1 in ./venv/lib/python2.7/site-packages (from mozsystemmonitor==0.0.0) 16:51:21 INFO - Installing collected packages: mozsystemmonitor 16:51:21 INFO - Running setup.py install for mozsystemmonitor 16:51:21 INFO - Successfully installed mozsystemmonitor 16:51:21 INFO - Cleaning up... 16:51:21 INFO - Return code: 0 16:51:21 INFO - Installing blobuploader==1.2.4 into virtualenv /builds/slave/test/build/venv 16:51:21 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:21 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:21 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:21 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:21 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:21 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:21 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:21 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4'] in /builds/slave/test/build 16:51:21 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub blobuploader==1.2.4 16:51:21 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:21 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:21 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:21 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:21 INFO - 'HOME': '/Users/cltbld', 16:51:21 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:21 INFO - 'LOGNAME': 'cltbld', 16:51:21 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:21 INFO - 'MOZ_NO_REMOTE': '1', 16:51:21 INFO - 'NO_EM_RESTART': '1', 16:51:21 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:21 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:21 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:21 INFO - 'PWD': '/builds/slave/test', 16:51:21 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:21 INFO - 'SHELL': '/bin/bash', 16:51:21 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:21 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:21 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:21 INFO - 'USER': 'cltbld', 16:51:21 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:21 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:21 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:21 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:21 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:21 INFO - Downloading/unpacking blobuploader==1.2.4 16:51:21 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:21 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:21 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:21 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:21 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:21 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:25 INFO - Downloading blobuploader-1.2.4.tar.gz 16:51:25 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblobuploader-1.2.4.tar.gz 16:51:25 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blobuploader/setup.py) egg_info for package blobuploader 16:51:25 INFO - Downloading/unpacking requests==1.2.3. (from blobuploader==1.2.4) 16:51:25 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:25 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:25 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:25 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:25 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:25 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:25 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Frequests-1.2.3.tar.gz 16:51:25 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/requests/setup.py) egg_info for package requests 16:51:26 INFO - Downloading/unpacking docopt==0.6.1 (from blobuploader==1.2.4) 16:51:26 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:26 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:26 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:26 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:26 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:26 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:26 INFO - Downloading docopt-0.6.1.tar.gz 16:51:26 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fdocopt-0.6.1.tar.gz 16:51:26 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/docopt/setup.py) egg_info for package docopt 16:51:27 INFO - Installing collected packages: blobuploader, requests, docopt 16:51:27 INFO - Running setup.py install for blobuploader 16:51:27 INFO - changing mode of build/scripts-2.7/blobberc.py from 664 to 775 16:51:27 INFO - changing mode of /builds/slave/test/build/venv/bin/blobberc.py to 775 16:51:27 INFO - Running setup.py install for requests 16:51:27 INFO - Running setup.py install for docopt 16:51:28 INFO - Successfully installed blobuploader requests docopt 16:51:28 INFO - Cleaning up... 16:51:28 INFO - Return code: 0 16:51:28 INFO - Installing None into virtualenv /builds/slave/test/build/venv 16:51:28 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:28 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:28 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:28 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:28 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:28 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:28 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:28 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 16:51:28 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 16:51:28 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:28 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:28 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:28 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:28 INFO - 'HOME': '/Users/cltbld', 16:51:28 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:28 INFO - 'LOGNAME': 'cltbld', 16:51:28 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:28 INFO - 'MOZ_NO_REMOTE': '1', 16:51:28 INFO - 'NO_EM_RESTART': '1', 16:51:28 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:28 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:28 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:28 INFO - 'PWD': '/builds/slave/test', 16:51:28 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:28 INFO - 'SHELL': '/bin/bash', 16:51:28 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:28 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:28 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:28 INFO - 'USER': 'cltbld', 16:51:28 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:28 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:28 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:28 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:28 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 16:51:28 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-rxPHvg-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 16:51:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 16:51:28 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-sL7Pio-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 16:51:28 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 16:51:28 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Y2vQR8-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-d_OuQS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-bzh57_-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-6rLans-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-qwGUlT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-B81F9H-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Jq02MU-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 16:51:29 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 16:51:29 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-nJLZIh-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-FhjHdR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-kptp3w-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-thjnc4-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-hbXjFR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-vAn8zH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:30 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 16:51:30 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-RssqZq-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 16:51:31 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 16:51:31 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-R8Csc3-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 16:51:31 INFO - Installing collected packages: manifestparser, mozcrash, mozdebug, mozdevice, mozfile, mozhttpd, mozinfo, mozInstall, mozleak, mozlog, moznetwork, mozprocess, mozprofile, mozrunner, mozscreenshot, moztest, mozversion 16:51:31 INFO - Running setup.py install for manifestparser 16:51:31 INFO - Installing manifestparser script to /builds/slave/test/build/venv/bin 16:51:31 INFO - Running setup.py install for mozcrash 16:51:31 INFO - Running setup.py install for mozdebug 16:51:31 INFO - Running setup.py install for mozdevice 16:51:32 INFO - Installing sutini script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Installing dm script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Running setup.py install for mozfile 16:51:32 INFO - Running setup.py install for mozhttpd 16:51:32 INFO - Installing mozhttpd script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Running setup.py install for mozinfo 16:51:32 INFO - Installing mozinfo script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Running setup.py install for mozInstall 16:51:32 INFO - Installing moz_remove_from_system script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Installing mozuninstall script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Installing mozinstall script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Installing moz_add_to_system script to /builds/slave/test/build/venv/bin 16:51:32 INFO - Running setup.py install for mozleak 16:51:33 INFO - Running setup.py install for mozlog 16:51:33 INFO - Installing structlog script to /builds/slave/test/build/venv/bin 16:51:33 INFO - Running setup.py install for moznetwork 16:51:33 INFO - Installing moznetwork script to /builds/slave/test/build/venv/bin 16:51:33 INFO - Running setup.py install for mozprocess 16:51:33 INFO - Running setup.py install for mozprofile 16:51:33 INFO - Installing mozprofile script to /builds/slave/test/build/venv/bin 16:51:33 INFO - Installing diff-profiles script to /builds/slave/test/build/venv/bin 16:51:33 INFO - Installing view-profile script to /builds/slave/test/build/venv/bin 16:51:33 INFO - Running setup.py install for mozrunner 16:51:34 INFO - Installing mozrunner script to /builds/slave/test/build/venv/bin 16:51:34 INFO - Running setup.py install for mozscreenshot 16:51:34 INFO - Running setup.py install for moztest 16:51:34 INFO - Running setup.py install for mozversion 16:51:34 INFO - Installing mozversion script to /builds/slave/test/build/venv/bin 16:51:34 INFO - Successfully installed manifestparser mozcrash mozdebug mozdevice mozfile mozhttpd mozinfo mozInstall mozleak mozlog moznetwork mozprocess mozprofile mozrunner mozscreenshot moztest mozversion 16:51:34 INFO - Cleaning up... 16:51:34 INFO - Return code: 0 16:51:34 INFO - Installing None into virtualenv /builds/slave/test/build/venv 16:51:34 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:34 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:34 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:34 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:34 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:34 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:34 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:34 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 16:51:34 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 16:51:34 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:34 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:34 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:34 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:34 INFO - 'HOME': '/Users/cltbld', 16:51:34 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:34 INFO - 'LOGNAME': 'cltbld', 16:51:34 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:34 INFO - 'MOZ_NO_REMOTE': '1', 16:51:34 INFO - 'NO_EM_RESTART': '1', 16:51:34 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:34 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:34 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:34 INFO - 'PWD': '/builds/slave/test', 16:51:34 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:34 INFO - 'SHELL': '/bin/bash', 16:51:34 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:34 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:34 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:34 INFO - 'USER': 'cltbld', 16:51:34 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:34 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:34 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:34 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:35 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:35 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 16:51:35 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-l3ZMvT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 16:51:35 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 16:51:35 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 16:51:35 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-UZ0G63-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 16:51:35 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:35 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 16:51:35 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-obGx9d-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 16:51:35 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 16:51:35 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 16:51:35 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-sK6p4A-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 16:51:35 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.46 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:35 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 16:51:35 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-924yRE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-AR36u7-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Iu5Sqi-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.8 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-2rpxop-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-TuT64t-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Sv0TFN-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 16:51:36 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-fNdLNq-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 16:51:36 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 16:51:36 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Z2Eg2t-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 16:51:37 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-6p9s4I-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 16:51:37 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-5Msmnk-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 16:51:37 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-6Nqsmw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 16:51:37 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-ngnbHE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 16:51:37 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 16:51:37 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-5N8aM8-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.46->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:37 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.46->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:37 INFO - Downloading/unpacking blessings>=1.3 (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 16:51:37 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:37 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:37 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:37 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:37 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:37 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:41 INFO - Downloading blessings-1.5.1.tar.gz 16:51:41 INFO - Storing download in cache at /builds/slave/test/build/venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblessings-1.5.1.tar.gz 16:51:41 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blessings/setup.py) egg_info for package blessings 16:51:41 INFO - Installing collected packages: blessings 16:51:41 INFO - Running setup.py install for blessings 16:51:41 INFO - Successfully installed blessings 16:51:41 INFO - Cleaning up... 16:51:41 INFO - Return code: 0 16:51:41 INFO - Installing pip>=1.5 into virtualenv /builds/slave/test/build/venv 16:51:41 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:41 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:41 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:41 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:41 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:41 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:41 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:41 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5'] in /builds/slave/test/build 16:51:41 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub pip>=1.5 16:51:41 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:41 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:41 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:41 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:41 INFO - 'HOME': '/Users/cltbld', 16:51:41 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:41 INFO - 'LOGNAME': 'cltbld', 16:51:41 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:41 INFO - 'MOZ_NO_REMOTE': '1', 16:51:41 INFO - 'NO_EM_RESTART': '1', 16:51:41 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:41 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:41 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:41 INFO - 'PWD': '/builds/slave/test', 16:51:41 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:41 INFO - 'SHELL': '/bin/bash', 16:51:41 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:41 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:41 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:41 INFO - 'USER': 'cltbld', 16:51:41 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:41 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:41 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:41 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:42 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:42 INFO - Requirement already satisfied (use --upgrade to upgrade): pip>=1.5 in ./venv/lib/python2.7/site-packages/pip-1.5.5-py2.7.egg 16:51:42 INFO - Cleaning up... 16:51:42 INFO - Return code: 0 16:51:42 INFO - Installing psutil==3.1.1 into virtualenv /builds/slave/test/build/venv 16:51:42 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:42 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:42 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:42 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:42 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:42 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:42 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:42 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1'] in /builds/slave/test/build 16:51:42 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil==3.1.1 16:51:42 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:42 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:42 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:42 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:42 INFO - 'HOME': '/Users/cltbld', 16:51:42 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:42 INFO - 'LOGNAME': 'cltbld', 16:51:42 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:42 INFO - 'MOZ_NO_REMOTE': '1', 16:51:42 INFO - 'NO_EM_RESTART': '1', 16:51:42 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:42 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:42 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:42 INFO - 'PWD': '/builds/slave/test', 16:51:42 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:42 INFO - 'SHELL': '/bin/bash', 16:51:42 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:42 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:42 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:42 INFO - 'USER': 'cltbld', 16:51:42 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:42 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:42 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:42 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:42 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:42 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil==3.1.1 in ./venv/lib/python2.7/site-packages 16:51:42 INFO - Cleaning up... 16:51:42 INFO - Return code: 0 16:51:42 INFO - Installing mock into virtualenv /builds/slave/test/build/venv 16:51:42 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:42 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:42 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:42 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:42 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:42 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:42 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:42 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock'] in /builds/slave/test/build 16:51:42 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mock 16:51:42 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:42 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:42 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:42 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:42 INFO - 'HOME': '/Users/cltbld', 16:51:42 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:42 INFO - 'LOGNAME': 'cltbld', 16:51:42 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:42 INFO - 'MOZ_NO_REMOTE': '1', 16:51:42 INFO - 'NO_EM_RESTART': '1', 16:51:42 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:42 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:42 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:42 INFO - 'PWD': '/builds/slave/test', 16:51:42 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:42 INFO - 'SHELL': '/bin/bash', 16:51:42 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:42 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:42 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:42 INFO - 'USER': 'cltbld', 16:51:42 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:42 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:42 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:42 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:42 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:42 INFO - Downloading/unpacking mock 16:51:42 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:42 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:42 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:42 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:42 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:42 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:47 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmock-1.0.1.tar.gz 16:51:47 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mock/setup.py) egg_info for package mock 16:51:47 INFO - warning: no files found matching '*.png' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.css' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.html' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.js' under directory 'docs' 16:51:47 INFO - Installing collected packages: mock 16:51:47 INFO - Running setup.py install for mock 16:51:47 INFO - warning: no files found matching '*.png' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.css' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.html' under directory 'docs' 16:51:47 INFO - warning: no files found matching '*.js' under directory 'docs' 16:51:47 INFO - Successfully installed mock 16:51:47 INFO - Cleaning up... 16:51:47 INFO - Return code: 0 16:51:47 INFO - Installing simplejson into virtualenv /builds/slave/test/build/venv 16:51:47 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:47 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:47 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:47 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:47 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:47 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:47 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:47 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson'] in /builds/slave/test/build 16:51:47 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub simplejson 16:51:47 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:47 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:47 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:47 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:47 INFO - 'HOME': '/Users/cltbld', 16:51:47 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:47 INFO - 'LOGNAME': 'cltbld', 16:51:47 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:47 INFO - 'MOZ_NO_REMOTE': '1', 16:51:47 INFO - 'NO_EM_RESTART': '1', 16:51:47 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:47 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:47 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:47 INFO - 'PWD': '/builds/slave/test', 16:51:47 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:47 INFO - 'SHELL': '/bin/bash', 16:51:47 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:47 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:47 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:47 INFO - 'USER': 'cltbld', 16:51:47 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:47 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:47 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:47 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:48 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:48 INFO - Downloading/unpacking simplejson 16:51:48 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:48 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:48 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:48 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com has it available 16:51:48 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 16:51:48 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 16:51:51 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fsimplejson-3.3.0.tar.gz 16:51:51 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/simplejson/setup.py) egg_info for package simplejson 16:51:51 INFO - Installing collected packages: simplejson 16:51:51 INFO - Running setup.py install for simplejson 16:51:51 INFO - building 'simplejson._speedups' extension 16:51:51 INFO - gcc -fno-strict-aliasing -g -O2 -DNDEBUG -g -fwrapv -O3 -Wall -Wstrict-prototypes -I/tools/python27/include/python2.7 -c simplejson/_speedups.c -o build/temp.macosx-10.4-x86_64-2.7/simplejson/_speedups.o 16:51:51 INFO - unable to execute gcc: No such file or directory 16:51:51 INFO - *************************************************************************** 16:51:51 INFO - WARNING: The C extension could not be compiled, speedups are not enabled. 16:51:51 INFO - Failure information, if any, is above. 16:51:51 INFO - I'm retrying the build without the C extension now. 16:51:51 INFO - *************************************************************************** 16:51:51 INFO - *************************************************************************** 16:51:51 INFO - WARNING: The C extension could not be compiled, speedups are not enabled. 16:51:51 INFO - Plain-Python installation succeeded. 16:51:51 INFO - *************************************************************************** 16:51:51 INFO - Successfully installed simplejson 16:51:51 INFO - Cleaning up... 16:51:51 INFO - Return code: 0 16:51:51 INFO - Installing None into virtualenv /builds/slave/test/build/venv 16:51:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:51 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:51 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:51 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:51 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:51 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:51 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:51 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 16:51:51 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 16:51:51 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:51 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:51 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:51 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:51 INFO - 'HOME': '/Users/cltbld', 16:51:51 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:51 INFO - 'LOGNAME': 'cltbld', 16:51:51 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:51 INFO - 'MOZ_NO_REMOTE': '1', 16:51:51 INFO - 'NO_EM_RESTART': '1', 16:51:51 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:51 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:51 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:51 INFO - 'PWD': '/builds/slave/test', 16:51:51 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:51 INFO - 'SHELL': '/bin/bash', 16:51:51 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:51 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:51 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:51 INFO - 'USER': 'cltbld', 16:51:51 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:51 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:51 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:51 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:52 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 16:51:52 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-mwGyuC-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 16:51:52 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 16:51:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 16:51:52 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-5Dz7MD-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 16:51:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 16:51:52 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-MzzI4r-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 16:51:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 16:51:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 16:51:52 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-hdoopy-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 16:51:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.46 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 16:51:52 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-KiTxYB-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-4Js_OT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-poHiH0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.8 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Na_n09-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-vpIh2o-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-wqmHDw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 16:51:53 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 16:51:53 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 16:51:53 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-5Vojip-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-yatB6F-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-775iBS-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-r1PaCf-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-IzBkNA-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-oQQjT2-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 16:51:54 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 16:51:54 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 16:51:54 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-SH8YRz-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 16:51:55 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 16:51:55 INFO - Cleaning up... 16:51:55 INFO - Return code: 0 16:51:55 INFO - Installing None into virtualenv /builds/slave/test/build/venv 16:51:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:55 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 16:51:55 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:55 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:51:55 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 16:51:55 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub 16:51:55 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x1004d1030>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x100528a08>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x10036b750>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/Users/cltbld', 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 'NO_EM_RESTART': '1', 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 'XPCOM_DEBUG_BREAK': 'warn', 'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 'VERSIONER_PYTHON_VERSION': '2.6', 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 'NO_FAIL_ON_TEST_ERRORS': '1', 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 'SHELL': '/bin/bash', 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', '__CF_USER_TEXT_ENCODING': '0x1C:0:0', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json'}}, attempt #1 16:51:55 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 16:51:55 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.scl3.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 16:51:55 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:51:55 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:51:55 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:51:55 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:51:55 INFO - 'HOME': '/Users/cltbld', 16:51:55 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:51:55 INFO - 'LOGNAME': 'cltbld', 16:51:55 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:51:55 INFO - 'MOZ_NO_REMOTE': '1', 16:51:55 INFO - 'NO_EM_RESTART': '1', 16:51:55 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:51:55 INFO - 'PATH': '/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:51:55 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:51:55 INFO - 'PWD': '/builds/slave/test', 16:51:55 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:51:55 INFO - 'SHELL': '/bin/bash', 16:51:55 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:51:55 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:51:55 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:51:55 INFO - 'USER': 'cltbld', 16:51:55 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:51:55 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:51:55 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:51:55 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:51:55 INFO - Ignoring indexes: https://pypi.python.org/simple/ 16:51:55 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 16:51:55 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-G8AsRy-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 16:51:55 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 16:51:55 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 16:51:55 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-XaI7u9-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 16:51:55 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:55 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 16:51:55 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-pjzjUl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-q7rvkZ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.46 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-xRyycG-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-NUe1Ck-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-qzsI1y-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.8 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-8g6jvR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 16:51:56 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 16:51:56 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 16:51:56 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-G7x9lT-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-dEROBA-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-u95GfV-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-9g1G0E-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-5HEWzo-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-0LyiiL-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 16:51:57 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 16:51:57 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:57 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-c4N7Ja-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 16:51:58 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 16:51:58 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-oDuNem-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 16:51:58 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 16:51:58 INFO - Running setup.py (path:/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/pip-Ub9ucf-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.46->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.46->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 16:51:58 INFO - Requirement already satisfied (use --upgrade to upgrade): blessings>=1.3 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 16:51:58 INFO - Cleaning up... 16:51:58 INFO - Return code: 0 16:51:58 INFO - Done creating virtualenv /builds/slave/test/build/venv. 16:51:58 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 16:51:58 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 16:51:58 INFO - Reading from file tmpfile_stdout 16:51:58 INFO - Current package versions: 16:51:58 INFO - blessings == 1.5.1 16:51:58 INFO - blobuploader == 1.2.4 16:51:58 INFO - docopt == 0.6.1 16:51:58 INFO - manifestparser == 1.1 16:51:58 INFO - mock == 1.0.1 16:51:58 INFO - mozInstall == 1.12 16:51:58 INFO - mozcrash == 0.16 16:51:58 INFO - mozdebug == 0.1 16:51:58 INFO - mozdevice == 0.46 16:51:58 INFO - mozfile == 1.2 16:51:58 INFO - mozhttpd == 0.7 16:51:58 INFO - mozinfo == 0.8 16:51:58 INFO - mozleak == 0.1 16:51:58 INFO - mozlog == 3.0 16:51:58 INFO - moznetwork == 0.27 16:51:58 INFO - mozprocess == 0.22 16:51:58 INFO - mozprofile == 0.27 16:51:58 INFO - mozrunner == 6.11 16:51:58 INFO - mozscreenshot == 0.1 16:51:58 INFO - mozsystemmonitor == 0.0 16:51:58 INFO - moztest == 0.7 16:51:58 INFO - mozversion == 1.4 16:51:58 INFO - psutil == 3.1.1 16:51:58 INFO - requests == 1.2.3 16:51:58 INFO - simplejson == 3.3.0 16:51:58 INFO - wsgiref == 0.1.2 16:51:58 INFO - Running post-action listener: _resource_record_post_action 16:51:58 INFO - Running post-action listener: _start_resource_monitoring 16:51:58 INFO - Starting resource monitoring. 16:51:58 INFO - ##### 16:51:58 INFO - ##### Running install step. 16:51:58 INFO - ##### 16:51:58 INFO - Running pre-action listener: _resource_record_pre_action 16:51:58 INFO - Running main action method: install 16:51:58 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 16:51:58 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 16:51:59 INFO - Reading from file tmpfile_stdout 16:51:59 INFO - Detecting whether we're running mozinstall >=1.0... 16:51:59 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '-h'] 16:51:59 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall -h 16:51:59 INFO - Reading from file tmpfile_stdout 16:51:59 INFO - Output received: 16:51:59 INFO - Usage: mozinstall [options] installer 16:51:59 INFO - Options: 16:51:59 INFO - -h, --help show this help message and exit 16:51:59 INFO - -d DEST, --destination=DEST 16:51:59 INFO - Directory to install application into. [default: 16:51:59 INFO - "/builds/slave/test"] 16:51:59 INFO - --app=APP Application being installed. [default: firefox] 16:51:59 INFO - mkdir: /builds/slave/test/build/application 16:51:59 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '/builds/slave/test/installer.dmg', '--destination', '/builds/slave/test/build/application'] 16:51:59 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall /builds/slave/test/installer.dmg --destination /builds/slave/test/build/application 16:52:18 INFO - Reading from file tmpfile_stdout 16:52:18 INFO - Output received: 16:52:18 INFO - /builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox 16:52:18 INFO - Running post-action listener: _resource_record_post_action 16:52:18 INFO - ##### 16:52:18 INFO - ##### Running run-tests step. 16:52:18 INFO - ##### 16:52:18 INFO - Running pre-action listener: _resource_record_pre_action 16:52:18 INFO - Running pre-action listener: _set_gcov_prefix 16:52:18 INFO - Running main action method: run_tests 16:52:18 INFO - #### Running mochitest suites 16:52:18 INFO - grabbing minidump binary from tooltool 16:52:18 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 16:52:18 INFO - retry: Calling run_command with args: (['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'],), kwargs: {'error_list': [{'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x1004542a0>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x10044e030>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x10052a4e0>, 'level': 'critical'}, {'substr': 'ERROR - ', 'level': 'error'}], 'cwd': '/builds/slave/test/build', 'privileged': False}, attempt #1 16:52:18 INFO - Running command: ['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'] in /builds/slave/test/build 16:52:18 INFO - Copy/paste: /tools/tooltool.py --url https://api.pub.build.mozilla.org/tooltool/ --authentication-file /builds/relengapi.tok fetch -m /builds/slave/test/build/tests/config/tooltool-manifests/macosx64/releng.manifest -o -c /builds/tooltool_cache 16:52:19 INFO - INFO - File macosx64-minidump_stackwalk retrieved from local cache /builds/tooltool_cache 16:52:19 INFO - Return code: 0 16:52:19 INFO - Chmoding /builds/slave/test/build/macosx64-minidump_stackwalk to 0755 16:52:19 INFO - mkdir: /builds/slave/test/build/blobber_upload_dir 16:52:19 INFO - ENV: MOZ_UPLOAD_DIR is now /builds/slave/test/build/blobber_upload_dir 16:52:19 INFO - ENV: MINIDUMP_STACKWALK is now /builds/slave/test/build/macosx64-minidump_stackwalk 16:52:19 INFO - ENV: MINIDUMP_SAVE_PATH is now /builds/slave/test/build/blobber_upload_dir 16:52:19 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '6', '--appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] in /builds/slave/test/build 16:52:19 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python -u /builds/slave/test/build/tests/mochitest/runtests.py --total-chunks 8 --this-chunk 6 --appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox --utility-path=tests/bin --extra-profile-file=tests/bin/plugins --symbols-path=/builds/slave/test/build/symbols --certificate-path=tests/certs --quiet --log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log --log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log --screenshot-on-fail --browser-chrome --subsuite=devtools --chunk-by-runtime 16:52:19 INFO - Using env: {'Apple_PubSub_Socket_Render': '/tmp/launch-nsq2bG/Render', 16:52:19 INFO - 'DISPLAY': '/tmp/launch-6aJMsw/org.x:0', 16:52:19 INFO - 'GIT_SHARE_BASE_DIR': '/builds/git-shared', 16:52:19 INFO - 'HG_SHARE_BASE_DIR': '/builds/hg-shared', 16:52:19 INFO - 'HOME': '/Users/cltbld', 16:52:19 INFO - 'IDLEIZER_DISABLE_SHUTDOWN': 'true', 16:52:19 INFO - 'LOGNAME': 'cltbld', 16:52:19 INFO - 'MINIDUMP_SAVE_PATH': '/builds/slave/test/build/blobber_upload_dir', 16:52:19 INFO - 'MINIDUMP_STACKWALK': '/builds/slave/test/build/macosx64-minidump_stackwalk', 16:52:19 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 16:52:19 INFO - 'MOZ_NO_REMOTE': '1', 16:52:19 INFO - 'MOZ_UPLOAD_DIR': '/builds/slave/test/build/blobber_upload_dir', 16:52:19 INFO - 'NO_EM_RESTART': '1', 16:52:19 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 16:52:19 INFO - 'PATH': '/builds/slave/test/build/venv/bin:/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11', 16:52:19 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 16:52:19 INFO - 'PWD': '/builds/slave/test', 16:52:19 INFO - 'RUNNER_CONFIG_CMD': '/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg', 16:52:19 INFO - 'SHELL': '/bin/bash', 16:52:19 INFO - 'SSH_AUTH_SOCK': '/tmp/launch-nqOe0Q/Listeners', 16:52:19 INFO - 'TMPDIR': '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/', 16:52:19 INFO - 'TWISTD_LOG_PATH': '/builds/slave/twistd.log', 16:52:19 INFO - 'USER': 'cltbld', 16:52:19 INFO - 'VERSIONER_PYTHON_PREFER_32_BIT': 'no', 16:52:19 INFO - 'VERSIONER_PYTHON_VERSION': '2.6', 16:52:19 INFO - 'XPCOM_DEBUG_BREAK': 'warn', 16:52:19 INFO - '__CF_USER_TEXT_ENCODING': '0x1C:0:0'} 16:52:19 INFO - Calling ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '6', '--appname=/builds/slave/test/build/application/NightlyDebug.app/Contents/MacOS/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] with output_timeout 1000 16:52:19 INFO - /builds/slave/test/build/venv/lib/python2.7/site-packages/mozrunner/utils.py:20: UserWarning: Module moznetwork was already imported from /builds/slave/test/build/tests/mochitest/moznetwork.py, but /builds/slave/test/build/venv/lib/python2.7/site-packages is being added to sys.path 16:52:19 INFO - import pkg_resources 16:52:19 INFO - Checking for orphan ssltunnel processes... 16:52:19 INFO - Checking for orphan xpcshell processes... 16:52:20 INFO - SUITE-START | Running 236 tests 16:52:20 INFO - TEST-START | devtools/client/shadereditor/test/browser_se_bfcache.js 16:52:20 INFO - TEST-SKIP | devtools/client/shadereditor/test/browser_se_bfcache.js | took 0ms 16:52:20 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js 16:52:20 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js | took 0ms 16:52:20 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js 16:52:20 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js | took 0ms 16:52:20 INFO - dir: devtools/client/shadereditor/test 16:52:20 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 16:52:20 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/NightlyDebug.app/Contents/Resources', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpuUfbA8.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 16:52:20 INFO - runtests.py | Server pid: 1047 16:52:20 INFO - runtests.py | Websocket server pid: 1048 16:52:20 INFO - runtests.py | SSL tunnel pid: 1049 16:52:20 INFO - runtests.py | Running tests: start. 16:52:20 INFO - runtests.py | Application pid: 1050 16:52:20 INFO - TEST-INFO | started process Main app process 16:52:20 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpuUfbA8.mozrunner/runtests_leaks.log 16:52:20 INFO - 2015-10-29 16:52:20.895 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x10100ace0 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:52:20 INFO - 2015-10-29 16:52:20.899 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x10100b830 of class NSCFArray autoreleased with no pool in place - just leaking 16:52:21 INFO - 2015-10-29 16:52:21.224 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x101006e90 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:52:21 INFO - 2015-10-29 16:52:21.225 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x100119b90 of class NSCFData autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.660 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x120db5dd0 of class __NSFastEnumerationEnumerator autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.661 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x100124e90 of class NSCFNumber autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.661 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x120ffefb0 of class NSConcreteValue autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.662 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x101019f40 of class NSCFNumber autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.662 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x120fff070 of class NSConcreteValue autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.663 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x10011a240 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:52:22 INFO - ++DOCSHELL 0x1224b8a00 == 1 [pid = 1050] [id = 1] 16:52:22 INFO - ++DOMWINDOW == 1 (0x1204d1800) [pid = 1050] [serial = 1] [outer = 0x0] 16:52:22 INFO - 2015-10-29 16:52:22.742 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224e7780 of class __NSFontTypefaceInfo autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.743 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x122501e40 of class NSAffineTransform autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.743 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad6d0 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.744 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad730 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.746 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224e77d0 of class __NSFontTypefaceInfo autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.746 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad760 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.747 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad790 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.749 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad7c0 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.749 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad7f0 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.750 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad970 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.751 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad9a0 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.751 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ad9d0 of class NSFont autoreleased with no pool in place - just leaking 16:52:22 INFO - 2015-10-29 16:52:22.752 firefox[1050:903] *** __NSAutoreleaseNoPool(): Object 0x1224ada00 of class NSFont autoreleased with no pool in place - just leaking 16:52:23 INFO - ++DOMWINDOW == 2 (0x122559000) [pid = 1050] [serial = 2] [outer = 0x1204d1800] 16:52:24 INFO - ++DOCSHELL 0x1203d1800 == 2 [pid = 1050] [id = 2] 16:52:24 INFO - ++DOMWINDOW == 3 (0x12793e400) [pid = 1050] [serial = 3] [outer = 0x0] 16:52:24 INFO - ++DOMWINDOW == 4 (0x12793e800) [pid = 1050] [serial = 4] [outer = 0x12793e400] 16:52:24 INFO - [1050] WARNING: Loaded script chrome://global/content/printUtils.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:24 INFO - [1050] WARNING: Loaded script chrome://global/content/viewZoomOverlay.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:24 INFO - [1050] WARNING: Loaded script chrome://browser/content/places/browserPlacesViews.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - [1050] WARNING: Loaded script chrome://browser/content/browser.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - [1050] WARNING: Loaded script chrome://browser/content/downloads/downloads.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - [1050] WARNING: Loaded script chrome://browser/content/downloads/indicator.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:52:25 INFO - [1050] WARNING: Loaded script chrome://browser/content/customizableui/panelUI.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - [1050] WARNING: Loaded script chrome://global/content/viewSourceUtils.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:52:25 INFO - ++DOCSHELL 0x12a2e6f00 == 3 [pid = 1050] [id = 3] 16:52:25 INFO - ++DOMWINDOW == 5 (0x12a2d7c00) [pid = 1050] [serial = 5] [outer = 0x0] 16:52:25 INFO - ++DOCSHELL 0x12a2e7400 == 4 [pid = 1050] [id = 4] 16:52:25 INFO - ++DOMWINDOW == 6 (0x12a323000) [pid = 1050] [serial = 6] [outer = 0x0] 16:52:25 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:25 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:25 INFO - [1050] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:52:26 INFO - [1050] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 16:52:26 INFO - ++DOCSHELL 0x12bf46600 == 5 [pid = 1050] [id = 5] 16:52:26 INFO - ++DOMWINDOW == 7 (0x12a2d7800) [pid = 1050] [serial = 7] [outer = 0x0] 16:52:26 INFO - [1050] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 16:52:26 INFO - ++DOMWINDOW == 8 (0x12c72e000) [pid = 1050] [serial = 8] [outer = 0x12a2d7800] 16:52:26 INFO - ++DOMWINDOW == 9 (0x12c3b2000) [pid = 1050] [serial = 9] [outer = 0x12a2d7c00] 16:52:26 INFO - ++DOMWINDOW == 10 (0x12c3b2400) [pid = 1050] [serial = 10] [outer = 0x12a323000] 16:52:26 INFO - ++DOMWINDOW == 11 (0x12c3b2800) [pid = 1050] [serial = 11] [outer = 0x12a2d7800] 16:52:27 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:27 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:27 INFO - [1050] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:52:27 INFO - ++DOMWINDOW == 12 (0x12cd49800) [pid = 1050] [serial = 12] [outer = 0x12a2d7800] 16:52:27 INFO - ++DOCSHELL 0x12d4b3000 == 6 [pid = 1050] [id = 6] 16:52:27 INFO - ++DOMWINDOW == 13 (0x12d4b2400) [pid = 1050] [serial = 13] [outer = 0x0] 16:52:27 INFO - ++DOMWINDOW == 14 (0x12d4b2800) [pid = 1050] [serial = 14] [outer = 0x12d4b2400] 16:52:28 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:28 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:28 INFO - [1050] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:52:28 INFO - 0 INFO *** Start BrowserChrome Test Results *** 16:52:28 INFO - ++DOCSHELL 0x13132fa00 == 7 [pid = 1050] [id = 7] 16:52:28 INFO - ++DOMWINDOW == 15 (0x1278d7400) [pid = 1050] [serial = 15] [outer = 0x0] 16:52:28 INFO - ++DOMWINDOW == 16 (0x13103c800) [pid = 1050] [serial = 16] [outer = 0x1278d7400] 16:52:28 INFO - 1 INFO checking window state 16:52:28 INFO - 2 INFO TEST-INFO | (browser-test.js) | Console message: [JavaScript Error: "DEPRECATION WARNING: FUEL is deprecated, you should use the add-on SDK instead. 16:52:28 INFO - You may find more details about this deprecation at: https://developer.mozilla.org/Add-ons/SDK/ 16:52:28 INFO - jar:file:///builds/slave/test/build/application/NightlyDebug.app/Contents/Resources/browser/omni.ja!/components/fuelApplication.js 1458 Application 16:52:28 INFO - jar:file:///builds/slave/test/build/application/NightlyDebug.app/Contents/Resources/browser/omni.ja!/components/fuelApplication.js 726 af_ci 16:52:28 INFO - chrome://mochikit/content/browser-test.js 254 Tester_start 16:52:28 INFO - chrome://mochikit/content/browser-harness.xul 255 createTester/%20%20%20%20%20%20%20%20%20%20] 16:52:41 INFO - --DOMWINDOW == 30 (0x120ca6000) [pid = 1050] [serial = 44] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:41 INFO - --DOMWINDOW == 29 (0x1355c5c00) [pid = 1050] [serial = 23] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:41 INFO - --DOMWINDOW == 28 (0x1277a3c00) [pid = 1050] [serial = 41] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:52:41 INFO - ++DOMWINDOW == 29 (0x12e3fb800) [pid = 1050] [serial = 52] [outer = 0x128125c00] 16:52:41 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:41 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:41 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:41 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:41 INFO - ++DOCSHELL 0x132f15500 == 11 [pid = 1050] [id = 22] 16:52:41 INFO - ++DOMWINDOW == 30 (0x128a47000) [pid = 1050] [serial = 53] [outer = 0x0] 16:52:41 INFO - ++DOMWINDOW == 31 (0x128b60000) [pid = 1050] [serial = 54] [outer = 0x128a47000] 16:52:41 INFO - ++DOMWINDOW == 32 (0x128f87800) [pid = 1050] [serial = 55] [outer = 0x128a47000] 16:52:41 INFO - ++DOCSHELL 0x133229b00 == 12 [pid = 1050] [id = 23] 16:52:41 INFO - ++DOMWINDOW == 33 (0x12c166400) [pid = 1050] [serial = 56] [outer = 0x0] 16:52:41 INFO - ++DOMWINDOW == 34 (0x12c1c0400) [pid = 1050] [serial = 57] [outer = 0x12c166400] 16:52:42 INFO - ++DOMWINDOW == 35 (0x129ffcc00) [pid = 1050] [serial = 58] [outer = 0x128125c00] 16:52:42 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:52:42 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:42 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:42 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:42 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:42 INFO - ++DOCSHELL 0x137962d00 == 13 [pid = 1050] [id = 24] 16:52:42 INFO - ++DOMWINDOW == 36 (0x129ca0400) [pid = 1050] [serial = 59] [outer = 0x0] 16:52:42 INFO - ++DOCSHELL 0x137963700 == 14 [pid = 1050] [id = 25] 16:52:42 INFO - ++DOMWINDOW == 37 (0x130779000) [pid = 1050] [serial = 60] [outer = 0x0] 16:52:42 INFO - [1050] WARNING: No inner window available!: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 16:52:42 INFO - [1050] WARNING: No inner window available!: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 16:52:42 INFO - ++DOMWINDOW == 38 (0x10c777c00) [pid = 1050] [serial = 61] [outer = 0x129ca0400] 16:52:42 INFO - ++DOMWINDOW == 39 (0x11fe5e800) [pid = 1050] [serial = 62] [outer = 0x130779000] 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:45 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 16:52:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:46 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 16:52:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:46 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:46 INFO - --DOMWINDOW == 38 (0x12ccc3000) [pid = 1050] [serial = 43] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:46 INFO - --DOMWINDOW == 37 (0x10c5c0400) [pid = 1050] [serial = 37] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:47 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:52:47 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:47 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:47 INFO - --DOCSHELL 0x133229b00 == 13 [pid = 1050] [id = 23] 16:52:47 INFO - --DOCSHELL 0x132f15500 == 12 [pid = 1050] [id = 22] 16:52:47 INFO - --DOCSHELL 0x137962d00 == 11 [pid = 1050] [id = 24] 16:52:47 INFO - --DOCSHELL 0x137963700 == 10 [pid = 1050] [id = 25] 16:52:47 INFO - --DOCSHELL 0x12d4b4900 == 9 [pid = 1050] [id = 21] 16:52:47 INFO - --DOMWINDOW == 36 (0x129b2cc00) [pid = 1050] [serial = 47] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:47 INFO - --DOMWINDOW == 35 (0x129b2c800) [pid = 1050] [serial = 46] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:47 INFO - --DOMWINDOW == 34 (0x1277d7400) [pid = 1050] [serial = 42] [outer = 0x0] [url = about:blank] 16:52:47 INFO - --DOMWINDOW == 33 (0x135496400) [pid = 1050] [serial = 25] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:47 INFO - MEMORY STAT | vsize 3735MB | residentFast 343MB | heapAllocated 99MB 16:52:47 INFO - 8 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-error-gutter.js | took 7331ms 16:52:47 INFO - ++DOCSHELL 0x11fd21b00 == 10 [pid = 1050] [id = 26] 16:52:47 INFO - ++DOMWINDOW == 34 (0x10c7ff400) [pid = 1050] [serial = 63] [outer = 0x0] 16:52:47 INFO - ++DOMWINDOW == 35 (0x11fd7a000) [pid = 1050] [serial = 64] [outer = 0x10c7ff400] 16:52:47 INFO - 9 INFO TEST-START | devtools/client/shadereditor/test/browser_se_editors-error-tooltip.js 16:52:47 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:47 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:47 INFO - ++DOCSHELL 0x128047b00 == 11 [pid = 1050] [id = 27] 16:52:47 INFO - ++DOMWINDOW == 36 (0x120345c00) [pid = 1050] [serial = 65] [outer = 0x0] 16:52:48 INFO - ++DOMWINDOW == 37 (0x120cb0c00) [pid = 1050] [serial = 66] [outer = 0x120345c00] 16:52:48 INFO - --DOCSHELL 0x11fe32e00 == 10 [pid = 1050] [id = 20] 16:52:48 INFO - --DOMWINDOW == 36 (0x128a47400) [pid = 1050] [serial = 51] [outer = 0x0] [url = about:blank] 16:52:48 INFO - --DOMWINDOW == 35 (0x11fd15c00) [pid = 1050] [serial = 48] [outer = 0x0] [url = about:blank] 16:52:48 INFO - --DOMWINDOW == 34 (0x11fe5a400) [pid = 1050] [serial = 49] [outer = 0x0] [url = about:blank] 16:52:48 INFO - --DOMWINDOW == 33 (0x129ca0400) [pid = 1050] [serial = 59] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:48 INFO - --DOMWINDOW == 32 (0x130779000) [pid = 1050] [serial = 60] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:48 INFO - --DOMWINDOW == 31 (0x12c166400) [pid = 1050] [serial = 56] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:52:48 INFO - --DOMWINDOW == 30 (0x128125c00) [pid = 1050] [serial = 50] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:48 INFO - --DOMWINDOW == 29 (0x128b60000) [pid = 1050] [serial = 54] [outer = 0x0] [url = about:blank] 16:52:48 INFO - --DOMWINDOW == 28 (0x11fd34800) [pid = 1050] [serial = 38] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:48 INFO - ++DOMWINDOW == 29 (0x10c5c0c00) [pid = 1050] [serial = 67] [outer = 0x120345c00] 16:52:48 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:48 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:48 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:48 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:49 INFO - ++DOCSHELL 0x129c6b300 == 11 [pid = 1050] [id = 28] 16:52:49 INFO - ++DOMWINDOW == 30 (0x120556000) [pid = 1050] [serial = 68] [outer = 0x0] 16:52:49 INFO - ++DOMWINDOW == 31 (0x120da0c00) [pid = 1050] [serial = 69] [outer = 0x120556000] 16:52:49 INFO - ++DOMWINDOW == 32 (0x120e7a000) [pid = 1050] [serial = 70] [outer = 0x120556000] 16:52:49 INFO - ++DOCSHELL 0x12b952e00 == 12 [pid = 1050] [id = 29] 16:52:49 INFO - ++DOMWINDOW == 33 (0x12a052400) [pid = 1050] [serial = 71] [outer = 0x0] 16:52:49 INFO - ++DOMWINDOW == 34 (0x12a137800) [pid = 1050] [serial = 72] [outer = 0x12a052400] 16:52:50 INFO - ++DOMWINDOW == 35 (0x126eb4400) [pid = 1050] [serial = 73] [outer = 0x120345c00] 16:52:50 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:52:50 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:50 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:50 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:50 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:50 INFO - ++DOCSHELL 0x133226900 == 13 [pid = 1050] [id = 30] 16:52:50 INFO - ++DOMWINDOW == 36 (0x12c3b2800) [pid = 1050] [serial = 74] [outer = 0x0] 16:52:50 INFO - ++DOCSHELL 0x133229100 == 14 [pid = 1050] [id = 31] 16:52:50 INFO - ++DOMWINDOW == 37 (0x12c474400) [pid = 1050] [serial = 75] [outer = 0x0] 16:52:50 INFO - ++DOMWINDOW == 38 (0x12c474800) [pid = 1050] [serial = 76] [outer = 0x12c3b2800] 16:52:50 INFO - ++DOMWINDOW == 39 (0x12c474c00) [pid = 1050] [serial = 77] [outer = 0x12c474400] 16:52:51 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:52:51 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:51 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:52:51 INFO - [1050] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:52:52 INFO - --DOCSHELL 0x12b952e00 == 13 [pid = 1050] [id = 29] 16:52:52 INFO - --DOCSHELL 0x133226900 == 12 [pid = 1050] [id = 30] 16:52:52 INFO - --DOCSHELL 0x133229100 == 11 [pid = 1050] [id = 31] 16:52:52 INFO - --DOMWINDOW == 38 (0x129ffcc00) [pid = 1050] [serial = 58] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:52 INFO - --DOMWINDOW == 37 (0x12e3fb800) [pid = 1050] [serial = 52] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:52 INFO - --DOMWINDOW == 36 (0x11fe5e800) [pid = 1050] [serial = 62] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:52 INFO - --DOMWINDOW == 35 (0x10c777c00) [pid = 1050] [serial = 61] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:52 INFO - --DOMWINDOW == 34 (0x12c1c0400) [pid = 1050] [serial = 57] [outer = 0x0] [url = about:blank] 16:52:52 INFO - --DOMWINDOW == 33 (0x12053d400) [pid = 1050] [serial = 40] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:52 INFO - MEMORY STAT | vsize 3738MB | residentFast 344MB | heapAllocated 100MB 16:52:52 INFO - 10 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-error-tooltip.js | took 4430ms 16:52:52 INFO - ++DOCSHELL 0x10c52f200 == 12 [pid = 1050] [id = 32] 16:52:52 INFO - ++DOMWINDOW == 34 (0x10c777c00) [pid = 1050] [serial = 78] [outer = 0x0] 16:52:52 INFO - ++DOMWINDOW == 35 (0x11fcc7400) [pid = 1050] [serial = 79] [outer = 0x10c777c00] 16:52:52 INFO - 11 INFO TEST-START | devtools/client/shadereditor/test/browser_se_editors-lazy-init.js 16:52:52 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:52 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:52 INFO - ++DOCSHELL 0x129c69500 == 13 [pid = 1050] [id = 33] 16:52:52 INFO - ++DOMWINDOW == 36 (0x120cb5400) [pid = 1050] [serial = 80] [outer = 0x0] 16:52:52 INFO - ++DOMWINDOW == 37 (0x120d6c800) [pid = 1050] [serial = 81] [outer = 0x120cb5400] 16:52:53 INFO - --DOCSHELL 0x11fd21b00 == 12 [pid = 1050] [id = 26] 16:52:53 INFO - --DOCSHELL 0x129c6b300 == 11 [pid = 1050] [id = 28] 16:52:53 INFO - --DOCSHELL 0x128047b00 == 10 [pid = 1050] [id = 27] 16:52:53 INFO - --DOMWINDOW == 36 (0x120da0c00) [pid = 1050] [serial = 69] [outer = 0x0] [url = about:blank] 16:52:53 INFO - --DOMWINDOW == 35 (0x120cb0c00) [pid = 1050] [serial = 66] [outer = 0x0] [url = about:blank] 16:52:53 INFO - --DOMWINDOW == 34 (0x120345c00) [pid = 1050] [serial = 65] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:53 INFO - --DOMWINDOW == 33 (0x10c5c0c00) [pid = 1050] [serial = 67] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:53 INFO - --DOMWINDOW == 32 (0x126eb4400) [pid = 1050] [serial = 73] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:53 INFO - --DOMWINDOW == 31 (0x11fd7a000) [pid = 1050] [serial = 64] [outer = 0x0] [url = about:blank] 16:52:53 INFO - --DOMWINDOW == 30 (0x10c7ff400) [pid = 1050] [serial = 63] [outer = 0x0] [url = about:blank] 16:52:53 INFO - --DOMWINDOW == 29 (0x128a47000) [pid = 1050] [serial = 53] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:53 INFO - --DOMWINDOW == 28 (0x12c3b2800) [pid = 1050] [serial = 74] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:53 INFO - --DOMWINDOW == 27 (0x12c474400) [pid = 1050] [serial = 75] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:53 INFO - --DOMWINDOW == 26 (0x12a052400) [pid = 1050] [serial = 71] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:52:53 INFO - ++DOMWINDOW == 27 (0x10c6b6c00) [pid = 1050] [serial = 82] [outer = 0x120cb5400] 16:52:53 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:53 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:53 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:53 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:53 INFO - ++DOCSHELL 0x12802f100 == 11 [pid = 1050] [id = 34] 16:52:53 INFO - ++DOMWINDOW == 28 (0x120396c00) [pid = 1050] [serial = 83] [outer = 0x0] 16:52:53 INFO - ++DOMWINDOW == 29 (0x12040f000) [pid = 1050] [serial = 84] [outer = 0x120396c00] 16:52:53 INFO - ++DOMWINDOW == 30 (0x120510c00) [pid = 1050] [serial = 85] [outer = 0x120396c00] 16:52:53 INFO - ++DOCSHELL 0x128047b00 == 12 [pid = 1050] [id = 35] 16:52:53 INFO - ++DOMWINDOW == 31 (0x129db5800) [pid = 1050] [serial = 86] [outer = 0x0] 16:52:53 INFO - ++DOMWINDOW == 32 (0x129de9400) [pid = 1050] [serial = 87] [outer = 0x129db5800] 16:52:54 INFO - ++DOMWINDOW == 33 (0x126eb4000) [pid = 1050] [serial = 88] [outer = 0x120cb5400] 16:52:54 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:52:54 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:54 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:54 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:54 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:54 INFO - ++DOCSHELL 0x10c680000 == 13 [pid = 1050] [id = 36] 16:52:54 INFO - ++DOMWINDOW == 34 (0x12241a000) [pid = 1050] [serial = 89] [outer = 0x0] 16:52:54 INFO - ++DOMWINDOW == 35 (0x12c3b2800) [pid = 1050] [serial = 90] [outer = 0x12241a000] 16:52:54 INFO - ++DOCSHELL 0x130446d00 == 14 [pid = 1050] [id = 37] 16:52:54 INFO - ++DOMWINDOW == 36 (0x12c3e9000) [pid = 1050] [serial = 91] [outer = 0x0] 16:52:55 INFO - ++DOMWINDOW == 37 (0x12c474000) [pid = 1050] [serial = 92] [outer = 0x12c3e9000] 16:52:56 INFO - --DOCSHELL 0x128047b00 == 13 [pid = 1050] [id = 35] 16:52:56 INFO - --DOCSHELL 0x10c680000 == 12 [pid = 1050] [id = 36] 16:52:56 INFO - --DOMWINDOW == 36 (0x12c474c00) [pid = 1050] [serial = 77] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:56 INFO - --DOMWINDOW == 35 (0x12c474800) [pid = 1050] [serial = 76] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:56 INFO - --DOMWINDOW == 34 (0x12a137800) [pid = 1050] [serial = 72] [outer = 0x0] [url = about:blank] 16:52:56 INFO - --DOMWINDOW == 33 (0x128f87800) [pid = 1050] [serial = 55] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:56 INFO - MEMORY STAT | vsize 3748MB | residentFast 349MB | heapAllocated 101MB 16:52:56 INFO - 12 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_editors-lazy-init.js | took 3938ms 16:52:56 INFO - ++DOCSHELL 0x10c52fc00 == 13 [pid = 1050] [id = 38] 16:52:56 INFO - ++DOMWINDOW == 34 (0x10c656000) [pid = 1050] [serial = 93] [outer = 0x0] 16:52:56 INFO - ++DOMWINDOW == 35 (0x10c777400) [pid = 1050] [serial = 94] [outer = 0x10c656000] 16:52:56 INFO - --DOCSHELL 0x130446d00 == 12 [pid = 1050] [id = 37] 16:52:56 INFO - 13 INFO TEST-START | devtools/client/shadereditor/test/browser_se_first-run.js 16:52:56 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:56 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:56 INFO - ++DOCSHELL 0x129c6d600 == 13 [pid = 1050] [id = 39] 16:52:56 INFO - ++DOMWINDOW == 36 (0x120fb4000) [pid = 1050] [serial = 95] [outer = 0x0] 16:52:56 INFO - ++DOMWINDOW == 37 (0x122470c00) [pid = 1050] [serial = 96] [outer = 0x120fb4000] 16:52:57 INFO - --DOCSHELL 0x10c52f200 == 12 [pid = 1050] [id = 32] 16:52:57 INFO - --DOCSHELL 0x12802f100 == 11 [pid = 1050] [id = 34] 16:52:57 INFO - --DOCSHELL 0x129c69500 == 10 [pid = 1050] [id = 33] 16:52:57 INFO - --DOMWINDOW == 36 (0x10c777c00) [pid = 1050] [serial = 78] [outer = 0x0] [url = about:blank] 16:52:57 INFO - --DOMWINDOW == 35 (0x11fcc7400) [pid = 1050] [serial = 79] [outer = 0x0] [url = about:blank] 16:52:57 INFO - --DOMWINDOW == 34 (0x12040f000) [pid = 1050] [serial = 84] [outer = 0x0] [url = about:blank] 16:52:57 INFO - --DOMWINDOW == 33 (0x120d6c800) [pid = 1050] [serial = 81] [outer = 0x0] [url = about:blank] 16:52:57 INFO - --DOMWINDOW == 32 (0x120cb5400) [pid = 1050] [serial = 80] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:57 INFO - --DOMWINDOW == 31 (0x120556000) [pid = 1050] [serial = 68] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:57 INFO - --DOMWINDOW == 30 (0x12c3e9000) [pid = 1050] [serial = 91] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:57 INFO - --DOMWINDOW == 29 (0x12241a000) [pid = 1050] [serial = 89] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:57 INFO - --DOMWINDOW == 28 (0x129db5800) [pid = 1050] [serial = 86] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:52:57 INFO - ++DOMWINDOW == 29 (0x10c5c0400) [pid = 1050] [serial = 97] [outer = 0x120fb4000] 16:52:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:57 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:57 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:57 INFO - ++DOCSHELL 0x12e290f00 == 11 [pid = 1050] [id = 40] 16:52:57 INFO - ++DOMWINDOW == 30 (0x120fb8000) [pid = 1050] [serial = 98] [outer = 0x0] 16:52:57 INFO - ++DOMWINDOW == 31 (0x12241a000) [pid = 1050] [serial = 99] [outer = 0x120fb8000] 16:52:57 INFO - ++DOMWINDOW == 32 (0x120376400) [pid = 1050] [serial = 100] [outer = 0x120fb8000] 16:52:58 INFO - ++DOCSHELL 0x131330e00 == 12 [pid = 1050] [id = 41] 16:52:58 INFO - ++DOMWINDOW == 33 (0x12a2d5000) [pid = 1050] [serial = 101] [outer = 0x0] 16:52:58 INFO - ++DOMWINDOW == 34 (0x12a2d5800) [pid = 1050] [serial = 102] [outer = 0x12a2d5000] 16:52:58 INFO - ++DOMWINDOW == 35 (0x12c733c00) [pid = 1050] [serial = 103] [outer = 0x120fb4000] 16:52:58 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:52:58 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:58 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:52:58 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:58 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:59 INFO - --DOCSHELL 0x131330e00 == 11 [pid = 1050] [id = 41] 16:52:59 INFO - MEMORY STAT | vsize 3768MB | residentFast 350MB | heapAllocated 103MB 16:52:59 INFO - 14 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_first-run.js | took 3039ms 16:52:59 INFO - ++DOCSHELL 0x127811900 == 12 [pid = 1050] [id = 42] 16:52:59 INFO - ++DOMWINDOW == 36 (0x10c7ff400) [pid = 1050] [serial = 104] [outer = 0x0] 16:52:59 INFO - ++DOMWINDOW == 37 (0x120134000) [pid = 1050] [serial = 105] [outer = 0x10c7ff400] 16:52:59 INFO - --DOMWINDOW == 36 (0x120e7a000) [pid = 1050] [serial = 70] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:52:59 INFO - --DOMWINDOW == 35 (0x10c6b6c00) [pid = 1050] [serial = 82] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:59 INFO - --DOMWINDOW == 34 (0x12c474000) [pid = 1050] [serial = 92] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:59 INFO - --DOMWINDOW == 33 (0x12c3b2800) [pid = 1050] [serial = 90] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:52:59 INFO - --DOMWINDOW == 32 (0x126eb4000) [pid = 1050] [serial = 88] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:52:59 INFO - --DOMWINDOW == 31 (0x129de9400) [pid = 1050] [serial = 87] [outer = 0x0] [url = about:blank] 16:52:59 INFO - 15 INFO TEST-START | devtools/client/shadereditor/test/browser_se_navigation.js 16:52:59 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:59 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:52:59 INFO - ++DOCSHELL 0x129a5ff00 == 13 [pid = 1050] [id = 43] 16:52:59 INFO - ++DOMWINDOW == 32 (0x120139c00) [pid = 1050] [serial = 106] [outer = 0x0] 16:52:59 INFO - ++DOMWINDOW == 33 (0x120299800) [pid = 1050] [serial = 107] [outer = 0x120139c00] 16:53:00 INFO - --DOCSHELL 0x129c6d600 == 12 [pid = 1050] [id = 39] 16:53:00 INFO - --DOCSHELL 0x10c52fc00 == 11 [pid = 1050] [id = 38] 16:53:00 INFO - --DOCSHELL 0x12e290f00 == 10 [pid = 1050] [id = 40] 16:53:00 INFO - --DOMWINDOW == 32 (0x12241a000) [pid = 1050] [serial = 99] [outer = 0x0] [url = about:blank] 16:53:00 INFO - --DOMWINDOW == 31 (0x122470c00) [pid = 1050] [serial = 96] [outer = 0x0] [url = about:blank] 16:53:00 INFO - --DOMWINDOW == 30 (0x10c777400) [pid = 1050] [serial = 94] [outer = 0x0] [url = about:blank] 16:53:00 INFO - --DOMWINDOW == 29 (0x10c656000) [pid = 1050] [serial = 93] [outer = 0x0] [url = about:blank] 16:53:00 INFO - --DOMWINDOW == 28 (0x120fb4000) [pid = 1050] [serial = 95] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:00 INFO - --DOMWINDOW == 27 (0x12a2d5000) [pid = 1050] [serial = 101] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:00 INFO - --DOMWINDOW == 26 (0x120396c00) [pid = 1050] [serial = 83] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:00 INFO - ++DOMWINDOW == 27 (0x10c5c0c00) [pid = 1050] [serial = 108] [outer = 0x120139c00] 16:53:00 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:00 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:00 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:00 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:01 INFO - ++DOCSHELL 0x127810f00 == 11 [pid = 1050] [id = 44] 16:53:01 INFO - ++DOMWINDOW == 28 (0x10c7d4800) [pid = 1050] [serial = 109] [outer = 0x0] 16:53:01 INFO - ++DOMWINDOW == 29 (0x120299400) [pid = 1050] [serial = 110] [outer = 0x10c7d4800] 16:53:01 INFO - ++DOMWINDOW == 30 (0x122470000) [pid = 1050] [serial = 111] [outer = 0x10c7d4800] 16:53:01 INFO - ++DOCSHELL 0x12a17d300 == 12 [pid = 1050] [id = 45] 16:53:01 INFO - ++DOMWINDOW == 31 (0x129ea3c00) [pid = 1050] [serial = 112] [outer = 0x0] 16:53:01 INFO - ++DOMWINDOW == 32 (0x129eb6800) [pid = 1050] [serial = 113] [outer = 0x129ea3c00] 16:53:01 INFO - ++DOMWINDOW == 33 (0x1276bd800) [pid = 1050] [serial = 114] [outer = 0x120139c00] 16:53:01 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:01 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:01 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:02 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:02 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:02 INFO - ++DOCSHELL 0x133186e00 == 13 [pid = 1050] [id = 46] 16:53:02 INFO - ++DOMWINDOW == 34 (0x12c235c00) [pid = 1050] [serial = 115] [outer = 0x0] 16:53:02 INFO - ++DOCSHELL 0x133225000 == 14 [pid = 1050] [id = 47] 16:53:02 INFO - ++DOMWINDOW == 35 (0x12c398000) [pid = 1050] [serial = 116] [outer = 0x0] 16:53:02 INFO - ++DOMWINDOW == 36 (0x12c3b2800) [pid = 1050] [serial = 117] [outer = 0x12c235c00] 16:53:02 INFO - ++DOMWINDOW == 37 (0x12c3b2c00) [pid = 1050] [serial = 118] [outer = 0x12c398000] 16:53:03 INFO - --DOCSHELL 0x12a17d300 == 13 [pid = 1050] [id = 45] 16:53:03 INFO - --DOMWINDOW == 36 (0x120510c00) [pid = 1050] [serial = 85] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:03 INFO - --DOCSHELL 0x133225000 == 12 [pid = 1050] [id = 47] 16:53:03 INFO - --DOCSHELL 0x133186e00 == 11 [pid = 1050] [id = 46] 16:53:03 INFO - --DOMWINDOW == 35 (0x12a2d5800) [pid = 1050] [serial = 102] [outer = 0x0] [url = about:blank] 16:53:03 INFO - --DOMWINDOW == 34 (0x10c5c0400) [pid = 1050] [serial = 97] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:03 INFO - --DOMWINDOW == 33 (0x12c733c00) [pid = 1050] [serial = 103] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:03 INFO - MEMORY STAT | vsize 3739MB | residentFast 342MB | heapAllocated 98MB 16:53:03 INFO - 16 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_navigation.js | took 3838ms 16:53:03 INFO - ++DOCSHELL 0x10c52f200 == 12 [pid = 1050] [id = 48] 16:53:03 INFO - ++DOMWINDOW == 34 (0x10c6b6c00) [pid = 1050] [serial = 119] [outer = 0x0] 16:53:03 INFO - ++DOMWINDOW == 35 (0x11fd15c00) [pid = 1050] [serial = 120] [outer = 0x10c6b6c00] 16:53:03 INFO - 17 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-blackbox-01.js 16:53:03 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:03 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:03 INFO - ++DOCSHELL 0x129c6a400 == 13 [pid = 1050] [id = 49] 16:53:03 INFO - ++DOMWINDOW == 36 (0x120ca6000) [pid = 1050] [serial = 121] [outer = 0x0] 16:53:03 INFO - ++DOMWINDOW == 37 (0x120d38000) [pid = 1050] [serial = 122] [outer = 0x120ca6000] 16:53:04 INFO - --DOCSHELL 0x127811900 == 12 [pid = 1050] [id = 42] 16:53:04 INFO - --DOCSHELL 0x129a5ff00 == 11 [pid = 1050] [id = 43] 16:53:04 INFO - --DOCSHELL 0x127810f00 == 10 [pid = 1050] [id = 44] 16:53:04 INFO - --DOMWINDOW == 36 (0x120299400) [pid = 1050] [serial = 110] [outer = 0x0] [url = about:blank] 16:53:04 INFO - --DOMWINDOW == 35 (0x120fb8000) [pid = 1050] [serial = 98] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:04 INFO - --DOMWINDOW == 34 (0x120299800) [pid = 1050] [serial = 107] [outer = 0x0] [url = about:blank] 16:53:04 INFO - --DOMWINDOW == 33 (0x120139c00) [pid = 1050] [serial = 106] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:04 INFO - --DOMWINDOW == 32 (0x12c235c00) [pid = 1050] [serial = 115] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:04 INFO - --DOMWINDOW == 31 (0x10c7ff400) [pid = 1050] [serial = 104] [outer = 0x0] [url = about:blank] 16:53:04 INFO - --DOMWINDOW == 30 (0x129ea3c00) [pid = 1050] [serial = 112] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:04 INFO - --DOMWINDOW == 29 (0x120134000) [pid = 1050] [serial = 105] [outer = 0x0] [url = about:blank] 16:53:04 INFO - --DOMWINDOW == 28 (0x12c398000) [pid = 1050] [serial = 116] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:04 INFO - ++DOMWINDOW == 29 (0x10c62bc00) [pid = 1050] [serial = 123] [outer = 0x120ca6000] 16:53:04 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:04 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:04 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:04 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:04 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:04 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:05 INFO - ++DOCSHELL 0x133229100 == 11 [pid = 1050] [id = 50] 16:53:05 INFO - ++DOMWINDOW == 30 (0x120cb5400) [pid = 1050] [serial = 124] [outer = 0x0] 16:53:05 INFO - ++DOMWINDOW == 31 (0x120f72000) [pid = 1050] [serial = 125] [outer = 0x120cb5400] 16:53:05 INFO - ++DOMWINDOW == 32 (0x11fd65400) [pid = 1050] [serial = 126] [outer = 0x120cb5400] 16:53:05 INFO - ++DOCSHELL 0x1337f6200 == 12 [pid = 1050] [id = 51] 16:53:05 INFO - ++DOMWINDOW == 33 (0x12a3e1400) [pid = 1050] [serial = 127] [outer = 0x0] 16:53:05 INFO - ++DOMWINDOW == 34 (0x12a3e6800) [pid = 1050] [serial = 128] [outer = 0x12a3e1400] 16:53:06 INFO - ++DOMWINDOW == 35 (0x128a78c00) [pid = 1050] [serial = 129] [outer = 0x120ca6000] 16:53:06 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:06 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:06 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:06 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:06 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:06 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:06 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:06 INFO - ++DOCSHELL 0x129f19d00 == 13 [pid = 1050] [id = 52] 16:53:06 INFO - ++DOMWINDOW == 36 (0x133541000) [pid = 1050] [serial = 130] [outer = 0x0] 16:53:06 INFO - ++DOCSHELL 0x129f17f00 == 14 [pid = 1050] [id = 53] 16:53:06 INFO - ++DOMWINDOW == 37 (0x12e783400) [pid = 1050] [serial = 131] [outer = 0x0] 16:53:06 INFO - ++DOMWINDOW == 38 (0x12e783800) [pid = 1050] [serial = 132] [outer = 0x133541000] 16:53:06 INFO - ++DOMWINDOW == 39 (0x12e7f7400) [pid = 1050] [serial = 133] [outer = 0x12e783400] 16:53:09 INFO - --DOCSHELL 0x129c6a400 == 13 [pid = 1050] [id = 49] 16:53:09 INFO - --DOCSHELL 0x133229100 == 12 [pid = 1050] [id = 50] 16:53:09 INFO - --DOCSHELL 0x1337f6200 == 11 [pid = 1050] [id = 51] 16:53:09 INFO - --DOCSHELL 0x129f19d00 == 10 [pid = 1050] [id = 52] 16:53:09 INFO - --DOCSHELL 0x129f17f00 == 9 [pid = 1050] [id = 53] 16:53:09 INFO - --DOMWINDOW == 38 (0x120376400) [pid = 1050] [serial = 100] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:09 INFO - --DOMWINDOW == 37 (0x129eb6800) [pid = 1050] [serial = 113] [outer = 0x0] [url = about:blank] 16:53:09 INFO - --DOMWINDOW == 36 (0x12c3b2800) [pid = 1050] [serial = 117] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:09 INFO - --DOMWINDOW == 35 (0x12c3b2c00) [pid = 1050] [serial = 118] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:09 INFO - --DOMWINDOW == 34 (0x10c5c0c00) [pid = 1050] [serial = 108] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:09 INFO - --DOMWINDOW == 33 (0x1276bd800) [pid = 1050] [serial = 114] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:09 INFO - MEMORY STAT | vsize 3722MB | residentFast 348MB | heapAllocated 104MB 16:53:09 INFO - 18 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-blackbox-01.js | took 5903ms 16:53:09 INFO - ++DOCSHELL 0x10c7a8d00 == 10 [pid = 1050] [id = 54] 16:53:09 INFO - ++DOMWINDOW == 34 (0x11fd7a800) [pid = 1050] [serial = 134] [outer = 0x0] 16:53:09 INFO - ++DOMWINDOW == 35 (0x1200e3000) [pid = 1050] [serial = 135] [outer = 0x11fd7a800] 16:53:09 INFO - 19 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-blackbox-02.js 16:53:09 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:09 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:10 INFO - ++DOCSHELL 0x1278c6e00 == 11 [pid = 1050] [id = 55] 16:53:10 INFO - ++DOMWINDOW == 36 (0x120ddc800) [pid = 1050] [serial = 136] [outer = 0x0] 16:53:10 INFO - ++DOMWINDOW == 37 (0x120f7f800) [pid = 1050] [serial = 137] [outer = 0x120ddc800] 16:53:10 INFO - --DOCSHELL 0x10c52f200 == 10 [pid = 1050] [id = 48] 16:53:10 INFO - --DOMWINDOW == 36 (0x133541000) [pid = 1050] [serial = 130] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:10 INFO - --DOMWINDOW == 35 (0x12e783400) [pid = 1050] [serial = 131] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:10 INFO - --DOMWINDOW == 34 (0x120d38000) [pid = 1050] [serial = 122] [outer = 0x0] [url = about:blank] 16:53:10 INFO - --DOMWINDOW == 33 (0x10c6b6c00) [pid = 1050] [serial = 119] [outer = 0x0] [url = about:blank] 16:53:10 INFO - --DOMWINDOW == 32 (0x11fd15c00) [pid = 1050] [serial = 120] [outer = 0x0] [url = about:blank] 16:53:10 INFO - --DOMWINDOW == 31 (0x120f72000) [pid = 1050] [serial = 125] [outer = 0x0] [url = about:blank] 16:53:10 INFO - --DOMWINDOW == 30 (0x120ca6000) [pid = 1050] [serial = 121] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:10 INFO - --DOMWINDOW == 29 (0x10c7d4800) [pid = 1050] [serial = 109] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:10 INFO - --DOMWINDOW == 28 (0x12a3e1400) [pid = 1050] [serial = 127] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:10 INFO - ++DOMWINDOW == 29 (0x10c6a9400) [pid = 1050] [serial = 138] [outer = 0x120ddc800] 16:53:10 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:10 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:10 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:11 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:11 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:11 INFO - ++DOCSHELL 0x129c6d600 == 11 [pid = 1050] [id = 56] 16:53:11 INFO - ++DOMWINDOW == 30 (0x120f7fc00) [pid = 1050] [serial = 139] [outer = 0x0] 16:53:11 INFO - ++DOMWINDOW == 31 (0x127678800) [pid = 1050] [serial = 140] [outer = 0x120f7fc00] 16:53:11 INFO - ++DOMWINDOW == 32 (0x1277d7400) [pid = 1050] [serial = 141] [outer = 0x120f7fc00] 16:53:11 INFO - ++DOCSHELL 0x12c621600 == 12 [pid = 1050] [id = 57] 16:53:11 INFO - ++DOMWINDOW == 33 (0x12ad0e800) [pid = 1050] [serial = 142] [outer = 0x0] 16:53:11 INFO - ++DOMWINDOW == 34 (0x12adce000) [pid = 1050] [serial = 143] [outer = 0x12ad0e800] 16:53:12 INFO - ++DOMWINDOW == 35 (0x128f7c000) [pid = 1050] [serial = 144] [outer = 0x120ddc800] 16:53:12 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:12 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:12 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:12 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:12 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:12 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:12 INFO - ++DOCSHELL 0x132944500 == 13 [pid = 1050] [id = 58] 16:53:12 INFO - ++DOMWINDOW == 36 (0x12df8bc00) [pid = 1050] [serial = 145] [outer = 0x0] 16:53:12 INFO - ++DOCSHELL 0x132944f00 == 14 [pid = 1050] [id = 59] 16:53:12 INFO - ++DOMWINDOW == 37 (0x12e3bb400) [pid = 1050] [serial = 146] [outer = 0x0] 16:53:12 INFO - ++DOMWINDOW == 38 (0x12e3c5400) [pid = 1050] [serial = 147] [outer = 0x12df8bc00] 16:53:12 INFO - ++DOMWINDOW == 39 (0x12e3fb800) [pid = 1050] [serial = 148] [outer = 0x12e3bb400] 16:53:14 INFO - --DOCSHELL 0x12c621600 == 13 [pid = 1050] [id = 57] 16:53:14 INFO - --DOCSHELL 0x132944500 == 12 [pid = 1050] [id = 58] 16:53:14 INFO - --DOCSHELL 0x132944f00 == 11 [pid = 1050] [id = 59] 16:53:14 INFO - --DOMWINDOW == 38 (0x122470000) [pid = 1050] [serial = 111] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:14 INFO - --DOMWINDOW == 37 (0x12a3e6800) [pid = 1050] [serial = 128] [outer = 0x0] [url = about:blank] 16:53:14 INFO - --DOMWINDOW == 36 (0x12e783800) [pid = 1050] [serial = 132] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:14 INFO - --DOMWINDOW == 35 (0x12e7f7400) [pid = 1050] [serial = 133] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:14 INFO - --DOMWINDOW == 34 (0x10c62bc00) [pid = 1050] [serial = 123] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:14 INFO - --DOMWINDOW == 33 (0x128a78c00) [pid = 1050] [serial = 129] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:14 INFO - MEMORY STAT | vsize 3699MB | residentFast 328MB | heapAllocated 98MB 16:53:14 INFO - 20 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-blackbox-02.js | took 4927ms 16:53:14 INFO - ++DOCSHELL 0x10c52f700 == 12 [pid = 1050] [id = 60] 16:53:14 INFO - ++DOMWINDOW == 34 (0x10c630c00) [pid = 1050] [serial = 149] [outer = 0x0] 16:53:14 INFO - ++DOMWINDOW == 35 (0x10c6b6c00) [pid = 1050] [serial = 150] [outer = 0x10c630c00] 16:53:15 INFO - 21 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-cache.js 16:53:15 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:15 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:15 INFO - ++DOCSHELL 0x1281dd400 == 13 [pid = 1050] [id = 61] 16:53:15 INFO - ++DOMWINDOW == 36 (0x1203ed800) [pid = 1050] [serial = 151] [outer = 0x0] 16:53:15 INFO - ++DOMWINDOW == 37 (0x120510c00) [pid = 1050] [serial = 152] [outer = 0x1203ed800] 16:53:15 INFO - --DOCSHELL 0x1278c6e00 == 12 [pid = 1050] [id = 55] 16:53:15 INFO - --DOCSHELL 0x10c7a8d00 == 11 [pid = 1050] [id = 54] 16:53:15 INFO - --DOCSHELL 0x129c6d600 == 10 [pid = 1050] [id = 56] 16:53:15 INFO - --DOMWINDOW == 36 (0x12ad0e800) [pid = 1050] [serial = 142] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:15 INFO - --DOMWINDOW == 35 (0x120ddc800) [pid = 1050] [serial = 136] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:15 INFO - --DOMWINDOW == 34 (0x12e3bb400) [pid = 1050] [serial = 146] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:15 INFO - --DOMWINDOW == 33 (0x12df8bc00) [pid = 1050] [serial = 145] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:15 INFO - --DOMWINDOW == 32 (0x1200e3000) [pid = 1050] [serial = 135] [outer = 0x0] [url = about:blank] 16:53:15 INFO - --DOMWINDOW == 31 (0x11fd7a800) [pid = 1050] [serial = 134] [outer = 0x0] [url = about:blank] 16:53:15 INFO - --DOMWINDOW == 30 (0x120f7f800) [pid = 1050] [serial = 137] [outer = 0x0] [url = about:blank] 16:53:15 INFO - --DOMWINDOW == 29 (0x127678800) [pid = 1050] [serial = 140] [outer = 0x0] [url = about:blank] 16:53:15 INFO - --DOMWINDOW == 28 (0x120cb5400) [pid = 1050] [serial = 124] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:15 INFO - ++DOMWINDOW == 29 (0x12c03b000) [pid = 1050] [serial = 153] [outer = 0x1203ed800] 16:53:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:16 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:16 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:16 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:16 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:16 INFO - ++DOCSHELL 0x1281e0600 == 11 [pid = 1050] [id = 62] 16:53:16 INFO - ++DOMWINDOW == 30 (0x10c656000) [pid = 1050] [serial = 154] [outer = 0x0] 16:53:16 INFO - ++DOMWINDOW == 31 (0x120da0c00) [pid = 1050] [serial = 155] [outer = 0x10c656000] 16:53:16 INFO - ++DOMWINDOW == 32 (0x126f05400) [pid = 1050] [serial = 156] [outer = 0x10c656000] 16:53:16 INFO - ++DOCSHELL 0x12b952e00 == 12 [pid = 1050] [id = 63] 16:53:16 INFO - ++DOMWINDOW == 33 (0x12ac75000) [pid = 1050] [serial = 157] [outer = 0x0] 16:53:16 INFO - ++DOMWINDOW == 34 (0x12ac84400) [pid = 1050] [serial = 158] [outer = 0x12ac75000] 16:53:17 INFO - ++DOMWINDOW == 35 (0x128074000) [pid = 1050] [serial = 159] [outer = 0x1203ed800] 16:53:17 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:17 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:17 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:17 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:17 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:17 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:17 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:17 INFO - ++DOCSHELL 0x134049c00 == 13 [pid = 1050] [id = 64] 16:53:17 INFO - ++DOMWINDOW == 36 (0x12df2d800) [pid = 1050] [serial = 160] [outer = 0x0] 16:53:17 INFO - ++DOCSHELL 0x13404a100 == 14 [pid = 1050] [id = 65] 16:53:17 INFO - ++DOMWINDOW == 37 (0x12e7f7400) [pid = 1050] [serial = 161] [outer = 0x0] 16:53:17 INFO - ++DOMWINDOW == 38 (0x12e7f7c00) [pid = 1050] [serial = 162] [outer = 0x12df2d800] 16:53:17 INFO - ++DOMWINDOW == 39 (0x12eaea800) [pid = 1050] [serial = 163] [outer = 0x12e7f7400] 16:53:19 INFO - --DOCSHELL 0x12b952e00 == 13 [pid = 1050] [id = 63] 16:53:19 INFO - --DOMWINDOW == 38 (0x128f7c000) [pid = 1050] [serial = 144] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:19 INFO - --DOMWINDOW == 37 (0x11fd65400) [pid = 1050] [serial = 126] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:19 INFO - --DOMWINDOW == 36 (0x12adce000) [pid = 1050] [serial = 143] [outer = 0x0] [url = about:blank] 16:53:19 INFO - --DOMWINDOW == 35 (0x12e3c5400) [pid = 1050] [serial = 147] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:19 INFO - --DOMWINDOW == 34 (0x12e3fb800) [pid = 1050] [serial = 148] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:19 INFO - --DOCSHELL 0x134049c00 == 12 [pid = 1050] [id = 64] 16:53:19 INFO - --DOMWINDOW == 33 (0x10c6a9400) [pid = 1050] [serial = 138] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:19 INFO - --DOCSHELL 0x13404a100 == 11 [pid = 1050] [id = 65] 16:53:19 INFO - MEMORY STAT | vsize 3705MB | residentFast 332MB | heapAllocated 102MB 16:53:19 INFO - 22 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-cache.js | took 4081ms 16:53:19 INFO - ++DOCSHELL 0x11fd1f300 == 12 [pid = 1050] [id = 66] 16:53:19 INFO - ++DOMWINDOW == 34 (0x10c62bc00) [pid = 1050] [serial = 164] [outer = 0x0] 16:53:19 INFO - ++DOMWINDOW == 35 (0x10c777400) [pid = 1050] [serial = 165] [outer = 0x10c62bc00] 16:53:19 INFO - 23 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-highlight-01.js 16:53:19 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:19 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:19 INFO - ++DOCSHELL 0x128047b00 == 13 [pid = 1050] [id = 67] 16:53:19 INFO - ++DOMWINDOW == 36 (0x120396c00) [pid = 1050] [serial = 166] [outer = 0x0] 16:53:19 INFO - ++DOMWINDOW == 37 (0x120ca6000) [pid = 1050] [serial = 167] [outer = 0x120396c00] 16:53:19 INFO - --DOCSHELL 0x1281e0600 == 12 [pid = 1050] [id = 62] 16:53:19 INFO - --DOCSHELL 0x10c52f700 == 11 [pid = 1050] [id = 60] 16:53:19 INFO - --DOCSHELL 0x1281dd400 == 10 [pid = 1050] [id = 61] 16:53:20 INFO - --DOMWINDOW == 36 (0x120da0c00) [pid = 1050] [serial = 155] [outer = 0x0] [url = about:blank] 16:53:20 INFO - --DOMWINDOW == 35 (0x120510c00) [pid = 1050] [serial = 152] [outer = 0x0] [url = about:blank] 16:53:20 INFO - --DOMWINDOW == 34 (0x1203ed800) [pid = 1050] [serial = 151] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:20 INFO - --DOMWINDOW == 33 (0x10c630c00) [pid = 1050] [serial = 149] [outer = 0x0] [url = about:blank] 16:53:20 INFO - --DOMWINDOW == 32 (0x12ac75000) [pid = 1050] [serial = 157] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:20 INFO - --DOMWINDOW == 31 (0x12df2d800) [pid = 1050] [serial = 160] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:20 INFO - --DOMWINDOW == 30 (0x12e7f7400) [pid = 1050] [serial = 161] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:20 INFO - --DOMWINDOW == 29 (0x10c6b6c00) [pid = 1050] [serial = 150] [outer = 0x0] [url = about:blank] 16:53:20 INFO - --DOMWINDOW == 28 (0x120f7fc00) [pid = 1050] [serial = 139] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:20 INFO - ++DOMWINDOW == 29 (0x12bff2c00) [pid = 1050] [serial = 168] [outer = 0x120396c00] 16:53:20 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:20 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:20 INFO - ++DOCSHELL 0x130785400 == 11 [pid = 1050] [id = 68] 16:53:20 INFO - ++DOMWINDOW == 30 (0x12025ec00) [pid = 1050] [serial = 169] [outer = 0x0] 16:53:20 INFO - ++DOMWINDOW == 31 (0x120556000) [pid = 1050] [serial = 170] [outer = 0x12025ec00] 16:53:20 INFO - ++DOMWINDOW == 32 (0x1279fcc00) [pid = 1050] [serial = 171] [outer = 0x12025ec00] 16:53:20 INFO - ++DOCSHELL 0x131330400 == 12 [pid = 1050] [id = 69] 16:53:20 INFO - ++DOMWINDOW == 33 (0x12ae64800) [pid = 1050] [serial = 172] [outer = 0x0] 16:53:20 INFO - ++DOMWINDOW == 34 (0x12aec3400) [pid = 1050] [serial = 173] [outer = 0x12ae64800] 16:53:21 INFO - ++DOMWINDOW == 35 (0x1279ca800) [pid = 1050] [serial = 174] [outer = 0x120396c00] 16:53:21 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:21 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:21 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:21 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:21 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:21 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:21 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:21 INFO - ++DOCSHELL 0x128f5b500 == 13 [pid = 1050] [id = 70] 16:53:21 INFO - ++DOMWINDOW == 36 (0x129906c00) [pid = 1050] [serial = 175] [outer = 0x0] 16:53:21 INFO - ++DOCSHELL 0x128f5ba00 == 14 [pid = 1050] [id = 71] 16:53:21 INFO - ++DOMWINDOW == 37 (0x1305f0c00) [pid = 1050] [serial = 176] [outer = 0x0] 16:53:21 INFO - ++DOMWINDOW == 38 (0x1305fb400) [pid = 1050] [serial = 177] [outer = 0x129906c00] 16:53:21 INFO - ++DOMWINDOW == 39 (0x1305fb800) [pid = 1050] [serial = 178] [outer = 0x1305f0c00] 16:53:24 INFO - --DOCSHELL 0x131330400 == 13 [pid = 1050] [id = 69] 16:53:24 INFO - --DOCSHELL 0x128f5b500 == 12 [pid = 1050] [id = 70] 16:53:24 INFO - --DOCSHELL 0x128f5ba00 == 11 [pid = 1050] [id = 71] 16:53:24 INFO - --DOMWINDOW == 38 (0x1277d7400) [pid = 1050] [serial = 141] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:24 INFO - --DOMWINDOW == 37 (0x12ac84400) [pid = 1050] [serial = 158] [outer = 0x0] [url = about:blank] 16:53:24 INFO - --DOMWINDOW == 36 (0x12e7f7c00) [pid = 1050] [serial = 162] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:24 INFO - --DOMWINDOW == 35 (0x12eaea800) [pid = 1050] [serial = 163] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:24 INFO - --DOMWINDOW == 34 (0x12c03b000) [pid = 1050] [serial = 153] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:24 INFO - --DOMWINDOW == 33 (0x128074000) [pid = 1050] [serial = 159] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:24 INFO - MEMORY STAT | vsize 3707MB | residentFast 334MB | heapAllocated 102MB 16:53:24 INFO - 24 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-highlight-01.js | took 5301ms 16:53:24 INFO - ++DOCSHELL 0x10c52f200 == 12 [pid = 1050] [id = 72] 16:53:24 INFO - ++DOMWINDOW == 34 (0x11fd24c00) [pid = 1050] [serial = 179] [outer = 0x0] 16:53:24 INFO - ++DOMWINDOW == 35 (0x11fe3c800) [pid = 1050] [serial = 180] [outer = 0x11fd24c00] 16:53:24 INFO - 25 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-highlight-02.js 16:53:24 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:24 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:24 INFO - ++DOCSHELL 0x1281dd900 == 13 [pid = 1050] [id = 73] 16:53:24 INFO - ++DOMWINDOW == 36 (0x120c83400) [pid = 1050] [serial = 181] [outer = 0x0] 16:53:24 INFO - ++DOMWINDOW == 37 (0x120d38800) [pid = 1050] [serial = 182] [outer = 0x120c83400] 16:53:25 INFO - --DOCSHELL 0x128047b00 == 12 [pid = 1050] [id = 67] 16:53:25 INFO - --DOCSHELL 0x130785400 == 11 [pid = 1050] [id = 68] 16:53:25 INFO - --DOCSHELL 0x11fd1f300 == 10 [pid = 1050] [id = 66] 16:53:25 INFO - --DOMWINDOW == 36 (0x120556000) [pid = 1050] [serial = 170] [outer = 0x0] [url = about:blank] 16:53:25 INFO - --DOMWINDOW == 35 (0x120ca6000) [pid = 1050] [serial = 167] [outer = 0x0] [url = about:blank] 16:53:25 INFO - --DOMWINDOW == 34 (0x10c62bc00) [pid = 1050] [serial = 164] [outer = 0x0] [url = about:blank] 16:53:25 INFO - --DOMWINDOW == 33 (0x10c777400) [pid = 1050] [serial = 165] [outer = 0x0] [url = about:blank] 16:53:25 INFO - --DOMWINDOW == 32 (0x1305f0c00) [pid = 1050] [serial = 176] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:25 INFO - --DOMWINDOW == 31 (0x129906c00) [pid = 1050] [serial = 175] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:25 INFO - --DOMWINDOW == 30 (0x12ae64800) [pid = 1050] [serial = 172] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:25 INFO - --DOMWINDOW == 29 (0x120396c00) [pid = 1050] [serial = 166] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:25 INFO - --DOMWINDOW == 28 (0x10c656000) [pid = 1050] [serial = 154] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:25 INFO - ++DOMWINDOW == 29 (0x12bfda400) [pid = 1050] [serial = 183] [outer = 0x120c83400] 16:53:25 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:25 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:25 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:25 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:25 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:26 INFO - ++DOCSHELL 0x128f5d300 == 11 [pid = 1050] [id = 74] 16:53:26 INFO - ++DOMWINDOW == 30 (0x10c630c00) [pid = 1050] [serial = 184] [outer = 0x0] 16:53:26 INFO - ++DOMWINDOW == 31 (0x120396c00) [pid = 1050] [serial = 185] [outer = 0x10c630c00] 16:53:26 INFO - ++DOMWINDOW == 32 (0x120fb4000) [pid = 1050] [serial = 186] [outer = 0x10c630c00] 16:53:26 INFO - ++DOCSHELL 0x129a77300 == 12 [pid = 1050] [id = 75] 16:53:26 INFO - ++DOMWINDOW == 33 (0x12a137400) [pid = 1050] [serial = 187] [outer = 0x0] 16:53:26 INFO - ++DOMWINDOW == 34 (0x12a137800) [pid = 1050] [serial = 188] [outer = 0x12a137400] 16:53:26 INFO - ++DOMWINDOW == 35 (0x127989800) [pid = 1050] [serial = 189] [outer = 0x120c83400] 16:53:26 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:27 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:27 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:27 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:27 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:27 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:27 INFO - ++DOCSHELL 0x12eee9800 == 13 [pid = 1050] [id = 76] 16:53:27 INFO - ++DOMWINDOW == 36 (0x12c7fd400) [pid = 1050] [serial = 190] [outer = 0x0] 16:53:27 INFO - ++DOCSHELL 0x130444500 == 14 [pid = 1050] [id = 77] 16:53:27 INFO - ++DOMWINDOW == 37 (0x12cc19400) [pid = 1050] [serial = 191] [outer = 0x0] 16:53:27 INFO - ++DOMWINDOW == 38 (0x12cca2000) [pid = 1050] [serial = 192] [outer = 0x12c7fd400] 16:53:27 INFO - ++DOMWINDOW == 39 (0x12ccc3000) [pid = 1050] [serial = 193] [outer = 0x12cc19400] 16:53:29 INFO - --DOCSHELL 0x129a77300 == 13 [pid = 1050] [id = 75] 16:53:29 INFO - --DOCSHELL 0x12eee9800 == 12 [pid = 1050] [id = 76] 16:53:29 INFO - --DOCSHELL 0x130444500 == 11 [pid = 1050] [id = 77] 16:53:29 INFO - --DOMWINDOW == 38 (0x126f05400) [pid = 1050] [serial = 156] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:29 INFO - --DOMWINDOW == 37 (0x12aec3400) [pid = 1050] [serial = 173] [outer = 0x0] [url = about:blank] 16:53:29 INFO - --DOMWINDOW == 36 (0x1305fb400) [pid = 1050] [serial = 177] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:29 INFO - --DOMWINDOW == 35 (0x1305fb800) [pid = 1050] [serial = 178] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:29 INFO - --DOMWINDOW == 34 (0x12bff2c00) [pid = 1050] [serial = 168] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:29 INFO - --DOMWINDOW == 33 (0x1279ca800) [pid = 1050] [serial = 174] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:29 INFO - MEMORY STAT | vsize 3702MB | residentFast 331MB | heapAllocated 101MB 16:53:29 INFO - 26 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-highlight-02.js | took 4761ms 16:53:29 INFO - ++DOCSHELL 0x11fe35100 == 12 [pid = 1050] [id = 78] 16:53:29 INFO - ++DOMWINDOW == 34 (0x10c777400) [pid = 1050] [serial = 194] [outer = 0x0] 16:53:29 INFO - ++DOMWINDOW == 35 (0x11fd34800) [pid = 1050] [serial = 195] [outer = 0x10c777400] 16:53:29 INFO - 27 INFO TEST-START | devtools/client/shadereditor/test/browser_se_programs-list.js 16:53:29 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:29 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:29 INFO - ++DOCSHELL 0x12802b000 == 13 [pid = 1050] [id = 79] 16:53:29 INFO - ++DOMWINDOW == 36 (0x1203ed800) [pid = 1050] [serial = 196] [outer = 0x0] 16:53:29 INFO - ++DOMWINDOW == 37 (0x12053d400) [pid = 1050] [serial = 197] [outer = 0x1203ed800] 16:53:30 INFO - --DOCSHELL 0x128f5d300 == 12 [pid = 1050] [id = 74] 16:53:30 INFO - --DOCSHELL 0x1281dd900 == 11 [pid = 1050] [id = 73] 16:53:30 INFO - --DOCSHELL 0x10c52f200 == 10 [pid = 1050] [id = 72] 16:53:30 INFO - --DOMWINDOW == 36 (0x120c83400) [pid = 1050] [serial = 181] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:30 INFO - --DOMWINDOW == 35 (0x12a137400) [pid = 1050] [serial = 187] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:30 INFO - --DOMWINDOW == 34 (0x12cc19400) [pid = 1050] [serial = 191] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:30 INFO - --DOMWINDOW == 33 (0x12c7fd400) [pid = 1050] [serial = 190] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:30 INFO - --DOMWINDOW == 32 (0x11fd24c00) [pid = 1050] [serial = 179] [outer = 0x0] [url = about:blank] 16:53:30 INFO - --DOMWINDOW == 31 (0x11fe3c800) [pid = 1050] [serial = 180] [outer = 0x0] [url = about:blank] 16:53:30 INFO - --DOMWINDOW == 30 (0x120d38800) [pid = 1050] [serial = 182] [outer = 0x0] [url = about:blank] 16:53:30 INFO - --DOMWINDOW == 29 (0x120396c00) [pid = 1050] [serial = 185] [outer = 0x0] [url = about:blank] 16:53:30 INFO - --DOMWINDOW == 28 (0x12025ec00) [pid = 1050] [serial = 169] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:30 INFO - ++DOMWINDOW == 29 (0x129cc4c00) [pid = 1050] [serial = 198] [outer = 0x1203ed800] 16:53:30 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:30 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:30 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:30 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:30 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:30 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:31 INFO - ++DOCSHELL 0x129f1b600 == 11 [pid = 1050] [id = 80] 16:53:31 INFO - ++DOMWINDOW == 30 (0x12040f400) [pid = 1050] [serial = 199] [outer = 0x0] 16:53:31 INFO - ++DOMWINDOW == 31 (0x126e85800) [pid = 1050] [serial = 200] [outer = 0x12040f400] 16:53:31 INFO - ++DOMWINDOW == 32 (0x126f05400) [pid = 1050] [serial = 201] [outer = 0x12040f400] 16:53:31 INFO - ++DOCSHELL 0x12d4b5800 == 12 [pid = 1050] [id = 81] 16:53:31 INFO - ++DOMWINDOW == 33 (0x12a323800) [pid = 1050] [serial = 202] [outer = 0x0] 16:53:31 INFO - ++DOMWINDOW == 34 (0x12a323c00) [pid = 1050] [serial = 203] [outer = 0x12a323800] 16:53:32 INFO - ++DOMWINDOW == 35 (0x12a1f2c00) [pid = 1050] [serial = 204] [outer = 0x1203ed800] 16:53:32 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:32 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:32 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:32 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:32 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:32 INFO - ++DOCSHELL 0x1337f5800 == 13 [pid = 1050] [id = 82] 16:53:32 INFO - ++DOMWINDOW == 36 (0x1305fbc00) [pid = 1050] [serial = 205] [outer = 0x0] 16:53:32 INFO - ++DOCSHELL 0x1337f4900 == 14 [pid = 1050] [id = 83] 16:53:32 INFO - ++DOMWINDOW == 37 (0x133107000) [pid = 1050] [serial = 206] [outer = 0x0] 16:53:32 INFO - ++DOMWINDOW == 38 (0x133197400) [pid = 1050] [serial = 207] [outer = 0x1305fbc00] 16:53:32 INFO - ++DOMWINDOW == 39 (0x133197800) [pid = 1050] [serial = 208] [outer = 0x133107000] 16:53:34 INFO - --DOCSHELL 0x12d4b5800 == 13 [pid = 1050] [id = 81] 16:53:34 INFO - --DOCSHELL 0x1337f5800 == 12 [pid = 1050] [id = 82] 16:53:34 INFO - --DOCSHELL 0x1337f4900 == 11 [pid = 1050] [id = 83] 16:53:34 INFO - --DOMWINDOW == 38 (0x127989800) [pid = 1050] [serial = 189] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:34 INFO - --DOMWINDOW == 37 (0x12ccc3000) [pid = 1050] [serial = 193] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:34 INFO - --DOMWINDOW == 36 (0x12cca2000) [pid = 1050] [serial = 192] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:34 INFO - --DOMWINDOW == 35 (0x12a137800) [pid = 1050] [serial = 188] [outer = 0x0] [url = about:blank] 16:53:34 INFO - --DOMWINDOW == 34 (0x1279fcc00) [pid = 1050] [serial = 171] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:34 INFO - --DOMWINDOW == 33 (0x12bfda400) [pid = 1050] [serial = 183] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_blended-geometry.html] 16:53:34 INFO - MEMORY STAT | vsize 3708MB | residentFast 337MB | heapAllocated 105MB 16:53:34 INFO - 28 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_programs-list.js | took 4708ms 16:53:34 INFO - ++DOCSHELL 0x11fd1e900 == 12 [pid = 1050] [id = 84] 16:53:34 INFO - ++DOMWINDOW == 34 (0x10c6a9400) [pid = 1050] [serial = 209] [outer = 0x0] 16:53:34 INFO - ++DOMWINDOW == 35 (0x10c777c00) [pid = 1050] [serial = 210] [outer = 0x10c6a9400] 16:53:34 INFO - 29 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-01.js 16:53:34 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:34 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:34 INFO - ++DOCSHELL 0x128044e00 == 13 [pid = 1050] [id = 85] 16:53:34 INFO - ++DOMWINDOW == 36 (0x120321800) [pid = 1050] [serial = 211] [outer = 0x0] 16:53:34 INFO - ++DOMWINDOW == 37 (0x120376400) [pid = 1050] [serial = 212] [outer = 0x120321800] 16:53:35 INFO - --DOCSHELL 0x11fe35100 == 12 [pid = 1050] [id = 78] 16:53:35 INFO - --DOCSHELL 0x12802b000 == 11 [pid = 1050] [id = 79] 16:53:35 INFO - --DOCSHELL 0x129f1b600 == 10 [pid = 1050] [id = 80] 16:53:35 INFO - --DOMWINDOW == 36 (0x133107000) [pid = 1050] [serial = 206] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:35 INFO - --DOMWINDOW == 35 (0x1305fbc00) [pid = 1050] [serial = 205] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:35 INFO - --DOMWINDOW == 34 (0x12a323800) [pid = 1050] [serial = 202] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:35 INFO - --DOMWINDOW == 33 (0x10c777400) [pid = 1050] [serial = 194] [outer = 0x0] [url = about:blank] 16:53:35 INFO - --DOMWINDOW == 32 (0x11fd34800) [pid = 1050] [serial = 195] [outer = 0x0] [url = about:blank] 16:53:35 INFO - --DOMWINDOW == 31 (0x126e85800) [pid = 1050] [serial = 200] [outer = 0x0] [url = about:blank] 16:53:35 INFO - --DOMWINDOW == 30 (0x12053d400) [pid = 1050] [serial = 197] [outer = 0x0] [url = about:blank] 16:53:35 INFO - --DOMWINDOW == 29 (0x1203ed800) [pid = 1050] [serial = 196] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:35 INFO - --DOMWINDOW == 28 (0x10c630c00) [pid = 1050] [serial = 184] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:35 INFO - ++DOMWINDOW == 29 (0x12eb75c00) [pid = 1050] [serial = 213] [outer = 0x120321800] 16:53:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:35 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:35 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:35 INFO - ++DOCSHELL 0x129a60900 == 11 [pid = 1050] [id = 86] 16:53:35 INFO - ++DOMWINDOW == 30 (0x120345c00) [pid = 1050] [serial = 214] [outer = 0x0] 16:53:35 INFO - ++DOMWINDOW == 31 (0x120d6c800) [pid = 1050] [serial = 215] [outer = 0x120345c00] 16:53:36 INFO - ++DOMWINDOW == 32 (0x120ddc800) [pid = 1050] [serial = 216] [outer = 0x120345c00] 16:53:36 INFO - ++DOCSHELL 0x12a102000 == 12 [pid = 1050] [id = 87] 16:53:36 INFO - ++DOMWINDOW == 33 (0x12a3e6800) [pid = 1050] [serial = 217] [outer = 0x0] 16:53:36 INFO - ++DOMWINDOW == 34 (0x12ac74000) [pid = 1050] [serial = 218] [outer = 0x12a3e6800] 16:53:36 INFO - ++DOMWINDOW == 35 (0x1276e9c00) [pid = 1050] [serial = 219] [outer = 0x120321800] 16:53:36 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:36 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:36 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:37 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:37 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:37 INFO - ++DOCSHELL 0x132829500 == 13 [pid = 1050] [id = 88] 16:53:37 INFO - ++DOMWINDOW == 36 (0x12c733400) [pid = 1050] [serial = 220] [outer = 0x0] 16:53:37 INFO - ++DOCSHELL 0x133185f00 == 14 [pid = 1050] [id = 89] 16:53:37 INFO - ++DOMWINDOW == 37 (0x12ee46000) [pid = 1050] [serial = 221] [outer = 0x0] 16:53:37 INFO - ++DOMWINDOW == 38 (0x12ee46400) [pid = 1050] [serial = 222] [outer = 0x12c733400] 16:53:37 INFO - ++DOMWINDOW == 39 (0x12ee46800) [pid = 1050] [serial = 223] [outer = 0x12ee46000] 16:53:40 INFO - --DOCSHELL 0x128044e00 == 13 [pid = 1050] [id = 85] 16:53:40 INFO - --DOCSHELL 0x129a60900 == 12 [pid = 1050] [id = 86] 16:53:40 INFO - --DOCSHELL 0x12a102000 == 11 [pid = 1050] [id = 87] 16:53:40 INFO - --DOCSHELL 0x132829500 == 10 [pid = 1050] [id = 88] 16:53:40 INFO - --DOCSHELL 0x133185f00 == 9 [pid = 1050] [id = 89] 16:53:40 INFO - --DOMWINDOW == 38 (0x120fb4000) [pid = 1050] [serial = 186] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:40 INFO - --DOMWINDOW == 37 (0x12a323c00) [pid = 1050] [serial = 203] [outer = 0x0] [url = about:blank] 16:53:40 INFO - --DOMWINDOW == 36 (0x133197400) [pid = 1050] [serial = 207] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:40 INFO - --DOMWINDOW == 35 (0x133197800) [pid = 1050] [serial = 208] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:40 INFO - --DOMWINDOW == 34 (0x129cc4c00) [pid = 1050] [serial = 198] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:40 INFO - --DOMWINDOW == 33 (0x12a1f2c00) [pid = 1050] [serial = 204] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:40 INFO - MEMORY STAT | vsize 3719MB | residentFast 327MB | heapAllocated 99MB 16:53:40 INFO - 30 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-01.js | took 6084ms 16:53:40 INFO - ++DOCSHELL 0x10c7a6500 == 10 [pid = 1050] [id = 90] 16:53:40 INFO - ++DOMWINDOW == 34 (0x10c656c00) [pid = 1050] [serial = 224] [outer = 0x0] 16:53:40 INFO - ++DOMWINDOW == 35 (0x10c7ff400) [pid = 1050] [serial = 225] [outer = 0x10c656c00] 16:53:40 INFO - 31 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-02.js 16:53:40 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:40 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:40 INFO - ++DOCSHELL 0x1281e0600 == 11 [pid = 1050] [id = 91] 16:53:40 INFO - ++DOMWINDOW == 36 (0x12040f000) [pid = 1050] [serial = 226] [outer = 0x0] 16:53:40 INFO - ++DOMWINDOW == 37 (0x120cb5400) [pid = 1050] [serial = 227] [outer = 0x12040f000] 16:53:41 INFO - --DOCSHELL 0x11fd1e900 == 10 [pid = 1050] [id = 84] 16:53:41 INFO - --DOMWINDOW == 36 (0x12a3e6800) [pid = 1050] [serial = 217] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:41 INFO - --DOMWINDOW == 35 (0x120321800) [pid = 1050] [serial = 211] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:41 INFO - --DOMWINDOW == 34 (0x12040f400) [pid = 1050] [serial = 199] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:41 INFO - --DOMWINDOW == 33 (0x12ee46000) [pid = 1050] [serial = 221] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:41 INFO - --DOMWINDOW == 32 (0x12c733400) [pid = 1050] [serial = 220] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:41 INFO - --DOMWINDOW == 31 (0x120d6c800) [pid = 1050] [serial = 215] [outer = 0x0] [url = about:blank] 16:53:41 INFO - --DOMWINDOW == 30 (0x10c6a9400) [pid = 1050] [serial = 209] [outer = 0x0] [url = about:blank] 16:53:41 INFO - --DOMWINDOW == 29 (0x10c777c00) [pid = 1050] [serial = 210] [outer = 0x0] [url = about:blank] 16:53:41 INFO - --DOMWINDOW == 28 (0x120376400) [pid = 1050] [serial = 212] [outer = 0x0] [url = about:blank] 16:53:41 INFO - ++DOMWINDOW == 29 (0x10c777400) [pid = 1050] [serial = 228] [outer = 0x12040f000] 16:53:41 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:41 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:41 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:41 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:42 INFO - ++DOCSHELL 0x128f5c400 == 11 [pid = 1050] [id = 92] 16:53:42 INFO - ++DOMWINDOW == 30 (0x120c83400) [pid = 1050] [serial = 229] [outer = 0x0] 16:53:42 INFO - ++DOMWINDOW == 31 (0x120d38c00) [pid = 1050] [serial = 230] [outer = 0x120c83400] 16:53:42 INFO - ++DOMWINDOW == 32 (0x120da7000) [pid = 1050] [serial = 231] [outer = 0x120c83400] 16:53:42 INFO - ++DOCSHELL 0x129a5f000 == 12 [pid = 1050] [id = 93] 16:53:42 INFO - ++DOMWINDOW == 33 (0x129a18400) [pid = 1050] [serial = 232] [outer = 0x0] 16:53:42 INFO - ++DOMWINDOW == 34 (0x129a3e000) [pid = 1050] [serial = 233] [outer = 0x129a18400] 16:53:43 INFO - ++DOMWINDOW == 35 (0x1224d0c00) [pid = 1050] [serial = 234] [outer = 0x12040f000] 16:53:43 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:43 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:43 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:43 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:43 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:43 INFO - ++DOCSHELL 0x12d4b6c00 == 13 [pid = 1050] [id = 94] 16:53:43 INFO - ++DOMWINDOW == 36 (0x12c166400) [pid = 1050] [serial = 235] [outer = 0x0] 16:53:43 INFO - ++DOCSHELL 0x12eeea700 == 14 [pid = 1050] [id = 95] 16:53:43 INFO - ++DOMWINDOW == 37 (0x12c1c0800) [pid = 1050] [serial = 236] [outer = 0x0] 16:53:43 INFO - ++DOMWINDOW == 38 (0x12c1c3000) [pid = 1050] [serial = 237] [outer = 0x12c166400] 16:53:43 INFO - ++DOMWINDOW == 39 (0x12c1c3400) [pid = 1050] [serial = 238] [outer = 0x12c1c0800] 16:53:44 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:53:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:53:44 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:53:45 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 16:53:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:53:45 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:53:47 INFO - --DOCSHELL 0x1281e0600 == 13 [pid = 1050] [id = 91] 16:53:47 INFO - --DOCSHELL 0x128f5c400 == 12 [pid = 1050] [id = 92] 16:53:47 INFO - --DOCSHELL 0x129a5f000 == 11 [pid = 1050] [id = 93] 16:53:47 INFO - --DOCSHELL 0x12d4b6c00 == 10 [pid = 1050] [id = 94] 16:53:47 INFO - --DOCSHELL 0x12eeea700 == 9 [pid = 1050] [id = 95] 16:53:47 INFO - --DOMWINDOW == 38 (0x126f05400) [pid = 1050] [serial = 201] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:47 INFO - --DOMWINDOW == 37 (0x12ac74000) [pid = 1050] [serial = 218] [outer = 0x0] [url = about:blank] 16:53:47 INFO - --DOMWINDOW == 36 (0x12ee46400) [pid = 1050] [serial = 222] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:47 INFO - --DOMWINDOW == 35 (0x12ee46800) [pid = 1050] [serial = 223] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:47 INFO - --DOMWINDOW == 34 (0x12eb75c00) [pid = 1050] [serial = 213] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:47 INFO - --DOMWINDOW == 33 (0x1276e9c00) [pid = 1050] [serial = 219] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:47 INFO - MEMORY STAT | vsize 3720MB | residentFast 325MB | heapAllocated 98MB 16:53:47 INFO - 32 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-02.js | took 6591ms 16:53:47 INFO - ++DOCSHELL 0x11fd21b00 == 10 [pid = 1050] [id = 96] 16:53:47 INFO - ++DOMWINDOW == 34 (0x10c6a9400) [pid = 1050] [serial = 239] [outer = 0x0] 16:53:47 INFO - ++DOMWINDOW == 35 (0x10c7d4800) [pid = 1050] [serial = 240] [outer = 0x10c6a9400] 16:53:47 INFO - 33 INFO TEST-START | devtools/client/shadereditor/test/browser_se_shaders-edit-03.js 16:53:47 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:47 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:47 INFO - ++DOCSHELL 0x1281ded00 == 11 [pid = 1050] [id = 97] 16:53:47 INFO - ++DOMWINDOW == 36 (0x120345400) [pid = 1050] [serial = 241] [outer = 0x0] 16:53:47 INFO - ++DOMWINDOW == 37 (0x1204f8800) [pid = 1050] [serial = 242] [outer = 0x120345400] 16:53:48 INFO - --DOCSHELL 0x10c7a6500 == 10 [pid = 1050] [id = 90] 16:53:48 INFO - --DOMWINDOW == 36 (0x12040f000) [pid = 1050] [serial = 226] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:48 INFO - --DOMWINDOW == 35 (0x10c656c00) [pid = 1050] [serial = 224] [outer = 0x0] [url = about:blank] 16:53:48 INFO - --DOMWINDOW == 34 (0x10c7ff400) [pid = 1050] [serial = 225] [outer = 0x0] [url = about:blank] 16:53:48 INFO - --DOMWINDOW == 33 (0x120d38c00) [pid = 1050] [serial = 230] [outer = 0x0] [url = about:blank] 16:53:48 INFO - --DOMWINDOW == 32 (0x120cb5400) [pid = 1050] [serial = 227] [outer = 0x0] [url = about:blank] 16:53:48 INFO - --DOMWINDOW == 31 (0x120345c00) [pid = 1050] [serial = 214] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:48 INFO - --DOMWINDOW == 30 (0x12c166400) [pid = 1050] [serial = 235] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:48 INFO - --DOMWINDOW == 29 (0x12c1c0800) [pid = 1050] [serial = 236] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:48 INFO - --DOMWINDOW == 28 (0x129a18400) [pid = 1050] [serial = 232] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:48 INFO - ++DOMWINDOW == 29 (0x12acd6400) [pid = 1050] [serial = 243] [outer = 0x120345400] 16:53:48 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:48 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:48 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:48 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:48 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:48 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:48 INFO - ++DOCSHELL 0x12d509600 == 11 [pid = 1050] [id = 98] 16:53:48 INFO - ++DOMWINDOW == 30 (0x120134000) [pid = 1050] [serial = 244] [outer = 0x0] 16:53:48 INFO - ++DOMWINDOW == 31 (0x120510c00) [pid = 1050] [serial = 245] [outer = 0x120134000] 16:53:48 INFO - ++DOMWINDOW == 32 (0x122470000) [pid = 1050] [serial = 246] [outer = 0x120134000] 16:53:48 INFO - ++DOCSHELL 0x130445400 == 12 [pid = 1050] [id = 99] 16:53:48 INFO - ++DOMWINDOW == 33 (0x129eb6800) [pid = 1050] [serial = 247] [outer = 0x0] 16:53:48 INFO - ++DOMWINDOW == 34 (0x129ecf800) [pid = 1050] [serial = 248] [outer = 0x129eb6800] 16:53:49 INFO - ++DOMWINDOW == 35 (0x12241a000) [pid = 1050] [serial = 249] [outer = 0x120345400] 16:53:49 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:49 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:49 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:49 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:49 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:49 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:49 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:50 INFO - ++DOCSHELL 0x132f16e00 == 13 [pid = 1050] [id = 100] 16:53:50 INFO - ++DOMWINDOW == 36 (0x12c7a0c00) [pid = 1050] [serial = 250] [outer = 0x0] 16:53:50 INFO - ++DOCSHELL 0x135fc0700 == 14 [pid = 1050] [id = 101] 16:53:50 INFO - ++DOMWINDOW == 37 (0x12ca44800) [pid = 1050] [serial = 251] [outer = 0x0] 16:53:50 INFO - ++DOMWINDOW == 38 (0x12ca44c00) [pid = 1050] [serial = 252] [outer = 0x12c7a0c00] 16:53:50 INFO - ++DOMWINDOW == 39 (0x12cca2000) [pid = 1050] [serial = 253] [outer = 0x12ca44800] 16:53:53 INFO - --DOCSHELL 0x1281ded00 == 13 [pid = 1050] [id = 97] 16:53:53 INFO - --DOCSHELL 0x12d509600 == 12 [pid = 1050] [id = 98] 16:53:53 INFO - --DOCSHELL 0x130445400 == 11 [pid = 1050] [id = 99] 16:53:53 INFO - --DOCSHELL 0x132f16e00 == 10 [pid = 1050] [id = 100] 16:53:53 INFO - --DOCSHELL 0x135fc0700 == 9 [pid = 1050] [id = 101] 16:53:53 INFO - --DOMWINDOW == 38 (0x120ddc800) [pid = 1050] [serial = 216] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:53 INFO - --DOMWINDOW == 37 (0x129a3e000) [pid = 1050] [serial = 233] [outer = 0x0] [url = about:blank] 16:53:53 INFO - --DOMWINDOW == 36 (0x12c1c3000) [pid = 1050] [serial = 237] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:53 INFO - --DOMWINDOW == 35 (0x12c1c3400) [pid = 1050] [serial = 238] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:53 INFO - --DOMWINDOW == 34 (0x10c777400) [pid = 1050] [serial = 228] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:53 INFO - --DOMWINDOW == 33 (0x1224d0c00) [pid = 1050] [serial = 234] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:53:53 INFO - MEMORY STAT | vsize 3707MB | residentFast 325MB | heapAllocated 103MB 16:53:53 INFO - 34 INFO TEST-OK | devtools/client/shadereditor/test/browser_se_shaders-edit-03.js | took 5596ms 16:53:53 INFO - ++DOCSHELL 0x1202d6c00 == 10 [pid = 1050] [id = 102] 16:53:53 INFO - ++DOMWINDOW == 34 (0x10c630c00) [pid = 1050] [serial = 254] [outer = 0x0] 16:53:53 INFO - ++DOMWINDOW == 35 (0x10c6b6c00) [pid = 1050] [serial = 255] [outer = 0x10c630c00] 16:53:53 INFO - 35 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-01.js 16:53:53 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:53 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:53 INFO - ++DOCSHELL 0x129a77300 == 11 [pid = 1050] [id = 103] 16:53:53 INFO - ++DOMWINDOW == 36 (0x12025ec00) [pid = 1050] [serial = 256] [outer = 0x0] 16:53:53 INFO - ++DOMWINDOW == 37 (0x1202ad400) [pid = 1050] [serial = 257] [outer = 0x12025ec00] 16:53:54 INFO - --DOCSHELL 0x11fd21b00 == 10 [pid = 1050] [id = 96] 16:53:54 INFO - --DOMWINDOW == 36 (0x120345400) [pid = 1050] [serial = 241] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:54 INFO - --DOMWINDOW == 35 (0x120510c00) [pid = 1050] [serial = 245] [outer = 0x0] [url = about:blank] 16:53:54 INFO - --DOMWINDOW == 34 (0x12c7a0c00) [pid = 1050] [serial = 250] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:54 INFO - --DOMWINDOW == 33 (0x120c83400) [pid = 1050] [serial = 229] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:54 INFO - --DOMWINDOW == 32 (0x10c6a9400) [pid = 1050] [serial = 239] [outer = 0x0] [url = about:blank] 16:53:54 INFO - --DOMWINDOW == 31 (0x12ca44800) [pid = 1050] [serial = 251] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:54 INFO - --DOMWINDOW == 30 (0x1204f8800) [pid = 1050] [serial = 242] [outer = 0x0] [url = about:blank] 16:53:54 INFO - --DOMWINDOW == 29 (0x10c7d4800) [pid = 1050] [serial = 240] [outer = 0x0] [url = about:blank] 16:53:54 INFO - --DOMWINDOW == 28 (0x129eb6800) [pid = 1050] [serial = 247] [outer = 0x0] [url = chrome://devtools/content/shadereditor/shadereditor.xul] 16:53:54 INFO - ++DOMWINDOW == 29 (0x12c1ec800) [pid = 1050] [serial = 258] [outer = 0x12025ec00] 16:53:54 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:54 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:54 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:54 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - MEMORY STAT | vsize 3725MB | residentFast 326MB | heapAllocated 101MB 16:53:55 INFO - 36 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-01.js | took 1891ms 16:53:55 INFO - ++DOCSHELL 0x1202d6700 == 11 [pid = 1050] [id = 104] 16:53:55 INFO - ++DOMWINDOW == 30 (0x10c656000) [pid = 1050] [serial = 259] [outer = 0x0] 16:53:55 INFO - ++DOMWINDOW == 31 (0x10c7a5c00) [pid = 1050] [serial = 260] [outer = 0x10c656000] 16:53:55 INFO - --DOMWINDOW == 30 (0x120da7000) [pid = 1050] [serial = 231] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:53:55 INFO - --DOMWINDOW == 29 (0x12241a000) [pid = 1050] [serial = 249] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:55 INFO - --DOMWINDOW == 28 (0x12acd6400) [pid = 1050] [serial = 243] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:53:55 INFO - --DOMWINDOW == 27 (0x12ca44c00) [pid = 1050] [serial = 252] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:55 INFO - --DOMWINDOW == 26 (0x12cca2000) [pid = 1050] [serial = 253] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:53:55 INFO - --DOMWINDOW == 25 (0x129ecf800) [pid = 1050] [serial = 248] [outer = 0x0] [url = about:blank] 16:53:55 INFO - 37 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-02.js 16:53:55 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - ++DOCSHELL 0x128f5b500 == 12 [pid = 1050] [id = 105] 16:53:55 INFO - ++DOMWINDOW == 26 (0x12040f000) [pid = 1050] [serial = 261] [outer = 0x0] 16:53:55 INFO - ++DOMWINDOW == 27 (0x12053d400) [pid = 1050] [serial = 262] [outer = 0x12040f000] 16:53:55 INFO - ++DOMWINDOW == 28 (0x12aff5800) [pid = 1050] [serial = 263] [outer = 0x12040f000] 16:53:55 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:55 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:55 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - ++DOMWINDOW == 29 (0x126e85800) [pid = 1050] [serial = 264] [outer = 0x12040f000] 16:53:55 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:55 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:55 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:55 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:55 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:56 INFO - --DOCSHELL 0x129a77300 == 11 [pid = 1050] [id = 103] 16:53:56 INFO - --DOCSHELL 0x1202d6c00 == 10 [pid = 1050] [id = 102] 16:53:56 INFO - MEMORY STAT | vsize 3741MB | residentFast 327MB | heapAllocated 100MB 16:53:56 INFO - 38 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-02.js | took 1426ms 16:53:56 INFO - ++DOCSHELL 0x1202d6c00 == 11 [pid = 1050] [id = 106] 16:53:56 INFO - ++DOMWINDOW == 30 (0x11fe5e800) [pid = 1050] [serial = 265] [outer = 0x0] 16:53:56 INFO - ++DOMWINDOW == 31 (0x1204f8800) [pid = 1050] [serial = 266] [outer = 0x11fe5e800] 16:53:56 INFO - 39 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-03.js 16:53:56 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:56 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:57 INFO - ++DOCSHELL 0x132829f00 == 12 [pid = 1050] [id = 107] 16:53:57 INFO - ++DOMWINDOW == 32 (0x126f21400) [pid = 1050] [serial = 267] [outer = 0x0] 16:53:57 INFO - ++DOMWINDOW == 33 (0x1279ca800) [pid = 1050] [serial = 268] [outer = 0x126f21400] 16:53:57 INFO - ++DOMWINDOW == 34 (0x12cd74c00) [pid = 1050] [serial = 269] [outer = 0x126f21400] 16:53:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:57 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:57 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:57 INFO - ++DOMWINDOW == 35 (0x129a88400) [pid = 1050] [serial = 270] [outer = 0x126f21400] 16:53:57 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:57 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:57 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:57 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:58 INFO - MEMORY STAT | vsize 3773MB | residentFast 333MB | heapAllocated 107MB 16:53:58 INFO - 40 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-03.js | took 1571ms 16:53:58 INFO - ++DOCSHELL 0x10c52fc00 == 13 [pid = 1050] [id = 108] 16:53:58 INFO - ++DOMWINDOW == 36 (0x1200e3000) [pid = 1050] [serial = 271] [outer = 0x0] 16:53:58 INFO - ++DOMWINDOW == 37 (0x120396c00) [pid = 1050] [serial = 272] [outer = 0x1200e3000] 16:53:58 INFO - 41 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-04.js 16:53:58 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:58 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:58 INFO - ++DOCSHELL 0x136b55700 == 14 [pid = 1050] [id = 109] 16:53:58 INFO - ++DOMWINDOW == 38 (0x128a47400) [pid = 1050] [serial = 273] [outer = 0x0] 16:53:58 INFO - ++DOMWINDOW == 39 (0x128b31400) [pid = 1050] [serial = 274] [outer = 0x128a47400] 16:53:58 INFO - ++DOMWINDOW == 40 (0x12eea2400) [pid = 1050] [serial = 275] [outer = 0x128a47400] 16:53:59 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:59 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:59 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:59 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:59 INFO - ++DOMWINDOW == 41 (0x12a3ac000) [pid = 1050] [serial = 276] [outer = 0x128a47400] 16:53:59 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:53:59 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:59 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:53:59 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:53:59 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:00 INFO - --DOCSHELL 0x1202d6700 == 13 [pid = 1050] [id = 104] 16:54:00 INFO - --DOCSHELL 0x1202d6c00 == 12 [pid = 1050] [id = 106] 16:54:00 INFO - --DOCSHELL 0x132829f00 == 11 [pid = 1050] [id = 107] 16:54:00 INFO - --DOCSHELL 0x128f5b500 == 10 [pid = 1050] [id = 105] 16:54:00 INFO - MEMORY STAT | vsize 3804MB | residentFast 340MB | heapAllocated 114MB 16:54:00 INFO - 42 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-04.js | took 1739ms 16:54:00 INFO - ++DOCSHELL 0x1203cfa00 == 11 [pid = 1050] [id = 110] 16:54:00 INFO - ++DOMWINDOW == 42 (0x120139c00) [pid = 1050] [serial = 277] [outer = 0x0] 16:54:00 INFO - ++DOMWINDOW == 43 (0x120cb5400) [pid = 1050] [serial = 278] [outer = 0x120139c00] 16:54:00 INFO - 43 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-05.js 16:54:00 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:00 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:00 INFO - ++DOCSHELL 0x12ae9cc00 == 12 [pid = 1050] [id = 111] 16:54:00 INFO - ++DOMWINDOW == 44 (0x129ac4800) [pid = 1050] [serial = 279] [outer = 0x0] 16:54:00 INFO - ++DOMWINDOW == 45 (0x12a0a2000) [pid = 1050] [serial = 280] [outer = 0x129ac4800] 16:54:00 INFO - ++DOMWINDOW == 46 (0x12a3e1400) [pid = 1050] [serial = 281] [outer = 0x129ac4800] 16:54:00 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:00 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:00 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:00 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:01 INFO - ++DOMWINDOW == 47 (0x12c1c6000) [pid = 1050] [serial = 282] [outer = 0x129ac4800] 16:54:01 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:01 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:01 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:01 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:01 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - --DOCSHELL 0x10c52fc00 == 11 [pid = 1050] [id = 108] 16:54:02 INFO - --DOCSHELL 0x136b55700 == 10 [pid = 1050] [id = 109] 16:54:02 INFO - MEMORY STAT | vsize 3833MB | residentFast 346MB | heapAllocated 122MB 16:54:02 INFO - 44 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-05.js | took 1470ms 16:54:02 INFO - ++DOCSHELL 0x1202d4400 == 11 [pid = 1050] [id = 112] 16:54:02 INFO - ++DOMWINDOW == 48 (0x120510c00) [pid = 1050] [serial = 283] [outer = 0x0] 16:54:02 INFO - ++DOMWINDOW == 49 (0x12a137400) [pid = 1050] [serial = 284] [outer = 0x120510c00] 16:54:02 INFO - 45 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-06.js 16:54:02 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - ++DOCSHELL 0x12d5db700 == 12 [pid = 1050] [id = 113] 16:54:02 INFO - ++DOMWINDOW == 50 (0x12c733400) [pid = 1050] [serial = 285] [outer = 0x0] 16:54:02 INFO - ++DOMWINDOW == 51 (0x12c7fd400) [pid = 1050] [serial = 286] [outer = 0x12c733400] 16:54:02 INFO - ++DOMWINDOW == 52 (0x12ccc3000) [pid = 1050] [serial = 287] [outer = 0x12c733400] 16:54:02 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:02 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:02 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - ++DOMWINDOW == 53 (0x12e7f7c00) [pid = 1050] [serial = 288] [outer = 0x12c733400] 16:54:02 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:02 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:02 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:02 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:02 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:04 INFO - --DOMWINDOW == 52 (0x126f21400) [pid = 1050] [serial = 267] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 51 (0x10c630c00) [pid = 1050] [serial = 254] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 50 (0x1200e3000) [pid = 1050] [serial = 271] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 49 (0x12025ec00) [pid = 1050] [serial = 256] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 48 (0x10c656000) [pid = 1050] [serial = 259] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 47 (0x11fe5e800) [pid = 1050] [serial = 265] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 46 (0x12040f000) [pid = 1050] [serial = 261] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 45 (0x12a0a2000) [pid = 1050] [serial = 280] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 44 (0x1279ca800) [pid = 1050] [serial = 268] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 43 (0x128b31400) [pid = 1050] [serial = 274] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 42 (0x10c6b6c00) [pid = 1050] [serial = 255] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 41 (0x120396c00) [pid = 1050] [serial = 272] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 40 (0x1202ad400) [pid = 1050] [serial = 257] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 39 (0x10c7a5c00) [pid = 1050] [serial = 260] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 38 (0x1204f8800) [pid = 1050] [serial = 266] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 37 (0x12053d400) [pid = 1050] [serial = 262] [outer = 0x0] [url = about:blank] 16:54:04 INFO - --DOMWINDOW == 36 (0x120134000) [pid = 1050] [serial = 244] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:54:04 INFO - --DOMWINDOW == 35 (0x129ac4800) [pid = 1050] [serial = 279] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 34 (0x128a47400) [pid = 1050] [serial = 273] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 33 (0x122470000) [pid = 1050] [serial = 246] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:54:04 INFO - MEMORY STAT | vsize 3736MB | residentFast 330MB | heapAllocated 97MB 16:54:04 INFO - 46 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-06.js | took 2401ms 16:54:04 INFO - ++DOCSHELL 0x10c681400 == 13 [pid = 1050] [id = 114] 16:54:04 INFO - ++DOMWINDOW == 34 (0x10c62bc00) [pid = 1050] [serial = 289] [outer = 0x0] 16:54:04 INFO - ++DOMWINDOW == 35 (0x10c6a9400) [pid = 1050] [serial = 290] [outer = 0x10c62bc00] 16:54:04 INFO - --DOMWINDOW == 34 (0x12a3ac000) [pid = 1050] [serial = 276] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 33 (0x12cd74c00) [pid = 1050] [serial = 269] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 32 (0x12eea2400) [pid = 1050] [serial = 275] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 31 (0x12aff5800) [pid = 1050] [serial = 263] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 30 (0x126e85800) [pid = 1050] [serial = 264] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 29 (0x12a3e1400) [pid = 1050] [serial = 281] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 28 (0x12c1c6000) [pid = 1050] [serial = 282] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 27 (0x129a88400) [pid = 1050] [serial = 270] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - --DOMWINDOW == 26 (0x12c1ec800) [pid = 1050] [serial = 258] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:04 INFO - 47 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-07.js 16:54:04 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:04 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:04 INFO - ++DOCSHELL 0x12802b000 == 14 [pid = 1050] [id = 115] 16:54:04 INFO - ++DOMWINDOW == 27 (0x11fd7a800) [pid = 1050] [serial = 291] [outer = 0x0] 16:54:04 INFO - ++DOMWINDOW == 28 (0x11fe5a800) [pid = 1050] [serial = 292] [outer = 0x11fd7a800] 16:54:04 INFO - ++DOMWINDOW == 29 (0x12a137c00) [pid = 1050] [serial = 293] [outer = 0x11fd7a800] 16:54:04 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:04 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:05 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:05 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:05 INFO - ++DOMWINDOW == 30 (0x11fe5a400) [pid = 1050] [serial = 294] [outer = 0x11fd7a800] 16:54:05 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:05 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:05 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:05 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:05 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:06 INFO - --DOCSHELL 0x12ae9cc00 == 13 [pid = 1050] [id = 111] 16:54:06 INFO - --DOCSHELL 0x12d5db700 == 12 [pid = 1050] [id = 113] 16:54:06 INFO - --DOCSHELL 0x1202d4400 == 11 [pid = 1050] [id = 112] 16:54:06 INFO - --DOCSHELL 0x1203cfa00 == 10 [pid = 1050] [id = 110] 16:54:06 INFO - MEMORY STAT | vsize 3774MB | residentFast 337MB | heapAllocated 105MB 16:54:06 INFO - 48 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-07.js | took 1729ms 16:54:06 INFO - ++DOCSHELL 0x11fe35100 == 11 [pid = 1050] [id = 116] 16:54:06 INFO - ++DOMWINDOW == 31 (0x11fd7a000) [pid = 1050] [serial = 295] [outer = 0x0] 16:54:06 INFO - ++DOMWINDOW == 32 (0x1200e3000) [pid = 1050] [serial = 296] [outer = 0x11fd7a000] 16:54:06 INFO - 49 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-08.js 16:54:06 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:06 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:06 INFO - ++DOCSHELL 0x12ae9b800 == 12 [pid = 1050] [id = 117] 16:54:06 INFO - ++DOMWINDOW == 33 (0x120fb4000) [pid = 1050] [serial = 297] [outer = 0x0] 16:54:06 INFO - ++DOMWINDOW == 34 (0x122470000) [pid = 1050] [serial = 298] [outer = 0x120fb4000] 16:54:06 INFO - ++DOMWINDOW == 35 (0x122470c00) [pid = 1050] [serial = 299] [outer = 0x120fb4000] 16:54:06 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:06 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:06 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:06 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:07 INFO - ++DOMWINDOW == 36 (0x120376400) [pid = 1050] [serial = 300] [outer = 0x120fb4000] 16:54:07 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:07 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:07 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:07 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:07 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:08 INFO - --DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 114] 16:54:08 INFO - --DOCSHELL 0x12802b000 == 10 [pid = 1050] [id = 115] 16:54:08 INFO - MEMORY STAT | vsize 3804MB | residentFast 343MB | heapAllocated 112MB 16:54:08 INFO - 50 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-08.js | took 1966ms 16:54:08 INFO - ++DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 118] 16:54:08 INFO - ++DOMWINDOW == 37 (0x10c777400) [pid = 1050] [serial = 301] [outer = 0x0] 16:54:08 INFO - ++DOMWINDOW == 38 (0x11fd34800) [pid = 1050] [serial = 302] [outer = 0x10c777400] 16:54:08 INFO - 51 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-09.js 16:54:08 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:08 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:08 INFO - ++DOCSHELL 0x132f15f00 == 12 [pid = 1050] [id = 119] 16:54:08 INFO - ++DOMWINDOW == 39 (0x126f47000) [pid = 1050] [serial = 303] [outer = 0x0] 16:54:08 INFO - ++DOMWINDOW == 40 (0x128b46400) [pid = 1050] [serial = 304] [outer = 0x126f47000] 16:54:08 INFO - ++DOMWINDOW == 41 (0x129906c00) [pid = 1050] [serial = 305] [outer = 0x126f47000] 16:54:08 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:08 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:09 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:09 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:09 INFO - ++DOMWINDOW == 42 (0x129ea3800) [pid = 1050] [serial = 306] [outer = 0x126f47000] 16:54:09 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:09 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:09 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:09 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:09 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have a compiled vertex shader attached. 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: linkProgram: Must have an compiled fragment shader attached. 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:54:09 INFO - JavaScript warning: , line 0: Error: WebGL: getAttribLocation: `program` must be linked. 16:54:10 INFO - --DOCSHELL 0x11fe35100 == 11 [pid = 1050] [id = 116] 16:54:10 INFO - --DOCSHELL 0x12ae9b800 == 10 [pid = 1050] [id = 117] 16:54:10 INFO - MEMORY STAT | vsize 3838MB | residentFast 349MB | heapAllocated 119MB 16:54:10 INFO - 52 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-09.js | took 1846ms 16:54:10 INFO - ++DOCSHELL 0x11fe35100 == 11 [pid = 1050] [id = 120] 16:54:10 INFO - ++DOMWINDOW == 43 (0x120ddc800) [pid = 1050] [serial = 307] [outer = 0x0] 16:54:10 INFO - ++DOMWINDOW == 44 (0x126f05400) [pid = 1050] [serial = 308] [outer = 0x120ddc800] 16:54:10 INFO - 53 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-10.js 16:54:10 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:10 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:10 INFO - ++DOCSHELL 0x13763d200 == 12 [pid = 1050] [id = 121] 16:54:10 INFO - ++DOMWINDOW == 45 (0x129ea3c00) [pid = 1050] [serial = 309] [outer = 0x0] 16:54:10 INFO - ++DOMWINDOW == 46 (0x12a323c00) [pid = 1050] [serial = 310] [outer = 0x129ea3c00] 16:54:10 INFO - ++DOMWINDOW == 47 (0x12aec3400) [pid = 1050] [serial = 311] [outer = 0x129ea3c00] 16:54:10 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:10 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:11 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:11 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:11 INFO - ++DOMWINDOW == 48 (0x12c1b1000) [pid = 1050] [serial = 312] [outer = 0x129ea3c00] 16:54:11 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:11 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:11 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:11 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:11 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:11 INFO - ++DOMWINDOW == 49 (0x12ebf5800) [pid = 1050] [serial = 313] [outer = 0x129ea3c00] 16:54:11 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:11 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:11 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:11 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:11 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:12 INFO - --DOMWINDOW == 48 (0x12c7fd400) [pid = 1050] [serial = 286] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 47 (0x122470000) [pid = 1050] [serial = 298] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 46 (0x12c733400) [pid = 1050] [serial = 285] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:12 INFO - --DOMWINDOW == 45 (0x120139c00) [pid = 1050] [serial = 277] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 44 (0x11fd7a000) [pid = 1050] [serial = 295] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 43 (0x126f47000) [pid = 1050] [serial = 303] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:12 INFO - --DOMWINDOW == 42 (0x10c62bc00) [pid = 1050] [serial = 289] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 41 (0x120510c00) [pid = 1050] [serial = 283] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 40 (0x11fd7a800) [pid = 1050] [serial = 291] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:12 INFO - --DOMWINDOW == 39 (0x120fb4000) [pid = 1050] [serial = 297] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:12 INFO - --DOMWINDOW == 38 (0x120cb5400) [pid = 1050] [serial = 278] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 37 (0x1200e3000) [pid = 1050] [serial = 296] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 36 (0x128b46400) [pid = 1050] [serial = 304] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 35 (0x10c6a9400) [pid = 1050] [serial = 290] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 34 (0x12a137400) [pid = 1050] [serial = 284] [outer = 0x0] [url = about:blank] 16:54:12 INFO - --DOMWINDOW == 33 (0x11fe5a800) [pid = 1050] [serial = 292] [outer = 0x0] [url = about:blank] 16:54:12 INFO - ++DOMWINDOW == 34 (0x11fd24c00) [pid = 1050] [serial = 314] [outer = 0x129ea3c00] 16:54:12 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:12 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:12 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:12 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:12 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:13 INFO - --DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 118] 16:54:13 INFO - --DOCSHELL 0x132f15f00 == 10 [pid = 1050] [id = 119] 16:54:13 INFO - MEMORY STAT | vsize 3879MB | residentFast 350MB | heapAllocated 118MB 16:54:13 INFO - 54 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-10.js | took 2945ms 16:54:13 INFO - ++DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 122] 16:54:13 INFO - ++DOMWINDOW == 35 (0x10c630c00) [pid = 1050] [serial = 315] [outer = 0x0] 16:54:13 INFO - ++DOMWINDOW == 36 (0x10c6a9400) [pid = 1050] [serial = 316] [outer = 0x10c630c00] 16:54:13 INFO - --DOMWINDOW == 35 (0x122470c00) [pid = 1050] [serial = 299] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 34 (0x12ccc3000) [pid = 1050] [serial = 287] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 33 (0x129ea3800) [pid = 1050] [serial = 306] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 32 (0x12e7f7c00) [pid = 1050] [serial = 288] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 31 (0x129906c00) [pid = 1050] [serial = 305] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 30 (0x12a137c00) [pid = 1050] [serial = 293] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 29 (0x11fe5a400) [pid = 1050] [serial = 294] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:13 INFO - --DOMWINDOW == 28 (0x120376400) [pid = 1050] [serial = 300] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:14 INFO - 55 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-11.js 16:54:14 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:14 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:14 INFO - ++DOCSHELL 0x128b8b300 == 12 [pid = 1050] [id = 123] 16:54:14 INFO - ++DOMWINDOW == 29 (0x1200f3800) [pid = 1050] [serial = 317] [outer = 0x0] 16:54:14 INFO - ++DOMWINDOW == 30 (0x12025ec00) [pid = 1050] [serial = 318] [outer = 0x1200f3800] 16:54:14 INFO - ++DOMWINDOW == 31 (0x120321800) [pid = 1050] [serial = 319] [outer = 0x1200f3800] 16:54:14 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:14 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:14 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:14 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:14 INFO - ++DOMWINDOW == 32 (0x120f7f000) [pid = 1050] [serial = 320] [outer = 0x1200f3800] 16:54:14 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:14 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:14 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:14 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:14 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:15 INFO - --DOCSHELL 0x13763d200 == 11 [pid = 1050] [id = 121] 16:54:15 INFO - --DOCSHELL 0x11fe35100 == 10 [pid = 1050] [id = 120] 16:54:15 INFO - console.error: 16:54:15 INFO - Message: Error: Unexpected packet server1.conn26.webglActor6, {"from":"server1.conn26.webglActor6","error":"noSuchActor","message":"No such actor for ID: server1.conn26.webglActor6"} 16:54:15 INFO - Stack: 16:54:15 INFO - Front<.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/protocol.js:1218:17 16:54:15 INFO - DebuggerClient.prototype.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:930:7 16:54:15 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:54:15 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:54:15 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:54:15 INFO - Handler function LocalDebuggerTransport instance's this.other.hooks.onPacket threw an exception: Error: Unexpected packet server1.conn26.webglActor6, {"from":"server1.conn26.webglActor6","error":"noSuchActor","message":"No such actor for ID: server1.conn26.webglActor6"} 16:54:15 INFO - Stack: Front<.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/protocol.js:1218:17 16:54:15 INFO - DebuggerClient.prototype.onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:930:7 16:54:15 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:54:15 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:54:15 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:54:15 INFO - Line: 1218, column: 17 16:54:15 INFO - MEMORY STAT | vsize 3795MB | residentFast 343MB | heapAllocated 110MB 16:54:15 INFO - 56 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-11.js | took 1504ms 16:54:15 INFO - ++DOCSHELL 0x10c680000 == 11 [pid = 1050] [id = 124] 16:54:15 INFO - ++DOMWINDOW == 33 (0x12040f400) [pid = 1050] [serial = 321] [outer = 0x0] 16:54:15 INFO - ++DOMWINDOW == 34 (0x120fb4000) [pid = 1050] [serial = 322] [outer = 0x12040f400] 16:54:15 INFO - Handler function TabActor.prototype.onReload's delayed body threw an exception: TypeError: this.docShell is null 16:54:15 INFO - Stack: TabActor.prototype.webNavigation@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webbrowser.js:860:5 16:54:15 INFO - TabActor.prototype.onReload/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webbrowser.js:1389:7 16:54:15 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:54:15 INFO - Line: 860, column: 5 16:54:15 INFO - 57 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-12.js 16:54:15 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:15 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:15 INFO - ++DOCSHELL 0x12d502600 == 12 [pid = 1050] [id = 125] 16:54:15 INFO - ++DOMWINDOW == 35 (0x1279fcc00) [pid = 1050] [serial = 323] [outer = 0x0] 16:54:15 INFO - ++DOMWINDOW == 36 (0x128125c00) [pid = 1050] [serial = 324] [outer = 0x1279fcc00] 16:54:15 INFO - ++DOMWINDOW == 37 (0x128b60c00) [pid = 1050] [serial = 325] [outer = 0x1279fcc00] 16:54:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:16 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:16 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:16 INFO - ++DOMWINDOW == 38 (0x129d9a400) [pid = 1050] [serial = 326] [outer = 0x1279fcc00] 16:54:16 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:16 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:16 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:16 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - --DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 122] 16:54:17 INFO - --DOCSHELL 0x128b8b300 == 10 [pid = 1050] [id = 123] 16:54:17 INFO - MEMORY STAT | vsize 3824MB | residentFast 350MB | heapAllocated 116MB 16:54:17 INFO - 58 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-12.js | took 1613ms 16:54:17 INFO - ++DOCSHELL 0x1202d3a00 == 11 [pid = 1050] [id = 126] 16:54:17 INFO - ++DOMWINDOW == 39 (0x120134000) [pid = 1050] [serial = 327] [outer = 0x0] 16:54:17 INFO - ++DOMWINDOW == 40 (0x120335c00) [pid = 1050] [serial = 328] [outer = 0x120134000] 16:54:17 INFO - 59 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-13.js 16:54:17 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - ++DOCSHELL 0x13404a100 == 12 [pid = 1050] [id = 127] 16:54:17 INFO - ++DOMWINDOW == 41 (0x1279fc000) [pid = 1050] [serial = 329] [outer = 0x0] 16:54:17 INFO - ++DOMWINDOW == 42 (0x128a47000) [pid = 1050] [serial = 330] [outer = 0x1279fc000] 16:54:17 INFO - ++DOMWINDOW == 43 (0x131238800) [pid = 1050] [serial = 331] [outer = 0x1279fc000] 16:54:17 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:17 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:17 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:17 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:18 INFO - ++DOMWINDOW == 44 (0x12ae64400) [pid = 1050] [serial = 332] [outer = 0x1279fc000] 16:54:18 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:18 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:18 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:18 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:18 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:18 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:18 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:19 INFO - MEMORY STAT | vsize 3840MB | residentFast 356MB | heapAllocated 127MB 16:54:19 INFO - 60 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-13.js | took 2109ms 16:54:19 INFO - ++DOCSHELL 0x11fd1f300 == 13 [pid = 1050] [id = 128] 16:54:19 INFO - ++DOMWINDOW == 45 (0x11fd7a000) [pid = 1050] [serial = 333] [outer = 0x0] 16:54:19 INFO - ++DOMWINDOW == 46 (0x120299400) [pid = 1050] [serial = 334] [outer = 0x11fd7a000] 16:54:19 INFO - 61 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-14.js 16:54:19 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:19 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:19 INFO - ++DOCSHELL 0x1376a6e00 == 14 [pid = 1050] [id = 129] 16:54:19 INFO - ++DOMWINDOW == 47 (0x12993d000) [pid = 1050] [serial = 335] [outer = 0x0] 16:54:19 INFO - ++DOMWINDOW == 48 (0x129bca000) [pid = 1050] [serial = 336] [outer = 0x12993d000] 16:54:19 INFO - ++DOMWINDOW == 49 (0x12b9b0c00) [pid = 1050] [serial = 337] [outer = 0x12993d000] 16:54:19 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:20 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - ++DOMWINDOW == 50 (0x12eb36400) [pid = 1050] [serial = 338] [outer = 0x12993d000] 16:54:20 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:20 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:20 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:20 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:21 INFO - --DOCSHELL 0x10c680000 == 13 [pid = 1050] [id = 124] 16:54:21 INFO - --DOCSHELL 0x1202d3a00 == 12 [pid = 1050] [id = 126] 16:54:21 INFO - --DOCSHELL 0x12d502600 == 11 [pid = 1050] [id = 125] 16:54:21 INFO - --DOCSHELL 0x13404a100 == 10 [pid = 1050] [id = 127] 16:54:21 INFO - --DOMWINDOW == 49 (0x1279fc000) [pid = 1050] [serial = 329] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:21 INFO - --DOMWINDOW == 48 (0x1279fcc00) [pid = 1050] [serial = 323] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 16:54:21 INFO - --DOMWINDOW == 47 (0x12040f400) [pid = 1050] [serial = 321] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 46 (0x129ea3c00) [pid = 1050] [serial = 309] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:21 INFO - --DOMWINDOW == 45 (0x10c777400) [pid = 1050] [serial = 301] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 44 (0x120ddc800) [pid = 1050] [serial = 307] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 43 (0x1200f3800) [pid = 1050] [serial = 317] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:21 INFO - --DOMWINDOW == 42 (0x10c630c00) [pid = 1050] [serial = 315] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 41 (0x128125c00) [pid = 1050] [serial = 324] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 40 (0x120fb4000) [pid = 1050] [serial = 322] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 39 (0x12a323c00) [pid = 1050] [serial = 310] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 38 (0x128a47000) [pid = 1050] [serial = 330] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 37 (0x11fd34800) [pid = 1050] [serial = 302] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 36 (0x126f05400) [pid = 1050] [serial = 308] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 35 (0x12025ec00) [pid = 1050] [serial = 318] [outer = 0x0] [url = about:blank] 16:54:21 INFO - --DOMWINDOW == 34 (0x10c6a9400) [pid = 1050] [serial = 316] [outer = 0x0] [url = about:blank] 16:54:22 INFO - MEMORY STAT | vsize 3728MB | residentFast 335MB | heapAllocated 102MB 16:54:22 INFO - 62 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-14.js | took 2301ms 16:54:22 INFO - ++DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 130] 16:54:22 INFO - ++DOMWINDOW == 35 (0x10c6fcc00) [pid = 1050] [serial = 339] [outer = 0x0] 16:54:22 INFO - ++DOMWINDOW == 36 (0x10c7a5c00) [pid = 1050] [serial = 340] [outer = 0x10c6fcc00] 16:54:22 INFO - --DOMWINDOW == 35 (0x128b60c00) [pid = 1050] [serial = 325] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 16:54:22 INFO - --DOMWINDOW == 34 (0x11fd24c00) [pid = 1050] [serial = 314] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - --DOMWINDOW == 33 (0x12ebf5800) [pid = 1050] [serial = 313] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - --DOMWINDOW == 32 (0x12ae64400) [pid = 1050] [serial = 332] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:22 INFO - --DOMWINDOW == 31 (0x12aec3400) [pid = 1050] [serial = 311] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - --DOMWINDOW == 30 (0x12c1b1000) [pid = 1050] [serial = 312] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - --DOMWINDOW == 29 (0x131238800) [pid = 1050] [serial = 331] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:22 INFO - --DOMWINDOW == 28 (0x129d9a400) [pid = 1050] [serial = 326] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_shader-order.html] 16:54:22 INFO - --DOMWINDOW == 27 (0x120321800) [pid = 1050] [serial = 319] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - --DOMWINDOW == 26 (0x120f7f000) [pid = 1050] [serial = 320] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:22 INFO - 63 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-15.js 16:54:22 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:22 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:22 INFO - ++DOCSHELL 0x12802e700 == 12 [pid = 1050] [id = 131] 16:54:22 INFO - ++DOMWINDOW == 27 (0x120134c00) [pid = 1050] [serial = 341] [outer = 0x0] 16:54:22 INFO - ++DOMWINDOW == 28 (0x12025ec00) [pid = 1050] [serial = 342] [outer = 0x120134c00] 16:54:22 INFO - ++DOMWINDOW == 29 (0x120345400) [pid = 1050] [serial = 343] [outer = 0x120134c00] 16:54:22 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:22 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:22 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:22 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:22 INFO - ++DOMWINDOW == 30 (0x120e7a000) [pid = 1050] [serial = 344] [outer = 0x120134c00] 16:54:22 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:22 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:22 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:22 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:22 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:23 INFO - ++DOMWINDOW == 31 (0x12993dc00) [pid = 1050] [serial = 345] [outer = 0x120134c00] 16:54:23 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:23 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:23 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:23 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:23 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:23 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:23 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:26 INFO - --DOCSHELL 0x11fd1f300 == 11 [pid = 1050] [id = 128] 16:54:28 INFO - --DOCSHELL 0x1376a6e00 == 10 [pid = 1050] [id = 129] 16:54:28 INFO - MEMORY STAT | vsize 3773MB | residentFast 347MB | heapAllocated 112MB 16:54:28 INFO - 64 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-15.js | took 6174ms 16:54:28 INFO - ++DOCSHELL 0x11fd1f300 == 11 [pid = 1050] [id = 132] 16:54:28 INFO - ++DOMWINDOW == 32 (0x10c656000) [pid = 1050] [serial = 346] [outer = 0x0] 16:54:28 INFO - ++DOMWINDOW == 33 (0x10c777400) [pid = 1050] [serial = 347] [outer = 0x10c656000] 16:54:28 INFO - 65 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-16.js 16:54:28 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:28 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:28 INFO - ++DOCSHELL 0x130446d00 == 12 [pid = 1050] [id = 133] 16:54:28 INFO - ++DOMWINDOW == 34 (0x120cb5c00) [pid = 1050] [serial = 348] [outer = 0x0] 16:54:28 INFO - ++DOMWINDOW == 35 (0x120dcc400) [pid = 1050] [serial = 349] [outer = 0x120cb5c00] 16:54:28 INFO - ++DOMWINDOW == 36 (0x12c7a0c00) [pid = 1050] [serial = 350] [outer = 0x120cb5c00] 16:54:28 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:28 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:28 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:28 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - ++DOMWINDOW == 37 (0x128074000) [pid = 1050] [serial = 351] [outer = 0x120cb5c00] 16:54:29 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - ++DOMWINDOW == 38 (0x12a2a1800) [pid = 1050] [serial = 352] [outer = 0x120cb5c00] 16:54:29 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - ++DOMWINDOW == 39 (0x12c398000) [pid = 1050] [serial = 353] [outer = 0x120cb5c00] 16:54:29 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:29 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:29 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:30 INFO - --DOMWINDOW == 38 (0x129bca000) [pid = 1050] [serial = 336] [outer = 0x0] [url = about:blank] 16:54:30 INFO - --DOMWINDOW == 37 (0x120335c00) [pid = 1050] [serial = 328] [outer = 0x0] [url = about:blank] 16:54:30 INFO - --DOMWINDOW == 36 (0x120299400) [pid = 1050] [serial = 334] [outer = 0x0] [url = about:blank] 16:54:30 INFO - --DOMWINDOW == 35 (0x12025ec00) [pid = 1050] [serial = 342] [outer = 0x0] [url = about:blank] 16:54:30 INFO - --DOMWINDOW == 34 (0x12993d000) [pid = 1050] [serial = 335] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:30 INFO - --DOMWINDOW == 33 (0x120134000) [pid = 1050] [serial = 327] [outer = 0x0] [url = about:blank] 16:54:30 INFO - --DOMWINDOW == 32 (0x120134c00) [pid = 1050] [serial = 341] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:30 INFO - --DOMWINDOW == 31 (0x11fd7a000) [pid = 1050] [serial = 333] [outer = 0x0] [url = about:blank] 16:54:30 INFO - ++DOMWINDOW == 32 (0x11fd7a800) [pid = 1050] [serial = 354] [outer = 0x120cb5c00] 16:54:30 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:30 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:30 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:30 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:30 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:30 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:30 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:31 INFO - --DOCSHELL 0x10c681400 == 11 [pid = 1050] [id = 130] 16:54:31 INFO - --DOCSHELL 0x12802e700 == 10 [pid = 1050] [id = 131] 16:54:32 INFO - --DOMWINDOW == 31 (0x12b9b0c00) [pid = 1050] [serial = 337] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:32 INFO - --DOMWINDOW == 30 (0x12eb36400) [pid = 1050] [serial = 338] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:32 INFO - --DOMWINDOW == 29 (0x120e7a000) [pid = 1050] [serial = 344] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:32 INFO - --DOMWINDOW == 28 (0x12993dc00) [pid = 1050] [serial = 345] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:32 INFO - --DOMWINDOW == 27 (0x120345400) [pid = 1050] [serial = 343] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:32 INFO - MEMORY STAT | vsize 3772MB | residentFast 340MB | heapAllocated 108MB 16:54:32 INFO - 66 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-16.js | took 3743ms 16:54:32 INFO - ++DOCSHELL 0x11fd21b00 == 11 [pid = 1050] [id = 134] 16:54:32 INFO - ++DOMWINDOW == 28 (0x11fc50000) [pid = 1050] [serial = 355] [outer = 0x0] 16:54:32 INFO - ++DOMWINDOW == 29 (0x11fd7a000) [pid = 1050] [serial = 356] [outer = 0x11fc50000] 16:54:32 INFO - 67 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-17.js 16:54:32 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:32 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:32 INFO - ++DOCSHELL 0x128bac400 == 12 [pid = 1050] [id = 135] 16:54:32 INFO - ++DOMWINDOW == 30 (0x120510c00) [pid = 1050] [serial = 357] [outer = 0x0] 16:54:32 INFO - ++DOMWINDOW == 31 (0x120ca6000) [pid = 1050] [serial = 358] [outer = 0x120510c00] 16:54:32 INFO - ++DOMWINDOW == 32 (0x120d54800) [pid = 1050] [serial = 359] [outer = 0x120510c00] 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:32 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:32 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:32 INFO - ++DOMWINDOW == 33 (0x120cb0c00) [pid = 1050] [serial = 360] [outer = 0x120510c00] 16:54:32 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:32 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:33 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:33 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:34 INFO - --DOCSHELL 0x11fd1f300 == 11 [pid = 1050] [id = 132] 16:54:34 INFO - --DOCSHELL 0x130446d00 == 10 [pid = 1050] [id = 133] 16:54:34 INFO - MEMORY STAT | vsize 3785MB | residentFast 347MB | heapAllocated 117MB 16:54:34 INFO - 68 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-17.js | took 2363ms 16:54:34 INFO - ++DOCSHELL 0x120447800 == 11 [pid = 1050] [id = 136] 16:54:34 INFO - ++DOMWINDOW == 34 (0x10c656c00) [pid = 1050] [serial = 361] [outer = 0x0] 16:54:34 INFO - ++DOMWINDOW == 35 (0x12025ec00) [pid = 1050] [serial = 362] [outer = 0x10c656c00] 16:54:34 INFO - 69 INFO TEST-START | devtools/client/shadereditor/test/browser_webgl-actor-test-18.js 16:54:34 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:34 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:34 INFO - ++DOCSHELL 0x12e294600 == 12 [pid = 1050] [id = 137] 16:54:34 INFO - ++DOMWINDOW == 36 (0x128a47000) [pid = 1050] [serial = 363] [outer = 0x0] 16:54:34 INFO - ++DOMWINDOW == 37 (0x129db5800) [pid = 1050] [serial = 364] [outer = 0x128a47000] 16:54:35 INFO - ++DOMWINDOW == 38 (0x132fadc00) [pid = 1050] [serial = 365] [outer = 0x128a47000] 16:54:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:35 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - ++DOMWINDOW == 39 (0x12c1ecc00) [pid = 1050] [serial = 366] [outer = 0x128a47000] 16:54:35 INFO - [1050] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:35 INFO - [1050] WARNING: NS_ENSURE_TRUE(ParseTypeAttribute(type, &version)) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsScriptLoader.cpp, line 515 16:54:35 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:35 INFO - [1050] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:36 INFO - --DOCSHELL 0x11fd21b00 == 11 [pid = 1050] [id = 134] 16:54:36 INFO - --DOCSHELL 0x128bac400 == 10 [pid = 1050] [id = 135] 16:54:36 INFO - MEMORY STAT | vsize 3800MB | residentFast 352MB | heapAllocated 128MB 16:54:36 INFO - 70 INFO TEST-OK | devtools/client/shadereditor/test/browser_webgl-actor-test-18.js | took 1674ms 16:54:36 INFO - ++DOCSHELL 0x11fe33d00 == 11 [pid = 1050] [id = 138] 16:54:36 INFO - ++DOMWINDOW == 40 (0x1204f8800) [pid = 1050] [serial = 367] [outer = 0x0] 16:54:36 INFO - ++DOMWINDOW == 41 (0x120ddc400) [pid = 1050] [serial = 368] [outer = 0x1204f8800] 16:54:36 INFO - ++DOMWINDOW == 42 (0x129eed800) [pid = 1050] [serial = 369] [outer = 0x12a2d7c00] 16:54:36 INFO - ++DOMWINDOW == 43 (0x129ffcc00) [pid = 1050] [serial = 370] [outer = 0x12a323000] 16:54:36 INFO - --DOCSHELL 0x137d17d00 == 10 [pid = 1050] [id = 12] 16:54:36 INFO - ++DOMWINDOW == 44 (0x11fefd000) [pid = 1050] [serial = 371] [outer = 0x12a2d7c00] 16:54:36 INFO - ++DOMWINDOW == 45 (0x129ffc000) [pid = 1050] [serial = 372] [outer = 0x12a323000] 16:54:37 INFO - --DOCSHELL 0x11fd1ee00 == 9 [pid = 1050] [id = 15] 16:54:37 INFO - --DOCSHELL 0x131331800 == 8 [pid = 1050] [id = 8] 16:54:38 INFO - --DOCSHELL 0x120447800 == 7 [pid = 1050] [id = 136] 16:54:38 INFO - --DOCSHELL 0x12e294600 == 6 [pid = 1050] [id = 137] 16:54:38 INFO - --DOMWINDOW == 44 (0x129ffcc00) [pid = 1050] [serial = 370] [outer = 0x12a323000] [url = about:blank] 16:54:38 INFO - --DOMWINDOW == 43 (0x12c3b2400) [pid = 1050] [serial = 10] [outer = 0x12a323000] [url = about:blank] 16:54:38 INFO - --DOMWINDOW == 42 (0x129eed800) [pid = 1050] [serial = 369] [outer = 0x12a2d7c00] [url = about:blank] 16:54:38 INFO - --DOMWINDOW == 41 (0x12c3b2000) [pid = 1050] [serial = 9] [outer = 0x12a2d7c00] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 40 (0x10c7a5c00) [pid = 1050] [serial = 340] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 39 (0x11fd7a000) [pid = 1050] [serial = 356] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 38 (0x10c656c00) [pid = 1050] [serial = 361] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 37 (0x12025ec00) [pid = 1050] [serial = 362] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 36 (0x120ca6000) [pid = 1050] [serial = 358] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 35 (0x10c777400) [pid = 1050] [serial = 347] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 34 (0x120dcc400) [pid = 1050] [serial = 349] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 33 (0x129db5800) [pid = 1050] [serial = 364] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 32 (0x13301d000) [pid = 1050] [serial = 28] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 16:54:39 INFO - --DOMWINDOW == 31 (0x10c777000) [pid = 1050] [serial = 36] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 30 (0x10c62b000) [pid = 1050] [serial = 35] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 29 (0x10c5a0c00) [pid = 1050] [serial = 34] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 16:54:39 INFO - --DOMWINDOW == 28 (0x128a47000) [pid = 1050] [serial = 363] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:39 INFO - --DOMWINDOW == 27 (0x120cb5c00) [pid = 1050] [serial = 348] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:39 INFO - --DOMWINDOW == 26 (0x1332a7c00) [pid = 1050] [serial = 21] [outer = 0x0] [url = about:newtab] 16:54:39 INFO - --DOMWINDOW == 25 (0x120510c00) [pid = 1050] [serial = 357] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 16:54:39 INFO - --DOMWINDOW == 24 (0x12e3c5800) [pid = 1050] [serial = 17] [outer = 0x0] [url = about:newtab] 16:54:39 INFO - --DOMWINDOW == 23 (0x10c6fcc00) [pid = 1050] [serial = 339] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 22 (0x11fc50000) [pid = 1050] [serial = 355] [outer = 0x0] [url = about:blank] 16:54:39 INFO - --DOMWINDOW == 21 (0x10c656000) [pid = 1050] [serial = 346] [outer = 0x0] [url = about:blank] 16:54:40 INFO - --DOMWINDOW == 20 (0x12c7a0c00) [pid = 1050] [serial = 350] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:40 INFO - --DOMWINDOW == 19 (0x128074000) [pid = 1050] [serial = 351] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:40 INFO - --DOMWINDOW == 18 (0x12a2a1800) [pid = 1050] [serial = 352] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:40 INFO - --DOMWINDOW == 17 (0x12c398000) [pid = 1050] [serial = 353] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_simple-canvas.html] 16:54:40 INFO - --DOMWINDOW == 16 (0x120d54800) [pid = 1050] [serial = 359] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 16:54:40 INFO - --DOMWINDOW == 15 (0x132fadc00) [pid = 1050] [serial = 365] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:40 INFO - --DOMWINDOW == 14 (0x11fd7a800) [pid = 1050] [serial = 354] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:40 INFO - --DOMWINDOW == 13 (0x120cb0c00) [pid = 1050] [serial = 360] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_overlapping-geometry.html] 16:54:40 INFO - --DOMWINDOW == 12 (0x12c1ecc00) [pid = 1050] [serial = 366] [outer = 0x0] [url = http://example.com/browser/devtools/client/shadereditor/test/doc_multiple-contexts.html] 16:54:42 INFO - Completed ShutdownLeaks collections in process 1050 16:54:42 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 16:54:42 INFO - --DOCSHELL 0x12d4b3000 == 5 [pid = 1050] [id = 6] 16:54:42 INFO - --DOCSHELL 0x1224b8a00 == 4 [pid = 1050] [id = 1] 16:54:42 INFO - --DOCSHELL 0x12a2e6f00 == 3 [pid = 1050] [id = 3] 16:54:42 INFO - --DOCSHELL 0x11fe33d00 == 2 [pid = 1050] [id = 138] 16:54:42 INFO - --DOCSHELL 0x12a2e7400 == 1 [pid = 1050] [id = 4] 16:54:42 INFO - --DOCSHELL 0x1203d1800 == 0 [pid = 1050] [id = 2] 16:54:42 INFO - [1050] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:54:42 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 16:54:43 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 16:54:43 INFO - [1050] WARNING: nsAppShell::Exit() called redundantly: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsAppShell.mm, line 679 16:54:43 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 16:54:43 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 16:54:43 INFO - [1050] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 16:54:44 INFO - --DOMWINDOW == 11 (0x129ffc000) [pid = 1050] [serial = 372] [outer = 0x12a323000] [url = about:blank] 16:54:44 INFO - --DOMWINDOW == 10 (0x11fefd000) [pid = 1050] [serial = 371] [outer = 0x12a2d7c00] [url = about:blank] 16:54:44 INFO - --DOMWINDOW == 9 (0x12a323000) [pid = 1050] [serial = 6] [outer = 0x0] [url = about:blank] 16:54:44 INFO - --DOMWINDOW == 8 (0x12a2d7c00) [pid = 1050] [serial = 5] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 7 (0x12793e800) [pid = 1050] [serial = 4] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 6 (0x122559000) [pid = 1050] [serial = 2] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 5 (0x1204d1800) [pid = 1050] [serial = 1] [outer = 0x0] [url = chrome://browser/content/hiddenWindow.xul] 16:54:45 INFO - --DOMWINDOW == 4 (0x12d4b2800) [pid = 1050] [serial = 14] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 3 (0x120ddc400) [pid = 1050] [serial = 368] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 2 (0x1204f8800) [pid = 1050] [serial = 367] [outer = 0x0] [url = about:blank] 16:54:45 INFO - --DOMWINDOW == 1 (0x12d4b2400) [pid = 1050] [serial = 13] [outer = 0x0] [url = chrome://mochikit/content/browser-harness.xul] 16:54:45 INFO - --DOMWINDOW == 0 (0x12793e400) [pid = 1050] [serial = 3] [outer = 0x0] [url = chrome://browser/content/browser.xul] 16:54:45 INFO - [1050] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 16:54:45 INFO - nsStringStats 16:54:45 INFO - => mAllocCount: 427851 16:54:45 INFO - => mReallocCount: 34641 16:54:45 INFO - => mFreeCount: 427851 16:54:45 INFO - => mShareCount: 505125 16:54:45 INFO - => mAdoptCount: 32977 16:54:45 INFO - => mAdoptFreeCount: 32977 16:54:45 INFO - => Process ID: 1050, Thread ID: 140735084678336 16:54:45 INFO - TEST-INFO | Main app process: exit 0 16:54:45 INFO - runtests.py | Application ran for: 0:02:24.973738 16:54:45 INFO - zombiecheck | Reading PID log: /var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpSh95HTpidlog 16:54:45 INFO - Stopping web server 16:54:45 INFO - Stopping web socket server 16:54:45 INFO - Stopping ssltunnel 16:54:45 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 16:54:45 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 16:54:45 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 16:54:45 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 16:54:45 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1050 16:54:45 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 16:54:45 INFO - | | Per-Inst Leaked| Total Rem| 16:54:45 INFO - 0 |TOTAL | 21 0|25137500 0| 16:54:45 INFO - nsTraceRefcnt::DumpStatistics: 1387 entries 16:54:45 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 16:54:45 INFO - runtests.py | Running tests: end. 16:54:45 INFO - 71 INFO checking window state 16:54:45 INFO - 72 INFO TEST-START | Shutdown 16:54:45 INFO - 73 INFO Browser Chrome Test Summary 16:54:45 INFO - 74 INFO Passed: 736 16:54:45 INFO - 75 INFO Failed: 0 16:54:45 INFO - 76 INFO Todo: 0 16:54:45 INFO - 77 INFO *** End BrowserChrome Test Results *** 16:54:45 INFO - dir: devtools/client/webconsole/test 16:54:46 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 16:54:46 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/NightlyDebug.app/Contents/Resources', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpeiQe2O.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 16:54:46 INFO - runtests.py | Server pid: 1060 16:54:46 INFO - runtests.py | Websocket server pid: 1061 16:54:46 INFO - runtests.py | SSL tunnel pid: 1062 16:54:46 INFO - runtests.py | Running tests: start. 16:54:46 INFO - runtests.py | Application pid: 1063 16:54:46 INFO - TEST-INFO | started process Main app process 16:54:46 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpeiQe2O.mozrunner/runtests_leaks.log 16:54:46 INFO - 2015-10-29 16:54:46.541 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x100109850 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:54:46 INFO - 2015-10-29 16:54:46.544 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x101001500 of class NSCFArray autoreleased with no pool in place - just leaking 16:54:46 INFO - 2015-10-29 16:54:46.728 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x100113b30 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:54:46 INFO - 2015-10-29 16:54:46.729 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x100113310 of class NSCFData autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.074 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x12035b0b0 of class __NSFastEnumerationEnumerator autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.075 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x101010bb0 of class NSCFNumber autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.076 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x1217d3ad0 of class NSConcreteValue autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.076 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x101017340 of class NSCFNumber autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.077 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x1217d3b90 of class NSConcreteValue autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.078 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x10011d500 of class NSCFDictionary autoreleased with no pool in place - just leaking 16:54:48 INFO - ++DOCSHELL 0x121c8e400 == 1 [pid = 1063] [id = 1] 16:54:48 INFO - ++DOMWINDOW == 1 (0x12048f800) [pid = 1063] [serial = 1] [outer = 0x0] 16:54:48 INFO - 2015-10-29 16:54:48.150 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x1217f43d0 of class __NSFontTypefaceInfo autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.150 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121d005c0 of class NSAffineTransform autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.152 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad220 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.153 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad280 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.155 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x1217f4420 of class __NSFontTypefaceInfo autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.155 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad2b0 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.156 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad2e0 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.157 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad310 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.158 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad340 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.159 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad4c0 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.160 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad4f0 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.161 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad520 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - 2015-10-29 16:54:48.162 firefox[1063:903] *** __NSAutoreleaseNoPool(): Object 0x121cad550 of class NSFont autoreleased with no pool in place - just leaking 16:54:48 INFO - ++DOMWINDOW == 2 (0x121d4d000) [pid = 1063] [serial = 2] [outer = 0x12048f800] 16:54:49 INFO - ++DOCSHELL 0x127a9e300 == 2 [pid = 1063] [id = 2] 16:54:49 INFO - ++DOMWINDOW == 3 (0x127b62800) [pid = 1063] [serial = 3] [outer = 0x0] 16:54:49 INFO - ++DOMWINDOW == 4 (0x127b62c00) [pid = 1063] [serial = 4] [outer = 0x127b62800] 16:54:49 INFO - [1063] WARNING: Loaded script chrome://global/content/printUtils.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:49 INFO - [1063] WARNING: Loaded script chrome://global/content/viewZoomOverlay.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:49 INFO - [1063] WARNING: Loaded script chrome://browser/content/places/browserPlacesViews.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:49 INFO - [1063] WARNING: Loaded script chrome://browser/content/browser.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:49 INFO - [1063] WARNING: Loaded script chrome://browser/content/downloads/downloads.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:50 INFO - [1063] WARNING: Loaded script chrome://browser/content/downloads/indicator.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:50 INFO - [1063] WARNING: Loaded script chrome://browser/content/customizableui/panelUI.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:50 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:50 INFO - [1063] WARNING: Loaded script chrome://global/content/viewSourceUtils.js twice (bug 392650): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/xul/nsXULPrototypeCache.cpp, line 219 16:54:50 INFO - ++DOCSHELL 0x12a059500 == 3 [pid = 1063] [id = 3] 16:54:50 INFO - ++DOMWINDOW == 5 (0x129aaf000) [pid = 1063] [serial = 5] [outer = 0x0] 16:54:50 INFO - ++DOCSHELL 0x12a059a00 == 4 [pid = 1063] [id = 4] 16:54:50 INFO - ++DOMWINDOW == 6 (0x129aaf400) [pid = 1063] [serial = 6] [outer = 0x0] 16:54:50 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:50 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:50 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:54:50 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 16:54:51 INFO - ++DOCSHELL 0x12bf3f600 == 5 [pid = 1063] [id = 5] 16:54:51 INFO - ++DOMWINDOW == 7 (0x129aa6c00) [pid = 1063] [serial = 7] [outer = 0x0] 16:54:51 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 16:54:51 INFO - ++DOMWINDOW == 8 (0x12c41ac00) [pid = 1063] [serial = 8] [outer = 0x129aa6c00] 16:54:51 INFO - ++DOMWINDOW == 9 (0x12cbf1800) [pid = 1063] [serial = 9] [outer = 0x129aaf000] 16:54:51 INFO - ++DOMWINDOW == 10 (0x12cbf1c00) [pid = 1063] [serial = 10] [outer = 0x129aaf400] 16:54:51 INFO - ++DOMWINDOW == 11 (0x12cbb9000) [pid = 1063] [serial = 11] [outer = 0x129aa6c00] 16:54:51 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:51 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:52 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:54:52 INFO - ++DOMWINDOW == 12 (0x12e913c00) [pid = 1063] [serial = 12] [outer = 0x129aa6c00] 16:54:52 INFO - ++DOCSHELL 0x12cb87800 == 6 [pid = 1063] [id = 6] 16:54:52 INFO - ++DOMWINDOW == 13 (0x12d4f4000) [pid = 1063] [serial = 13] [outer = 0x0] 16:54:52 INFO - ++DOMWINDOW == 14 (0x12d4f4400) [pid = 1063] [serial = 14] [outer = 0x12d4f4000] 16:54:52 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:52 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:54:52 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:54:53 INFO - ++DOCSHELL 0x1334def00 == 7 [pid = 1063] [id = 7] 16:54:53 INFO - ++DOMWINDOW == 15 (0x12a03b400) [pid = 1063] [serial = 15] [outer = 0x0] 16:54:53 INFO - ++DOMWINDOW == 16 (0x13351f000) [pid = 1063] [serial = 16] [outer = 0x12a03b400] 16:54:53 INFO - ++DOCSHELL 0x1334e0d00 == 8 [pid = 1063] [id = 8] 16:54:53 INFO - ++DOMWINDOW == 17 (0x12988f800) [pid = 1063] [serial = 17] [outer = 0x0] 16:54:53 INFO - ++DOMWINDOW == 18 (0x131a86800) [pid = 1063] [serial = 18] [outer = 0x12988f800] 16:54:53 INFO - 78 INFO TEST-START | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js 16:54:53 INFO - ++DOCSHELL 0x131b29300 == 9 [pid = 1063] [id = 9] 16:54:53 INFO - ++DOMWINDOW == 19 (0x12be91000) [pid = 1063] [serial = 19] [outer = 0x0] 16:54:53 INFO - ++DOMWINDOW == 20 (0x12be91c00) [pid = 1063] [serial = 20] [outer = 0x12be91000] 16:54:53 INFO - ++DOMWINDOW == 21 (0x12ae58400) [pid = 1063] [serial = 21] [outer = 0x12988f800] 16:54:53 INFO - ++DOCSHELL 0x1349bf300 == 10 [pid = 1063] [id = 10] 16:54:53 INFO - ++DOMWINDOW == 22 (0x133e31400) [pid = 1063] [serial = 22] [outer = 0x0] 16:54:53 INFO - ++DOMWINDOW == 23 (0x133e31c00) [pid = 1063] [serial = 23] [outer = 0x133e31400] 16:54:54 INFO - ++DOMWINDOW == 24 (0x135172800) [pid = 1063] [serial = 24] [outer = 0x133e31400] 16:54:55 INFO - ++DOCSHELL 0x13674a500 == 11 [pid = 1063] [id = 11] 16:54:55 INFO - ++DOMWINDOW == 25 (0x1351dac00) [pid = 1063] [serial = 25] [outer = 0x0] 16:54:55 INFO - ++DOMWINDOW == 26 (0x1366cd400) [pid = 1063] [serial = 26] [outer = 0x1351dac00] 16:54:56 INFO - [1063] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 16:54:56 INFO - ++DOMWINDOW == 27 (0x137fc2000) [pid = 1063] [serial = 27] [outer = 0x12be91000] 16:54:56 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:54:56 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 16:54:56 INFO - console.log: 16:54:56.653 GET http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html [HTTP/1.1 200 OK 28ms] 16:54:56 INFO - 16:54:56.691 Content Security Policy: Not supporting directive 'reflected-xss'. Directive and values will be ignored.1 16:54:57 INFO - ++DOCSHELL 0x15389bf00 == 12 [pid = 1063] [id = 12] 16:54:57 INFO - ++DOMWINDOW == 28 (0x1538a5c00) [pid = 1063] [serial = 28] [outer = 0x0] 16:54:57 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 16:54:57 INFO - ++DOMWINDOW == 29 (0x13544f000) [pid = 1063] [serial = 29] [outer = 0x1538a5c00] 16:54:57 INFO - ++DOMWINDOW == 30 (0x13544f400) [pid = 1063] [serial = 30] [outer = 0x1538a5c00] 16:54:57 INFO - ++DOCSHELL 0x11f52b700 == 13 [pid = 1063] [id = 13] 16:54:57 INFO - ++DOMWINDOW == 31 (0x11f8ccc00) [pid = 1063] [serial = 31] [outer = 0x0] 16:54:57 INFO - ++DOMWINDOW == 32 (0x11f982c00) [pid = 1063] [serial = 32] [outer = 0x11f8ccc00] 16:54:57 INFO - --DOMWINDOW == 31 (0x129aa6c00) [pid = 1063] [serial = 7] [outer = 0x0] [url = about:blank] 16:54:57 INFO - --DOMWINDOW == 30 (0x133e31c00) [pid = 1063] [serial = 23] [outer = 0x0] [url = about:blank] 16:54:57 INFO - --DOMWINDOW == 29 (0x131a86800) [pid = 1063] [serial = 18] [outer = 0x0] [url = about:blank] 16:54:57 INFO - --DOMWINDOW == 28 (0x12c41ac00) [pid = 1063] [serial = 8] [outer = 0x0] [url = about:blank] 16:54:57 INFO - --DOMWINDOW == 27 (0x12cbb9000) [pid = 1063] [serial = 11] [outer = 0x0] [url = about:blank] 16:54:58 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 16:54:58 INFO - MEMORY STAT | vsize 3741MB | residentFast 359MB | heapAllocated 104MB 16:54:58 INFO - 79 INFO TEST-OK | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js | took 4672ms 16:54:58 INFO - ++DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 14] 16:54:58 INFO - ++DOMWINDOW == 28 (0x120410c00) [pid = 1063] [serial = 33] [outer = 0x0] 16:54:58 INFO - ++DOMWINDOW == 29 (0x120538400) [pid = 1063] [serial = 34] [outer = 0x120410c00] 16:54:58 INFO - 80 INFO TEST-START | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js 16:54:58 INFO - ++DOCSHELL 0x1201fd600 == 15 [pid = 1063] [id = 15] 16:54:58 INFO - ++DOMWINDOW == 30 (0x1208c7c00) [pid = 1063] [serial = 35] [outer = 0x0] 16:54:58 INFO - ++DOMWINDOW == 31 (0x120996c00) [pid = 1063] [serial = 36] [outer = 0x1208c7c00] 16:54:58 INFO - ++DOMWINDOW == 32 (0x121627c00) [pid = 1063] [serial = 37] [outer = 0x1208c7c00] 16:54:58 INFO - ++DOCSHELL 0x121645700 == 16 [pid = 1063] [id = 16] 16:54:58 INFO - ++DOMWINDOW == 33 (0x120961400) [pid = 1063] [serial = 38] [outer = 0x0] 16:54:58 INFO - ++DOMWINDOW == 34 (0x12165f000) [pid = 1063] [serial = 39] [outer = 0x120961400] 16:54:58 INFO - ++DOMWINDOW == 35 (0x121641800) [pid = 1063] [serial = 40] [outer = 0x120961400] 16:54:58 INFO - ++DOCSHELL 0x12737d800 == 17 [pid = 1063] [id = 17] 16:54:58 INFO - ++DOMWINDOW == 36 (0x1284e0c00) [pid = 1063] [serial = 41] [outer = 0x0] 16:54:58 INFO - ++DOMWINDOW == 37 (0x1285cb800) [pid = 1063] [serial = 42] [outer = 0x1284e0c00] 16:54:59 INFO - ++DOMWINDOW == 38 (0x12df19c00) [pid = 1063] [serial = 43] [outer = 0x1208c7c00] 16:54:59 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:55:00 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 16:55:00 INFO - --DOCSHELL 0x13674a500 == 16 [pid = 1063] [id = 11] 16:55:00 INFO - --DOCSHELL 0x12bf3f600 == 15 [pid = 1063] [id = 5] 16:55:00 INFO - --DOCSHELL 0x131b29300 == 14 [pid = 1063] [id = 9] 16:55:00 INFO - --DOCSHELL 0x1349bf300 == 13 [pid = 1063] [id = 10] 16:55:00 INFO - --DOMWINDOW == 37 (0x12e913c00) [pid = 1063] [serial = 12] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 36 (0x133e31400) [pid = 1063] [serial = 22] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:01 INFO - --DOMWINDOW == 35 (0x12be91c00) [pid = 1063] [serial = 20] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 34 (0x13544f000) [pid = 1063] [serial = 29] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 33 (0x12be91000) [pid = 1063] [serial = 19] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 16:55:01 INFO - --DOMWINDOW == 32 (0x12165f000) [pid = 1063] [serial = 39] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 31 (0x12a03b400) [pid = 1063] [serial = 15] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 30 (0x120996c00) [pid = 1063] [serial = 36] [outer = 0x0] [url = about:blank] 16:55:01 INFO - --DOMWINDOW == 29 (0x1351dac00) [pid = 1063] [serial = 25] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:01 INFO - --DOMWINDOW == 28 (0x137fc2000) [pid = 1063] [serial = 27] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 16:55:01 INFO - MEMORY STAT | vsize 3750MB | residentFast 367MB | heapAllocated 103MB 16:55:01 INFO - 81 INFO TEST-OK | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js | took 3016ms 16:55:01 INFO - ++DOCSHELL 0x12092ab00 == 14 [pid = 1063] [id = 18] 16:55:01 INFO - ++DOMWINDOW == 29 (0x11fe61000) [pid = 1063] [serial = 44] [outer = 0x0] 16:55:01 INFO - ++DOMWINDOW == 30 (0x120135c00) [pid = 1063] [serial = 45] [outer = 0x11fe61000] 16:55:01 INFO - 82 INFO TEST-START | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js 16:55:01 INFO - ++DOCSHELL 0x121c22000 == 15 [pid = 1063] [id = 19] 16:55:01 INFO - ++DOMWINDOW == 31 (0x121770000) [pid = 1063] [serial = 46] [outer = 0x0] 16:55:01 INFO - ++DOMWINDOW == 32 (0x1217a3000) [pid = 1063] [serial = 47] [outer = 0x121770000] 16:55:01 INFO - ++DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 48] [outer = 0x121770000] 16:55:01 INFO - ++DOCSHELL 0x127a9f200 == 16 [pid = 1063] [id = 20] 16:55:01 INFO - ++DOMWINDOW == 34 (0x12177fc00) [pid = 1063] [serial = 49] [outer = 0x0] 16:55:01 INFO - ++DOMWINDOW == 35 (0x121c61000) [pid = 1063] [serial = 50] [outer = 0x12177fc00] 16:55:01 INFO - ++DOMWINDOW == 36 (0x127ace000) [pid = 1063] [serial = 51] [outer = 0x12177fc00] 16:55:01 INFO - ++DOCSHELL 0x1298de000 == 17 [pid = 1063] [id = 21] 16:55:01 INFO - ++DOMWINDOW == 37 (0x12bb66000) [pid = 1063] [serial = 52] [outer = 0x0] 16:55:01 INFO - ++DOMWINDOW == 38 (0x12be38800) [pid = 1063] [serial = 53] [outer = 0x12bb66000] 16:55:03 INFO - ++DOMWINDOW == 39 (0x13351f800) [pid = 1063] [serial = 54] [outer = 0x121770000] 16:55:03 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:55:03 INFO - --DOCSHELL 0x12737d800 == 16 [pid = 1063] [id = 17] 16:55:03 INFO - --DOCSHELL 0x1334def00 == 15 [pid = 1063] [id = 7] 16:55:03 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 14] 16:55:03 INFO - --DOCSHELL 0x1201fd600 == 13 [pid = 1063] [id = 15] 16:55:03 INFO - --DOCSHELL 0x121645700 == 12 [pid = 1063] [id = 16] 16:55:03 INFO - --DOMWINDOW == 38 (0x1366cd400) [pid = 1063] [serial = 26] [outer = 0x0] [url = about:blank] 16:55:03 INFO - --DOMWINDOW == 37 (0x135172800) [pid = 1063] [serial = 24] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:03 INFO - --DOMWINDOW == 36 (0x13351f000) [pid = 1063] [serial = 16] [outer = 0x0] [url = about:blank] 16:55:04 INFO - --DOMWINDOW == 35 (0x1217a3000) [pid = 1063] [serial = 47] [outer = 0x0] [url = about:blank] 16:55:04 INFO - --DOMWINDOW == 34 (0x121c61000) [pid = 1063] [serial = 50] [outer = 0x0] [url = about:blank] 16:55:04 INFO - --DOMWINDOW == 33 (0x120961400) [pid = 1063] [serial = 38] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:04 INFO - --DOMWINDOW == 32 (0x1208c7c00) [pid = 1063] [serial = 35] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:04 INFO - --DOMWINDOW == 31 (0x120410c00) [pid = 1063] [serial = 33] [outer = 0x0] [url = about:blank] 16:55:04 INFO - --DOMWINDOW == 30 (0x1284e0c00) [pid = 1063] [serial = 41] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:04 INFO - --DOMWINDOW == 29 (0x12df19c00) [pid = 1063] [serial = 43] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-console.html] 16:55:04 INFO - --DOMWINDOW == 28 (0x121627c00) [pid = 1063] [serial = 37] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:04 INFO - MEMORY STAT | vsize 3758MB | residentFast 372MB | heapAllocated 108MB 16:55:04 INFO - 83 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js | took 2778ms 16:55:04 INFO - ++DOCSHELL 0x1201f9000 == 13 [pid = 1063] [id = 22] 16:55:04 INFO - ++DOMWINDOW == 29 (0x11fefd000) [pid = 1063] [serial = 55] [outer = 0x0] 16:55:04 INFO - ++DOMWINDOW == 30 (0x12024a800) [pid = 1063] [serial = 56] [outer = 0x11fefd000] 16:55:04 INFO - 84 INFO TEST-START | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js 16:55:04 INFO - ++DOCSHELL 0x12092a600 == 14 [pid = 1063] [id = 23] 16:55:04 INFO - ++DOMWINDOW == 31 (0x1208c7c00) [pid = 1063] [serial = 57] [outer = 0x0] 16:55:04 INFO - ++DOMWINDOW == 32 (0x12177f400) [pid = 1063] [serial = 58] [outer = 0x1208c7c00] 16:55:04 INFO - ++DOCSHELL 0x12172f800 == 15 [pid = 1063] [id = 24] 16:55:04 INFO - ++DOMWINDOW == 33 (0x121627c00) [pid = 1063] [serial = 59] [outer = 0x0] 16:55:04 INFO - ++DOMWINDOW == 34 (0x126671000) [pid = 1063] [serial = 60] [outer = 0x121627c00] 16:55:04 INFO - ++DOMWINDOW == 35 (0x1276eb000) [pid = 1063] [serial = 61] [outer = 0x121627c00] 16:55:04 INFO - ++DOCSHELL 0x127a9ca00 == 16 [pid = 1063] [id = 25] 16:55:04 INFO - ++DOMWINDOW == 36 (0x12a0bf000) [pid = 1063] [serial = 62] [outer = 0x0] 16:55:04 INFO - ++DOMWINDOW == 37 (0x12a0e6800) [pid = 1063] [serial = 63] [outer = 0x12a0bf000] 16:55:05 INFO - DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 16:55:05 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 16:55:05 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 16:55:05 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 16:55:05 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 16:55:05 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 16:55:05 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1547:14 16:55:05 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1545:24 16:55:05 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 16:55:05 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:949:5 16:55:05 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 16:55:05 INFO - @debugger eval code:1:31 16:55:05 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 16:55:05 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 16:55:05 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 16:55:05 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1599:15 16:55:05 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:55:05 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:55:05 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:55:05 INFO - console.warn: DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 16:55:05 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 16:55:05 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 16:55:05 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 16:55:05 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 16:55:05 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 16:55:05 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1547:14 16:55:05 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1545:24 16:55:05 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 16:55:05 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:949:5 16:55:05 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 16:55:05 INFO - @debugger eval code:1:31 16:55:05 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 16:55:05 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 16:55:05 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 16:55:05 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1599:15 16:55:05 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:55:05 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:55:05 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:55:05 INFO - ++DOCSHELL 0x11f881400 == 17 [pid = 1063] [id = 26] 16:55:05 INFO - ++DOMWINDOW == 38 (0x12ea1c000) [pid = 1063] [serial = 64] [outer = 0x0] 16:55:05 INFO - ++DOMWINDOW == 39 (0x12cee8400) [pid = 1063] [serial = 65] [outer = 0x12ea1c000] 16:55:05 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 16:55:06 INFO - [1063] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 16:55:06 INFO - [1063] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 16:55:09 INFO - --DOCSHELL 0x11f881400 == 16 [pid = 1063] [id = 26] 16:55:11 INFO - --DOCSHELL 0x1298de000 == 15 [pid = 1063] [id = 21] 16:55:11 INFO - --DOCSHELL 0x12092ab00 == 14 [pid = 1063] [id = 18] 16:55:11 INFO - --DOCSHELL 0x12172f800 == 13 [pid = 1063] [id = 24] 16:55:11 INFO - --DOCSHELL 0x127a9f200 == 12 [pid = 1063] [id = 20] 16:55:11 INFO - --DOCSHELL 0x127a9ca00 == 11 [pid = 1063] [id = 25] 16:55:11 INFO - --DOCSHELL 0x121c22000 == 10 [pid = 1063] [id = 19] 16:55:11 INFO - --DOMWINDOW == 38 (0x1285cb800) [pid = 1063] [serial = 42] [outer = 0x0] [url = about:blank] 16:55:11 INFO - --DOMWINDOW == 37 (0x121641800) [pid = 1063] [serial = 40] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:11 INFO - --DOMWINDOW == 36 (0x12664d400) [pid = 1063] [serial = 48] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446162901445] 16:55:11 INFO - --DOMWINDOW == 35 (0x120538400) [pid = 1063] [serial = 34] [outer = 0x0] [url = about:blank] 16:55:11 INFO - --DOMWINDOW == 34 (0x126671000) [pid = 1063] [serial = 60] [outer = 0x0] [url = about:blank] 16:55:11 INFO - --DOMWINDOW == 33 (0x11fe61000) [pid = 1063] [serial = 44] [outer = 0x0] [url = about:blank] 16:55:11 INFO - --DOMWINDOW == 32 (0x120135c00) [pid = 1063] [serial = 45] [outer = 0x0] [url = about:blank] 16:55:11 INFO - --DOMWINDOW == 31 (0x12bb66000) [pid = 1063] [serial = 52] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:11 INFO - --DOMWINDOW == 30 (0x12177fc00) [pid = 1063] [serial = 49] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:11 INFO - --DOMWINDOW == 29 (0x121770000) [pid = 1063] [serial = 46] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446162901445] 16:55:11 INFO - --DOMWINDOW == 28 (0x13351f800) [pid = 1063] [serial = 54] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446162901445] 16:55:11 INFO - MEMORY STAT | vsize 3760MB | residentFast 372MB | heapAllocated 108MB 16:55:11 INFO - 85 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js | took 6942ms 16:55:11 INFO - ++DOCSHELL 0x120196f00 == 11 [pid = 1063] [id = 27] 16:55:11 INFO - ++DOMWINDOW == 29 (0x1200e3400) [pid = 1063] [serial = 66] [outer = 0x0] 16:55:11 INFO - ++DOMWINDOW == 30 (0x120316800) [pid = 1063] [serial = 67] [outer = 0x1200e3400] 16:55:11 INFO - 86 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js 16:55:11 INFO - ++DOCSHELL 0x121645700 == 12 [pid = 1063] [id = 28] 16:55:11 INFO - ++DOMWINDOW == 31 (0x11f9bb000) [pid = 1063] [serial = 68] [outer = 0x0] 16:55:11 INFO - ++DOMWINDOW == 32 (0x1209dec00) [pid = 1063] [serial = 69] [outer = 0x11f9bb000] 16:55:11 INFO - ++DOMWINDOW == 33 (0x12177fc00) [pid = 1063] [serial = 70] [outer = 0x11f9bb000] 16:55:11 INFO - ++DOCSHELL 0x1201fa900 == 13 [pid = 1063] [id = 29] 16:55:11 INFO - ++DOMWINDOW == 34 (0x1208c7400) [pid = 1063] [serial = 71] [outer = 0x0] 16:55:11 INFO - ++DOMWINDOW == 35 (0x12664d400) [pid = 1063] [serial = 72] [outer = 0x1208c7400] 16:55:11 INFO - ++DOMWINDOW == 36 (0x121763c00) [pid = 1063] [serial = 73] [outer = 0x1208c7400] 16:55:11 INFO - ++DOCSHELL 0x127b2e000 == 14 [pid = 1063] [id = 30] 16:55:11 INFO - ++DOMWINDOW == 37 (0x129f83800) [pid = 1063] [serial = 74] [outer = 0x0] 16:55:11 INFO - ++DOMWINDOW == 38 (0x12a03bc00) [pid = 1063] [serial = 75] [outer = 0x129f83800] 16:55:12 INFO - ++DOCSHELL 0x131a99400 == 15 [pid = 1063] [id = 31] 16:55:12 INFO - ++DOMWINDOW == 39 (0x1333da400) [pid = 1063] [serial = 76] [outer = 0x0] 16:55:12 INFO - ++DOMWINDOW == 40 (0x1333dac00) [pid = 1063] [serial = 77] [outer = 0x1333da400] 16:55:14 INFO - --DOCSHELL 0x127b2e000 == 14 [pid = 1063] [id = 30] 16:55:14 INFO - --DOCSHELL 0x1201f9000 == 13 [pid = 1063] [id = 22] 16:55:14 INFO - --DOCSHELL 0x12092a600 == 12 [pid = 1063] [id = 23] 16:55:14 INFO - --DOCSHELL 0x131a99400 == 11 [pid = 1063] [id = 31] 16:55:14 INFO - --DOMWINDOW == 39 (0x12be38800) [pid = 1063] [serial = 53] [outer = 0x0] [url = about:blank] 16:55:14 INFO - --DOMWINDOW == 38 (0x127ace000) [pid = 1063] [serial = 51] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:14 INFO - --DOMWINDOW == 37 (0x12ea1c000) [pid = 1063] [serial = 64] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:14 INFO - --DOMWINDOW == 36 (0x1208c7c00) [pid = 1063] [serial = 57] [outer = 0x0] [url = data:text/html;charset=utf8,

test%20for%20bug%20862916] 16:55:14 INFO - --DOMWINDOW == 35 (0x12664d400) [pid = 1063] [serial = 72] [outer = 0x0] [url = about:blank] 16:55:14 INFO - --DOMWINDOW == 34 (0x1209dec00) [pid = 1063] [serial = 69] [outer = 0x0] [url = about:blank] 16:55:14 INFO - --DOMWINDOW == 33 (0x11fefd000) [pid = 1063] [serial = 55] [outer = 0x0] [url = about:blank] 16:55:14 INFO - --DOMWINDOW == 32 (0x12024a800) [pid = 1063] [serial = 56] [outer = 0x0] [url = about:blank] 16:55:14 INFO - --DOMWINDOW == 31 (0x121627c00) [pid = 1063] [serial = 59] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:14 INFO - --DOMWINDOW == 30 (0x12a0bf000) [pid = 1063] [serial = 62] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:14 INFO - MEMORY STAT | vsize 3764MB | residentFast 380MB | heapAllocated 111MB 16:55:14 INFO - 87 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js | took 3073ms 16:55:14 INFO - ++DOCSHELL 0x12019a100 == 12 [pid = 1063] [id = 32] 16:55:14 INFO - ++DOMWINDOW == 31 (0x121627c00) [pid = 1063] [serial = 78] [outer = 0x0] 16:55:14 INFO - ++DOMWINDOW == 32 (0x121c44000) [pid = 1063] [serial = 79] [outer = 0x121627c00] 16:55:14 INFO - 88 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js 16:55:14 INFO - ++DOCSHELL 0x12092ab00 == 13 [pid = 1063] [id = 33] 16:55:14 INFO - ++DOMWINDOW == 33 (0x126655400) [pid = 1063] [serial = 80] [outer = 0x0] 16:55:14 INFO - ++DOMWINDOW == 34 (0x127ace000) [pid = 1063] [serial = 81] [outer = 0x126655400] 16:55:14 INFO - ++DOMWINDOW == 35 (0x127bc1400) [pid = 1063] [serial = 82] [outer = 0x126655400] 16:55:14 INFO - ++DOCSHELL 0x1266a6e00 == 14 [pid = 1063] [id = 34] 16:55:14 INFO - ++DOMWINDOW == 36 (0x127a78000) [pid = 1063] [serial = 83] [outer = 0x0] 16:55:14 INFO - ++DOMWINDOW == 37 (0x127bc8400) [pid = 1063] [serial = 84] [outer = 0x127a78000] 16:55:15 INFO - ++DOMWINDOW == 38 (0x127b8fc00) [pid = 1063] [serial = 85] [outer = 0x127a78000] 16:55:15 INFO - ++DOCSHELL 0x127b2ea00 == 15 [pid = 1063] [id = 35] 16:55:15 INFO - ++DOMWINDOW == 39 (0x12c78f800) [pid = 1063] [serial = 86] [outer = 0x0] 16:55:15 INFO - ++DOMWINDOW == 40 (0x12c7b5c00) [pid = 1063] [serial = 87] [outer = 0x12c78f800] 16:55:16 INFO - ++DOCSHELL 0x12c822e00 == 16 [pid = 1063] [id = 36] 16:55:16 INFO - ++DOMWINDOW == 41 (0x131b3e800) [pid = 1063] [serial = 88] [outer = 0x0] 16:55:16 INFO - ++DOMWINDOW == 42 (0x131b3ec00) [pid = 1063] [serial = 89] [outer = 0x131b3e800] 16:55:16 INFO - ++DOCSHELL 0x12d4c1600 == 17 [pid = 1063] [id = 37] 16:55:16 INFO - ++DOMWINDOW == 43 (0x1335ff400) [pid = 1063] [serial = 90] [outer = 0x0] 16:55:16 INFO - ++DOMWINDOW == 44 (0x134066400) [pid = 1063] [serial = 91] [outer = 0x1335ff400] 16:55:17 INFO - --DOCSHELL 0x121645700 == 16 [pid = 1063] [id = 28] 16:55:17 INFO - --DOCSHELL 0x120196f00 == 15 [pid = 1063] [id = 27] 16:55:17 INFO - --DOCSHELL 0x1201fa900 == 14 [pid = 1063] [id = 29] 16:55:17 INFO - --DOCSHELL 0x127b2ea00 == 13 [pid = 1063] [id = 35] 16:55:17 INFO - --DOCSHELL 0x12c822e00 == 12 [pid = 1063] [id = 36] 16:55:17 INFO - --DOCSHELL 0x12d4c1600 == 11 [pid = 1063] [id = 37] 16:55:17 INFO - --DOMWINDOW == 43 (0x12177f400) [pid = 1063] [serial = 58] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 42 (0x12cee8400) [pid = 1063] [serial = 65] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:17 INFO - --DOMWINDOW == 41 (0x12a0e6800) [pid = 1063] [serial = 63] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 40 (0x1276eb000) [pid = 1063] [serial = 61] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:17 INFO - --DOMWINDOW == 39 (0x127ace000) [pid = 1063] [serial = 81] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 38 (0x120316800) [pid = 1063] [serial = 67] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 37 (0x1333da400) [pid = 1063] [serial = 76] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:17 INFO - --DOMWINDOW == 36 (0x127bc8400) [pid = 1063] [serial = 84] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 35 (0x131b3e800) [pid = 1063] [serial = 88] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:17 INFO - --DOMWINDOW == 34 (0x1208c7400) [pid = 1063] [serial = 71] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:17 INFO - --DOMWINDOW == 33 (0x129f83800) [pid = 1063] [serial = 74] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:17 INFO - --DOMWINDOW == 32 (0x11f9bb000) [pid = 1063] [serial = 68] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 16:55:17 INFO - --DOMWINDOW == 31 (0x1200e3400) [pid = 1063] [serial = 66] [outer = 0x0] [url = about:blank] 16:55:17 INFO - --DOMWINDOW == 30 (0x12177fc00) [pid = 1063] [serial = 70] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 16:55:17 INFO - MEMORY STAT | vsize 3761MB | residentFast 377MB | heapAllocated 105MB 16:55:17 INFO - 89 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js | took 2972ms 16:55:17 INFO - ++DOCSHELL 0x120196f00 == 12 [pid = 1063] [id = 38] 16:55:17 INFO - ++DOMWINDOW == 31 (0x120410c00) [pid = 1063] [serial = 92] [outer = 0x0] 16:55:17 INFO - ++DOMWINDOW == 32 (0x1205f8800) [pid = 1063] [serial = 93] [outer = 0x120410c00] 16:55:17 INFO - 90 INFO TEST-START | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js 16:55:17 INFO - ++DOCSHELL 0x120926a00 == 13 [pid = 1063] [id = 39] 16:55:17 INFO - ++DOMWINDOW == 33 (0x1208c7400) [pid = 1063] [serial = 94] [outer = 0x0] 16:55:17 INFO - ++DOMWINDOW == 34 (0x1217a3000) [pid = 1063] [serial = 95] [outer = 0x1208c7400] 16:55:17 INFO - ++DOCSHELL 0x12172e400 == 14 [pid = 1063] [id = 40] 16:55:17 INFO - ++DOMWINDOW == 35 (0x12177fc00) [pid = 1063] [serial = 96] [outer = 0x0] 16:55:17 INFO - ++DOMWINDOW == 36 (0x127ace000) [pid = 1063] [serial = 97] [outer = 0x12177fc00] 16:55:18 INFO - ++DOMWINDOW == 37 (0x127b8b000) [pid = 1063] [serial = 98] [outer = 0x12177fc00] 16:55:18 INFO - ++DOCSHELL 0x127766500 == 15 [pid = 1063] [id = 41] 16:55:18 INFO - ++DOMWINDOW == 38 (0x12a1e1800) [pid = 1063] [serial = 99] [outer = 0x0] 16:55:18 INFO - ++DOMWINDOW == 39 (0x12c6b9400) [pid = 1063] [serial = 100] [outer = 0x12a1e1800] 16:55:19 INFO - ++DOMWINDOW == 40 (0x12e296400) [pid = 1063] [serial = 101] [outer = 0x1208c7400] 16:55:19 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:55:19 INFO - ++DOCSHELL 0x12cb89b00 == 16 [pid = 1063] [id = 42] 16:55:19 INFO - ++DOMWINDOW == 41 (0x12e31e800) [pid = 1063] [serial = 102] [outer = 0x0] 16:55:19 INFO - ++DOMWINDOW == 42 (0x12e31ec00) [pid = 1063] [serial = 103] [outer = 0x12e31e800] 16:55:19 INFO - ++DOMWINDOW == 43 (0x1335ffc00) [pid = 1063] [serial = 104] [outer = 0x12e31e800] 16:55:19 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:55:19 INFO - ++DOCSHELL 0x131b29d00 == 17 [pid = 1063] [id = 43] 16:55:19 INFO - ++DOMWINDOW == 44 (0x13628a800) [pid = 1063] [serial = 105] [outer = 0x0] 16:55:19 INFO - ++DOMWINDOW == 45 (0x136333800) [pid = 1063] [serial = 106] [outer = 0x13628a800] 16:55:20 INFO - --DOCSHELL 0x12019a100 == 16 [pid = 1063] [id = 32] 16:55:20 INFO - --DOCSHELL 0x1266a6e00 == 15 [pid = 1063] [id = 34] 16:55:20 INFO - --DOCSHELL 0x127766500 == 14 [pid = 1063] [id = 41] 16:55:20 INFO - --DOCSHELL 0x131b29d00 == 13 [pid = 1063] [id = 43] 16:55:20 INFO - --DOCSHELL 0x12092ab00 == 12 [pid = 1063] [id = 33] 16:55:20 INFO - --DOMWINDOW == 44 (0x121763c00) [pid = 1063] [serial = 73] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:20 INFO - --DOMWINDOW == 43 (0x12a03bc00) [pid = 1063] [serial = 75] [outer = 0x0] [url = about:blank] 16:55:20 INFO - --DOMWINDOW == 42 (0x1333dac00) [pid = 1063] [serial = 77] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:20 INFO - --DOMWINDOW == 41 (0x131b3ec00) [pid = 1063] [serial = 89] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:20 INFO - --DOMWINDOW == 40 (0x127ace000) [pid = 1063] [serial = 97] [outer = 0x0] [url = about:blank] 16:55:20 INFO - --DOMWINDOW == 39 (0x121c44000) [pid = 1063] [serial = 79] [outer = 0x0] [url = about:blank] 16:55:20 INFO - --DOMWINDOW == 38 (0x12e31ec00) [pid = 1063] [serial = 103] [outer = 0x0] [url = about:blank] 16:55:20 INFO - --DOMWINDOW == 37 (0x127a78000) [pid = 1063] [serial = 83] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:20 INFO - --DOMWINDOW == 36 (0x12c78f800) [pid = 1063] [serial = 86] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:20 INFO - --DOMWINDOW == 35 (0x121627c00) [pid = 1063] [serial = 78] [outer = 0x0] [url = about:blank] 16:55:20 INFO - --DOMWINDOW == 34 (0x126655400) [pid = 1063] [serial = 80] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:55:20 INFO - --DOMWINDOW == 33 (0x1335ff400) [pid = 1063] [serial = 90] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:20 INFO - --DOMWINDOW == 32 (0x127bc1400) [pid = 1063] [serial = 82] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:55:20 INFO - MEMORY STAT | vsize 3763MB | residentFast 374MB | heapAllocated 102MB 16:55:20 INFO - 91 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js | took 3078ms 16:55:20 INFO - ++DOCSHELL 0x120926500 == 13 [pid = 1063] [id = 44] 16:55:20 INFO - ++DOMWINDOW == 33 (0x1209dec00) [pid = 1063] [serial = 107] [outer = 0x0] 16:55:20 INFO - ++DOMWINDOW == 34 (0x121641000) [pid = 1063] [serial = 108] [outer = 0x1209dec00] 16:55:20 INFO - 92 INFO TEST-START | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js 16:55:20 INFO - ++DOCSHELL 0x121c24d00 == 14 [pid = 1063] [id = 45] 16:55:20 INFO - ++DOMWINDOW == 35 (0x12177f400) [pid = 1063] [serial = 109] [outer = 0x0] 16:55:21 INFO - ++DOMWINDOW == 36 (0x12664d400) [pid = 1063] [serial = 110] [outer = 0x12177f400] 16:55:21 INFO - ++DOCSHELL 0x12737d800 == 15 [pid = 1063] [id = 46] 16:55:21 INFO - ++DOMWINDOW == 37 (0x11f8b6400) [pid = 1063] [serial = 111] [outer = 0x0] 16:55:21 INFO - ++DOMWINDOW == 38 (0x121c44000) [pid = 1063] [serial = 112] [outer = 0x11f8b6400] 16:55:21 INFO - ++DOMWINDOW == 39 (0x127a78000) [pid = 1063] [serial = 113] [outer = 0x11f8b6400] 16:55:21 INFO - ++DOCSHELL 0x1285b2f00 == 16 [pid = 1063] [id = 47] 16:55:21 INFO - ++DOMWINDOW == 40 (0x12a1d4800) [pid = 1063] [serial = 114] [outer = 0x0] 16:55:21 INFO - ++DOMWINDOW == 41 (0x12be38800) [pid = 1063] [serial = 115] [outer = 0x12a1d4800] 16:55:22 INFO - --DOCSHELL 0x12cb89b00 == 15 [pid = 1063] [id = 42] 16:55:22 INFO - --DOCSHELL 0x12172e400 == 14 [pid = 1063] [id = 40] 16:55:22 INFO - --DOCSHELL 0x1285b2f00 == 13 [pid = 1063] [id = 47] 16:55:22 INFO - --DOCSHELL 0x120926a00 == 12 [pid = 1063] [id = 39] 16:55:22 INFO - --DOMWINDOW == 40 (0x12c7b5c00) [pid = 1063] [serial = 87] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 39 (0x127b8fc00) [pid = 1063] [serial = 85] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:22 INFO - --DOMWINDOW == 38 (0x134066400) [pid = 1063] [serial = 91] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:22 INFO - --DOMWINDOW == 37 (0x1217a3000) [pid = 1063] [serial = 95] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 36 (0x1205f8800) [pid = 1063] [serial = 93] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 35 (0x121c44000) [pid = 1063] [serial = 112] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 34 (0x12177f400) [pid = 1063] [serial = 109] [outer = 0x0] [url = data:text/html;charset=utf8,bug871156

hello%20world] 16:55:22 INFO - --DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 110] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 32 (0x12177fc00) [pid = 1063] [serial = 96] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:22 INFO - --DOMWINDOW == 31 (0x13628a800) [pid = 1063] [serial = 105] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:22 INFO - --DOMWINDOW == 30 (0x12a1e1800) [pid = 1063] [serial = 99] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:22 INFO - --DOMWINDOW == 29 (0x12e31e800) [pid = 1063] [serial = 102] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 16:55:22 INFO - --DOMWINDOW == 28 (0x1208c7400) [pid = 1063] [serial = 94] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 16:55:22 INFO - --DOMWINDOW == 27 (0x120410c00) [pid = 1063] [serial = 92] [outer = 0x0] [url = about:blank] 16:55:22 INFO - --DOMWINDOW == 26 (0x1335ffc00) [pid = 1063] [serial = 104] [outer = 0x0] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 16:55:22 INFO - --DOMWINDOW == 25 (0x12e296400) [pid = 1063] [serial = 101] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 16:55:23 INFO - ++DOCSHELL 0x1201ad000 == 13 [pid = 1063] [id = 48] 16:55:23 INFO - ++DOMWINDOW == 26 (0x11f5c0400) [pid = 1063] [serial = 116] [outer = 0x0] 16:55:23 INFO - ++DOMWINDOW == 27 (0x11f840c00) [pid = 1063] [serial = 117] [outer = 0x11f5c0400] 16:55:23 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:23 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:23 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:23 INFO - MEMORY STAT | vsize 3743MB | residentFast 355MB | heapAllocated 102MB 16:55:23 INFO - 93 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js | took 2580ms 16:55:23 INFO - ++DOCSHELL 0x12092a600 == 14 [pid = 1063] [id = 49] 16:55:23 INFO - ++DOMWINDOW == 28 (0x128c59800) [pid = 1063] [serial = 118] [outer = 0x0] 16:55:23 INFO - ++DOMWINDOW == 29 (0x128d3a400) [pid = 1063] [serial = 119] [outer = 0x128c59800] 16:55:23 INFO - 94 INFO TEST-START | devtools/client/webconsole/test/browser_cached_messages.js 16:55:23 INFO - ++DOCSHELL 0x1266a6900 == 15 [pid = 1063] [id = 50] 16:55:23 INFO - ++DOMWINDOW == 30 (0x128eab800) [pid = 1063] [serial = 120] [outer = 0x0] 16:55:23 INFO - ++DOMWINDOW == 31 (0x128ffb000) [pid = 1063] [serial = 121] [outer = 0x128eab800] 16:55:23 INFO - ++DOMWINDOW == 32 (0x12976bc00) [pid = 1063] [serial = 122] [outer = 0x128eab800] 16:55:23 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html, line 15: TypeError: foo.bazBug611032 is not a function 16:55:23 INFO - ++DOCSHELL 0x1201b1600 == 16 [pid = 1063] [id = 51] 16:55:23 INFO - ++DOMWINDOW == 33 (0x11f856c00) [pid = 1063] [serial = 123] [outer = 0x0] 16:55:23 INFO - ++DOMWINDOW == 34 (0x11f8aec00) [pid = 1063] [serial = 124] [outer = 0x11f856c00] 16:55:24 INFO - ++DOMWINDOW == 35 (0x11fadc400) [pid = 1063] [serial = 125] [outer = 0x11f856c00] 16:55:24 INFO - ++DOCSHELL 0x1285b3e00 == 17 [pid = 1063] [id = 52] 16:55:24 INFO - ++DOMWINDOW == 36 (0x1308aa000) [pid = 1063] [serial = 126] [outer = 0x0] 16:55:24 INFO - ++DOMWINDOW == 37 (0x130a21c00) [pid = 1063] [serial = 127] [outer = 0x1308aa000] 16:55:25 INFO - --DOCSHELL 0x121c24d00 == 16 [pid = 1063] [id = 45] 16:55:25 INFO - --DOCSHELL 0x12737d800 == 15 [pid = 1063] [id = 46] 16:55:25 INFO - --DOCSHELL 0x120196f00 == 14 [pid = 1063] [id = 38] 16:55:25 INFO - --DOCSHELL 0x1285b3e00 == 13 [pid = 1063] [id = 52] 16:55:25 INFO - --DOMWINDOW == 36 (0x136333800) [pid = 1063] [serial = 106] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:25 INFO - --DOMWINDOW == 35 (0x12c6b9400) [pid = 1063] [serial = 100] [outer = 0x0] [url = about:blank] 16:55:25 INFO - --DOMWINDOW == 34 (0x127b8b000) [pid = 1063] [serial = 98] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:25 INFO - --DOMWINDOW == 33 (0x128ffb000) [pid = 1063] [serial = 121] [outer = 0x0] [url = about:blank] 16:55:25 INFO - --DOMWINDOW == 32 (0x121641000) [pid = 1063] [serial = 108] [outer = 0x0] [url = about:blank] 16:55:25 INFO - --DOMWINDOW == 31 (0x11f8aec00) [pid = 1063] [serial = 124] [outer = 0x0] [url = about:blank] 16:55:25 INFO - --DOMWINDOW == 30 (0x12a1d4800) [pid = 1063] [serial = 114] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:25 INFO - --DOMWINDOW == 29 (0x11f8b6400) [pid = 1063] [serial = 111] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:25 INFO - --DOMWINDOW == 28 (0x1209dec00) [pid = 1063] [serial = 107] [outer = 0x0] [url = about:blank] 16:55:25 INFO - ++DOCSHELL 0x11f881400 == 14 [pid = 1063] [id = 53] 16:55:25 INFO - ++DOMWINDOW == 29 (0x11f8b6400) [pid = 1063] [serial = 128] [outer = 0x0] 16:55:25 INFO - ++DOMWINDOW == 30 (0x11f9a5c00) [pid = 1063] [serial = 129] [outer = 0x11f8b6400] 16:55:25 INFO - ++DOMWINDOW == 31 (0x11fb24c00) [pid = 1063] [serial = 130] [outer = 0x11f8b6400] 16:55:26 INFO - ++DOCSHELL 0x1201fd600 == 15 [pid = 1063] [id = 54] 16:55:26 INFO - ++DOMWINDOW == 32 (0x1299ab000) [pid = 1063] [serial = 131] [outer = 0x0] 16:55:26 INFO - ++DOMWINDOW == 33 (0x1299ac000) [pid = 1063] [serial = 132] [outer = 0x1299ab000] 16:55:27 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 48] 16:55:27 INFO - --DOCSHELL 0x120926500 == 13 [pid = 1063] [id = 44] 16:55:27 INFO - --DOCSHELL 0x1201fd600 == 12 [pid = 1063] [id = 54] 16:55:27 INFO - --DOCSHELL 0x1201b1600 == 11 [pid = 1063] [id = 51] 16:55:27 INFO - --DOMWINDOW == 32 (0x12be38800) [pid = 1063] [serial = 115] [outer = 0x0] [url = about:blank] 16:55:27 INFO - --DOMWINDOW == 31 (0x127a78000) [pid = 1063] [serial = 113] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:27 INFO - --DOMWINDOW == 30 (0x11f9a5c00) [pid = 1063] [serial = 129] [outer = 0x0] [url = about:blank] 16:55:27 INFO - --DOMWINDOW == 29 (0x11f856c00) [pid = 1063] [serial = 123] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:27 INFO - --DOMWINDOW == 28 (0x11f5c0400) [pid = 1063] [serial = 116] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:27 INFO - --DOMWINDOW == 27 (0x1308aa000) [pid = 1063] [serial = 126] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:27 INFO - MEMORY STAT | vsize 3761MB | residentFast 369MB | heapAllocated 100MB 16:55:27 INFO - 95 INFO TEST-OK | devtools/client/webconsole/test/browser_cached_messages.js | took 3983ms 16:55:27 INFO - ++DOCSHELL 0x12019a100 == 12 [pid = 1063] [id = 55] 16:55:27 INFO - ++DOMWINDOW == 28 (0x120316800) [pid = 1063] [serial = 133] [outer = 0x0] 16:55:27 INFO - ++DOMWINDOW == 29 (0x120541000) [pid = 1063] [serial = 134] [outer = 0x120316800] 16:55:27 INFO - 96 INFO TEST-START | devtools/client/webconsole/test/browser_console.js 16:55:27 INFO - ++DOCSHELL 0x121642f00 == 13 [pid = 1063] [id = 56] 16:55:27 INFO - ++DOMWINDOW == 30 (0x1209f3800) [pid = 1063] [serial = 135] [outer = 0x0] 16:55:27 INFO - ++DOMWINDOW == 31 (0x121763c00) [pid = 1063] [serial = 136] [outer = 0x1209f3800] 16:55:27 INFO - ++DOMWINDOW == 32 (0x121c1c400) [pid = 1063] [serial = 137] [outer = 0x1209f3800] 16:55:28 INFO - ++DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 57] 16:55:28 INFO - ++DOMWINDOW == 33 (0x1200e3000) [pid = 1063] [serial = 138] [outer = 0x0] 16:55:28 INFO - ++DOMWINDOW == 34 (0x121c44000) [pid = 1063] [serial = 139] [outer = 0x1200e3000] 16:55:28 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:28 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:28 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:28 INFO - JavaScript error: chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_console.js, line 38: ReferenceError: foobarExceptionBug587757 is not defined 16:55:28 INFO - console.log: xhr loaded, status is: 200 16:55:28 INFO - console.log: xhr error loaded, status is: 404 16:55:29 INFO - MEMORY STAT | vsize 3746MB | residentFast 354MB | heapAllocated 105MB 16:55:29 INFO - 97 INFO TEST-OK | devtools/client/webconsole/test/browser_console.js | took 1322ms 16:55:29 INFO - ++DOCSHELL 0x129708000 == 15 [pid = 1063] [id = 58] 16:55:29 INFO - ++DOMWINDOW == 35 (0x127f4e000) [pid = 1063] [serial = 140] [outer = 0x0] 16:55:29 INFO - ++DOMWINDOW == 36 (0x127f51000) [pid = 1063] [serial = 141] [outer = 0x127f4e000] 16:55:29 INFO - 98 INFO TEST-START | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js 16:55:29 INFO - ++DOCSHELL 0x129f9a300 == 16 [pid = 1063] [id = 59] 16:55:29 INFO - ++DOMWINDOW == 37 (0x128696800) [pid = 1063] [serial = 142] [outer = 0x0] 16:55:29 INFO - ++DOMWINDOW == 38 (0x128fcf800) [pid = 1063] [serial = 143] [outer = 0x128696800] 16:55:29 INFO - ++DOCSHELL 0x12a05c700 == 17 [pid = 1063] [id = 60] 16:55:29 INFO - ++DOMWINDOW == 39 (0x128cf5400) [pid = 1063] [serial = 144] [outer = 0x0] 16:55:29 INFO - ++DOMWINDOW == 40 (0x12988fc00) [pid = 1063] [serial = 145] [outer = 0x128cf5400] 16:55:29 INFO - ++DOMWINDOW == 41 (0x120538400) [pid = 1063] [serial = 146] [outer = 0x128cf5400] 16:55:29 INFO - ++DOCSHELL 0x12bf3f600 == 18 [pid = 1063] [id = 61] 16:55:29 INFO - ++DOMWINDOW == 42 (0x1355c2000) [pid = 1063] [serial = 147] [outer = 0x0] 16:55:29 INFO - ++DOMWINDOW == 43 (0x1355ea000) [pid = 1063] [serial = 148] [outer = 0x1355c2000] 16:55:30 INFO - ++DOCSHELL 0x12d530600 == 19 [pid = 1063] [id = 62] 16:55:30 INFO - ++DOMWINDOW == 44 (0x12a117400) [pid = 1063] [serial = 149] [outer = 0x0] 16:55:30 INFO - ++DOMWINDOW == 45 (0x12a1d4800) [pid = 1063] [serial = 150] [outer = 0x12a117400] 16:55:30 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:30 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:30 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:30 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 199: TypeError: this._toolPanels is not iterable 16:55:31 INFO - --DOCSHELL 0x1266a6900 == 18 [pid = 1063] [id = 50] 16:55:31 INFO - --DOCSHELL 0x12092a600 == 17 [pid = 1063] [id = 49] 16:55:31 INFO - --DOCSHELL 0x11f881400 == 16 [pid = 1063] [id = 53] 16:55:31 INFO - --DOMWINDOW == 44 (0x11fadc400) [pid = 1063] [serial = 125] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:31 INFO - --DOMWINDOW == 43 (0x130a21c00) [pid = 1063] [serial = 127] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 42 (0x11f840c00) [pid = 1063] [serial = 117] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 41 (0x12988fc00) [pid = 1063] [serial = 145] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 40 (0x11f8b6400) [pid = 1063] [serial = 128] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:31 INFO - --DOMWINDOW == 39 (0x1299ab000) [pid = 1063] [serial = 131] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:31 INFO - --DOMWINDOW == 38 (0x128c59800) [pid = 1063] [serial = 118] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 37 (0x128eab800) [pid = 1063] [serial = 120] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 16:55:31 INFO - --DOMWINDOW == 36 (0x120316800) [pid = 1063] [serial = 133] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 35 (0x128d3a400) [pid = 1063] [serial = 119] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 34 (0x120541000) [pid = 1063] [serial = 134] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 33 (0x121763c00) [pid = 1063] [serial = 136] [outer = 0x0] [url = about:blank] 16:55:31 INFO - --DOMWINDOW == 32 (0x1209f3800) [pid = 1063] [serial = 135] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446162927810] 16:55:31 INFO - --DOMWINDOW == 31 (0x12976bc00) [pid = 1063] [serial = 122] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 16:55:31 INFO - MEMORY STAT | vsize 3745MB | residentFast 353MB | heapAllocated 102MB 16:55:31 INFO - 99 INFO TEST-OK | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js | took 2710ms 16:55:31 INFO - ++DOCSHELL 0x120196f00 == 17 [pid = 1063] [id = 63] 16:55:31 INFO - ++DOMWINDOW == 32 (0x120316800) [pid = 1063] [serial = 151] [outer = 0x0] 16:55:32 INFO - ++DOMWINDOW == 33 (0x1205f8800) [pid = 1063] [serial = 152] [outer = 0x120316800] 16:55:32 INFO - 100 INFO TEST-START | devtools/client/webconsole/test/browser_console_clear_on_reload.js 16:55:32 INFO - ++DOCSHELL 0x120926a00 == 18 [pid = 1063] [id = 64] 16:55:32 INFO - ++DOMWINDOW == 34 (0x120961400) [pid = 1063] [serial = 153] [outer = 0x0] 16:55:32 INFO - ++DOMWINDOW == 35 (0x121770000) [pid = 1063] [serial = 154] [outer = 0x120961400] 16:55:32 INFO - ++DOMWINDOW == 36 (0x127274400) [pid = 1063] [serial = 155] [outer = 0x120961400] 16:55:32 INFO - ++DOCSHELL 0x121c24d00 == 19 [pid = 1063] [id = 65] 16:55:32 INFO - ++DOMWINDOW == 37 (0x121cbac00) [pid = 1063] [serial = 156] [outer = 0x0] 16:55:32 INFO - ++DOMWINDOW == 38 (0x127afec00) [pid = 1063] [serial = 157] [outer = 0x121cbac00] 16:55:32 INFO - ++DOMWINDOW == 39 (0x121763c00) [pid = 1063] [serial = 158] [outer = 0x121cbac00] 16:55:32 INFO - ++DOCSHELL 0x127b2ea00 == 20 [pid = 1063] [id = 66] 16:55:32 INFO - ++DOMWINDOW == 40 (0x12e3cdc00) [pid = 1063] [serial = 159] [outer = 0x0] 16:55:32 INFO - ++DOMWINDOW == 41 (0x12e902c00) [pid = 1063] [serial = 160] [outer = 0x12e3cdc00] 16:55:33 INFO - ++DOCSHELL 0x12d530b00 == 21 [pid = 1063] [id = 67] 16:55:33 INFO - ++DOMWINDOW == 42 (0x12f10a800) [pid = 1063] [serial = 161] [outer = 0x0] 16:55:33 INFO - ++DOMWINDOW == 43 (0x12f10ac00) [pid = 1063] [serial = 162] [outer = 0x12f10a800] 16:55:33 INFO - ++DOCSHELL 0x131b29300 == 22 [pid = 1063] [id = 68] 16:55:33 INFO - ++DOMWINDOW == 44 (0x1335ff400) [pid = 1063] [serial = 163] [outer = 0x0] 16:55:33 INFO - ++DOMWINDOW == 45 (0x134066400) [pid = 1063] [serial = 164] [outer = 0x1335ff400] 16:55:34 INFO - ++DOMWINDOW == 46 (0x130aa9800) [pid = 1063] [serial = 165] [outer = 0x120961400] 16:55:34 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:55:34 INFO - --DOCSHELL 0x1285b2500 == 21 [pid = 1063] [id = 57] 16:55:34 INFO - --DOCSHELL 0x12bf3f600 == 20 [pid = 1063] [id = 61] 16:55:34 INFO - --DOCSHELL 0x12d530600 == 19 [pid = 1063] [id = 62] 16:55:34 INFO - --DOCSHELL 0x12019a100 == 18 [pid = 1063] [id = 55] 16:55:34 INFO - --DOCSHELL 0x12a05c700 == 17 [pid = 1063] [id = 60] 16:55:34 INFO - --DOCSHELL 0x121642f00 == 16 [pid = 1063] [id = 56] 16:55:34 INFO - --DOCSHELL 0x127b2ea00 == 15 [pid = 1063] [id = 66] 16:55:34 INFO - --DOCSHELL 0x129708000 == 14 [pid = 1063] [id = 58] 16:55:34 INFO - --DOCSHELL 0x129f9a300 == 13 [pid = 1063] [id = 59] 16:55:34 INFO - --DOCSHELL 0x12d530b00 == 12 [pid = 1063] [id = 67] 16:55:34 INFO - --DOCSHELL 0x131b29300 == 11 [pid = 1063] [id = 68] 16:55:34 INFO - --DOMWINDOW == 45 (0x1299ac000) [pid = 1063] [serial = 132] [outer = 0x0] [url = about:blank] 16:55:34 INFO - --DOMWINDOW == 44 (0x11fb24c00) [pid = 1063] [serial = 130] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:34 INFO - --DOMWINDOW == 43 (0x121c1c400) [pid = 1063] [serial = 137] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446162927810] 16:55:35 INFO - --DOMWINDOW == 42 (0x128696800) [pid = 1063] [serial = 142] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20866950] 16:55:35 INFO - --DOMWINDOW == 41 (0x127f4e000) [pid = 1063] [serial = 140] [outer = 0x0] [url = about:blank] 16:55:35 INFO - --DOMWINDOW == 40 (0x121770000) [pid = 1063] [serial = 154] [outer = 0x0] [url = about:blank] 16:55:35 INFO - --DOMWINDOW == 39 (0x128fcf800) [pid = 1063] [serial = 143] [outer = 0x0] [url = about:blank] 16:55:35 INFO - --DOMWINDOW == 38 (0x127f51000) [pid = 1063] [serial = 141] [outer = 0x0] [url = about:blank] 16:55:35 INFO - --DOMWINDOW == 37 (0x127afec00) [pid = 1063] [serial = 157] [outer = 0x0] [url = about:blank] 16:55:35 INFO - --DOMWINDOW == 36 (0x12f10a800) [pid = 1063] [serial = 161] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:35 INFO - --DOMWINDOW == 35 (0x128cf5400) [pid = 1063] [serial = 144] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:35 INFO - --DOMWINDOW == 34 (0x1355c2000) [pid = 1063] [serial = 147] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:35 INFO - --DOMWINDOW == 33 (0x12a117400) [pid = 1063] [serial = 149] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:35 INFO - --DOMWINDOW == 32 (0x1200e3000) [pid = 1063] [serial = 138] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:35 INFO - MEMORY STAT | vsize 3753MB | residentFast 362MB | heapAllocated 104MB 16:55:35 INFO - 101 INFO TEST-OK | devtools/client/webconsole/test/browser_console_clear_on_reload.js | took 3177ms 16:55:35 INFO - ++DOCSHELL 0x1201fa400 == 12 [pid = 1063] [id = 69] 16:55:35 INFO - ++DOMWINDOW == 33 (0x12024a800) [pid = 1063] [serial = 166] [outer = 0x0] 16:55:35 INFO - ++DOMWINDOW == 34 (0x121641000) [pid = 1063] [serial = 167] [outer = 0x12024a800] 16:55:35 INFO - 102 INFO TEST-START | devtools/client/webconsole/test/browser_console_click_focus.js 16:55:35 INFO - ++DOCSHELL 0x121644300 == 13 [pid = 1063] [id = 70] 16:55:35 INFO - ++DOMWINDOW == 35 (0x11fadc400) [pid = 1063] [serial = 168] [outer = 0x0] 16:55:35 INFO - ++DOMWINDOW == 36 (0x12666b000) [pid = 1063] [serial = 169] [outer = 0x11fadc400] 16:55:35 INFO - ++DOMWINDOW == 37 (0x120907c00) [pid = 1063] [serial = 170] [outer = 0x11fadc400] 16:55:35 INFO - ++DOCSHELL 0x1266a6e00 == 14 [pid = 1063] [id = 71] 16:55:35 INFO - ++DOMWINDOW == 38 (0x120907800) [pid = 1063] [serial = 171] [outer = 0x0] 16:55:35 INFO - ++DOMWINDOW == 39 (0x126655400) [pid = 1063] [serial = 172] [outer = 0x120907800] 16:55:35 INFO - ++DOMWINDOW == 40 (0x1272a0000) [pid = 1063] [serial = 173] [outer = 0x120907800] 16:55:35 INFO - ++DOCSHELL 0x127e63e00 == 15 [pid = 1063] [id = 72] 16:55:35 INFO - ++DOMWINDOW == 41 (0x12c6b9800) [pid = 1063] [serial = 174] [outer = 0x0] 16:55:35 INFO - ++DOMWINDOW == 42 (0x12c71e800) [pid = 1063] [serial = 175] [outer = 0x12c6b9800] 16:55:37 INFO - --DOCSHELL 0x120926a00 == 14 [pid = 1063] [id = 64] 16:55:37 INFO - --DOCSHELL 0x121c24d00 == 13 [pid = 1063] [id = 65] 16:55:37 INFO - --DOCSHELL 0x127e63e00 == 12 [pid = 1063] [id = 72] 16:55:37 INFO - --DOCSHELL 0x120196f00 == 11 [pid = 1063] [id = 63] 16:55:37 INFO - --DOMWINDOW == 41 (0x12a1d4800) [pid = 1063] [serial = 150] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 40 (0x121c44000) [pid = 1063] [serial = 139] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 39 (0x1355ea000) [pid = 1063] [serial = 148] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 38 (0x120538400) [pid = 1063] [serial = 146] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:37 INFO - --DOMWINDOW == 37 (0x12f10ac00) [pid = 1063] [serial = 162] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:37 INFO - --DOMWINDOW == 36 (0x12666b000) [pid = 1063] [serial = 169] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 35 (0x1205f8800) [pid = 1063] [serial = 152] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 34 (0x126655400) [pid = 1063] [serial = 172] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 33 (0x1335ff400) [pid = 1063] [serial = 163] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:37 INFO - --DOMWINDOW == 32 (0x12e3cdc00) [pid = 1063] [serial = 159] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:37 INFO - --DOMWINDOW == 31 (0x121cbac00) [pid = 1063] [serial = 156] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:37 INFO - --DOMWINDOW == 30 (0x120961400) [pid = 1063] [serial = 153] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:37 INFO - --DOMWINDOW == 29 (0x120316800) [pid = 1063] [serial = 151] [outer = 0x0] [url = about:blank] 16:55:37 INFO - --DOMWINDOW == 28 (0x130aa9800) [pid = 1063] [serial = 165] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:37 INFO - --DOMWINDOW == 27 (0x127274400) [pid = 1063] [serial = 155] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:37 INFO - MEMORY STAT | vsize 3752MB | residentFast 360MB | heapAllocated 103MB 16:55:37 INFO - 103 INFO TEST-OK | devtools/client/webconsole/test/browser_console_click_focus.js | took 2341ms 16:55:37 INFO - ++DOCSHELL 0x1201f9000 == 12 [pid = 1063] [id = 73] 16:55:37 INFO - ++DOMWINDOW == 28 (0x12024a000) [pid = 1063] [serial = 176] [outer = 0x0] 16:55:37 INFO - ++DOMWINDOW == 29 (0x120538400) [pid = 1063] [serial = 177] [outer = 0x12024a000] 16:55:37 INFO - 104 INFO TEST-START | devtools/client/webconsole/test/browser_console_consolejsm_output.js 16:55:37 INFO - console.log: bug861338-log-cached 16:55:37 INFO - ++DOCSHELL 0x121c23e00 == 13 [pid = 1063] [id = 74] 16:55:37 INFO - ++DOMWINDOW == 30 (0x1208c7c00) [pid = 1063] [serial = 178] [outer = 0x0] 16:55:37 INFO - ++DOMWINDOW == 31 (0x1209dec00) [pid = 1063] [serial = 179] [outer = 0x1208c7c00] 16:55:38 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:38 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:38 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:38 INFO - console.time: 'foobarTimer' @ Thu Oct 29 2015 16:55:38 GMT-0700 (PDT) 16:55:38 INFO - console.log: bug851231-log 16:55:38 INFO - console.info: bug851231-info 16:55:38 INFO - console.warn: bug851231-warn 16:55:38 INFO - console.error: 16:55:38 INFO - bug851231-error 16:55:38 INFO - Object 16:55:38 INFO - - bug851231prop = bug851231value 16:55:38 INFO - console.debug: 16:55:38 INFO - bug851231-debug 16:55:38 INFO - console.dir: 16:55:38 INFO - XULDocument 16:55:38 INFO - - location = Location {"href":"chrome://browser/content/browser.xul","origin":"chrome://browser","protocol":"chrome:","username":"","password":"","host":"browser","hostname":"browser","port":"","pathname":"/content/browser.xul","search":"","hash":""} 16:55:38 INFO - console.trace: 16:55:38 INFO - _onsolejsm_output.js 42 testTrace 16:55:38 INFO - _onsolejsm_output.js 54 16:55:38 INFO - _re/modules/Task.jsm 314 TaskImpl_run 16:55:38 INFO - _/Promise-backend.js 934 Handler.prototype.process 16:55:38 INFO - _/Promise-backend.js 813 this.PromiseWalker.walkerLoop 16:55:38 INFO - console.timeEnd: 'foobarTimer' 25ms 16:55:38 INFO - ++DOCSHELL 0x12ea32700 == 14 [pid = 1063] [id = 75] 16:55:38 INFO - ++DOMWINDOW == 32 (0x12f029400) [pid = 1063] [serial = 180] [outer = 0x0] 16:55:38 INFO - ++DOMWINDOW == 33 (0x12f10ac00) [pid = 1063] [serial = 181] [outer = 0x12f029400] 16:55:38 INFO - ++DOCSHELL 0x131b29300 == 15 [pid = 1063] [id = 76] 16:55:38 INFO - ++DOMWINDOW == 34 (0x1351f3000) [pid = 1063] [serial = 182] [outer = 0x0] 16:55:38 INFO - ++DOMWINDOW == 35 (0x1351f3400) [pid = 1063] [serial = 183] [outer = 0x1351f3000] 16:55:38 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 16:55:39 INFO - console.error: Log Prefix: 16:55:39 INFO - Testing a prefix 16:55:39 INFO - ++DOCSHELL 0x1332c0200 == 16 [pid = 1063] [id = 77] 16:55:39 INFO - ++DOMWINDOW == 36 (0x121c44000) [pid = 1063] [serial = 184] [outer = 0x0] 16:55:39 INFO - ++DOMWINDOW == 37 (0x128738000) [pid = 1063] [serial = 185] [outer = 0x121c44000] 16:55:39 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:39 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:39 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:39 INFO - console.error: 16:55:39 INFO - Error should be shown 16:55:40 INFO - ++DOCSHELL 0x134f98500 == 17 [pid = 1063] [id = 78] 16:55:40 INFO - ++DOMWINDOW == 38 (0x127b8fc00) [pid = 1063] [serial = 186] [outer = 0x0] 16:55:40 INFO - ++DOMWINDOW == 39 (0x127bc1c00) [pid = 1063] [serial = 187] [outer = 0x127b8fc00] 16:55:40 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:40 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:40 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:40 INFO - console.error: 16:55:40 INFO - Error should be shown 16:55:40 INFO - console.warn: Warn should be shown due to the initial pref value 16:55:40 INFO - console.info: info should be shown due to the pref change being observed 16:55:40 INFO - console.error: 16:55:40 INFO - Should be shown due to defaulting to error 16:55:40 INFO - ++DOCSHELL 0x1266a6900 == 18 [pid = 1063] [id = 79] 16:55:40 INFO - ++DOMWINDOW == 40 (0x1208cf000) [pid = 1063] [serial = 188] [outer = 0x0] 16:55:40 INFO - ++DOMWINDOW == 41 (0x12775dc00) [pid = 1063] [serial = 189] [outer = 0x1208cf000] 16:55:40 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:40 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:40 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:41 INFO - MEMORY STAT | vsize 3727MB | residentFast 338MB | heapAllocated 107MB 16:55:41 INFO - 105 INFO TEST-OK | devtools/client/webconsole/test/browser_console_consolejsm_output.js | took 3184ms 16:55:41 INFO - ++DOCSHELL 0x134f9c600 == 19 [pid = 1063] [id = 80] 16:55:41 INFO - ++DOMWINDOW == 42 (0x128fcf400) [pid = 1063] [serial = 190] [outer = 0x0] 16:55:41 INFO - ++DOMWINDOW == 43 (0x12965a000) [pid = 1063] [serial = 191] [outer = 0x128fcf400] 16:55:41 INFO - 106 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_command.js 16:55:41 INFO - ++DOCSHELL 0x135285e00 == 20 [pid = 1063] [id = 81] 16:55:41 INFO - ++DOMWINDOW == 44 (0x129e8dc00) [pid = 1063] [serial = 192] [outer = 0x0] 16:55:41 INFO - ++DOMWINDOW == 45 (0x1308b0c00) [pid = 1063] [serial = 193] [outer = 0x129e8dc00] 16:55:41 INFO - ++DOCSHELL 0x135544500 == 21 [pid = 1063] [id = 82] 16:55:41 INFO - ++DOMWINDOW == 46 (0x12f05ec00) [pid = 1063] [serial = 194] [outer = 0x0] 16:55:41 INFO - ++DOMWINDOW == 47 (0x1355a1800) [pid = 1063] [serial = 195] [outer = 0x12f05ec00] 16:55:41 INFO - ++DOMWINDOW == 48 (0x121770000) [pid = 1063] [serial = 196] [outer = 0x12f05ec00] 16:55:41 INFO - ++DOCSHELL 0x121645700 == 22 [pid = 1063] [id = 83] 16:55:41 INFO - ++DOMWINDOW == 49 (0x12848c400) [pid = 1063] [serial = 197] [outer = 0x0] 16:55:41 INFO - ++DOMWINDOW == 50 (0x12848c800) [pid = 1063] [serial = 198] [outer = 0x12848c400] 16:55:43 INFO - MEMORY STAT | vsize 3749MB | residentFast 360MB | heapAllocated 113MB 16:55:43 INFO - 107 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_command.js | took 2343ms 16:55:43 INFO - ++DOCSHELL 0x12a05c700 == 23 [pid = 1063] [id = 84] 16:55:43 INFO - ++DOMWINDOW == 51 (0x134821c00) [pid = 1063] [serial = 199] [outer = 0x0] 16:55:43 INFO - ++DOMWINDOW == 52 (0x1349a8800) [pid = 1063] [serial = 200] [outer = 0x134821c00] 16:55:43 INFO - 108 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js 16:55:43 INFO - ++DOCSHELL 0x135544f00 == 24 [pid = 1063] [id = 85] 16:55:43 INFO - ++DOMWINDOW == 53 (0x13621ac00) [pid = 1063] [serial = 201] [outer = 0x0] 16:55:43 INFO - ++DOMWINDOW == 54 (0x13628a000) [pid = 1063] [serial = 202] [outer = 0x13621ac00] 16:55:43 INFO - ++DOMWINDOW == 55 (0x1366cd400) [pid = 1063] [serial = 203] [outer = 0x13621ac00] 16:55:44 INFO - ++DOCSHELL 0x135284a00 == 25 [pid = 1063] [id = 86] 16:55:44 INFO - ++DOMWINDOW == 56 (0x127fff800) [pid = 1063] [serial = 204] [outer = 0x0] 16:55:44 INFO - ++DOMWINDOW == 57 (0x136333800) [pid = 1063] [serial = 205] [outer = 0x127fff800] 16:55:44 INFO - ++DOMWINDOW == 58 (0x1367bc400) [pid = 1063] [serial = 206] [outer = 0x127fff800] 16:55:44 INFO - ++DOCSHELL 0x1355f1a00 == 26 [pid = 1063] [id = 87] 16:55:44 INFO - ++DOMWINDOW == 59 (0x1367fb400) [pid = 1063] [serial = 207] [outer = 0x0] 16:55:44 INFO - ++DOMWINDOW == 60 (0x12cb91000) [pid = 1063] [serial = 208] [outer = 0x1367fb400] 16:55:46 INFO - --DOCSHELL 0x12ea32700 == 25 [pid = 1063] [id = 75] 16:55:46 INFO - --DOCSHELL 0x121644300 == 24 [pid = 1063] [id = 70] 16:55:46 INFO - --DOCSHELL 0x1201fa400 == 23 [pid = 1063] [id = 69] 16:55:46 INFO - --DOCSHELL 0x1266a6e00 == 22 [pid = 1063] [id = 71] 16:55:46 INFO - --DOCSHELL 0x121645700 == 21 [pid = 1063] [id = 83] 16:55:46 INFO - --DOCSHELL 0x1355f1a00 == 20 [pid = 1063] [id = 87] 16:55:46 INFO - --DOCSHELL 0x131b29300 == 19 [pid = 1063] [id = 76] 16:55:46 INFO - --DOCSHELL 0x121c23e00 == 18 [pid = 1063] [id = 74] 16:55:46 INFO - --DOCSHELL 0x1332c0200 == 17 [pid = 1063] [id = 77] 16:55:46 INFO - --DOCSHELL 0x134f98500 == 16 [pid = 1063] [id = 78] 16:55:46 INFO - --DOCSHELL 0x1266a6900 == 15 [pid = 1063] [id = 79] 16:55:46 INFO - --DOMWINDOW == 59 (0x134066400) [pid = 1063] [serial = 164] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:46 INFO - --DOMWINDOW == 58 (0x12e902c00) [pid = 1063] [serial = 160] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 57 (0x121763c00) [pid = 1063] [serial = 158] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:46 INFO - --DOMWINDOW == 56 (0x1351f3000) [pid = 1063] [serial = 182] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:46 INFO - --DOMWINDOW == 55 (0x12f029400) [pid = 1063] [serial = 180] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:46 INFO - --DOMWINDOW == 54 (0x120907800) [pid = 1063] [serial = 171] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:46 INFO - --DOMWINDOW == 53 (0x12c6b9800) [pid = 1063] [serial = 174] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:46 INFO - --DOMWINDOW == 52 (0x12024a000) [pid = 1063] [serial = 176] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 51 (0x11fadc400) [pid = 1063] [serial = 168] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:46 INFO - --DOMWINDOW == 50 (0x12024a800) [pid = 1063] [serial = 166] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 49 (0x1355a1800) [pid = 1063] [serial = 195] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 48 (0x12965a000) [pid = 1063] [serial = 191] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 47 (0x128fcf400) [pid = 1063] [serial = 190] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 46 (0x136333800) [pid = 1063] [serial = 205] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 45 (0x13628a000) [pid = 1063] [serial = 202] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 44 (0x120538400) [pid = 1063] [serial = 177] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 43 (0x121641000) [pid = 1063] [serial = 167] [outer = 0x0] [url = about:blank] 16:55:46 INFO - --DOMWINDOW == 42 (0x120907c00) [pid = 1063] [serial = 170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:46 INFO - MEMORY STAT | vsize 3727MB | residentFast 346MB | heapAllocated 105MB 16:55:46 INFO - 109 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js | took 3013ms 16:55:46 INFO - ++DOCSHELL 0x120198300 == 16 [pid = 1063] [id = 88] 16:55:46 INFO - ++DOMWINDOW == 43 (0x120135c00) [pid = 1063] [serial = 209] [outer = 0x0] 16:55:46 INFO - ++DOMWINDOW == 44 (0x12024a000) [pid = 1063] [serial = 210] [outer = 0x120135c00] 16:55:46 INFO - 110 INFO TEST-START | devtools/client/webconsole/test/browser_console_dead_objects.js 16:55:46 INFO - ++DOCSHELL 0x121644300 == 17 [pid = 1063] [id = 89] 16:55:46 INFO - ++DOMWINDOW == 45 (0x1208cf800) [pid = 1063] [serial = 211] [outer = 0x0] 16:55:46 INFO - ++DOMWINDOW == 46 (0x121627c00) [pid = 1063] [serial = 212] [outer = 0x1208cf800] 16:55:47 INFO - ++DOCSHELL 0x121c22000 == 18 [pid = 1063] [id = 90] 16:55:47 INFO - ++DOMWINDOW == 47 (0x12177fc00) [pid = 1063] [serial = 213] [outer = 0x0] 16:55:47 INFO - ++DOMWINDOW == 48 (0x121c1c400) [pid = 1063] [serial = 214] [outer = 0x12177fc00] 16:55:47 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:47 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:47 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:47 INFO - ++DOCSHELL 0x12d530600 == 19 [pid = 1063] [id = 91] 16:55:47 INFO - ++DOMWINDOW == 49 (0x12ea67000) [pid = 1063] [serial = 215] [outer = 0x0] 16:55:47 INFO - ++DOMWINDOW == 50 (0x12ea67800) [pid = 1063] [serial = 216] [outer = 0x12ea67000] 16:55:48 INFO - MEMORY STAT | vsize 3753MB | residentFast 372MB | heapAllocated 119MB 16:55:48 INFO - 111 INFO TEST-OK | devtools/client/webconsole/test/browser_console_dead_objects.js | took 1602ms 16:55:48 INFO - ++DOCSHELL 0x131b29d00 == 20 [pid = 1063] [id = 92] 16:55:48 INFO - ++DOMWINDOW == 51 (0x1351cc400) [pid = 1063] [serial = 217] [outer = 0x0] 16:55:48 INFO - ++DOMWINDOW == 52 (0x1351d7c00) [pid = 1063] [serial = 218] [outer = 0x1351cc400] 16:55:48 INFO - 112 INFO TEST-START | devtools/client/webconsole/test/browser_console_error_source_click.js 16:55:48 INFO - ++DOCSHELL 0x1334df400 == 21 [pid = 1063] [id = 93] 16:55:48 INFO - ++DOMWINDOW == 53 (0x1355a1400) [pid = 1063] [serial = 219] [outer = 0x0] 16:55:48 INFO - ++DOMWINDOW == 54 (0x1355a2400) [pid = 1063] [serial = 220] [outer = 0x1355a1400] 16:55:48 INFO - ++DOCSHELL 0x121c91b00 == 22 [pid = 1063] [id = 94] 16:55:48 INFO - ++DOMWINDOW == 55 (0x120410c00) [pid = 1063] [serial = 221] [outer = 0x0] 16:55:48 INFO - ++DOMWINDOW == 56 (0x12775d800) [pid = 1063] [serial = 222] [outer = 0x120410c00] 16:55:49 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:49 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:49 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:49 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!, line 1: ReferenceError: foobar is not defined 16:55:49 INFO - MEMORY STAT | vsize 3734MB | residentFast 354MB | heapAllocated 116MB 16:55:49 INFO - 113 INFO TEST-OK | devtools/client/webconsole/test/browser_console_error_source_click.js | took 1142ms 16:55:49 INFO - ++DOCSHELL 0x127a9d400 == 23 [pid = 1063] [id = 95] 16:55:49 INFO - ++DOMWINDOW == 57 (0x127f51000) [pid = 1063] [serial = 223] [outer = 0x0] 16:55:49 INFO - ++DOMWINDOW == 58 (0x12846b400) [pid = 1063] [serial = 224] [outer = 0x127f51000] 16:55:49 INFO - 114 INFO TEST-START | devtools/client/webconsole/test/browser_console_filters.js 16:55:49 INFO - ++DOCSHELL 0x127a9ca00 == 24 [pid = 1063] [id = 96] 16:55:49 INFO - ++DOMWINDOW == 59 (0x128d3a400) [pid = 1063] [serial = 225] [outer = 0x0] 16:55:49 INFO - ++DOMWINDOW == 60 (0x129887800) [pid = 1063] [serial = 226] [outer = 0x128d3a400] 16:55:50 INFO - ++DOCSHELL 0x1285b6100 == 25 [pid = 1063] [id = 97] 16:55:50 INFO - ++DOMWINDOW == 61 (0x129a2a400) [pid = 1063] [serial = 227] [outer = 0x0] 16:55:50 INFO - ++DOMWINDOW == 62 (0x129be1000) [pid = 1063] [serial = 228] [outer = 0x129a2a400] 16:55:50 INFO - ++DOMWINDOW == 63 (0x129882c00) [pid = 1063] [serial = 229] [outer = 0x129a2a400] 16:55:50 INFO - ++DOCSHELL 0x129bdd400 == 26 [pid = 1063] [id = 98] 16:55:50 INFO - ++DOMWINDOW == 64 (0x1376c5400) [pid = 1063] [serial = 230] [outer = 0x0] 16:55:50 INFO - ++DOMWINDOW == 65 (0x1377e8800) [pid = 1063] [serial = 231] [outer = 0x1376c5400] 16:55:52 INFO - --DOCSHELL 0x1201f9000 == 25 [pid = 1063] [id = 73] 16:55:52 INFO - --DOCSHELL 0x135284a00 == 24 [pid = 1063] [id = 86] 16:55:52 INFO - --DOCSHELL 0x135285e00 == 23 [pid = 1063] [id = 81] 16:55:52 INFO - --DOCSHELL 0x12a05c700 == 22 [pid = 1063] [id = 84] 16:55:52 INFO - --DOCSHELL 0x135544f00 == 21 [pid = 1063] [id = 85] 16:55:52 INFO - --DOCSHELL 0x129bdd400 == 20 [pid = 1063] [id = 98] 16:55:52 INFO - --DOCSHELL 0x134f9c600 == 19 [pid = 1063] [id = 80] 16:55:52 INFO - --DOCSHELL 0x135544500 == 18 [pid = 1063] [id = 82] 16:55:52 INFO - --DOCSHELL 0x12d530600 == 17 [pid = 1063] [id = 91] 16:55:52 INFO - --DOCSHELL 0x121c22000 == 16 [pid = 1063] [id = 90] 16:55:52 INFO - --DOCSHELL 0x121c91b00 == 15 [pid = 1063] [id = 94] 16:55:52 INFO - --DOMWINDOW == 64 (0x1272a0000) [pid = 1063] [serial = 173] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:52 INFO - --DOMWINDOW == 63 (0x12f10ac00) [pid = 1063] [serial = 181] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 62 (0x1351f3400) [pid = 1063] [serial = 183] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 61 (0x12c71e800) [pid = 1063] [serial = 175] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 60 (0x13621ac00) [pid = 1063] [serial = 201] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:52 INFO - --DOMWINDOW == 59 (0x120135c00) [pid = 1063] [serial = 209] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 58 (0x1208cf800) [pid = 1063] [serial = 211] [outer = 0x0] [url = data:text/html;charset=utf8,

dead%20objects!] 16:55:52 INFO - --DOMWINDOW == 57 (0x1351cc400) [pid = 1063] [serial = 217] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 56 (0x12ea67000) [pid = 1063] [serial = 215] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:52 INFO - --DOMWINDOW == 55 (0x12177fc00) [pid = 1063] [serial = 213] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 54 (0x129be1000) [pid = 1063] [serial = 228] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 53 (0x1355a1400) [pid = 1063] [serial = 219] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!] 16:55:52 INFO - --DOMWINDOW == 52 (0x120410c00) [pid = 1063] [serial = 221] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 51 (0x1208cf000) [pid = 1063] [serial = 188] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 50 (0x1367fb400) [pid = 1063] [serial = 207] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 49 (0x127b8fc00) [pid = 1063] [serial = 186] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 48 (0x121c44000) [pid = 1063] [serial = 184] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 47 (0x12f05ec00) [pid = 1063] [serial = 194] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:52 INFO - --DOMWINDOW == 46 (0x1208c7c00) [pid = 1063] [serial = 178] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 45 (0x12848c400) [pid = 1063] [serial = 197] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:52 INFO - --DOMWINDOW == 44 (0x127fff800) [pid = 1063] [serial = 204] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:52 INFO - --DOMWINDOW == 43 (0x129e8dc00) [pid = 1063] [serial = 192] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20

%20%20%20%20

Testing%20copy%20command

%20%20%20%20

This%20is%20some%20example%20text

%20%20%20%20Lorem%20ipsum%20dolor%20sit%20amet,%20consectetur%20adipisicing%20elit,%20sed%20do%20eiusmod%20tempor%20incididunt%20ut%20labore%20et%20dolore%20magna%20aliqua.%20Ut%20enim%20ad%20minim%20veniam,%20quis%20nostrud%20exercitation%20ullamco%20laboris%20nisi%20ut%20aliquip%20ex%20ea%20commodo%20consequat.%20Duis%20aute%20irure%20dolor%20in%20reprehenderit%20in%20voluptate%20velit%20esse%20cillum%20dolore%20eu%20fugiat%20nulla%20pariatur.%20Excepteur%20sint%20occaecat%20cupidatat%20non%20proident,%20sunt%20in%20culpa%20qui%20officia%20deserunt%20mollit%20anim%20id%20est%20laborum.Thu%20Oct%2029%202015%2016:55:41%20GMT-0700%20(PDT)

%20%20
%20%20

] 16:55:52 INFO - --DOMWINDOW == 42 (0x134821c00) [pid = 1063] [serial = 199] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 41 (0x1308b0c00) [pid = 1063] [serial = 193] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 40 (0x1349a8800) [pid = 1063] [serial = 200] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 39 (0x12024a000) [pid = 1063] [serial = 210] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 38 (0x121627c00) [pid = 1063] [serial = 212] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 37 (0x1351d7c00) [pid = 1063] [serial = 218] [outer = 0x0] [url = about:blank] 16:55:52 INFO - --DOMWINDOW == 36 (0x1366cd400) [pid = 1063] [serial = 203] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:55:52 INFO - ++DOCSHELL 0x127766500 == 16 [pid = 1063] [id = 99] 16:55:52 INFO - ++DOMWINDOW == 37 (0x127b8bc00) [pid = 1063] [serial = 232] [outer = 0x0] 16:55:52 INFO - ++DOMWINDOW == 38 (0x127b8fc00) [pid = 1063] [serial = 233] [outer = 0x127b8bc00] 16:55:52 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:52 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:53 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:53 INFO - MEMORY STAT | vsize 3733MB | residentFast 348MB | heapAllocated 108MB 16:55:53 INFO - 115 INFO TEST-OK | devtools/client/webconsole/test/browser_console_filters.js | took 3446ms 16:55:53 INFO - ++DOCSHELL 0x1285b2000 == 17 [pid = 1063] [id = 100] 16:55:53 INFO - ++DOMWINDOW == 39 (0x12c21b400) [pid = 1063] [serial = 234] [outer = 0x0] 16:55:53 INFO - ++DOMWINDOW == 40 (0x12c50f800) [pid = 1063] [serial = 235] [outer = 0x12c21b400] 16:55:53 INFO - 116 INFO TEST-START | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js 16:55:53 INFO - ++DOCSHELL 0x129f9ad00 == 18 [pid = 1063] [id = 101] 16:55:53 INFO - ++DOMWINDOW == 41 (0x12c71e800) [pid = 1063] [serial = 236] [outer = 0x0] 16:55:53 INFO - ++DOMWINDOW == 42 (0x12cbb6000) [pid = 1063] [serial = 237] [outer = 0x12c71e800] 16:55:53 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:53 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:53 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:53 INFO - ++DOCSHELL 0x135546d00 == 19 [pid = 1063] [id = 102] 16:55:53 INFO - ++DOMWINDOW == 43 (0x13628a400) [pid = 1063] [serial = 238] [outer = 0x0] 16:55:53 INFO - ++DOMWINDOW == 44 (0x13628a800) [pid = 1063] [serial = 239] [outer = 0x13628a400] 16:55:54 INFO - ++DOCSHELL 0x1355f2400 == 20 [pid = 1063] [id = 103] 16:55:54 INFO - ++DOMWINDOW == 45 (0x137049400) [pid = 1063] [serial = 240] [outer = 0x0] 16:55:54 INFO - ++DOMWINDOW == 46 (0x1370a1400) [pid = 1063] [serial = 241] [outer = 0x137049400] 16:55:54 INFO - ++DOCSHELL 0x12ca2db00 == 21 [pid = 1063] [id = 104] 16:55:54 INFO - ++DOMWINDOW == 47 (0x137062c00) [pid = 1063] [serial = 242] [outer = 0x0] 16:55:54 INFO - ++DOMWINDOW == 48 (0x137e5dc00) [pid = 1063] [serial = 243] [outer = 0x137062c00] 16:55:54 INFO - ++DOMWINDOW == 49 (0x1208cf000) [pid = 1063] [serial = 244] [outer = 0x137062c00] 16:55:54 INFO - ++DOCSHELL 0x1365eaa00 == 22 [pid = 1063] [id = 105] 16:55:54 INFO - ++DOMWINDOW == 50 (0x12c6df000) [pid = 1063] [serial = 245] [outer = 0x0] 16:55:54 INFO - ++DOMWINDOW == 51 (0x12c6dfc00) [pid = 1063] [serial = 246] [outer = 0x12c6df000] 16:55:55 INFO - ++DOCSHELL 0x121730200 == 23 [pid = 1063] [id = 106] 16:55:55 INFO - ++DOMWINDOW == 52 (0x12988f000) [pid = 1063] [serial = 247] [outer = 0x0] 16:55:55 INFO - ++DOMWINDOW == 53 (0x12988fc00) [pid = 1063] [serial = 248] [outer = 0x12988f000] 16:55:56 INFO - --DOCSHELL 0x131b29d00 == 22 [pid = 1063] [id = 92] 16:55:56 INFO - --DOCSHELL 0x120198300 == 21 [pid = 1063] [id = 88] 16:55:56 INFO - --DOCSHELL 0x121644300 == 20 [pid = 1063] [id = 89] 16:55:56 INFO - --DOCSHELL 0x1334df400 == 19 [pid = 1063] [id = 93] 16:55:56 INFO - --DOCSHELL 0x1285b6100 == 18 [pid = 1063] [id = 97] 16:55:56 INFO - --DOMWINDOW == 52 (0x128738000) [pid = 1063] [serial = 185] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 51 (0x121c1c400) [pid = 1063] [serial = 214] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 50 (0x12ea67800) [pid = 1063] [serial = 216] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 49 (0x121770000) [pid = 1063] [serial = 196] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:56 INFO - --DOMWINDOW == 48 (0x1367bc400) [pid = 1063] [serial = 206] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:56 INFO - --DOMWINDOW == 47 (0x1209dec00) [pid = 1063] [serial = 179] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 46 (0x12cb91000) [pid = 1063] [serial = 208] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 45 (0x12848c800) [pid = 1063] [serial = 198] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 44 (0x127bc1c00) [pid = 1063] [serial = 187] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 43 (0x12775dc00) [pid = 1063] [serial = 189] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 42 (0x1355a2400) [pid = 1063] [serial = 220] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 41 (0x12775d800) [pid = 1063] [serial = 222] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 40 (0x12846b400) [pid = 1063] [serial = 224] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 39 (0x129887800) [pid = 1063] [serial = 226] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 38 (0x137e5dc00) [pid = 1063] [serial = 243] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 37 (0x1376c5400) [pid = 1063] [serial = 230] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:55:56 INFO - --DOMWINDOW == 36 (0x129a2a400) [pid = 1063] [serial = 227] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:56 INFO - --DOMWINDOW == 35 (0x127f51000) [pid = 1063] [serial = 223] [outer = 0x0] [url = about:blank] 16:55:56 INFO - --DOMWINDOW == 34 (0x128d3a400) [pid = 1063] [serial = 225] [outer = 0x0] [url = data:text/html;charset=utf8,

browser%20console%20filters] 16:55:57 INFO - ++DOCSHELL 0x121642500 == 19 [pid = 1063] [id = 107] 16:55:57 INFO - ++DOMWINDOW == 35 (0x1208cf800) [pid = 1063] [serial = 249] [outer = 0x0] 16:55:57 INFO - ++DOMWINDOW == 36 (0x1209dec00) [pid = 1063] [serial = 250] [outer = 0x1208cf800] 16:55:57 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:57 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:55:57 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:55:57 INFO - ++DOCSHELL 0x131a9b700 == 20 [pid = 1063] [id = 108] 16:55:57 INFO - ++DOMWINDOW == 37 (0x129f83c00) [pid = 1063] [serial = 251] [outer = 0x0] 16:55:57 INFO - ++DOMWINDOW == 38 (0x12c777800) [pid = 1063] [serial = 252] [outer = 0x129f83c00] 16:55:57 INFO - ++DOCSHELL 0x1332bf300 == 21 [pid = 1063] [id = 109] 16:55:57 INFO - ++DOMWINDOW == 39 (0x12df86800) [pid = 1063] [serial = 253] [outer = 0x0] 16:55:57 INFO - ++DOMWINDOW == 40 (0x12e221000) [pid = 1063] [serial = 254] [outer = 0x12df86800] 16:55:57 INFO - ++DOMWINDOW == 41 (0x11f8cc800) [pid = 1063] [serial = 255] [outer = 0x12df86800] 16:55:57 INFO - ++DOCSHELL 0x1334dfe00 == 22 [pid = 1063] [id = 110] 16:55:57 INFO - ++DOMWINDOW == 42 (0x13347e400) [pid = 1063] [serial = 256] [outer = 0x0] 16:55:57 INFO - ++DOMWINDOW == 43 (0x1334d1000) [pid = 1063] [serial = 257] [outer = 0x13347e400] 16:55:58 INFO - ++DOCSHELL 0x134f9c600 == 23 [pid = 1063] [id = 111] 16:55:58 INFO - ++DOMWINDOW == 44 (0x12e3cdc00) [pid = 1063] [serial = 258] [outer = 0x0] 16:55:58 INFO - ++DOMWINDOW == 45 (0x12e824400) [pid = 1063] [serial = 259] [outer = 0x12e3cdc00] 16:55:59 INFO - --DOCSHELL 0x1365eaa00 == 22 [pid = 1063] [id = 105] 16:55:59 INFO - --DOCSHELL 0x127766500 == 21 [pid = 1063] [id = 99] 16:55:59 INFO - --DOCSHELL 0x127a9d400 == 20 [pid = 1063] [id = 95] 16:55:59 INFO - --DOCSHELL 0x127a9ca00 == 19 [pid = 1063] [id = 96] 16:55:59 INFO - --DOCSHELL 0x121730200 == 18 [pid = 1063] [id = 106] 16:55:59 INFO - --DOCSHELL 0x12ca2db00 == 17 [pid = 1063] [id = 104] 16:55:59 INFO - --DOCSHELL 0x135546d00 == 16 [pid = 1063] [id = 102] 16:55:59 INFO - --DOCSHELL 0x129f9ad00 == 15 [pid = 1063] [id = 101] 16:55:59 INFO - --DOMWINDOW == 44 (0x1377e8800) [pid = 1063] [serial = 231] [outer = 0x0] [url = about:blank] 16:55:59 INFO - --DOMWINDOW == 43 (0x129882c00) [pid = 1063] [serial = 229] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:55:59 INFO - --DOMWINDOW == 42 (0x13628a400) [pid = 1063] [serial = 238] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:59 INFO - --DOMWINDOW == 41 (0x12988f000) [pid = 1063] [serial = 247] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:55:59 INFO - --DOMWINDOW == 40 (0x12e221000) [pid = 1063] [serial = 254] [outer = 0x0] [url = about:blank] 16:55:59 INFO - --DOMWINDOW == 39 (0x127b8bc00) [pid = 1063] [serial = 232] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:00 INFO - MEMORY STAT | vsize 3731MB | residentFast 349MB | heapAllocated 105MB 16:56:00 INFO - 117 INFO TEST-OK | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js | took 6624ms 16:56:00 INFO - ++DOCSHELL 0x121c23e00 == 16 [pid = 1063] [id = 112] 16:56:00 INFO - ++DOMWINDOW == 40 (0x121641000) [pid = 1063] [serial = 260] [outer = 0x0] 16:56:00 INFO - ++DOMWINDOW == 41 (0x12664d400) [pid = 1063] [serial = 261] [outer = 0x121641000] 16:56:00 INFO - 118 INFO TEST-START | devtools/client/webconsole/test/browser_console_history_persist.js 16:56:00 INFO - ++DOCSHELL 0x127a9f200 == 17 [pid = 1063] [id = 113] 16:56:00 INFO - ++DOMWINDOW == 42 (0x127f4e400) [pid = 1063] [serial = 262] [outer = 0x0] 16:56:00 INFO - ++DOMWINDOW == 43 (0x1287eb400) [pid = 1063] [serial = 263] [outer = 0x127f4e400] 16:56:00 INFO - ++DOCSHELL 0x127e63900 == 18 [pid = 1063] [id = 114] 16:56:00 INFO - ++DOMWINDOW == 44 (0x128696c00) [pid = 1063] [serial = 264] [outer = 0x0] 16:56:00 INFO - ++DOMWINDOW == 45 (0x128ffb000) [pid = 1063] [serial = 265] [outer = 0x128696c00] 16:56:00 INFO - ++DOMWINDOW == 46 (0x127b00800) [pid = 1063] [serial = 266] [outer = 0x128696c00] 16:56:00 INFO - ++DOCSHELL 0x1285b3e00 == 19 [pid = 1063] [id = 115] 16:56:00 INFO - ++DOMWINDOW == 47 (0x12d4cd000) [pid = 1063] [serial = 267] [outer = 0x0] 16:56:00 INFO - ++DOMWINDOW == 48 (0x12d5a6000) [pid = 1063] [serial = 268] [outer = 0x12d4cd000] 16:56:01 INFO - ++DOCSHELL 0x11fb1ee00 == 20 [pid = 1063] [id = 116] 16:56:01 INFO - ++DOMWINDOW == 49 (0x12df27c00) [pid = 1063] [serial = 269] [outer = 0x0] 16:56:01 INFO - ++DOMWINDOW == 50 (0x12e221000) [pid = 1063] [serial = 270] [outer = 0x12df27c00] 16:56:01 INFO - ++DOCSHELL 0x12d52e800 == 21 [pid = 1063] [id = 117] 16:56:01 INFO - ++DOMWINDOW == 51 (0x12e21fc00) [pid = 1063] [serial = 271] [outer = 0x0] 16:56:01 INFO - ++DOMWINDOW == 52 (0x1317f7800) [pid = 1063] [serial = 272] [outer = 0x12e21fc00] 16:56:02 INFO - ++DOMWINDOW == 53 (0x1333b2800) [pid = 1063] [serial = 273] [outer = 0x12e21fc00] 16:56:02 INFO - ++DOCSHELL 0x12d4c1100 == 22 [pid = 1063] [id = 118] 16:56:02 INFO - ++DOMWINDOW == 54 (0x1367bcc00) [pid = 1063] [serial = 274] [outer = 0x0] 16:56:02 INFO - ++DOMWINDOW == 55 (0x1367d8800) [pid = 1063] [serial = 275] [outer = 0x1367bcc00] 16:56:03 INFO - ++DOCSHELL 0x131b28900 == 23 [pid = 1063] [id = 119] 16:56:03 INFO - ++DOMWINDOW == 56 (0x1538a5800) [pid = 1063] [serial = 276] [outer = 0x0] 16:56:03 INFO - ++DOMWINDOW == 57 (0x13515ac00) [pid = 1063] [serial = 277] [outer = 0x1538a5800] 16:56:03 INFO - ++DOCSHELL 0x12c825600 == 24 [pid = 1063] [id = 120] 16:56:03 INFO - ++DOMWINDOW == 58 (0x1208cf400) [pid = 1063] [serial = 278] [outer = 0x0] 16:56:03 INFO - ++DOMWINDOW == 59 (0x136b7a000) [pid = 1063] [serial = 279] [outer = 0x1208cf400] 16:56:03 INFO - ++DOMWINDOW == 60 (0x136b7a800) [pid = 1063] [serial = 280] [outer = 0x1208cf400] 16:56:03 INFO - ++DOCSHELL 0x1334e2b00 == 25 [pid = 1063] [id = 121] 16:56:03 INFO - ++DOMWINDOW == 61 (0x137eac800) [pid = 1063] [serial = 281] [outer = 0x0] 16:56:03 INFO - ++DOMWINDOW == 62 (0x130fb9000) [pid = 1063] [serial = 282] [outer = 0x137eac800] 16:56:04 INFO - ++DOCSHELL 0x127e63e00 == 26 [pid = 1063] [id = 122] 16:56:04 INFO - ++DOMWINDOW == 63 (0x135587000) [pid = 1063] [serial = 283] [outer = 0x0] 16:56:04 INFO - ++DOMWINDOW == 64 (0x1362eac00) [pid = 1063] [serial = 284] [outer = 0x135587000] 16:56:04 INFO - ++DOCSHELL 0x129f9b200 == 27 [pid = 1063] [id = 123] 16:56:04 INFO - ++DOMWINDOW == 65 (0x1362ea800) [pid = 1063] [serial = 285] [outer = 0x0] 16:56:04 INFO - ++DOMWINDOW == 66 (0x1365f5000) [pid = 1063] [serial = 286] [outer = 0x1362ea800] 16:56:05 INFO - ++DOMWINDOW == 67 (0x129fcac00) [pid = 1063] [serial = 287] [outer = 0x1362ea800] 16:56:05 INFO - ++DOCSHELL 0x12ca2c700 == 28 [pid = 1063] [id = 124] 16:56:05 INFO - ++DOMWINDOW == 68 (0x133fd7400) [pid = 1063] [serial = 288] [outer = 0x0] 16:56:05 INFO - ++DOMWINDOW == 69 (0x133fd7c00) [pid = 1063] [serial = 289] [outer = 0x133fd7400] 16:56:06 INFO - ++DOCSHELL 0x12d52ed00 == 29 [pid = 1063] [id = 125] 16:56:06 INFO - ++DOMWINDOW == 70 (0x1367fb000) [pid = 1063] [serial = 290] [outer = 0x0] 16:56:06 INFO - ++DOMWINDOW == 71 (0x137048400) [pid = 1063] [serial = 291] [outer = 0x1367fb000] 16:56:06 INFO - ++DOCSHELL 0x136495700 == 30 [pid = 1063] [id = 126] 16:56:06 INFO - ++DOMWINDOW == 72 (0x11f5b8c00) [pid = 1063] [serial = 292] [outer = 0x0] 16:56:06 INFO - ++DOMWINDOW == 73 (0x127bad800) [pid = 1063] [serial = 293] [outer = 0x11f5b8c00] 16:56:06 INFO - ++DOMWINDOW == 74 (0x11f5b8000) [pid = 1063] [serial = 294] [outer = 0x11f5b8c00] 16:56:06 INFO - ++DOCSHELL 0x1365ed200 == 31 [pid = 1063] [id = 127] 16:56:06 INFO - ++DOMWINDOW == 75 (0x1354dbc00) [pid = 1063] [serial = 295] [outer = 0x0] 16:56:06 INFO - ++DOMWINDOW == 76 (0x1354db000) [pid = 1063] [serial = 296] [outer = 0x1354dbc00] 16:56:08 INFO - --DOCSHELL 0x1334dfe00 == 30 [pid = 1063] [id = 110] 16:56:08 INFO - --DOCSHELL 0x134f9c600 == 29 [pid = 1063] [id = 111] 16:56:08 INFO - --DOCSHELL 0x1332bf300 == 28 [pid = 1063] [id = 109] 16:56:08 INFO - --DOCSHELL 0x1285b2000 == 27 [pid = 1063] [id = 100] 16:56:08 INFO - --DOCSHELL 0x1355f2400 == 26 [pid = 1063] [id = 103] 16:56:08 INFO - --DOCSHELL 0x1365ed200 == 25 [pid = 1063] [id = 127] 16:56:08 INFO - --DOCSHELL 0x131a9b700 == 24 [pid = 1063] [id = 108] 16:56:08 INFO - --DOCSHELL 0x121642500 == 23 [pid = 1063] [id = 107] 16:56:08 INFO - --DOMWINDOW == 75 (0x127b8fc00) [pid = 1063] [serial = 233] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 74 (0x12988fc00) [pid = 1063] [serial = 248] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 73 (0x13628a800) [pid = 1063] [serial = 239] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 72 (0x12e3cdc00) [pid = 1063] [serial = 258] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:08 INFO - --DOMWINDOW == 71 (0x136b7a000) [pid = 1063] [serial = 279] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 70 (0x12c6df000) [pid = 1063] [serial = 245] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:08 INFO - --DOMWINDOW == 69 (0x137062c00) [pid = 1063] [serial = 242] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:08 INFO - --DOMWINDOW == 68 (0x12c71e800) [pid = 1063] [serial = 236] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:08 INFO - --DOMWINDOW == 67 (0x13347e400) [pid = 1063] [serial = 256] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:08 INFO - --DOMWINDOW == 66 (0x12df86800) [pid = 1063] [serial = 253] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:08 INFO - --DOMWINDOW == 65 (0x1208cf800) [pid = 1063] [serial = 249] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:08 INFO - --DOMWINDOW == 64 (0x137049400) [pid = 1063] [serial = 240] [outer = 0x0] [url = data:text/html;charset=utf8,hello%20world] 16:56:08 INFO - --DOMWINDOW == 63 (0x12c21b400) [pid = 1063] [serial = 234] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 62 (0x129f83c00) [pid = 1063] [serial = 251] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:08 INFO - --DOMWINDOW == 61 (0x1370a1400) [pid = 1063] [serial = 241] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 60 (0x12c50f800) [pid = 1063] [serial = 235] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 59 (0x1317f7800) [pid = 1063] [serial = 272] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 58 (0x128ffb000) [pid = 1063] [serial = 265] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 57 (0x127bad800) [pid = 1063] [serial = 293] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOMWINDOW == 56 (0x1365f5000) [pid = 1063] [serial = 286] [outer = 0x0] [url = about:blank] 16:56:08 INFO - --DOCSHELL 0x12ca2c700 == 22 [pid = 1063] [id = 124] 16:56:08 INFO - --DOCSHELL 0x1334e2b00 == 21 [pid = 1063] [id = 121] 16:56:08 INFO - --DOCSHELL 0x12d4c1100 == 20 [pid = 1063] [id = 118] 16:56:09 INFO - --DOCSHELL 0x1285b3e00 == 19 [pid = 1063] [id = 115] 16:56:09 INFO - MEMORY STAT | vsize 3752MB | residentFast 375MB | heapAllocated 112MB 16:56:09 INFO - 119 INFO TEST-OK | devtools/client/webconsole/test/browser_console_history_persist.js | took 9076ms 16:56:09 INFO - ++DOCSHELL 0x127b2ea00 == 20 [pid = 1063] [id = 128] 16:56:09 INFO - ++DOMWINDOW == 57 (0x12976bc00) [pid = 1063] [serial = 297] [outer = 0x0] 16:56:09 INFO - ++DOMWINDOW == 58 (0x12988f000) [pid = 1063] [serial = 298] [outer = 0x12976bc00] 16:56:09 INFO - 120 INFO TEST-START | devtools/client/webconsole/test/browser_console_iframe_messages.js 16:56:09 INFO - ++DOCSHELL 0x128ead000 == 21 [pid = 1063] [id = 129] 16:56:09 INFO - ++DOMWINDOW == 59 (0x10a465400) [pid = 1063] [serial = 299] [outer = 0x0] 16:56:09 INFO - ++DOMWINDOW == 60 (0x129be1800) [pid = 1063] [serial = 300] [outer = 0x10a465400] 16:56:09 INFO - ++DOMWINDOW == 61 (0x129e8d400) [pid = 1063] [serial = 301] [outer = 0x10a465400] 16:56:09 INFO - ++DOCSHELL 0x129fc4e00 == 22 [pid = 1063] [id = 130] 16:56:09 INFO - ++DOMWINDOW == 62 (0x12a0bf000) [pid = 1063] [serial = 302] [outer = 0x0] 16:56:09 INFO - ++DOCSHELL 0x129fc6c00 == 23 [pid = 1063] [id = 131] 16:56:09 INFO - ++DOMWINDOW == 63 (0x12a1d3400) [pid = 1063] [serial = 303] [outer = 0x0] 16:56:09 INFO - ++DOCSHELL 0x12a05b800 == 24 [pid = 1063] [id = 132] 16:56:09 INFO - ++DOMWINDOW == 64 (0x12ae6ac00) [pid = 1063] [serial = 304] [outer = 0x0] 16:56:09 INFO - ++DOMWINDOW == 65 (0x12a117400) [pid = 1063] [serial = 305] [outer = 0x12a1d3400] 16:56:09 INFO - ++DOMWINDOW == 66 (0x12c48b000) [pid = 1063] [serial = 306] [outer = 0x12a0bf000] 16:56:09 INFO - ++DOMWINDOW == 67 (0x12c48bc00) [pid = 1063] [serial = 307] [outer = 0x12ae6ac00] 16:56:09 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html, line 5: ReferenceError: blah is not defined 16:56:09 INFO - ++DOCSHELL 0x12bb2f800 == 25 [pid = 1063] [id = 133] 16:56:09 INFO - ++DOMWINDOW == 68 (0x12c46bc00) [pid = 1063] [serial = 308] [outer = 0x0] 16:56:09 INFO - ++DOMWINDOW == 69 (0x129be1400) [pid = 1063] [serial = 309] [outer = 0x12c46bc00] 16:56:09 INFO - ++DOCSHELL 0x127a9c500 == 26 [pid = 1063] [id = 134] 16:56:09 INFO - ++DOMWINDOW == 70 (0x12c52bc00) [pid = 1063] [serial = 310] [outer = 0x0] 16:56:09 INFO - ++DOMWINDOW == 71 (0x12c71ec00) [pid = 1063] [serial = 311] [outer = 0x12c52bc00] 16:56:10 INFO - ++DOMWINDOW == 72 (0x12c50f800) [pid = 1063] [serial = 312] [outer = 0x12c52bc00] 16:56:10 INFO - ++DOCSHELL 0x12d4c0200 == 27 [pid = 1063] [id = 135] 16:56:10 INFO - ++DOMWINDOW == 73 (0x130aa3800) [pid = 1063] [serial = 313] [outer = 0x0] 16:56:10 INFO - ++DOMWINDOW == 74 (0x130e8b400) [pid = 1063] [serial = 314] [outer = 0x130aa3800] 16:56:11 INFO - --DOCSHELL 0x12d4c0200 == 26 [pid = 1063] [id = 135] 16:56:11 INFO - --DOCSHELL 0x127e63900 == 25 [pid = 1063] [id = 114] 16:56:11 INFO - --DOCSHELL 0x12d52ed00 == 24 [pid = 1063] [id = 125] 16:56:11 INFO - --DOCSHELL 0x127e63e00 == 23 [pid = 1063] [id = 122] 16:56:11 INFO - --DOCSHELL 0x129f9b200 == 22 [pid = 1063] [id = 123] 16:56:11 INFO - --DOCSHELL 0x12c825600 == 21 [pid = 1063] [id = 120] 16:56:11 INFO - --DOCSHELL 0x136495700 == 20 [pid = 1063] [id = 126] 16:56:11 INFO - --DOCSHELL 0x12d52e800 == 19 [pid = 1063] [id = 117] 16:56:11 INFO - --DOMWINDOW == 73 (0x12c777800) [pid = 1063] [serial = 252] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 72 (0x1209dec00) [pid = 1063] [serial = 250] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 71 (0x12cbb6000) [pid = 1063] [serial = 237] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 70 (0x12e824400) [pid = 1063] [serial = 259] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 69 (0x1334d1000) [pid = 1063] [serial = 257] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 68 (0x11f8cc800) [pid = 1063] [serial = 255] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:11 INFO - --DOMWINDOW == 67 (0x12c6dfc00) [pid = 1063] [serial = 246] [outer = 0x0] [url = about:blank] 16:56:11 INFO - --DOMWINDOW == 66 (0x1208cf000) [pid = 1063] [serial = 244] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:12 INFO - --DOMWINDOW == 65 (0x1367fb000) [pid = 1063] [serial = 290] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 16:56:12 INFO - --DOMWINDOW == 64 (0x135587000) [pid = 1063] [serial = 283] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 16:56:12 INFO - --DOMWINDOW == 63 (0x1538a5800) [pid = 1063] [serial = 276] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 16:56:12 INFO - --DOMWINDOW == 62 (0x12df27c00) [pid = 1063] [serial = 269] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 16:56:12 INFO - --DOMWINDOW == 61 (0x127f4e400) [pid = 1063] [serial = 262] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 16:56:12 INFO - --DOMWINDOW == 60 (0x121641000) [pid = 1063] [serial = 260] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 59 (0x12c71ec00) [pid = 1063] [serial = 311] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 58 (0x1354dbc00) [pid = 1063] [serial = 295] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:12 INFO - --DOMWINDOW == 57 (0x11f5b8c00) [pid = 1063] [serial = 292] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:12 INFO - --DOMWINDOW == 56 (0x129be1800) [pid = 1063] [serial = 300] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 55 (0x137048400) [pid = 1063] [serial = 291] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 54 (0x1362eac00) [pid = 1063] [serial = 284] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 53 (0x13515ac00) [pid = 1063] [serial = 277] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 52 (0x12e221000) [pid = 1063] [serial = 270] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 51 (0x1287eb400) [pid = 1063] [serial = 263] [outer = 0x0] [url = about:blank] 16:56:12 INFO - --DOMWINDOW == 50 (0x12664d400) [pid = 1063] [serial = 261] [outer = 0x0] [url = about:blank] 16:56:12 INFO - ++DOCSHELL 0x120926500 == 20 [pid = 1063] [id = 136] 16:56:12 INFO - ++DOMWINDOW == 51 (0x11f83bc00) [pid = 1063] [serial = 315] [outer = 0x0] 16:56:12 INFO - ++DOMWINDOW == 52 (0x11f856c00) [pid = 1063] [serial = 316] [outer = 0x11f83bc00] 16:56:12 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:12 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:12 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:12 INFO - MEMORY STAT | vsize 3734MB | residentFast 353MB | heapAllocated 108MB 16:56:12 INFO - 121 INFO TEST-OK | devtools/client/webconsole/test/browser_console_iframe_messages.js | took 3386ms 16:56:12 INFO - ++DOCSHELL 0x121646100 == 21 [pid = 1063] [id = 137] 16:56:12 INFO - ++DOMWINDOW == 53 (0x12c48b800) [pid = 1063] [serial = 317] [outer = 0x0] 16:56:12 INFO - ++DOMWINDOW == 54 (0x12c76f800) [pid = 1063] [serial = 318] [outer = 0x12c48b800] 16:56:12 INFO - 122 INFO TEST-START | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js 16:56:12 INFO - ++DOCSHELL 0x127a9ca00 == 22 [pid = 1063] [id = 138] 16:56:12 INFO - ++DOMWINDOW == 55 (0x12c989000) [pid = 1063] [serial = 319] [outer = 0x0] 16:56:13 INFO - ++DOMWINDOW == 56 (0x12c9b4c00) [pid = 1063] [serial = 320] [outer = 0x12c989000] 16:56:13 INFO - ++DOMWINDOW == 57 (0x1370a5000) [pid = 1063] [serial = 321] [outer = 0x12c989000] 16:56:13 INFO - ++DOCSHELL 0x1201af300 == 23 [pid = 1063] [id = 139] 16:56:13 INFO - ++DOMWINDOW == 58 (0x12c9b4800) [pid = 1063] [serial = 322] [outer = 0x0] 16:56:13 INFO - ++DOMWINDOW == 59 (0x12d473000) [pid = 1063] [serial = 323] [outer = 0x12c9b4800] 16:56:13 INFO - ++DOMWINDOW == 60 (0x12c48b400) [pid = 1063] [serial = 324] [outer = 0x12c9b4800] 16:56:13 INFO - ++DOCSHELL 0x1298def00 == 24 [pid = 1063] [id = 140] 16:56:13 INFO - ++DOMWINDOW == 61 (0x1355c2c00) [pid = 1063] [serial = 325] [outer = 0x0] 16:56:13 INFO - ++DOMWINDOW == 62 (0x136211800) [pid = 1063] [serial = 326] [outer = 0x1355c2c00] 16:56:15 INFO - --DOCSHELL 0x1298def00 == 23 [pid = 1063] [id = 140] 16:56:15 INFO - --DOCSHELL 0x127a9f200 == 22 [pid = 1063] [id = 113] 16:56:15 INFO - --DOCSHELL 0x121c23e00 == 21 [pid = 1063] [id = 112] 16:56:15 INFO - --DOCSHELL 0x11fb1ee00 == 20 [pid = 1063] [id = 116] 16:56:15 INFO - --DOCSHELL 0x127a9c500 == 19 [pid = 1063] [id = 134] 16:56:15 INFO - --DOCSHELL 0x131b28900 == 18 [pid = 1063] [id = 119] 16:56:15 INFO - --DOMWINDOW == 61 (0x1354db000) [pid = 1063] [serial = 296] [outer = 0x0] [url = about:blank] 16:56:15 INFO - --DOMWINDOW == 60 (0x11f5b8000) [pid = 1063] [serial = 294] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 59 (0x12c52bc00) [pid = 1063] [serial = 310] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 58 (0x1362ea800) [pid = 1063] [serial = 285] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 57 (0x12976bc00) [pid = 1063] [serial = 297] [outer = 0x0] [url = about:blank] 16:56:16 INFO - --DOMWINDOW == 56 (0x10a465400) [pid = 1063] [serial = 299] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 16:56:16 INFO - --DOMWINDOW == 55 (0x12a0bf000) [pid = 1063] [serial = 302] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 16:56:16 INFO - --DOMWINDOW == 54 (0x12ae6ac00) [pid = 1063] [serial = 304] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html] 16:56:16 INFO - --DOMWINDOW == 53 (0x12c46bc00) [pid = 1063] [serial = 308] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 16:56:16 INFO - --DOMWINDOW == 52 (0x12a1d3400) [pid = 1063] [serial = 303] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html] 16:56:16 INFO - --DOMWINDOW == 51 (0x12988f000) [pid = 1063] [serial = 298] [outer = 0x0] [url = about:blank] 16:56:16 INFO - --DOMWINDOW == 50 (0x129e8d400) [pid = 1063] [serial = 301] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 16:56:16 INFO - --DOMWINDOW == 49 (0x12c48b000) [pid = 1063] [serial = 306] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 16:56:16 INFO - --DOMWINDOW == 48 (0x12c48bc00) [pid = 1063] [serial = 307] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html] 16:56:16 INFO - --DOMWINDOW == 47 (0x129be1400) [pid = 1063] [serial = 309] [outer = 0x0] [url = about:blank] 16:56:16 INFO - --DOMWINDOW == 46 (0x12c9b4c00) [pid = 1063] [serial = 320] [outer = 0x0] [url = about:blank] 16:56:16 INFO - --DOMWINDOW == 45 (0x12d473000) [pid = 1063] [serial = 323] [outer = 0x0] [url = about:blank] 16:56:16 INFO - --DOMWINDOW == 44 (0x130aa3800) [pid = 1063] [serial = 313] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:16 INFO - --DOMWINDOW == 43 (0x128696c00) [pid = 1063] [serial = 264] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 42 (0x1367bcc00) [pid = 1063] [serial = 274] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:16 INFO - --DOMWINDOW == 41 (0x12d4cd000) [pid = 1063] [serial = 267] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:16 INFO - --DOMWINDOW == 40 (0x1208cf400) [pid = 1063] [serial = 278] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 39 (0x12e21fc00) [pid = 1063] [serial = 271] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:16 INFO - --DOMWINDOW == 38 (0x133fd7400) [pid = 1063] [serial = 288] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:16 INFO - --DOMWINDOW == 37 (0x137eac800) [pid = 1063] [serial = 281] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:16 INFO - MEMORY STAT | vsize 3769MB | residentFast 381MB | heapAllocated 112MB 16:56:16 INFO - 123 INFO TEST-OK | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js | took 3234ms 16:56:16 INFO - ++DOCSHELL 0x12092a600 == 19 [pid = 1063] [id = 141] 16:56:16 INFO - ++DOMWINDOW == 38 (0x1208cf400) [pid = 1063] [serial = 327] [outer = 0x0] 16:56:16 INFO - ++DOMWINDOW == 39 (0x121627c00) [pid = 1063] [serial = 328] [outer = 0x1208cf400] 16:56:16 INFO - 124 INFO TEST-START | devtools/client/webconsole/test/browser_console_log_inspectable_object.js 16:56:16 INFO - ++DOCSHELL 0x121c91b00 == 20 [pid = 1063] [id = 142] 16:56:16 INFO - ++DOMWINDOW == 40 (0x121641000) [pid = 1063] [serial = 329] [outer = 0x0] 16:56:16 INFO - ++DOMWINDOW == 41 (0x121cbac00) [pid = 1063] [serial = 330] [outer = 0x121641000] 16:56:16 INFO - ++DOCSHELL 0x1201b1600 == 21 [pid = 1063] [id = 143] 16:56:16 INFO - ++DOMWINDOW == 42 (0x121c1c400) [pid = 1063] [serial = 331] [outer = 0x0] 16:56:16 INFO - ++DOMWINDOW == 43 (0x127ace000) [pid = 1063] [serial = 332] [outer = 0x121c1c400] 16:56:16 INFO - ++DOMWINDOW == 44 (0x127f0b800) [pid = 1063] [serial = 333] [outer = 0x121c1c400] 16:56:16 INFO - ++DOCSHELL 0x1285b2000 == 22 [pid = 1063] [id = 144] 16:56:16 INFO - ++DOMWINDOW == 45 (0x12e8fd000) [pid = 1063] [serial = 334] [outer = 0x0] 16:56:16 INFO - ++DOMWINDOW == 46 (0x12e8fd800) [pid = 1063] [serial = 335] [outer = 0x12e8fd000] 16:56:17 INFO - ++DOCSHELL 0x12d4bdf00 == 23 [pid = 1063] [id = 145] 16:56:17 INFO - ++DOMWINDOW == 47 (0x129be1400) [pid = 1063] [serial = 336] [outer = 0x0] 16:56:17 INFO - ++DOMWINDOW == 48 (0x129e8d400) [pid = 1063] [serial = 337] [outer = 0x129be1400] 16:56:18 INFO - --DOCSHELL 0x120926500 == 22 [pid = 1063] [id = 136] 16:56:18 INFO - --DOCSHELL 0x127b2ea00 == 21 [pid = 1063] [id = 128] 16:56:18 INFO - --DOCSHELL 0x12bb2f800 == 20 [pid = 1063] [id = 133] 16:56:18 INFO - --DOCSHELL 0x129fc4e00 == 19 [pid = 1063] [id = 130] 16:56:18 INFO - --DOCSHELL 0x129fc6c00 == 18 [pid = 1063] [id = 131] 16:56:18 INFO - --DOCSHELL 0x12a05b800 == 17 [pid = 1063] [id = 132] 16:56:18 INFO - --DOCSHELL 0x128ead000 == 16 [pid = 1063] [id = 129] 16:56:18 INFO - --DOCSHELL 0x121646100 == 15 [pid = 1063] [id = 137] 16:56:18 INFO - --DOCSHELL 0x127a9ca00 == 14 [pid = 1063] [id = 138] 16:56:18 INFO - --DOCSHELL 0x1285b2000 == 13 [pid = 1063] [id = 144] 16:56:18 INFO - --DOCSHELL 0x1201af300 == 12 [pid = 1063] [id = 139] 16:56:18 INFO - --DOCSHELL 0x12d4bdf00 == 11 [pid = 1063] [id = 145] 16:56:18 INFO - --DOMWINDOW == 47 (0x130e8b400) [pid = 1063] [serial = 314] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 46 (0x127b00800) [pid = 1063] [serial = 266] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 45 (0x1367d8800) [pid = 1063] [serial = 275] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 44 (0x12d5a6000) [pid = 1063] [serial = 268] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 43 (0x136b7a800) [pid = 1063] [serial = 280] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 42 (0x1333b2800) [pid = 1063] [serial = 273] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 41 (0x133fd7c00) [pid = 1063] [serial = 289] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 40 (0x130fb9000) [pid = 1063] [serial = 282] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 39 (0x12a117400) [pid = 1063] [serial = 305] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html] 16:56:18 INFO - --DOMWINDOW == 38 (0x12c50f800) [pid = 1063] [serial = 312] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 37 (0x129fcac00) [pid = 1063] [serial = 287] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 36 (0x12c76f800) [pid = 1063] [serial = 318] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 35 (0x127ace000) [pid = 1063] [serial = 332] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 34 (0x129be1400) [pid = 1063] [serial = 336] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:18 INFO - --DOMWINDOW == 33 (0x1355c2c00) [pid = 1063] [serial = 325] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:18 INFO - --DOMWINDOW == 32 (0x12c9b4800) [pid = 1063] [serial = 322] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:18 INFO - --DOMWINDOW == 31 (0x11f83bc00) [pid = 1063] [serial = 315] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:18 INFO - --DOMWINDOW == 30 (0x12c989000) [pid = 1063] [serial = 319] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:56:18 INFO - --DOMWINDOW == 29 (0x12c48b800) [pid = 1063] [serial = 317] [outer = 0x0] [url = about:blank] 16:56:18 INFO - --DOMWINDOW == 28 (0x1370a5000) [pid = 1063] [serial = 321] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:56:18 INFO - MEMORY STAT | vsize 3764MB | residentFast 373MB | heapAllocated 110MB 16:56:18 INFO - 125 INFO TEST-OK | devtools/client/webconsole/test/browser_console_log_inspectable_object.js | took 2493ms 16:56:18 INFO - ++DOCSHELL 0x1201fb300 == 12 [pid = 1063] [id = 146] 16:56:18 INFO - ++DOMWINDOW == 29 (0x1208cfc00) [pid = 1063] [serial = 338] [outer = 0x0] 16:56:18 INFO - ++DOMWINDOW == 30 (0x12164e400) [pid = 1063] [serial = 339] [outer = 0x1208cfc00] 16:56:18 INFO - 126 INFO TEST-START | devtools/client/webconsole/test/browser_console_native_getters.js 16:56:18 INFO - ++DOCSHELL 0x12172fd00 == 13 [pid = 1063] [id = 147] 16:56:18 INFO - ++DOMWINDOW == 31 (0x12164e800) [pid = 1063] [serial = 340] [outer = 0x0] 16:56:19 INFO - ++DOMWINDOW == 32 (0x12666b000) [pid = 1063] [serial = 341] [outer = 0x12164e800] 16:56:19 INFO - ++DOCSHELL 0x121644800 == 14 [pid = 1063] [id = 148] 16:56:19 INFO - ++DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 342] [outer = 0x0] 16:56:19 INFO - ++DOMWINDOW == 34 (0x127f51000) [pid = 1063] [serial = 343] [outer = 0x12664d400] 16:56:19 INFO - ++DOMWINDOW == 35 (0x127f4e800) [pid = 1063] [serial = 344] [outer = 0x12664d400] 16:56:19 INFO - ++DOCSHELL 0x127e64300 == 15 [pid = 1063] [id = 149] 16:56:19 INFO - ++DOMWINDOW == 36 (0x12d5a6800) [pid = 1063] [serial = 345] [outer = 0x0] 16:56:19 INFO - ++DOMWINDOW == 37 (0x12d5a6c00) [pid = 1063] [serial = 346] [outer = 0x12d5a6800] 16:56:20 INFO - ++DOCSHELL 0x12ca2c700 == 16 [pid = 1063] [id = 150] 16:56:20 INFO - ++DOMWINDOW == 38 (0x12e2b9c00) [pid = 1063] [serial = 347] [outer = 0x0] 16:56:20 INFO - ++DOMWINDOW == 39 (0x12e3cdc00) [pid = 1063] [serial = 348] [outer = 0x12e2b9c00] 16:56:20 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 16:56:22 INFO - ++DOCSHELL 0x120929200 == 17 [pid = 1063] [id = 151] 16:56:22 INFO - ++DOMWINDOW == 40 (0x127f4e400) [pid = 1063] [serial = 349] [outer = 0x0] 16:56:22 INFO - ++DOMWINDOW == 41 (0x12d4cd000) [pid = 1063] [serial = 350] [outer = 0x127f4e400] 16:56:25 INFO - --DOCSHELL 0x12092a600 == 16 [pid = 1063] [id = 141] 16:56:25 INFO - --DOCSHELL 0x121644800 == 15 [pid = 1063] [id = 148] 16:56:25 INFO - --DOCSHELL 0x127e64300 == 14 [pid = 1063] [id = 149] 16:56:25 INFO - --DOCSHELL 0x1201b1600 == 13 [pid = 1063] [id = 143] 16:56:25 INFO - --DOCSHELL 0x12ca2c700 == 12 [pid = 1063] [id = 150] 16:56:25 INFO - --DOCSHELL 0x121c91b00 == 11 [pid = 1063] [id = 142] 16:56:25 INFO - --DOCSHELL 0x120929200 == 10 [pid = 1063] [id = 151] 16:56:25 INFO - --DOMWINDOW == 40 (0x136211800) [pid = 1063] [serial = 326] [outer = 0x0] [url = about:blank] 16:56:25 INFO - --DOMWINDOW == 39 (0x12c48b400) [pid = 1063] [serial = 324] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:25 INFO - --DOMWINDOW == 38 (0x11f856c00) [pid = 1063] [serial = 316] [outer = 0x0] [url = about:blank] 16:56:25 INFO - --DOMWINDOW == 37 (0x129e8d400) [pid = 1063] [serial = 337] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:26 INFO - --DOMWINDOW == 36 (0x121641000) [pid = 1063] [serial = 329] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20676722%20-%20inspectable%20objects%20for%20window.console] 16:56:26 INFO - --DOMWINDOW == 35 (0x1208cf400) [pid = 1063] [serial = 327] [outer = 0x0] [url = about:blank] 16:56:26 INFO - --DOMWINDOW == 34 (0x12e2b9c00) [pid = 1063] [serial = 347] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:26 INFO - --DOMWINDOW == 33 (0x121c1c400) [pid = 1063] [serial = 331] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:26 INFO - --DOMWINDOW == 32 (0x12e8fd000) [pid = 1063] [serial = 334] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:26 INFO - --DOMWINDOW == 31 (0x121cbac00) [pid = 1063] [serial = 330] [outer = 0x0] [url = about:blank] 16:56:26 INFO - --DOMWINDOW == 30 (0x121627c00) [pid = 1063] [serial = 328] [outer = 0x0] [url = about:blank] 16:56:26 INFO - --DOMWINDOW == 29 (0x127f51000) [pid = 1063] [serial = 343] [outer = 0x0] [url = about:blank] 16:56:26 INFO - MEMORY STAT | vsize 3762MB | residentFast 380MB | heapAllocated 117MB 16:56:26 INFO - 127 INFO TEST-OK | devtools/client/webconsole/test/browser_console_native_getters.js | took 7373ms 16:56:26 INFO - ++DOCSHELL 0x1201fdb00 == 11 [pid = 1063] [id = 152] 16:56:26 INFO - ++DOMWINDOW == 30 (0x1200e3000) [pid = 1063] [serial = 351] [outer = 0x0] 16:56:26 INFO - ++DOMWINDOW == 31 (0x120410c00) [pid = 1063] [serial = 352] [outer = 0x1200e3000] 16:56:26 INFO - 128 INFO TEST-START | devtools/client/webconsole/test/browser_console_navigation_marker.js 16:56:26 INFO - ++DOCSHELL 0x121c24d00 == 12 [pid = 1063] [id = 153] 16:56:26 INFO - ++DOMWINDOW == 32 (0x1208cf000) [pid = 1063] [serial = 353] [outer = 0x0] 16:56:26 INFO - ++DOMWINDOW == 33 (0x1209dec00) [pid = 1063] [serial = 354] [outer = 0x1208cf000] 16:56:26 INFO - ++DOMWINDOW == 34 (0x12cf7d800) [pid = 1063] [serial = 355] [outer = 0x1208cf000] 16:56:26 INFO - ++DOCSHELL 0x127e63e00 == 13 [pid = 1063] [id = 154] 16:56:26 INFO - ++DOMWINDOW == 35 (0x120961400) [pid = 1063] [serial = 356] [outer = 0x0] 16:56:26 INFO - ++DOMWINDOW == 36 (0x12775d400) [pid = 1063] [serial = 357] [outer = 0x120961400] 16:56:26 INFO - ++DOMWINDOW == 37 (0x12775d800) [pid = 1063] [serial = 358] [outer = 0x120961400] 16:56:26 INFO - ++DOCSHELL 0x1285b6100 == 14 [pid = 1063] [id = 155] 16:56:26 INFO - ++DOMWINDOW == 38 (0x12ae6a000) [pid = 1063] [serial = 359] [outer = 0x0] 16:56:26 INFO - ++DOMWINDOW == 39 (0x12ae6ac00) [pid = 1063] [serial = 360] [outer = 0x12ae6a000] 16:56:27 INFO - ++DOMWINDOW == 40 (0x133500c00) [pid = 1063] [serial = 361] [outer = 0x1208cf000] 16:56:27 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:56:28 INFO - --DOCSHELL 0x12172fd00 == 13 [pid = 1063] [id = 147] 16:56:28 INFO - --DOCSHELL 0x1201fb300 == 12 [pid = 1063] [id = 146] 16:56:28 INFO - --DOMWINDOW == 39 (0x12e3cdc00) [pid = 1063] [serial = 348] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:28 INFO - --DOMWINDOW == 38 (0x12e8fd800) [pid = 1063] [serial = 335] [outer = 0x0] [url = about:blank] 16:56:28 INFO - --DOMWINDOW == 37 (0x127f0b800) [pid = 1063] [serial = 333] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:29 INFO - --DOMWINDOW == 36 (0x127f4e400) [pid = 1063] [serial = 349] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:29 INFO - --DOMWINDOW == 35 (0x12664d400) [pid = 1063] [serial = 342] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:29 INFO - --DOMWINDOW == 34 (0x12164e800) [pid = 1063] [serial = 340] [outer = 0x0] [url = data:text/html;charset=utf8,bug870220

hello%20world

native%20getters!] 16:56:29 INFO - --DOMWINDOW == 33 (0x12775d400) [pid = 1063] [serial = 357] [outer = 0x0] [url = about:blank] 16:56:29 INFO - --DOMWINDOW == 32 (0x1209dec00) [pid = 1063] [serial = 354] [outer = 0x0] [url = about:blank] 16:56:29 INFO - --DOMWINDOW == 31 (0x1208cfc00) [pid = 1063] [serial = 338] [outer = 0x0] [url = about:blank] 16:56:29 INFO - --DOMWINDOW == 30 (0x12d5a6800) [pid = 1063] [serial = 345] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:29 INFO - MEMORY STAT | vsize 3765MB | residentFast 379MB | heapAllocated 113MB 16:56:29 INFO - 129 INFO TEST-OK | devtools/client/webconsole/test/browser_console_navigation_marker.js | took 2826ms 16:56:29 INFO - ++DOCSHELL 0x121642000 == 13 [pid = 1063] [id = 156] 16:56:29 INFO - ++DOMWINDOW == 31 (0x1208cf400) [pid = 1063] [serial = 362] [outer = 0x0] 16:56:29 INFO - ++DOMWINDOW == 32 (0x1209dec00) [pid = 1063] [serial = 363] [outer = 0x1208cf400] 16:56:29 INFO - 130 INFO TEST-START | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js 16:56:29 INFO - ++DOCSHELL 0x1266a6e00 == 14 [pid = 1063] [id = 157] 16:56:29 INFO - ++DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 364] [outer = 0x0] 16:56:29 INFO - ++DOMWINDOW == 34 (0x12775dc00) [pid = 1063] [serial = 365] [outer = 0x12664d400] 16:56:29 INFO - ++DOCSHELL 0x127a9f200 == 15 [pid = 1063] [id = 158] 16:56:29 INFO - ++DOMWINDOW == 35 (0x12775d400) [pid = 1063] [serial = 366] [outer = 0x0] 16:56:29 INFO - ++DOMWINDOW == 36 (0x127b8fc00) [pid = 1063] [serial = 367] [outer = 0x12775d400] 16:56:29 INFO - ++DOMWINDOW == 37 (0x127b8b800) [pid = 1063] [serial = 368] [outer = 0x12775d400] 16:56:29 INFO - ++DOCSHELL 0x1285b2a00 == 16 [pid = 1063] [id = 159] 16:56:29 INFO - ++DOMWINDOW == 38 (0x12c78f800) [pid = 1063] [serial = 369] [outer = 0x0] 16:56:29 INFO - ++DOMWINDOW == 39 (0x12c87d800) [pid = 1063] [serial = 370] [outer = 0x12c78f800] 16:56:31 INFO - --DOCSHELL 0x1285b6100 == 15 [pid = 1063] [id = 155] 16:56:31 INFO - --DOCSHELL 0x121c24d00 == 14 [pid = 1063] [id = 153] 16:56:31 INFO - --DOCSHELL 0x127e63e00 == 13 [pid = 1063] [id = 154] 16:56:31 INFO - --DOMWINDOW == 38 (0x12d5a6c00) [pid = 1063] [serial = 346] [outer = 0x0] [url = about:blank] 16:56:31 INFO - --DOMWINDOW == 37 (0x127f4e800) [pid = 1063] [serial = 344] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:31 INFO - --DOMWINDOW == 36 (0x12d4cd000) [pid = 1063] [serial = 350] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:31 INFO - --DOMWINDOW == 35 (0x12666b000) [pid = 1063] [serial = 341] [outer = 0x0] [url = about:blank] 16:56:31 INFO - --DOMWINDOW == 34 (0x12cf7d800) [pid = 1063] [serial = 355] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:56:31 INFO - --DOMWINDOW == 33 (0x12164e400) [pid = 1063] [serial = 339] [outer = 0x0] [url = about:blank] 16:56:31 INFO - --DOMWINDOW == 32 (0x120961400) [pid = 1063] [serial = 356] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:31 INFO - --DOMWINDOW == 31 (0x1208cf000) [pid = 1063] [serial = 353] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:56:31 INFO - --DOMWINDOW == 30 (0x127b8fc00) [pid = 1063] [serial = 367] [outer = 0x0] [url = about:blank] 16:56:31 INFO - --DOMWINDOW == 29 (0x1200e3000) [pid = 1063] [serial = 351] [outer = 0x0] [url = about:blank] 16:56:31 INFO - --DOMWINDOW == 28 (0x12ae6a000) [pid = 1063] [serial = 359] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:31 INFO - --DOMWINDOW == 27 (0x133500c00) [pid = 1063] [serial = 361] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:56:31 INFO - ++DOCSHELL 0x1201af300 == 14 [pid = 1063] [id = 160] 16:56:31 INFO - ++DOMWINDOW == 28 (0x10a465400) [pid = 1063] [serial = 371] [outer = 0x0] 16:56:31 INFO - ++DOMWINDOW == 29 (0x11f5b8000) [pid = 1063] [serial = 372] [outer = 0x10a465400] 16:56:31 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:31 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:31 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:32 INFO - MEMORY STAT | vsize 3772MB | residentFast 382MB | heapAllocated 117MB 16:56:32 INFO - 131 INFO TEST-OK | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js | took 2758ms 16:56:32 INFO - ++DOCSHELL 0x12ca2db00 == 15 [pid = 1063] [id = 161] 16:56:32 INFO - ++DOMWINDOW == 30 (0x128d3a800) [pid = 1063] [serial = 373] [outer = 0x0] 16:56:32 INFO - ++DOMWINDOW == 31 (0x128fcf400) [pid = 1063] [serial = 374] [outer = 0x128d3a800] 16:56:32 INFO - 132 INFO TEST-START | devtools/client/webconsole/test/browser_console_open_or_focus.js 16:56:32 INFO - ++DOCSHELL 0x1332c0200 == 16 [pid = 1063] [id = 162] 16:56:32 INFO - ++DOMWINDOW == 32 (0x12976bc00) [pid = 1063] [serial = 375] [outer = 0x0] 16:56:32 INFO - ++DOMWINDOW == 33 (0x12ce44c00) [pid = 1063] [serial = 376] [outer = 0x12976bc00] 16:56:32 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:32 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:32 INFO - console.log: testmessage 16:56:32 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:33 INFO - MEMORY STAT | vsize 3747MB | residentFast 355MB | heapAllocated 115MB 16:56:33 INFO - 133 INFO TEST-OK | devtools/client/webconsole/test/browser_console_open_or_focus.js | took 692ms 16:56:33 INFO - ++DOCSHELL 0x12172f300 == 17 [pid = 1063] [id = 163] 16:56:33 INFO - ++DOMWINDOW == 34 (0x12cf7d800) [pid = 1063] [serial = 377] [outer = 0x0] 16:56:33 INFO - ++DOMWINDOW == 35 (0x12d4cd000) [pid = 1063] [serial = 378] [outer = 0x12cf7d800] 16:56:33 INFO - 134 INFO TEST-START | devtools/client/webconsole/test/browser_console_optimized_out_vars.js 16:56:33 INFO - ++DOCSHELL 0x121c24d00 == 18 [pid = 1063] [id = 164] 16:56:33 INFO - ++DOMWINDOW == 36 (0x13351f000) [pid = 1063] [serial = 379] [outer = 0x0] 16:56:33 INFO - ++DOMWINDOW == 37 (0x1351cc800) [pid = 1063] [serial = 380] [outer = 0x13351f000] 16:56:33 INFO - ++DOMWINDOW == 38 (0x1351f3400) [pid = 1063] [serial = 381] [outer = 0x13351f000] 16:56:33 INFO - ++DOCSHELL 0x1285b2f00 == 19 [pid = 1063] [id = 165] 16:56:33 INFO - ++DOMWINDOW == 39 (0x1351cc000) [pid = 1063] [serial = 382] [outer = 0x0] 16:56:33 INFO - ++DOMWINDOW == 40 (0x13621a400) [pid = 1063] [serial = 383] [outer = 0x1351cc000] 16:56:33 INFO - ++DOMWINDOW == 41 (0x13544fc00) [pid = 1063] [serial = 384] [outer = 0x1351cc000] 16:56:33 INFO - ++DOCSHELL 0x1298de000 == 20 [pid = 1063] [id = 166] 16:56:33 INFO - ++DOMWINDOW == 42 (0x12c48e000) [pid = 1063] [serial = 385] [outer = 0x0] 16:56:33 INFO - ++DOMWINDOW == 43 (0x12c48ec00) [pid = 1063] [serial = 386] [outer = 0x12c48e000] 16:56:34 INFO - ++DOCSHELL 0x11f9a8d00 == 21 [pid = 1063] [id = 167] 16:56:34 INFO - ++DOMWINDOW == 44 (0x1284e0c00) [pid = 1063] [serial = 387] [outer = 0x0] 16:56:34 INFO - ++DOMWINDOW == 45 (0x12cbcec00) [pid = 1063] [serial = 388] [outer = 0x1284e0c00] 16:56:35 INFO - ++DOCSHELL 0x134f9b700 == 22 [pid = 1063] [id = 168] 16:56:35 INFO - ++DOMWINDOW == 46 (0x153894000) [pid = 1063] [serial = 389] [outer = 0x0] 16:56:35 INFO - ++DOMWINDOW == 47 (0x131bc1400) [pid = 1063] [serial = 390] [outer = 0x153894000] 16:56:36 INFO - --DOCSHELL 0x1285b2a00 == 21 [pid = 1063] [id = 159] 16:56:36 INFO - --DOCSHELL 0x12ca2db00 == 20 [pid = 1063] [id = 161] 16:56:36 INFO - --DOCSHELL 0x1266a6e00 == 19 [pid = 1063] [id = 157] 16:56:36 INFO - --DOCSHELL 0x127a9f200 == 18 [pid = 1063] [id = 158] 16:56:36 INFO - --DOCSHELL 0x1201fdb00 == 17 [pid = 1063] [id = 152] 16:56:36 INFO - --DOCSHELL 0x121642000 == 16 [pid = 1063] [id = 156] 16:56:36 INFO - --DOCSHELL 0x1201af300 == 15 [pid = 1063] [id = 160] 16:56:36 INFO - --DOCSHELL 0x1332c0200 == 14 [pid = 1063] [id = 162] 16:56:36 INFO - --DOMWINDOW == 46 (0x12775d800) [pid = 1063] [serial = 358] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:36 INFO - --DOMWINDOW == 45 (0x120410c00) [pid = 1063] [serial = 352] [outer = 0x0] [url = about:blank] 16:56:36 INFO - --DOMWINDOW == 44 (0x12ae6ac00) [pid = 1063] [serial = 360] [outer = 0x0] [url = about:blank] 16:56:38 INFO - --DOCSHELL 0x134f9b700 == 13 [pid = 1063] [id = 168] 16:56:38 INFO - --DOCSHELL 0x11f9a8d00 == 12 [pid = 1063] [id = 167] 16:56:38 INFO - --DOCSHELL 0x1298de000 == 11 [pid = 1063] [id = 166] 16:56:39 INFO - --DOMWINDOW == 43 (0x10a465400) [pid = 1063] [serial = 371] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:39 INFO - --DOMWINDOW == 42 (0x12c78f800) [pid = 1063] [serial = 369] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:39 INFO - --DOMWINDOW == 41 (0x12976bc00) [pid = 1063] [serial = 375] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:39 INFO - --DOMWINDOW == 40 (0x12775d400) [pid = 1063] [serial = 366] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:39 INFO - --DOMWINDOW == 39 (0x1208cf400) [pid = 1063] [serial = 362] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 38 (0x12664d400) [pid = 1063] [serial = 364] [outer = 0x0] [url = data:text/html;charset=utf8,bug859756

hello%20world

nsIConsoleMessages%20ftw!] 16:56:39 INFO - --DOMWINDOW == 37 (0x128d3a800) [pid = 1063] [serial = 373] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 36 (0x13621a400) [pid = 1063] [serial = 383] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 35 (0x1209dec00) [pid = 1063] [serial = 363] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 34 (0x12775dc00) [pid = 1063] [serial = 365] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 33 (0x128fcf400) [pid = 1063] [serial = 374] [outer = 0x0] [url = about:blank] 16:56:39 INFO - --DOMWINDOW == 32 (0x1351cc800) [pid = 1063] [serial = 380] [outer = 0x0] [url = about:blank] 16:56:39 INFO - MEMORY STAT | vsize 3752MB | residentFast 358MB | heapAllocated 111MB 16:56:39 INFO - 135 INFO TEST-OK | devtools/client/webconsole/test/browser_console_optimized_out_vars.js | took 6126ms 16:56:39 INFO - ++DOCSHELL 0x120926000 == 12 [pid = 1063] [id = 169] 16:56:39 INFO - ++DOMWINDOW == 33 (0x12164ec00) [pid = 1063] [serial = 391] [outer = 0x0] 16:56:39 INFO - ++DOMWINDOW == 34 (0x12177fc00) [pid = 1063] [serial = 392] [outer = 0x12164ec00] 16:56:39 INFO - 136 INFO TEST-START | devtools/client/webconsole/test/browser_console_private_browsing.js 16:56:39 INFO - ++DOCSHELL 0x127aa0100 == 13 [pid = 1063] [id = 170] 16:56:39 INFO - ++DOMWINDOW == 35 (0x120316800) [pid = 1063] [serial = 393] [outer = 0x0] 16:56:39 INFO - ++DOMWINDOW == 36 (0x127a78000) [pid = 1063] [serial = 394] [outer = 0x120316800] 16:56:39 INFO - ++DOCSHELL 0x127e63e00 == 14 [pid = 1063] [id = 171] 16:56:39 INFO - ++DOMWINDOW == 37 (0x127bc1400) [pid = 1063] [serial = 395] [outer = 0x0] 16:56:39 INFO - ++DOMWINDOW == 38 (0x127bea800) [pid = 1063] [serial = 396] [outer = 0x127bc1400] 16:56:39 INFO - ++DOCSHELL 0x128580100 == 15 [pid = 1063] [id = 172] 16:56:39 INFO - ++DOMWINDOW == 39 (0x129887800) [pid = 1063] [serial = 397] [outer = 0x0] 16:56:39 INFO - ++DOCSHELL 0x1285b2000 == 16 [pid = 1063] [id = 173] 16:56:39 INFO - ++DOMWINDOW == 40 (0x12988f400) [pid = 1063] [serial = 398] [outer = 0x0] 16:56:39 INFO - ++DOMWINDOW == 41 (0x1299ab000) [pid = 1063] [serial = 399] [outer = 0x12988f400] 16:56:39 INFO - ++DOCSHELL 0x1285b5700 == 17 [pid = 1063] [id = 174] 16:56:39 INFO - ++DOMWINDOW == 42 (0x1297a0800) [pid = 1063] [serial = 400] [outer = 0x0] 16:56:39 INFO - ++DOMWINDOW == 43 (0x12c9b4c00) [pid = 1063] [serial = 401] [outer = 0x1297a0800] 16:56:39 INFO - ++DOMWINDOW == 44 (0x12cbce400) [pid = 1063] [serial = 402] [outer = 0x129887800] 16:56:39 INFO - ++DOMWINDOW == 45 (0x12ced0800) [pid = 1063] [serial = 403] [outer = 0x12988f400] 16:56:39 INFO - ++DOMWINDOW == 46 (0x12cee8c00) [pid = 1063] [serial = 404] [outer = 0x1297a0800] 16:56:40 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:40 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:40 INFO - ++DOMWINDOW == 47 (0x13621a400) [pid = 1063] [serial = 405] [outer = 0x1297a0800] 16:56:40 INFO - ++DOCSHELL 0x136a6bf00 == 18 [pid = 1063] [id = 175] 16:56:40 INFO - ++DOMWINDOW == 48 (0x13628a000) [pid = 1063] [serial = 406] [outer = 0x0] 16:56:40 INFO - ++DOMWINDOW == 49 (0x1362d4c00) [pid = 1063] [serial = 407] [outer = 0x13628a000] 16:56:40 INFO - ++DOCSHELL 0x136b27600 == 19 [pid = 1063] [id = 176] 16:56:40 INFO - ++DOMWINDOW == 50 (0x137062c00) [pid = 1063] [serial = 408] [outer = 0x0] 16:56:40 INFO - ++DOMWINDOW == 51 (0x1370a1400) [pid = 1063] [serial = 409] [outer = 0x137062c00] 16:56:40 INFO - [1063] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1300 16:56:40 INFO - ++DOCSHELL 0x1371f8800 == 20 [pid = 1063] [id = 177] 16:56:40 INFO - ++DOMWINDOW == 52 (0x1370b7400) [pid = 1063] [serial = 410] [outer = 0x0] 16:56:40 INFO - ++DOMWINDOW == 53 (0x137302c00) [pid = 1063] [serial = 411] [outer = 0x1370b7400] 16:56:41 INFO - ++DOMWINDOW == 54 (0x1376c5000) [pid = 1063] [serial = 412] [outer = 0x1370b7400] 16:56:41 INFO - ++DOMWINDOW == 55 (0x137f6d000) [pid = 1063] [serial = 413] [outer = 0x137062c00] 16:56:41 INFO - [1063] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1300 16:56:41 INFO - ++DOCSHELL 0x137ee4700 == 21 [pid = 1063] [id = 178] 16:56:41 INFO - ++DOMWINDOW == 56 (0x12e3a4c00) [pid = 1063] [serial = 414] [outer = 0x0] 16:56:41 INFO - ++DOMWINDOW == 57 (0x134862400) [pid = 1063] [serial = 415] [outer = 0x12e3a4c00] 16:56:42 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 16:56:42 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:42 INFO - --DOCSHELL 0x121c24d00 == 20 [pid = 1063] [id = 164] 16:56:42 INFO - --DOCSHELL 0x12172f300 == 19 [pid = 1063] [id = 163] 16:56:42 INFO - --DOCSHELL 0x1285b2f00 == 18 [pid = 1063] [id = 165] 16:56:42 INFO - --DOCSHELL 0x137ee4700 == 17 [pid = 1063] [id = 178] 16:56:42 INFO - --DOMWINDOW == 56 (0x127b8b800) [pid = 1063] [serial = 368] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:42 INFO - --DOMWINDOW == 55 (0x12c87d800) [pid = 1063] [serial = 370] [outer = 0x0] [url = about:blank] 16:56:42 INFO - --DOMWINDOW == 54 (0x11f5b8000) [pid = 1063] [serial = 372] [outer = 0x0] [url = about:blank] 16:56:42 INFO - --DOMWINDOW == 53 (0x12ce44c00) [pid = 1063] [serial = 376] [outer = 0x0] [url = about:blank] 16:56:42 INFO - --DOMWINDOW == 52 (0x1299ab000) [pid = 1063] [serial = 399] [outer = 0x12988f400] [url = about:blank] 16:56:43 INFO - ++DOCSHELL 0x11f882300 == 18 [pid = 1063] [id = 179] 16:56:43 INFO - ++DOMWINDOW == 53 (0x10a465c00) [pid = 1063] [serial = 416] [outer = 0x0] 16:56:43 INFO - ++DOMWINDOW == 54 (0x11f4e5000) [pid = 1063] [serial = 417] [outer = 0x10a465c00] 16:56:43 INFO - --DOMWINDOW == 53 (0x12d4cd000) [pid = 1063] [serial = 378] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 52 (0x12c9b4c00) [pid = 1063] [serial = 401] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 51 (0x12cee8c00) [pid = 1063] [serial = 404] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 50 (0x137302c00) [pid = 1063] [serial = 411] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 49 (0x1370a1400) [pid = 1063] [serial = 409] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 48 (0x13351f000) [pid = 1063] [serial = 379] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 16:56:43 INFO - --DOMWINDOW == 47 (0x12c48e000) [pid = 1063] [serial = 385] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:43 INFO - --DOMWINDOW == 46 (0x1284e0c00) [pid = 1063] [serial = 387] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:56:43 INFO - --DOMWINDOW == 45 (0x1351cc000) [pid = 1063] [serial = 382] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:43 INFO - --DOMWINDOW == 44 (0x12cf7d800) [pid = 1063] [serial = 377] [outer = 0x0] [url = about:blank] 16:56:43 INFO - --DOMWINDOW == 43 (0x153894000) [pid = 1063] [serial = 389] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:56:43 INFO - --DOMWINDOW == 42 (0x1351f3400) [pid = 1063] [serial = 381] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 16:56:43 INFO - ++DOMWINDOW == 43 (0x11f5b8000) [pid = 1063] [serial = 418] [outer = 0x10a465c00] 16:56:43 INFO - ++DOCSHELL 0x121c24d00 == 19 [pid = 1063] [id = 180] 16:56:43 INFO - ++DOMWINDOW == 44 (0x12ea1c000) [pid = 1063] [serial = 419] [outer = 0x0] 16:56:43 INFO - ++DOMWINDOW == 45 (0x12eb83800) [pid = 1063] [serial = 420] [outer = 0x12ea1c000] 16:56:44 INFO - --DOCSHELL 0x121c24d00 == 18 [pid = 1063] [id = 180] 16:56:44 INFO - --DOCSHELL 0x136b27600 == 17 [pid = 1063] [id = 176] 16:56:44 INFO - --DOMWINDOW == 44 (0x12cbcec00) [pid = 1063] [serial = 388] [outer = 0x0] [url = about:blank] 16:56:44 INFO - --DOMWINDOW == 43 (0x12c48ec00) [pid = 1063] [serial = 386] [outer = 0x0] [url = about:blank] 16:56:44 INFO - --DOMWINDOW == 42 (0x13544fc00) [pid = 1063] [serial = 384] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:44 INFO - --DOMWINDOW == 41 (0x131bc1400) [pid = 1063] [serial = 390] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:56:44 INFO - --DOMWINDOW == 40 (0x11f4e5000) [pid = 1063] [serial = 417] [outer = 0x0] [url = about:blank] 16:56:44 INFO - ++DOCSHELL 0x1201fb300 == 18 [pid = 1063] [id = 181] 16:56:44 INFO - ++DOMWINDOW == 41 (0x11f4e5800) [pid = 1063] [serial = 421] [outer = 0x0] 16:56:44 INFO - ++DOMWINDOW == 42 (0x11f598c00) [pid = 1063] [serial = 422] [outer = 0x11f4e5800] 16:56:45 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:45 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:45 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 16:56:45 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:45 INFO - ++DOCSHELL 0x1201ad000 == 19 [pid = 1063] [id = 182] 16:56:45 INFO - ++DOMWINDOW == 43 (0x1200e3000) [pid = 1063] [serial = 423] [outer = 0x0] 16:56:45 INFO - ++DOMWINDOW == 44 (0x12775d000) [pid = 1063] [serial = 424] [outer = 0x1200e3000] 16:56:45 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:45 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:56:46 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:56:46 INFO - MEMORY STAT | vsize 3737MB | residentFast 352MB | heapAllocated 116MB 16:56:46 INFO - 137 INFO TEST-OK | devtools/client/webconsole/test/browser_console_private_browsing.js | took 7055ms 16:56:46 INFO - ++DOCSHELL 0x121c24d00 == 20 [pid = 1063] [id = 183] 16:56:46 INFO - ++DOMWINDOW == 45 (0x129838400) [pid = 1063] [serial = 425] [outer = 0x0] 16:56:46 INFO - ++DOMWINDOW == 46 (0x129f83800) [pid = 1063] [serial = 426] [outer = 0x129838400] 16:56:46 INFO - 138 INFO TEST-START | devtools/client/webconsole/test/browser_console_server_logging.js 16:56:46 INFO - ++DOCSHELL 0x127e66100 == 21 [pid = 1063] [id = 184] 16:56:46 INFO - ++DOMWINDOW == 47 (0x12031e800) [pid = 1063] [serial = 427] [outer = 0x0] 16:56:46 INFO - ++DOMWINDOW == 48 (0x120538400) [pid = 1063] [serial = 428] [outer = 0x12031e800] 16:56:46 INFO - ++DOMWINDOW == 49 (0x12014b400) [pid = 1063] [serial = 429] [outer = 0x12031e800] 16:56:46 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:56:46 INFO - ++DOCSHELL 0x129f99e00 == 22 [pid = 1063] [id = 185] 16:56:46 INFO - ++DOMWINDOW == 50 (0x1204e0400) [pid = 1063] [serial = 430] [outer = 0x0] 16:56:46 INFO - ++DOMWINDOW == 51 (0x127f0bc00) [pid = 1063] [serial = 431] [outer = 0x1204e0400] 16:56:47 INFO - ++DOMWINDOW == 52 (0x1205f8c00) [pid = 1063] [serial = 432] [outer = 0x1204e0400] 16:56:47 INFO - ++DOCSHELL 0x12a05c200 == 23 [pid = 1063] [id = 186] 16:56:47 INFO - ++DOMWINDOW == 53 (0x130995400) [pid = 1063] [serial = 433] [outer = 0x0] 16:56:47 INFO - ++DOMWINDOW == 54 (0x130aa9800) [pid = 1063] [serial = 434] [outer = 0x130995400] 16:56:48 INFO - ++DOMWINDOW == 55 (0x12bfd9000) [pid = 1063] [serial = 435] [outer = 0x12031e800] 16:56:48 INFO - [1063] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsDocument.cpp, line 4761 16:56:48 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:56:48 INFO - --DOCSHELL 0x127aa0100 == 22 [pid = 1063] [id = 170] 16:56:48 INFO - --DOCSHELL 0x12a05c200 == 21 [pid = 1063] [id = 186] 16:56:48 INFO - --DOCSHELL 0x11f882300 == 20 [pid = 1063] [id = 179] 16:56:48 INFO - --DOMWINDOW == 54 (0x12ced0800) [pid = 1063] [serial = 403] [outer = 0x12988f400] [url = about:blank] 16:56:48 INFO - --DOMWINDOW == 53 (0x12cbce400) [pid = 1063] [serial = 402] [outer = 0x129887800] [url = about:blank] 16:56:48 INFO - --DOMWINDOW == 52 (0x129887800) [pid = 1063] [serial = 397] [outer = 0x0] [url = about:blank] 16:56:48 INFO - --DOMWINDOW == 51 (0x12988f400) [pid = 1063] [serial = 398] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 50 (0x1297a0800) [pid = 1063] [serial = 400] [outer = 0x0] [url = about:privatebrowsing] 16:56:49 INFO - --DOMWINDOW == 49 (0x1370b7400) [pid = 1063] [serial = 410] [outer = 0x0] [url = about:privatebrowsing] 16:56:49 INFO - --DOMWINDOW == 48 (0x10a465c00) [pid = 1063] [serial = 416] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:49 INFO - --DOMWINDOW == 47 (0x137062c00) [pid = 1063] [serial = 408] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:49 INFO - --DOMWINDOW == 46 (0x12ea1c000) [pid = 1063] [serial = 419] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:49 INFO - --DOMWINDOW == 45 (0x12e3a4c00) [pid = 1063] [serial = 414] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:49 INFO - --DOMWINDOW == 44 (0x120316800) [pid = 1063] [serial = 393] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world!%20I%20am%20not%20private!] 16:56:49 INFO - --DOMWINDOW == 43 (0x12164ec00) [pid = 1063] [serial = 391] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 42 (0x127a78000) [pid = 1063] [serial = 394] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 41 (0x12177fc00) [pid = 1063] [serial = 392] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 40 (0x120538400) [pid = 1063] [serial = 428] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 39 (0x127f0bc00) [pid = 1063] [serial = 431] [outer = 0x0] [url = about:blank] 16:56:49 INFO - --DOMWINDOW == 38 (0x12014b400) [pid = 1063] [serial = 429] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 16:56:49 INFO - MEMORY STAT | vsize 3743MB | residentFast 371MB | heapAllocated 112MB 16:56:49 INFO - 139 INFO TEST-OK | devtools/client/webconsole/test/browser_console_server_logging.js | took 2682ms 16:56:49 INFO - ++DOCSHELL 0x120926f00 == 21 [pid = 1063] [id = 187] 16:56:49 INFO - ++DOMWINDOW == 39 (0x120538400) [pid = 1063] [serial = 436] [outer = 0x0] 16:56:49 INFO - ++DOMWINDOW == 40 (0x12164ec00) [pid = 1063] [serial = 437] [outer = 0x120538400] 16:56:49 INFO - 140 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view.js 16:56:49 INFO - ++DOCSHELL 0x1266a6900 == 22 [pid = 1063] [id = 188] 16:56:49 INFO - ++DOMWINDOW == 41 (0x11f856c00) [pid = 1063] [serial = 438] [outer = 0x0] 16:56:49 INFO - ++DOMWINDOW == 42 (0x127a78000) [pid = 1063] [serial = 439] [outer = 0x11f856c00] 16:56:49 INFO - ++DOMWINDOW == 43 (0x1334dd800) [pid = 1063] [serial = 440] [outer = 0x11f856c00] 16:56:49 INFO - ++DOCSHELL 0x1285b2f00 == 23 [pid = 1063] [id = 189] 16:56:49 INFO - ++DOMWINDOW == 44 (0x12775dc00) [pid = 1063] [serial = 441] [outer = 0x0] 16:56:49 INFO - ++DOMWINDOW == 45 (0x127fb7400) [pid = 1063] [serial = 442] [outer = 0x12775dc00] 16:56:49 INFO - ++DOMWINDOW == 46 (0x127f4e400) [pid = 1063] [serial = 443] [outer = 0x12775dc00] 16:56:49 INFO - ++DOCSHELL 0x129f99400 == 24 [pid = 1063] [id = 190] 16:56:49 INFO - ++DOMWINDOW == 47 (0x12e3cdc00) [pid = 1063] [serial = 444] [outer = 0x0] 16:56:49 INFO - ++DOMWINDOW == 48 (0x12e824400) [pid = 1063] [serial = 445] [outer = 0x12e3cdc00] 16:56:50 INFO - ++DOCSHELL 0x130927000 == 25 [pid = 1063] [id = 191] 16:56:50 INFO - ++DOMWINDOW == 49 (0x12a03b400) [pid = 1063] [serial = 446] [outer = 0x0] 16:56:50 INFO - ++DOMWINDOW == 50 (0x12a0bf000) [pid = 1063] [serial = 447] [outer = 0x12a03b400] 16:56:52 INFO - --DOCSHELL 0x120926000 == 24 [pid = 1063] [id = 169] 16:56:52 INFO - --DOCSHELL 0x1201fb300 == 23 [pid = 1063] [id = 181] 16:56:52 INFO - --DOCSHELL 0x128580100 == 22 [pid = 1063] [id = 172] 16:56:52 INFO - --DOCSHELL 0x1285b2000 == 21 [pid = 1063] [id = 173] 16:56:52 INFO - --DOCSHELL 0x1285b5700 == 20 [pid = 1063] [id = 174] 16:56:52 INFO - --DOCSHELL 0x1371f8800 == 19 [pid = 1063] [id = 177] 16:56:52 INFO - --DOCSHELL 0x127e63e00 == 18 [pid = 1063] [id = 171] 16:56:52 INFO - --DOCSHELL 0x1201ad000 == 17 [pid = 1063] [id = 182] 16:56:52 INFO - --DOCSHELL 0x136a6bf00 == 16 [pid = 1063] [id = 175] 16:56:52 INFO - --DOCSHELL 0x127e66100 == 15 [pid = 1063] [id = 184] 16:56:52 INFO - --DOCSHELL 0x129f99e00 == 14 [pid = 1063] [id = 185] 16:56:52 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 190] 16:56:52 INFO - --DOCSHELL 0x130927000 == 12 [pid = 1063] [id = 191] 16:56:52 INFO - --DOMWINDOW == 49 (0x12eb83800) [pid = 1063] [serial = 420] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 48 (0x11f5b8000) [pid = 1063] [serial = 418] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:52 INFO - --DOMWINDOW == 47 (0x134862400) [pid = 1063] [serial = 415] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 46 (0x137f6d000) [pid = 1063] [serial = 413] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:52 INFO - --DOMWINDOW == 45 (0x13621a400) [pid = 1063] [serial = 405] [outer = 0x0] [url = about:privatebrowsing] 16:56:52 INFO - --DOMWINDOW == 44 (0x1376c5000) [pid = 1063] [serial = 412] [outer = 0x0] [url = about:privatebrowsing] 16:56:52 INFO - --DOMWINDOW == 43 (0x13628a000) [pid = 1063] [serial = 406] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20world!%20bug%20874061click] 16:56:52 INFO - --DOMWINDOW == 42 (0x12031e800) [pid = 1063] [serial = 427] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 16:56:52 INFO - --DOMWINDOW == 41 (0x129838400) [pid = 1063] [serial = 425] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 40 (0x127a78000) [pid = 1063] [serial = 439] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 39 (0x129f83800) [pid = 1063] [serial = 426] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 38 (0x127fb7400) [pid = 1063] [serial = 442] [outer = 0x0] [url = about:blank] 16:56:52 INFO - --DOMWINDOW == 37 (0x11f4e5800) [pid = 1063] [serial = 421] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:52 INFO - --DOMWINDOW == 36 (0x130995400) [pid = 1063] [serial = 433] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:52 INFO - --DOMWINDOW == 35 (0x1204e0400) [pid = 1063] [serial = 430] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:52 INFO - --DOMWINDOW == 34 (0x1200e3000) [pid = 1063] [serial = 423] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:56:52 INFO - --DOMWINDOW == 33 (0x127bc1400) [pid = 1063] [serial = 395] [outer = 0x0] [url = chrome://browser/content/browser.xul] 16:56:52 INFO - --DOMWINDOW == 32 (0x12bfd9000) [pid = 1063] [serial = 435] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 16:56:52 INFO - MEMORY STAT | vsize 3747MB | residentFast 373MB | heapAllocated 110MB 16:56:52 INFO - 141 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view.js | took 3284ms 16:56:52 INFO - ++DOCSHELL 0x1201fb300 == 13 [pid = 1063] [id = 192] 16:56:52 INFO - ++DOMWINDOW == 33 (0x12031e800) [pid = 1063] [serial = 448] [outer = 0x0] 16:56:52 INFO - ++DOMWINDOW == 34 (0x120510000) [pid = 1063] [serial = 449] [outer = 0x12031e800] 16:56:52 INFO - 142 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js 16:56:52 INFO - ++DOCSHELL 0x121c91b00 == 14 [pid = 1063] [id = 193] 16:56:52 INFO - ++DOMWINDOW == 35 (0x121641000) [pid = 1063] [serial = 450] [outer = 0x0] 16:56:52 INFO - ++DOMWINDOW == 36 (0x121770000) [pid = 1063] [serial = 451] [outer = 0x121641000] 16:56:53 INFO - ++DOCSHELL 0x127a9f200 == 15 [pid = 1063] [id = 194] 16:56:53 INFO - ++DOMWINDOW == 37 (0x1216fe400) [pid = 1063] [serial = 452] [outer = 0x0] 16:56:53 INFO - ++DOMWINDOW == 38 (0x127ace000) [pid = 1063] [serial = 453] [outer = 0x1216fe400] 16:56:53 INFO - ++DOMWINDOW == 39 (0x11f4e5c00) [pid = 1063] [serial = 454] [outer = 0x1216fe400] 16:56:53 INFO - ++DOCSHELL 0x1285b2a00 == 16 [pid = 1063] [id = 195] 16:56:53 INFO - ++DOMWINDOW == 40 (0x12c26dc00) [pid = 1063] [serial = 455] [outer = 0x0] 16:56:53 INFO - ++DOMWINDOW == 41 (0x12c345400) [pid = 1063] [serial = 456] [outer = 0x12c26dc00] 16:56:54 INFO - ++DOCSHELL 0x12cb89600 == 17 [pid = 1063] [id = 196] 16:56:54 INFO - ++DOMWINDOW == 42 (0x127b00800) [pid = 1063] [serial = 457] [outer = 0x0] 16:56:54 INFO - ++DOMWINDOW == 43 (0x127f4e000) [pid = 1063] [serial = 458] [outer = 0x127b00800] 16:56:55 INFO - --DOCSHELL 0x1266a6900 == 16 [pid = 1063] [id = 188] 16:56:55 INFO - --DOCSHELL 0x121c24d00 == 15 [pid = 1063] [id = 183] 16:56:55 INFO - --DOCSHELL 0x1285b2f00 == 14 [pid = 1063] [id = 189] 16:56:55 INFO - --DOCSHELL 0x120926f00 == 13 [pid = 1063] [id = 187] 16:56:55 INFO - --DOCSHELL 0x1285b2a00 == 12 [pid = 1063] [id = 195] 16:56:55 INFO - --DOCSHELL 0x12cb89600 == 11 [pid = 1063] [id = 196] 16:56:55 INFO - --DOMWINDOW == 42 (0x12775d000) [pid = 1063] [serial = 424] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 41 (0x11f598c00) [pid = 1063] [serial = 422] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 40 (0x127bea800) [pid = 1063] [serial = 396] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 39 (0x130aa9800) [pid = 1063] [serial = 434] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 38 (0x1205f8c00) [pid = 1063] [serial = 432] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:56:55 INFO - --DOMWINDOW == 37 (0x1362d4c00) [pid = 1063] [serial = 407] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 36 (0x12164ec00) [pid = 1063] [serial = 437] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 35 (0x127ace000) [pid = 1063] [serial = 453] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 34 (0x12a03b400) [pid = 1063] [serial = 446] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:56:55 INFO - --DOMWINDOW == 33 (0x11f856c00) [pid = 1063] [serial = 438] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:56:55 INFO - --DOMWINDOW == 32 (0x120538400) [pid = 1063] [serial = 436] [outer = 0x0] [url = about:blank] 16:56:55 INFO - --DOMWINDOW == 31 (0x1334dd800) [pid = 1063] [serial = 440] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:56:55 INFO - MEMORY STAT | vsize 3747MB | residentFast 371MB | heapAllocated 108MB 16:56:55 INFO - 143 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js | took 2536ms 16:56:55 INFO - ++DOCSHELL 0x1201fdb00 == 12 [pid = 1063] [id = 197] 16:56:55 INFO - ++DOMWINDOW == 32 (0x12031e000) [pid = 1063] [serial = 459] [outer = 0x0] 16:56:55 INFO - ++DOMWINDOW == 33 (0x120410c00) [pid = 1063] [serial = 460] [outer = 0x12031e000] 16:56:55 INFO - 144 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js 16:56:55 INFO - ++DOCSHELL 0x121c24d00 == 13 [pid = 1063] [id = 198] 16:56:55 INFO - ++DOMWINDOW == 34 (0x121cbac00) [pid = 1063] [serial = 461] [outer = 0x0] 16:56:55 INFO - ++DOMWINDOW == 35 (0x12775d000) [pid = 1063] [serial = 462] [outer = 0x121cbac00] 16:56:55 INFO - ++DOCSHELL 0x127a9ca00 == 14 [pid = 1063] [id = 199] 16:56:55 INFO - ++DOMWINDOW == 36 (0x1276eb000) [pid = 1063] [serial = 463] [outer = 0x0] 16:56:55 INFO - ++DOMWINDOW == 37 (0x127f4e800) [pid = 1063] [serial = 464] [outer = 0x1276eb000] 16:56:55 INFO - ++DOMWINDOW == 38 (0x127f0b800) [pid = 1063] [serial = 465] [outer = 0x1276eb000] 16:56:55 INFO - ++DOCSHELL 0x12857c500 == 15 [pid = 1063] [id = 200] 16:56:55 INFO - ++DOMWINDOW == 39 (0x12bf01400) [pid = 1063] [serial = 466] [outer = 0x0] 16:56:55 INFO - ++DOMWINDOW == 40 (0x12bf01800) [pid = 1063] [serial = 467] [outer = 0x12bf01400] 16:56:56 INFO - ++DOCSHELL 0x12ca29000 == 16 [pid = 1063] [id = 201] 16:56:56 INFO - ++DOMWINDOW == 41 (0x129838400) [pid = 1063] [serial = 468] [outer = 0x0] 16:56:56 INFO - ++DOMWINDOW == 42 (0x129887800) [pid = 1063] [serial = 469] [outer = 0x129838400] 16:57:01 INFO - --DOCSHELL 0x1201fb300 == 15 [pid = 1063] [id = 192] 16:57:01 INFO - --DOCSHELL 0x127a9ca00 == 14 [pid = 1063] [id = 199] 16:57:01 INFO - --DOCSHELL 0x12857c500 == 13 [pid = 1063] [id = 200] 16:57:01 INFO - --DOCSHELL 0x127a9f200 == 12 [pid = 1063] [id = 194] 16:57:01 INFO - --DOCSHELL 0x121c91b00 == 11 [pid = 1063] [id = 193] 16:57:01 INFO - --DOCSHELL 0x12ca29000 == 10 [pid = 1063] [id = 201] 16:57:01 INFO - --DOMWINDOW == 41 (0x12a0bf000) [pid = 1063] [serial = 447] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:01 INFO - --DOMWINDOW == 40 (0x127b00800) [pid = 1063] [serial = 457] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:01 INFO - --DOMWINDOW == 39 (0x12c26dc00) [pid = 1063] [serial = 455] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:01 INFO - --DOMWINDOW == 38 (0x121641000) [pid = 1063] [serial = 450] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20for%20DOM%20nodes%20in%20variables%20view%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%] 16:57:01 INFO - --DOMWINDOW == 37 (0x12031e800) [pid = 1063] [serial = 448] [outer = 0x0] [url = about:blank] 16:57:01 INFO - --DOMWINDOW == 36 (0x12e3cdc00) [pid = 1063] [serial = 444] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:01 INFO - --DOMWINDOW == 35 (0x1216fe400) [pid = 1063] [serial = 452] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:01 INFO - --DOMWINDOW == 34 (0x12775dc00) [pid = 1063] [serial = 441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:01 INFO - --DOMWINDOW == 33 (0x127f4e800) [pid = 1063] [serial = 464] [outer = 0x0] [url = about:blank] 16:57:01 INFO - --DOMWINDOW == 32 (0x121770000) [pid = 1063] [serial = 451] [outer = 0x0] [url = about:blank] 16:57:01 INFO - --DOMWINDOW == 31 (0x120510000) [pid = 1063] [serial = 449] [outer = 0x0] [url = about:blank] 16:57:01 INFO - MEMORY STAT | vsize 3743MB | residentFast 372MB | heapAllocated 114MB 16:57:01 INFO - 145 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js | took 6232ms 16:57:01 INFO - ++DOCSHELL 0x120926000 == 11 [pid = 1063] [id = 202] 16:57:01 INFO - ++DOMWINDOW == 32 (0x120316800) [pid = 1063] [serial = 470] [outer = 0x0] 16:57:01 INFO - ++DOMWINDOW == 33 (0x120510000) [pid = 1063] [serial = 471] [outer = 0x120316800] 16:57:01 INFO - 146 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_filter.js 16:57:01 INFO - ++DOCSHELL 0x1266a6900 == 12 [pid = 1063] [id = 203] 16:57:01 INFO - ++DOMWINDOW == 34 (0x1205f8c00) [pid = 1063] [serial = 472] [outer = 0x0] 16:57:01 INFO - ++DOMWINDOW == 35 (0x121c1c400) [pid = 1063] [serial = 473] [outer = 0x1205f8c00] 16:57:02 INFO - ++DOCSHELL 0x121642500 == 13 [pid = 1063] [id = 204] 16:57:02 INFO - ++DOMWINDOW == 36 (0x12177fc00) [pid = 1063] [serial = 474] [outer = 0x0] 16:57:02 INFO - ++DOMWINDOW == 37 (0x127b8b000) [pid = 1063] [serial = 475] [outer = 0x12177fc00] 16:57:02 INFO - ++DOMWINDOW == 38 (0x127b8b800) [pid = 1063] [serial = 476] [outer = 0x12177fc00] 16:57:02 INFO - ++DOCSHELL 0x127e66100 == 14 [pid = 1063] [id = 205] 16:57:02 INFO - ++DOMWINDOW == 39 (0x12c3d1000) [pid = 1063] [serial = 477] [outer = 0x0] 16:57:02 INFO - ++DOMWINDOW == 40 (0x12c48e400) [pid = 1063] [serial = 478] [outer = 0x12c3d1000] 16:57:03 INFO - ++DOCSHELL 0x12d52e800 == 15 [pid = 1063] [id = 206] 16:57:03 INFO - ++DOMWINDOW == 41 (0x133500c00) [pid = 1063] [serial = 479] [outer = 0x0] 16:57:03 INFO - ++DOMWINDOW == 42 (0x13351f000) [pid = 1063] [serial = 480] [outer = 0x133500c00] 16:57:04 INFO - --DOCSHELL 0x1201fdb00 == 14 [pid = 1063] [id = 197] 16:57:04 INFO - --DOCSHELL 0x127e66100 == 13 [pid = 1063] [id = 205] 16:57:04 INFO - --DOCSHELL 0x121c24d00 == 12 [pid = 1063] [id = 198] 16:57:04 INFO - --DOCSHELL 0x12d52e800 == 11 [pid = 1063] [id = 206] 16:57:04 INFO - --DOMWINDOW == 41 (0x127f4e000) [pid = 1063] [serial = 458] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:04 INFO - --DOMWINDOW == 40 (0x12c345400) [pid = 1063] [serial = 456] [outer = 0x0] [url = about:blank] 16:57:04 INFO - --DOMWINDOW == 39 (0x11f4e5c00) [pid = 1063] [serial = 454] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:04 INFO - --DOMWINDOW == 38 (0x12e824400) [pid = 1063] [serial = 445] [outer = 0x0] [url = about:blank] 16:57:04 INFO - --DOMWINDOW == 37 (0x127f4e400) [pid = 1063] [serial = 443] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:04 INFO - --DOMWINDOW == 36 (0x129838400) [pid = 1063] [serial = 468] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:04 INFO - --DOMWINDOW == 35 (0x121cbac00) [pid = 1063] [serial = 461] [outer = 0x0] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20document%20for%20bug%20977500%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20

%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%] 16:57:04 INFO - --DOMWINDOW == 34 (0x127b8b000) [pid = 1063] [serial = 475] [outer = 0x0] [url = about:blank] 16:57:04 INFO - --DOMWINDOW == 33 (0x12031e000) [pid = 1063] [serial = 459] [outer = 0x0] [url = about:blank] 16:57:04 INFO - --DOMWINDOW == 32 (0x120410c00) [pid = 1063] [serial = 460] [outer = 0x0] [url = about:blank] 16:57:04 INFO - --DOMWINDOW == 31 (0x1276eb000) [pid = 1063] [serial = 463] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:04 INFO - --DOMWINDOW == 30 (0x12bf01400) [pid = 1063] [serial = 466] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:04 INFO - --DOMWINDOW == 29 (0x12775d000) [pid = 1063] [serial = 462] [outer = 0x0] [url = about:blank] 16:57:04 INFO - MEMORY STAT | vsize 3740MB | residentFast 369MB | heapAllocated 109MB 16:57:04 INFO - 147 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_filter.js | took 2953ms 16:57:04 INFO - ++DOCSHELL 0x12092ab00 == 12 [pid = 1063] [id = 207] 16:57:04 INFO - ++DOMWINDOW == 30 (0x12031e800) [pid = 1063] [serial = 481] [outer = 0x0] 16:57:04 INFO - ++DOMWINDOW == 31 (0x1208c7c00) [pid = 1063] [serial = 482] [outer = 0x12031e800] 16:57:05 INFO - 148 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js 16:57:05 INFO - ++DOCSHELL 0x1266a6400 == 13 [pid = 1063] [id = 208] 16:57:05 INFO - ++DOMWINDOW == 32 (0x11f830c00) [pid = 1063] [serial = 483] [outer = 0x0] 16:57:05 INFO - ++DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 484] [outer = 0x11f830c00] 16:57:05 INFO - ++DOMWINDOW == 34 (0x127ad8c00) [pid = 1063] [serial = 485] [outer = 0x11f830c00] 16:57:05 INFO - ++DOCSHELL 0x127b2ea00 == 14 [pid = 1063] [id = 209] 16:57:05 INFO - ++DOMWINDOW == 35 (0x121770000) [pid = 1063] [serial = 486] [outer = 0x0] 16:57:05 INFO - ++DOMWINDOW == 36 (0x127bc1400) [pid = 1063] [serial = 487] [outer = 0x121770000] 16:57:05 INFO - ++DOMWINDOW == 37 (0x127f4e800) [pid = 1063] [serial = 488] [outer = 0x121770000] 16:57:05 INFO - ++DOCSHELL 0x128ead000 == 15 [pid = 1063] [id = 210] 16:57:05 INFO - ++DOMWINDOW == 38 (0x12c3ea000) [pid = 1063] [serial = 489] [outer = 0x0] 16:57:05 INFO - ++DOMWINDOW == 39 (0x12c3ea400) [pid = 1063] [serial = 490] [outer = 0x12c3ea000] 16:57:06 INFO - ++DOCSHELL 0x12ca29000 == 16 [pid = 1063] [id = 211] 16:57:06 INFO - ++DOMWINDOW == 40 (0x12976b400) [pid = 1063] [serial = 491] [outer = 0x0] 16:57:06 INFO - ++DOMWINDOW == 41 (0x1297a0800) [pid = 1063] [serial = 492] [outer = 0x12976b400] 16:57:06 INFO - ++DOCSHELL 0x130928e00 == 17 [pid = 1063] [id = 212] 16:57:06 INFO - ++DOMWINDOW == 42 (0x136671800) [pid = 1063] [serial = 493] [outer = 0x0] 16:57:06 INFO - ++DOMWINDOW == 43 (0x1366dbc00) [pid = 1063] [serial = 494] [outer = 0x136671800] 16:57:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:07 INFO - ++DOCSHELL 0x13092b600 == 18 [pid = 1063] [id = 213] 16:57:07 INFO - ++DOMWINDOW == 44 (0x120917c00) [pid = 1063] [serial = 495] [outer = 0x0] 16:57:07 INFO - ++DOMWINDOW == 45 (0x131b85800) [pid = 1063] [serial = 496] [outer = 0x120917c00] 16:57:07 INFO - ++DOCSHELL 0x131b2a200 == 19 [pid = 1063] [id = 214] 16:57:07 INFO - ++DOMWINDOW == 46 (0x136439800) [pid = 1063] [serial = 497] [outer = 0x0] 16:57:07 INFO - ++DOCSHELL 0x1332bdf00 == 20 [pid = 1063] [id = 215] 16:57:07 INFO - ++DOMWINDOW == 47 (0x136439c00) [pid = 1063] [serial = 498] [outer = 0x0] 16:57:07 INFO - ++DOCSHELL 0x1332be900 == 21 [pid = 1063] [id = 216] 16:57:07 INFO - ++DOMWINDOW == 48 (0x137178000) [pid = 1063] [serial = 499] [outer = 0x0] 16:57:07 INFO - ++DOCSHELL 0x1332bf300 == 22 [pid = 1063] [id = 217] 16:57:07 INFO - ++DOMWINDOW == 49 (0x137178400) [pid = 1063] [serial = 500] [outer = 0x0] 16:57:07 INFO - ++DOCSHELL 0x1332c0200 == 23 [pid = 1063] [id = 218] 16:57:07 INFO - ++DOMWINDOW == 50 (0x137178c00) [pid = 1063] [serial = 501] [outer = 0x0] 16:57:07 INFO - ++DOMWINDOW == 51 (0x15385f000) [pid = 1063] [serial = 502] [outer = 0x136439800] 16:57:07 INFO - ++DOMWINDOW == 52 (0x15385fc00) [pid = 1063] [serial = 503] [outer = 0x136439c00] 16:57:07 INFO - ++DOMWINDOW == 53 (0x1372bb400) [pid = 1063] [serial = 504] [outer = 0x137178000] 16:57:07 INFO - ++DOMWINDOW == 54 (0x12cb35000) [pid = 1063] [serial = 505] [outer = 0x137178400] 16:57:07 INFO - ++DOMWINDOW == 55 (0x12cb35800) [pid = 1063] [serial = 506] [outer = 0x137178c00] 16:57:07 INFO - ++DOCSHELL 0x134f9cb00 == 24 [pid = 1063] [id = 219] 16:57:07 INFO - ++DOMWINDOW == 56 (0x12bbc3000) [pid = 1063] [serial = 507] [outer = 0x0] 16:57:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:07 INFO - ++DOMWINDOW == 57 (0x12f1c0c00) [pid = 1063] [serial = 508] [outer = 0x12bbc3000] 16:57:07 INFO - console.warn: Asynchronous operation was aborted as selection changed. 16:57:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:08 INFO - ++DOCSHELL 0x136a6d800 == 25 [pid = 1063] [id = 220] 16:57:08 INFO - ++DOMWINDOW == 58 (0x12bbc3c00) [pid = 1063] [serial = 509] [outer = 0x0] 16:57:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:08 INFO - ++DOCSHELL 0x136a6ec00 == 26 [pid = 1063] [id = 221] 16:57:08 INFO - ++DOMWINDOW == 59 (0x137312400) [pid = 1063] [serial = 510] [outer = 0x0] 16:57:08 INFO - ++DOCSHELL 0x136a6fb00 == 27 [pid = 1063] [id = 222] 16:57:08 INFO - ++DOMWINDOW == 60 (0x1373f1000) [pid = 1063] [serial = 511] [outer = 0x0] 16:57:08 INFO - ++DOCSHELL 0x136b23a00 == 28 [pid = 1063] [id = 223] 16:57:08 INFO - ++DOMWINDOW == 61 (0x1373f1400) [pid = 1063] [serial = 512] [outer = 0x0] 16:57:08 INFO - ++DOCSHELL 0x136b24900 == 29 [pid = 1063] [id = 224] 16:57:08 INFO - ++DOMWINDOW == 62 (0x1373f1800) [pid = 1063] [serial = 513] [outer = 0x0] 16:57:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:08 INFO - ++DOCSHELL 0x136b25300 == 30 [pid = 1063] [id = 225] 16:57:08 INFO - ++DOMWINDOW == 63 (0x12a01e800) [pid = 1063] [serial = 514] [outer = 0x0] 16:57:08 INFO - ++DOMWINDOW == 64 (0x12a01ec00) [pid = 1063] [serial = 515] [outer = 0x12a01e800] 16:57:08 INFO - ++DOMWINDOW == 65 (0x10a465000) [pid = 1063] [serial = 516] [outer = 0x12bbc3c00] 16:57:08 INFO - ++DOMWINDOW == 66 (0x1334d1000) [pid = 1063] [serial = 517] [outer = 0x137312400] 16:57:08 INFO - ++DOMWINDOW == 67 (0x13542ec00) [pid = 1063] [serial = 518] [outer = 0x1373f1000] 16:57:08 INFO - ++DOMWINDOW == 68 (0x1373f9400) [pid = 1063] [serial = 519] [outer = 0x1373f1400] 16:57:08 INFO - ++DOMWINDOW == 69 (0x1373f9c00) [pid = 1063] [serial = 520] [outer = 0x1373f1800] 16:57:08 INFO - ++DOMWINDOW == 70 (0x137fd6400) [pid = 1063] [serial = 521] [outer = 0x12a01e800] 16:57:08 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:57:08 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:57:08 INFO - Exported SkiaGL extensions: GL_EXT_packed_depth_stencil GL_EXT_bgra 16:57:08 INFO - Determined SkiaGL cache limits: Size 100663296, Items: 256 16:57:08 INFO - [GFX2-]: Using SkiaGL canvas. 16:57:12 INFO - --DOCSHELL 0x136a6fb00 == 29 [pid = 1063] [id = 222] 16:57:12 INFO - --DOCSHELL 0x136b23a00 == 28 [pid = 1063] [id = 223] 16:57:12 INFO - --DOCSHELL 0x136a6ec00 == 27 [pid = 1063] [id = 221] 16:57:12 INFO - --DOCSHELL 0x136b24900 == 26 [pid = 1063] [id = 224] 16:57:12 INFO - --DOCSHELL 0x136a6d800 == 25 [pid = 1063] [id = 220] 16:57:12 INFO - --DOCSHELL 0x134f9cb00 == 24 [pid = 1063] [id = 219] 16:57:13 INFO - --DOCSHELL 0x136b25300 == 23 [pid = 1063] [id = 225] 16:57:13 INFO - --DOCSHELL 0x1266a6900 == 22 [pid = 1063] [id = 203] 16:57:13 INFO - --DOCSHELL 0x128ead000 == 21 [pid = 1063] [id = 210] 16:57:13 INFO - --DOCSHELL 0x12ca29000 == 20 [pid = 1063] [id = 211] 16:57:13 INFO - --DOCSHELL 0x130928e00 == 19 [pid = 1063] [id = 212] 16:57:13 INFO - --DOCSHELL 0x13092b600 == 18 [pid = 1063] [id = 213] 16:57:13 INFO - --DOCSHELL 0x120926000 == 17 [pid = 1063] [id = 202] 16:57:13 INFO - --DOCSHELL 0x121642500 == 16 [pid = 1063] [id = 204] 16:57:13 INFO - --DOCSHELL 0x131b2a200 == 15 [pid = 1063] [id = 214] 16:57:13 INFO - --DOCSHELL 0x1332bdf00 == 14 [pid = 1063] [id = 215] 16:57:13 INFO - --DOCSHELL 0x1332be900 == 13 [pid = 1063] [id = 216] 16:57:13 INFO - --DOCSHELL 0x1332bf300 == 12 [pid = 1063] [id = 217] 16:57:13 INFO - --DOCSHELL 0x1332c0200 == 11 [pid = 1063] [id = 218] 16:57:13 INFO - --DOMWINDOW == 69 (0x127f0b800) [pid = 1063] [serial = 465] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:13 INFO - --DOMWINDOW == 68 (0x12bf01800) [pid = 1063] [serial = 467] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 67 (0x129887800) [pid = 1063] [serial = 469] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:13 INFO - --DOMWINDOW == 66 (0x120316800) [pid = 1063] [serial = 470] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 65 (0x1205f8c00) [pid = 1063] [serial = 472] [outer = 0x0] [url = data:text/html;charset=utf-8,webconsole-filter] 16:57:13 INFO - --DOMWINDOW == 64 (0x133500c00) [pid = 1063] [serial = 479] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:13 INFO - --DOMWINDOW == 63 (0x127bc1400) [pid = 1063] [serial = 487] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 62 (0x12a01e800) [pid = 1063] [serial = 514] [outer = 0x0] [url = data:text/html,] 16:57:13 INFO - --DOMWINDOW == 61 (0x1373f1800) [pid = 1063] [serial = 513] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 16:57:13 INFO - --DOMWINDOW == 60 (0x1373f1000) [pid = 1063] [serial = 511] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 16:57:13 INFO - --DOMWINDOW == 59 (0x12976b400) [pid = 1063] [serial = 491] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:13 INFO - --DOMWINDOW == 58 (0x137178000) [pid = 1063] [serial = 499] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 16:57:13 INFO - --DOMWINDOW == 57 (0x12bbc3000) [pid = 1063] [serial = 507] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:13 INFO - --DOMWINDOW == 56 (0x137178400) [pid = 1063] [serial = 500] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 16:57:13 INFO - --DOMWINDOW == 55 (0x137fd6400) [pid = 1063] [serial = 521] [outer = 0x0] [url = data:text/html,] 16:57:13 INFO - --DOMWINDOW == 54 (0x12a01ec00) [pid = 1063] [serial = 515] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 53 (0x12177fc00) [pid = 1063] [serial = 474] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:13 INFO - --DOMWINDOW == 52 (0x12c3d1000) [pid = 1063] [serial = 477] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:13 INFO - --DOMWINDOW == 51 (0x120510000) [pid = 1063] [serial = 471] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 50 (0x121c1c400) [pid = 1063] [serial = 473] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 49 (0x12664d400) [pid = 1063] [serial = 484] [outer = 0x0] [url = about:blank] 16:57:13 INFO - --DOMWINDOW == 48 (0x1372bb400) [pid = 1063] [serial = 504] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 16:57:13 INFO - MEMORY STAT | vsize 3747MB | residentFast 382MB | heapAllocated 117MB 16:57:13 INFO - 149 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js | took 8713ms 16:57:13 INFO - ++DOCSHELL 0x1201fd600 == 12 [pid = 1063] [id = 226] 16:57:13 INFO - ++DOMWINDOW == 49 (0x11fe61000) [pid = 1063] [serial = 522] [outer = 0x0] 16:57:13 INFO - ++DOMWINDOW == 50 (0x1200e3000) [pid = 1063] [serial = 523] [outer = 0x11fe61000] 16:57:13 INFO - 150 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js 16:57:13 INFO - ++DOCSHELL 0x1285b6100 == 13 [pid = 1063] [id = 227] 16:57:13 INFO - ++DOMWINDOW == 51 (0x11f5b8400) [pid = 1063] [serial = 524] [outer = 0x0] 16:57:13 INFO - ++DOMWINDOW == 52 (0x121ddbc00) [pid = 1063] [serial = 525] [outer = 0x11f5b8400] 16:57:13 INFO - ++DOMWINDOW == 53 (0x12d43d400) [pid = 1063] [serial = 526] [outer = 0x11f5b8400] 16:57:14 INFO - ++DOCSHELL 0x130929300 == 14 [pid = 1063] [id = 228] 16:57:14 INFO - ++DOMWINDOW == 54 (0x121ddb400) [pid = 1063] [serial = 527] [outer = 0x0] 16:57:14 INFO - ++DOMWINDOW == 55 (0x1299fe000) [pid = 1063] [serial = 528] [outer = 0x121ddb400] 16:57:14 INFO - ++DOMWINDOW == 56 (0x1284e0400) [pid = 1063] [serial = 529] [outer = 0x121ddb400] 16:57:14 INFO - ++DOCSHELL 0x131a41e00 == 15 [pid = 1063] [id = 229] 16:57:14 INFO - ++DOMWINDOW == 57 (0x12cbf1400) [pid = 1063] [serial = 530] [outer = 0x0] 16:57:14 INFO - ++DOMWINDOW == 58 (0x12ce44400) [pid = 1063] [serial = 531] [outer = 0x12cbf1400] 16:57:15 INFO - ++DOCSHELL 0x13715e400 == 16 [pid = 1063] [id = 230] 16:57:15 INFO - ++DOMWINDOW == 59 (0x1333b6c00) [pid = 1063] [serial = 532] [outer = 0x0] 16:57:15 INFO - ++DOMWINDOW == 60 (0x133500c00) [pid = 1063] [serial = 533] [outer = 0x1333b6c00] 16:57:15 INFO - ++DOCSHELL 0x1201af300 == 17 [pid = 1063] [id = 231] 16:57:15 INFO - ++DOMWINDOW == 61 (0x137fce000) [pid = 1063] [serial = 534] [outer = 0x0] 16:57:15 INFO - ++DOMWINDOW == 62 (0x15385f400) [pid = 1063] [serial = 535] [outer = 0x137fce000] 16:57:16 INFO - ++DOCSHELL 0x1364c8e00 == 18 [pid = 1063] [id = 232] 16:57:16 INFO - ++DOMWINDOW == 63 (0x120065400) [pid = 1063] [serial = 536] [outer = 0x0] 16:57:16 INFO - ++DOMWINDOW == 64 (0x12d582000) [pid = 1063] [serial = 537] [outer = 0x120065400] 16:57:18 INFO - --DOCSHELL 0x127b2ea00 == 17 [pid = 1063] [id = 209] 16:57:18 INFO - --DOCSHELL 0x130929300 == 16 [pid = 1063] [id = 228] 16:57:18 INFO - --DOCSHELL 0x131a41e00 == 15 [pid = 1063] [id = 229] 16:57:18 INFO - --DOCSHELL 0x13715e400 == 14 [pid = 1063] [id = 230] 16:57:18 INFO - --DOCSHELL 0x1201af300 == 13 [pid = 1063] [id = 231] 16:57:18 INFO - --DOCSHELL 0x1266a6400 == 12 [pid = 1063] [id = 208] 16:57:18 INFO - --DOCSHELL 0x1364c8e00 == 11 [pid = 1063] [id = 232] 16:57:18 INFO - --DOCSHELL 0x12092ab00 == 10 [pid = 1063] [id = 207] 16:57:18 INFO - --DOMWINDOW == 63 (0x127b8b800) [pid = 1063] [serial = 476] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:18 INFO - --DOMWINDOW == 62 (0x1297a0800) [pid = 1063] [serial = 492] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:18 INFO - --DOMWINDOW == 61 (0x12c48e400) [pid = 1063] [serial = 478] [outer = 0x0] [url = about:blank] 16:57:18 INFO - --DOMWINDOW == 60 (0x13351f000) [pid = 1063] [serial = 480] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:18 INFO - --DOMWINDOW == 59 (0x12cb35000) [pid = 1063] [serial = 505] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 16:57:18 INFO - --DOMWINDOW == 58 (0x12f1c0c00) [pid = 1063] [serial = 508] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:18 INFO - --DOMWINDOW == 57 (0x13542ec00) [pid = 1063] [serial = 518] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 16:57:18 INFO - --DOMWINDOW == 56 (0x1373f9c00) [pid = 1063] [serial = 520] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 16:57:18 INFO - --DOMWINDOW == 55 (0x1373f1400) [pid = 1063] [serial = 512] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 16:57:18 INFO - --DOMWINDOW == 54 (0x137312400) [pid = 1063] [serial = 510] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:18 INFO - --DOMWINDOW == 53 (0x12bbc3c00) [pid = 1063] [serial = 509] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:18 INFO - --DOMWINDOW == 52 (0x136439c00) [pid = 1063] [serial = 498] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 16:57:18 INFO - --DOMWINDOW == 51 (0x136439800) [pid = 1063] [serial = 497] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 16:57:18 INFO - --DOMWINDOW == 50 (0x120917c00) [pid = 1063] [serial = 495] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 16:57:18 INFO - --DOMWINDOW == 49 (0x1299fe000) [pid = 1063] [serial = 528] [outer = 0x0] [url = about:blank] 16:57:18 INFO - --DOMWINDOW == 48 (0x136671800) [pid = 1063] [serial = 493] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 16:57:18 INFO - --DOMWINDOW == 47 (0x121770000) [pid = 1063] [serial = 486] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:18 INFO - --DOMWINDOW == 46 (0x12c3ea000) [pid = 1063] [serial = 489] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:18 INFO - --DOMWINDOW == 45 (0x137178c00) [pid = 1063] [serial = 501] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 16:57:18 INFO - --DOMWINDOW == 44 (0x12031e800) [pid = 1063] [serial = 481] [outer = 0x0] [url = about:blank] 16:57:18 INFO - --DOMWINDOW == 43 (0x11f830c00) [pid = 1063] [serial = 483] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 16:57:18 INFO - --DOMWINDOW == 42 (0x137fce000) [pid = 1063] [serial = 534] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:18 INFO - --DOMWINDOW == 41 (0x1208c7c00) [pid = 1063] [serial = 482] [outer = 0x0] [url = about:blank] 16:57:18 INFO - --DOMWINDOW == 40 (0x121ddbc00) [pid = 1063] [serial = 525] [outer = 0x0] [url = about:blank] 16:57:18 INFO - --DOMWINDOW == 39 (0x12cb35800) [pid = 1063] [serial = 506] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 16:57:18 INFO - --DOMWINDOW == 38 (0x127ad8c00) [pid = 1063] [serial = 485] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 16:57:18 INFO - MEMORY STAT | vsize 3760MB | residentFast 384MB | heapAllocated 123MB 16:57:18 INFO - 151 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js | took 4731ms 16:57:18 INFO - ++DOCSHELL 0x12092ab00 == 11 [pid = 1063] [id = 233] 16:57:18 INFO - ++DOMWINDOW == 39 (0x11fee7000) [pid = 1063] [serial = 538] [outer = 0x0] 16:57:18 INFO - ++DOMWINDOW == 40 (0x120065800) [pid = 1063] [serial = 539] [outer = 0x11fee7000] 16:57:18 INFO - 152 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js 16:57:18 INFO - ++DOCSHELL 0x129ea8100 == 12 [pid = 1063] [id = 234] 16:57:18 INFO - ++DOMWINDOW == 41 (0x120410c00) [pid = 1063] [serial = 540] [outer = 0x0] 16:57:18 INFO - ++DOMWINDOW == 42 (0x1216fe400) [pid = 1063] [serial = 541] [outer = 0x120410c00] 16:57:18 INFO - ++DOMWINDOW == 43 (0x12775d800) [pid = 1063] [serial = 542] [outer = 0x120410c00] 16:57:18 INFO - ++DOCSHELL 0x121644300 == 13 [pid = 1063] [id = 235] 16:57:18 INFO - ++DOMWINDOW == 44 (0x120917c00) [pid = 1063] [serial = 543] [outer = 0x0] 16:57:18 INFO - ++DOMWINDOW == 45 (0x121df4000) [pid = 1063] [serial = 544] [outer = 0x120917c00] 16:57:19 INFO - ++DOMWINDOW == 46 (0x127ace000) [pid = 1063] [serial = 545] [outer = 0x120917c00] 16:57:19 INFO - ++DOCSHELL 0x12c6dec00 == 14 [pid = 1063] [id = 236] 16:57:19 INFO - ++DOMWINDOW == 47 (0x12c71ec00) [pid = 1063] [serial = 546] [outer = 0x0] 16:57:19 INFO - ++DOMWINDOW == 48 (0x12c777800) [pid = 1063] [serial = 547] [outer = 0x12c71ec00] 16:57:20 INFO - ++DOCSHELL 0x131a40f00 == 15 [pid = 1063] [id = 237] 16:57:20 INFO - ++DOMWINDOW == 49 (0x1299ab000) [pid = 1063] [serial = 548] [outer = 0x0] 16:57:20 INFO - ++DOMWINDOW == 50 (0x129aa6c00) [pid = 1063] [serial = 549] [outer = 0x1299ab000] 16:57:20 INFO - ++DOCSHELL 0x131a44100 == 16 [pid = 1063] [id = 238] 16:57:20 INFO - ++DOMWINDOW == 51 (0x1367e9000) [pid = 1063] [serial = 550] [outer = 0x0] 16:57:20 INFO - ++DOMWINDOW == 52 (0x12e8d8800) [pid = 1063] [serial = 551] [outer = 0x1367e9000] 16:57:20 INFO - ++DOCSHELL 0x136a6d800 == 17 [pid = 1063] [id = 239] 16:57:20 INFO - ++DOMWINDOW == 53 (0x136bca400) [pid = 1063] [serial = 552] [outer = 0x0] 16:57:20 INFO - ++DOMWINDOW == 54 (0x136bcac00) [pid = 1063] [serial = 553] [outer = 0x136bca400] 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - ++DOCSHELL 0x136b24900 == 18 [pid = 1063] [id = 240] 16:57:21 INFO - ++DOMWINDOW == 55 (0x13760fc00) [pid = 1063] [serial = 554] [outer = 0x0] 16:57:21 INFO - ++DOMWINDOW == 56 (0x13767a000) [pid = 1063] [serial = 555] [outer = 0x13760fc00] 16:57:21 INFO - ++DOCSHELL 0x136b25d00 == 19 [pid = 1063] [id = 241] 16:57:21 INFO - ++DOMWINDOW == 57 (0x13767a400) [pid = 1063] [serial = 556] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x136b26c00 == 20 [pid = 1063] [id = 242] 16:57:21 INFO - ++DOMWINDOW == 58 (0x13767a800) [pid = 1063] [serial = 557] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x136b27100 == 21 [pid = 1063] [id = 243] 16:57:21 INFO - ++DOMWINDOW == 59 (0x13767ac00) [pid = 1063] [serial = 558] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x13707e000 == 22 [pid = 1063] [id = 244] 16:57:21 INFO - ++DOMWINDOW == 60 (0x137794000) [pid = 1063] [serial = 559] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x13707e500 == 23 [pid = 1063] [id = 245] 16:57:21 INFO - ++DOMWINDOW == 61 (0x137794400) [pid = 1063] [serial = 560] [outer = 0x0] 16:57:21 INFO - ++DOMWINDOW == 62 (0x137794800) [pid = 1063] [serial = 561] [outer = 0x13767a400] 16:57:21 INFO - ++DOMWINDOW == 63 (0x137fba000) [pid = 1063] [serial = 562] [outer = 0x13767a800] 16:57:21 INFO - ++DOMWINDOW == 64 (0x1538de000) [pid = 1063] [serial = 563] [outer = 0x13767ac00] 16:57:21 INFO - ++DOMWINDOW == 65 (0x1538dec00) [pid = 1063] [serial = 564] [outer = 0x137794000] 16:57:21 INFO - ++DOMWINDOW == 66 (0x1373a3400) [pid = 1063] [serial = 565] [outer = 0x137794400] 16:57:21 INFO - ++DOCSHELL 0x136a6ec00 == 24 [pid = 1063] [id = 246] 16:57:21 INFO - ++DOMWINDOW == 67 (0x137010000) [pid = 1063] [serial = 566] [outer = 0x0] 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - ++DOCSHELL 0x13715ee00 == 25 [pid = 1063] [id = 247] 16:57:21 INFO - ++DOMWINDOW == 68 (0x12e372800) [pid = 1063] [serial = 567] [outer = 0x0] 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - ++DOMWINDOW == 69 (0x12082f000) [pid = 1063] [serial = 568] [outer = 0x137010000] 16:57:21 INFO - [1063] WARNING: We should have hit the document element...: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 16:57:21 INFO - ++DOMWINDOW == 70 (0x12087ec00) [pid = 1063] [serial = 569] [outer = 0x12e372800] 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - ++DOCSHELL 0x137161b00 == 26 [pid = 1063] [id = 248] 16:57:21 INFO - ++DOMWINDOW == 71 (0x1366aac00) [pid = 1063] [serial = 570] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x1371f8800 == 27 [pid = 1063] [id = 249] 16:57:21 INFO - ++DOMWINDOW == 72 (0x133598000) [pid = 1063] [serial = 571] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x1371f9c00 == 28 [pid = 1063] [id = 250] 16:57:21 INFO - ++DOMWINDOW == 73 (0x133598400) [pid = 1063] [serial = 572] [outer = 0x0] 16:57:21 INFO - ++DOCSHELL 0x137ee2e00 == 29 [pid = 1063] [id = 251] 16:57:21 INFO - ++DOMWINDOW == 74 (0x133598c00) [pid = 1063] [serial = 573] [outer = 0x0] 16:57:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:21 INFO - ++DOCSHELL 0x137ee4700 == 30 [pid = 1063] [id = 252] 16:57:21 INFO - ++DOMWINDOW == 75 (0x1335a6400) [pid = 1063] [serial = 574] [outer = 0x0] 16:57:21 INFO - ++DOMWINDOW == 76 (0x1335a6800) [pid = 1063] [serial = 575] [outer = 0x1335a6400] 16:57:22 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 16:57:22 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 16:57:22 INFO - ++DOMWINDOW == 77 (0x133bec800) [pid = 1063] [serial = 576] [outer = 0x1366aac00] 16:57:22 INFO - ++DOMWINDOW == 78 (0x13358c000) [pid = 1063] [serial = 577] [outer = 0x133598000] 16:57:22 INFO - ++DOMWINDOW == 79 (0x13358c800) [pid = 1063] [serial = 578] [outer = 0x133598400] 16:57:22 INFO - ++DOMWINDOW == 80 (0x12e14d000) [pid = 1063] [serial = 579] [outer = 0x133598c00] 16:57:22 INFO - ++DOMWINDOW == 81 (0x12e14dc00) [pid = 1063] [serial = 580] [outer = 0x1335a6400] 16:57:23 INFO - --DOCSHELL 0x1201fd600 == 29 [pid = 1063] [id = 226] 16:57:23 INFO - --DOCSHELL 0x1285b6100 == 28 [pid = 1063] [id = 227] 16:57:23 INFO - --DOMWINDOW == 80 (0x127f4e800) [pid = 1063] [serial = 488] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:23 INFO - --DOMWINDOW == 79 (0x12c3ea400) [pid = 1063] [serial = 490] [outer = 0x0] [url = about:blank] 16:57:23 INFO - --DOMWINDOW == 78 (0x1366dbc00) [pid = 1063] [serial = 494] [outer = 0x0] [url = about:blank] 16:57:23 INFO - --DOMWINDOW == 77 (0x131b85800) [pid = 1063] [serial = 496] [outer = 0x0] [url = about:blank] 16:57:23 INFO - --DOMWINDOW == 76 (0x15385f000) [pid = 1063] [serial = 502] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 16:57:23 INFO - --DOMWINDOW == 75 (0x15385fc00) [pid = 1063] [serial = 503] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 16:57:23 INFO - --DOMWINDOW == 74 (0x15385f400) [pid = 1063] [serial = 535] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:23 INFO - --DOMWINDOW == 73 (0x10a465000) [pid = 1063] [serial = 516] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:23 INFO - --DOMWINDOW == 72 (0x1334d1000) [pid = 1063] [serial = 517] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:23 INFO - --DOMWINDOW == 71 (0x1373f9400) [pid = 1063] [serial = 519] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 16:57:24 INFO - ++DOCSHELL 0x130929d00 == 29 [pid = 1063] [id = 253] 16:57:24 INFO - ++DOMWINDOW == 72 (0x12a12cc00) [pid = 1063] [serial = 581] [outer = 0x0] 16:57:24 INFO - ++DOMWINDOW == 73 (0x12c52bc00) [pid = 1063] [serial = 582] [outer = 0x12a12cc00] 16:57:24 INFO - --DOCSHELL 0x137ee4700 == 28 [pid = 1063] [id = 252] 16:57:24 INFO - --DOCSHELL 0x131a44100 == 27 [pid = 1063] [id = 238] 16:57:24 INFO - --DOCSHELL 0x1371f8800 == 26 [pid = 1063] [id = 249] 16:57:24 INFO - --DOCSHELL 0x1371f9c00 == 25 [pid = 1063] [id = 250] 16:57:24 INFO - --DOCSHELL 0x137161b00 == 24 [pid = 1063] [id = 248] 16:57:24 INFO - --DOCSHELL 0x137ee2e00 == 23 [pid = 1063] [id = 251] 16:57:24 INFO - --DOCSHELL 0x13715ee00 == 22 [pid = 1063] [id = 247] 16:57:24 INFO - --DOCSHELL 0x136a6ec00 == 21 [pid = 1063] [id = 246] 16:57:24 INFO - --DOCSHELL 0x136b24900 == 20 [pid = 1063] [id = 240] 16:57:25 INFO - --DOCSHELL 0x136a6d800 == 19 [pid = 1063] [id = 239] 16:57:25 INFO - --DOCSHELL 0x131a40f00 == 18 [pid = 1063] [id = 237] 16:57:25 INFO - --DOCSHELL 0x12c6dec00 == 17 [pid = 1063] [id = 236] 16:57:25 INFO - --DOCSHELL 0x130929d00 == 16 [pid = 1063] [id = 253] 16:57:25 INFO - --DOCSHELL 0x136b25d00 == 15 [pid = 1063] [id = 241] 16:57:25 INFO - --DOCSHELL 0x136b26c00 == 14 [pid = 1063] [id = 242] 16:57:25 INFO - --DOCSHELL 0x136b27100 == 13 [pid = 1063] [id = 243] 16:57:25 INFO - --DOCSHELL 0x13707e000 == 12 [pid = 1063] [id = 244] 16:57:25 INFO - --DOCSHELL 0x13707e500 == 11 [pid = 1063] [id = 245] 16:57:25 INFO - --DOCSHELL 0x121644300 == 10 [pid = 1063] [id = 235] 16:57:26 INFO - --DOMWINDOW == 72 (0x11fe61000) [pid = 1063] [serial = 522] [outer = 0x0] [url = about:blank] 16:57:26 INFO - --DOMWINDOW == 71 (0x11f5b8400) [pid = 1063] [serial = 524] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:26 INFO - --DOMWINDOW == 70 (0x1335a6400) [pid = 1063] [serial = 574] [outer = 0x0] [url = data:text/html,] 16:57:26 INFO - --DOMWINDOW == 69 (0x12e14dc00) [pid = 1063] [serial = 580] [outer = 0x0] [url = data:text/html,] 16:57:26 INFO - --DOMWINDOW == 68 (0x1367e9000) [pid = 1063] [serial = 550] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:26 INFO - --DOMWINDOW == 67 (0x13767a800) [pid = 1063] [serial = 557] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 16:57:26 INFO - --DOMWINDOW == 66 (0x13767ac00) [pid = 1063] [serial = 558] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 16:57:26 INFO - --DOMWINDOW == 65 (0x137794000) [pid = 1063] [serial = 559] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 16:57:26 INFO - --DOMWINDOW == 64 (0x137010000) [pid = 1063] [serial = 566] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:26 INFO - --DOMWINDOW == 63 (0x133598000) [pid = 1063] [serial = 571] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 16:57:26 INFO - --DOMWINDOW == 62 (0x133598c00) [pid = 1063] [serial = 573] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 16:57:26 INFO - --DOMWINDOW == 61 (0x12e372800) [pid = 1063] [serial = 567] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:26 INFO - --DOMWINDOW == 60 (0x1335a6800) [pid = 1063] [serial = 575] [outer = 0x0] [url = about:blank] 16:57:26 INFO - --DOMWINDOW == 59 (0x121ddb400) [pid = 1063] [serial = 527] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:26 INFO - --DOMWINDOW == 58 (0x120065400) [pid = 1063] [serial = 536] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:26 INFO - --DOMWINDOW == 57 (0x12cbf1400) [pid = 1063] [serial = 530] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:26 INFO - --DOMWINDOW == 56 (0x1333b6c00) [pid = 1063] [serial = 532] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:57:26 INFO - --DOMWINDOW == 55 (0x121df4000) [pid = 1063] [serial = 544] [outer = 0x0] [url = about:blank] 16:57:26 INFO - --DOMWINDOW == 54 (0x1200e3000) [pid = 1063] [serial = 523] [outer = 0x0] [url = about:blank] 16:57:26 INFO - --DOMWINDOW == 53 (0x1216fe400) [pid = 1063] [serial = 541] [outer = 0x0] [url = about:blank] 16:57:26 INFO - --DOMWINDOW == 52 (0x1538de000) [pid = 1063] [serial = 563] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 16:57:26 INFO - --DOMWINDOW == 51 (0x12d43d400) [pid = 1063] [serial = 526] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:26 INFO - MEMORY STAT | vsize 3763MB | residentFast 391MB | heapAllocated 126MB 16:57:26 INFO - 153 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js | took 7500ms 16:57:26 INFO - ++DOCSHELL 0x120926f00 == 11 [pid = 1063] [id = 254] 16:57:26 INFO - ++DOMWINDOW == 52 (0x11fe61000) [pid = 1063] [serial = 583] [outer = 0x0] 16:57:26 INFO - ++DOMWINDOW == 53 (0x1200e3000) [pid = 1063] [serial = 584] [outer = 0x11fe61000] 16:57:26 INFO - 154 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js 16:57:26 INFO - ++DOCSHELL 0x12c6dce00 == 12 [pid = 1063] [id = 255] 16:57:26 INFO - ++DOMWINDOW == 54 (0x10a467400) [pid = 1063] [serial = 585] [outer = 0x0] 16:57:26 INFO - ++DOMWINDOW == 55 (0x129fcac00) [pid = 1063] [serial = 586] [outer = 0x10a467400] 16:57:26 INFO - ++DOMWINDOW == 56 (0x1317f7800) [pid = 1063] [serial = 587] [outer = 0x10a467400] 16:57:26 INFO - ++DOCSHELL 0x1266a6400 == 13 [pid = 1063] [id = 256] 16:57:26 INFO - ++DOMWINDOW == 57 (0x121ddb400) [pid = 1063] [serial = 588] [outer = 0x0] 16:57:26 INFO - ++DOMWINDOW == 58 (0x127ac6c00) [pid = 1063] [serial = 589] [outer = 0x121ddb400] 16:57:26 INFO - ++DOMWINDOW == 59 (0x128e94000) [pid = 1063] [serial = 590] [outer = 0x121ddb400] 16:57:26 INFO - ++DOCSHELL 0x131a42800 == 14 [pid = 1063] [id = 257] 16:57:26 INFO - ++DOMWINDOW == 60 (0x12d5c7400) [pid = 1063] [serial = 591] [outer = 0x0] 16:57:26 INFO - ++DOMWINDOW == 61 (0x12df19000) [pid = 1063] [serial = 592] [outer = 0x12d5c7400] 16:57:27 INFO - ++DOCSHELL 0x135548600 == 15 [pid = 1063] [id = 258] 16:57:27 INFO - ++DOMWINDOW == 62 (0x131636800) [pid = 1063] [serial = 593] [outer = 0x0] 16:57:27 INFO - ++DOMWINDOW == 63 (0x1316d1000) [pid = 1063] [serial = 594] [outer = 0x131636800] 16:57:28 INFO - ++DOCSHELL 0x1364c9800 == 16 [pid = 1063] [id = 259] 16:57:28 INFO - ++DOMWINDOW == 64 (0x134882c00) [pid = 1063] [serial = 595] [outer = 0x0] 16:57:28 INFO - ++DOMWINDOW == 65 (0x134934c00) [pid = 1063] [serial = 596] [outer = 0x134882c00] 16:57:30 INFO - --DOCSHELL 0x129ea8100 == 15 [pid = 1063] [id = 234] 16:57:30 INFO - --DOCSHELL 0x12092ab00 == 14 [pid = 1063] [id = 233] 16:57:30 INFO - --DOMWINDOW == 64 (0x1284e0400) [pid = 1063] [serial = 529] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:30 INFO - --DOMWINDOW == 63 (0x12ce44400) [pid = 1063] [serial = 531] [outer = 0x0] [url = about:blank] 16:57:30 INFO - --DOMWINDOW == 62 (0x133500c00) [pid = 1063] [serial = 533] [outer = 0x0] [url = about:blank] 16:57:30 INFO - --DOMWINDOW == 61 (0x12e8d8800) [pid = 1063] [serial = 551] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:30 INFO - --DOMWINDOW == 60 (0x12d582000) [pid = 1063] [serial = 537] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:30 INFO - --DOMWINDOW == 59 (0x12082f000) [pid = 1063] [serial = 568] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:30 INFO - --DOMWINDOW == 58 (0x12e14d000) [pid = 1063] [serial = 579] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 16:57:30 INFO - --DOMWINDOW == 57 (0x13358c000) [pid = 1063] [serial = 577] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 16:57:30 INFO - --DOMWINDOW == 56 (0x12087ec00) [pid = 1063] [serial = 569] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:30 INFO - --DOMWINDOW == 55 (0x137fba000) [pid = 1063] [serial = 562] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 16:57:30 INFO - --DOMWINDOW == 54 (0x1538dec00) [pid = 1063] [serial = 564] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 16:57:31 INFO - --DOCSHELL 0x1364c9800 == 13 [pid = 1063] [id = 259] 16:57:31 INFO - --DOCSHELL 0x135548600 == 12 [pid = 1063] [id = 258] 16:57:31 INFO - --DOCSHELL 0x131a42800 == 11 [pid = 1063] [id = 257] 16:57:31 INFO - --DOCSHELL 0x1266a6400 == 10 [pid = 1063] [id = 256] 16:57:32 INFO - --DOMWINDOW == 53 (0x13767a400) [pid = 1063] [serial = 556] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 16:57:32 INFO - --DOMWINDOW == 52 (0x133598400) [pid = 1063] [serial = 572] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 16:57:32 INFO - --DOMWINDOW == 51 (0x1366aac00) [pid = 1063] [serial = 570] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:32 INFO - --DOMWINDOW == 50 (0x13760fc00) [pid = 1063] [serial = 554] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 16:57:32 INFO - --DOMWINDOW == 49 (0x134882c00) [pid = 1063] [serial = 595] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:32 INFO - --DOMWINDOW == 48 (0x120917c00) [pid = 1063] [serial = 543] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:32 INFO - --DOMWINDOW == 47 (0x12a12cc00) [pid = 1063] [serial = 581] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:32 INFO - --DOMWINDOW == 46 (0x1299ab000) [pid = 1063] [serial = 548] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:57:32 INFO - --DOMWINDOW == 45 (0x12c71ec00) [pid = 1063] [serial = 546] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:32 INFO - --DOMWINDOW == 44 (0x136bca400) [pid = 1063] [serial = 552] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 16:57:32 INFO - --DOMWINDOW == 43 (0x137794400) [pid = 1063] [serial = 560] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 16:57:32 INFO - --DOMWINDOW == 42 (0x11fee7000) [pid = 1063] [serial = 538] [outer = 0x0] [url = about:blank] 16:57:32 INFO - --DOMWINDOW == 41 (0x120410c00) [pid = 1063] [serial = 540] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:32 INFO - --DOMWINDOW == 40 (0x127ac6c00) [pid = 1063] [serial = 589] [outer = 0x0] [url = about:blank] 16:57:32 INFO - --DOMWINDOW == 39 (0x120065800) [pid = 1063] [serial = 539] [outer = 0x0] [url = about:blank] 16:57:32 INFO - --DOMWINDOW == 38 (0x129fcac00) [pid = 1063] [serial = 586] [outer = 0x0] [url = about:blank] 16:57:32 INFO - --DOMWINDOW == 37 (0x1373a3400) [pid = 1063] [serial = 565] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 16:57:32 INFO - --DOMWINDOW == 36 (0x12775d800) [pid = 1063] [serial = 542] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:32 INFO - MEMORY STAT | vsize 3780MB | residentFast 399MB | heapAllocated 131MB 16:57:32 INFO - 155 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js | took 5860ms 16:57:32 INFO - ++DOCSHELL 0x120926500 == 11 [pid = 1063] [id = 260] 16:57:32 INFO - ++DOMWINDOW == 37 (0x11f830c00) [pid = 1063] [serial = 597] [outer = 0x0] 16:57:32 INFO - ++DOMWINDOW == 38 (0x11fe1ac00) [pid = 1063] [serial = 598] [outer = 0x11f830c00] 16:57:32 INFO - 156 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js 16:57:32 INFO - ++DOCSHELL 0x12bb2f800 == 12 [pid = 1063] [id = 261] 16:57:32 INFO - ++DOMWINDOW == 39 (0x11f9bb000) [pid = 1063] [serial = 599] [outer = 0x0] 16:57:32 INFO - ++DOMWINDOW == 40 (0x12080d800) [pid = 1063] [serial = 600] [outer = 0x11f9bb000] 16:57:32 INFO - ++DOMWINDOW == 41 (0x12af11000) [pid = 1063] [serial = 601] [outer = 0x11f9bb000] 16:57:32 INFO - ++DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 262] 16:57:32 INFO - ++DOMWINDOW == 42 (0x12080d400) [pid = 1063] [serial = 602] [outer = 0x0] 16:57:32 INFO - ++DOMWINDOW == 43 (0x1208c7c00) [pid = 1063] [serial = 603] [outer = 0x12080d400] 16:57:32 INFO - ++DOMWINDOW == 44 (0x121763c00) [pid = 1063] [serial = 604] [outer = 0x12080d400] 16:57:32 INFO - ++DOCSHELL 0x12ca2c700 == 14 [pid = 1063] [id = 263] 16:57:32 INFO - ++DOMWINDOW == 45 (0x12be25400) [pid = 1063] [serial = 605] [outer = 0x0] 16:57:32 INFO - ++DOMWINDOW == 46 (0x12be25c00) [pid = 1063] [serial = 606] [outer = 0x12be25400] 16:57:33 INFO - ++DOCSHELL 0x131a40000 == 15 [pid = 1063] [id = 264] 16:57:33 INFO - ++DOMWINDOW == 47 (0x128738800) [pid = 1063] [serial = 607] [outer = 0x0] 16:57:33 INFO - ++DOMWINDOW == 48 (0x128cf5400) [pid = 1063] [serial = 608] [outer = 0x128738800] 16:57:33 INFO - ++DOCSHELL 0x131a42d00 == 16 [pid = 1063] [id = 265] 16:57:33 INFO - ++DOMWINDOW == 49 (0x1353ce800) [pid = 1063] [serial = 609] [outer = 0x0] 16:57:33 INFO - ++DOMWINDOW == 50 (0x12f15d800) [pid = 1063] [serial = 610] [outer = 0x1353ce800] 16:57:36 INFO - --DOCSHELL 0x12ca2c700 == 15 [pid = 1063] [id = 263] 16:57:36 INFO - --DOCSHELL 0x131a40000 == 14 [pid = 1063] [id = 264] 16:57:36 INFO - --DOCSHELL 0x131a42d00 == 13 [pid = 1063] [id = 265] 16:57:36 INFO - --DOCSHELL 0x12c6dce00 == 12 [pid = 1063] [id = 255] 16:57:36 INFO - --DOCSHELL 0x120926f00 == 11 [pid = 1063] [id = 254] 16:57:36 INFO - --DOMWINDOW == 49 (0x12c52bc00) [pid = 1063] [serial = 582] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:36 INFO - --DOMWINDOW == 48 (0x127ace000) [pid = 1063] [serial = 545] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:36 INFO - --DOMWINDOW == 47 (0x12c777800) [pid = 1063] [serial = 547] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 46 (0x129aa6c00) [pid = 1063] [serial = 549] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 45 (0x134934c00) [pid = 1063] [serial = 596] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:36 INFO - --DOMWINDOW == 44 (0x13767a000) [pid = 1063] [serial = 555] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 43 (0x133bec800) [pid = 1063] [serial = 576] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 16:57:36 INFO - --DOMWINDOW == 42 (0x13358c800) [pid = 1063] [serial = 578] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 16:57:36 INFO - --DOMWINDOW == 41 (0x137794800) [pid = 1063] [serial = 561] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 16:57:36 INFO - --DOMWINDOW == 40 (0x136bcac00) [pid = 1063] [serial = 553] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 39 (0x1200e3000) [pid = 1063] [serial = 584] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 38 (0x12080d800) [pid = 1063] [serial = 600] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 37 (0x1208c7c00) [pid = 1063] [serial = 603] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 36 (0x121ddb400) [pid = 1063] [serial = 588] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:36 INFO - --DOMWINDOW == 35 (0x12d5c7400) [pid = 1063] [serial = 591] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:36 INFO - --DOMWINDOW == 34 (0x131636800) [pid = 1063] [serial = 593] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:57:36 INFO - --DOMWINDOW == 33 (0x11fe61000) [pid = 1063] [serial = 583] [outer = 0x0] [url = about:blank] 16:57:36 INFO - --DOMWINDOW == 32 (0x10a467400) [pid = 1063] [serial = 585] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:36 INFO - --DOMWINDOW == 31 (0x1317f7800) [pid = 1063] [serial = 587] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:36 INFO - MEMORY STAT | vsize 3822MB | residentFast 419MB | heapAllocated 145MB 16:57:36 INFO - 157 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js | took 4391ms 16:57:36 INFO - ++DOCSHELL 0x1201fb300 == 12 [pid = 1063] [id = 266] 16:57:36 INFO - ++DOMWINDOW == 32 (0x11fa56000) [pid = 1063] [serial = 611] [outer = 0x0] 16:57:36 INFO - ++DOMWINDOW == 33 (0x120065000) [pid = 1063] [serial = 612] [outer = 0x11fa56000] 16:57:36 INFO - 158 INFO TEST-START | devtools/client/webconsole/test/browser_jsterm_inspect.js 16:57:36 INFO - ++DOCSHELL 0x127b2ea00 == 13 [pid = 1063] [id = 267] 16:57:36 INFO - ++DOMWINDOW == 34 (0x120065c00) [pid = 1063] [serial = 613] [outer = 0x0] 16:57:36 INFO - ++DOMWINDOW == 35 (0x12080d000) [pid = 1063] [serial = 614] [outer = 0x120065c00] 16:57:37 INFO - ++DOCSHELL 0x12a05c700 == 14 [pid = 1063] [id = 268] 16:57:37 INFO - ++DOMWINDOW == 36 (0x120410c00) [pid = 1063] [serial = 615] [outer = 0x0] 16:57:37 INFO - ++DOMWINDOW == 37 (0x12087e800) [pid = 1063] [serial = 616] [outer = 0x120410c00] 16:57:37 INFO - ++DOMWINDOW == 38 (0x121cbac00) [pid = 1063] [serial = 617] [outer = 0x120410c00] 16:57:37 INFO - ++DOCSHELL 0x12c6de200 == 15 [pid = 1063] [id = 269] 16:57:37 INFO - ++DOMWINDOW == 39 (0x12c48e400) [pid = 1063] [serial = 618] [outer = 0x0] 16:57:37 INFO - ++DOMWINDOW == 40 (0x12c50f800) [pid = 1063] [serial = 619] [outer = 0x12c48e400] 16:57:38 INFO - ++DOCSHELL 0x12c6de700 == 16 [pid = 1063] [id = 270] 16:57:38 INFO - ++DOMWINDOW == 41 (0x127ad8c00) [pid = 1063] [serial = 620] [outer = 0x0] 16:57:38 INFO - ++DOMWINDOW == 42 (0x127bea400) [pid = 1063] [serial = 621] [outer = 0x127ad8c00] 16:57:38 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 16:57:38 INFO - [1063] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 16:57:38 INFO - [1063] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 16:57:45 INFO - --DOCSHELL 0x12bb2f800 == 15 [pid = 1063] [id = 261] 16:57:45 INFO - --DOCSHELL 0x12a05c700 == 14 [pid = 1063] [id = 268] 16:57:45 INFO - --DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 262] 16:57:45 INFO - --DOCSHELL 0x12c6de200 == 12 [pid = 1063] [id = 269] 16:57:45 INFO - --DOCSHELL 0x12c6de700 == 11 [pid = 1063] [id = 270] 16:57:45 INFO - --DOCSHELL 0x120926500 == 10 [pid = 1063] [id = 260] 16:57:45 INFO - --DOMWINDOW == 41 (0x1316d1000) [pid = 1063] [serial = 594] [outer = 0x0] [url = about:blank] 16:57:45 INFO - --DOMWINDOW == 40 (0x12df19000) [pid = 1063] [serial = 592] [outer = 0x0] [url = about:blank] 16:57:45 INFO - --DOMWINDOW == 39 (0x128e94000) [pid = 1063] [serial = 590] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:45 INFO - --DOMWINDOW == 38 (0x1353ce800) [pid = 1063] [serial = 609] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:45 INFO - --DOMWINDOW == 37 (0x11f9bb000) [pid = 1063] [serial = 599] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:45 INFO - --DOMWINDOW == 36 (0x11f830c00) [pid = 1063] [serial = 597] [outer = 0x0] [url = about:blank] 16:57:45 INFO - --DOMWINDOW == 35 (0x128738800) [pid = 1063] [serial = 607] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:57:45 INFO - --DOMWINDOW == 34 (0x12be25400) [pid = 1063] [serial = 605] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:45 INFO - --DOMWINDOW == 33 (0x12080d400) [pid = 1063] [serial = 602] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:45 INFO - --DOMWINDOW == 32 (0x12087e800) [pid = 1063] [serial = 616] [outer = 0x0] [url = about:blank] 16:57:45 INFO - --DOMWINDOW == 31 (0x12c48e400) [pid = 1063] [serial = 618] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:45 INFO - --DOMWINDOW == 30 (0x127ad8c00) [pid = 1063] [serial = 620] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:45 INFO - --DOMWINDOW == 29 (0x11fe1ac00) [pid = 1063] [serial = 598] [outer = 0x0] [url = about:blank] 16:57:45 INFO - --DOMWINDOW == 28 (0x12af11000) [pid = 1063] [serial = 601] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 16:57:45 INFO - MEMORY STAT | vsize 3796MB | residentFast 397MB | heapAllocated 124MB 16:57:45 INFO - 159 INFO TEST-OK | devtools/client/webconsole/test/browser_jsterm_inspect.js | took 9083ms 16:57:45 INFO - ++DOCSHELL 0x1201b0200 == 11 [pid = 1063] [id = 271] 16:57:45 INFO - ++DOMWINDOW == 29 (0x11f8cc800) [pid = 1063] [serial = 622] [outer = 0x0] 16:57:45 INFO - ++DOMWINDOW == 30 (0x11fe1ac00) [pid = 1063] [serial = 623] [outer = 0x11f8cc800] 16:57:46 INFO - 160 INFO TEST-START | devtools/client/webconsole/test/browser_longstring_hang.js 16:57:46 INFO - ++DOCSHELL 0x129f9b700 == 12 [pid = 1063] [id = 272] 16:57:46 INFO - ++DOMWINDOW == 31 (0x12031e800) [pid = 1063] [serial = 624] [outer = 0x0] 16:57:46 INFO - ++DOMWINDOW == 32 (0x12087e800) [pid = 1063] [serial = 625] [outer = 0x12031e800] 16:57:46 INFO - ++DOMWINDOW == 33 (0x121df4000) [pid = 1063] [serial = 626] [outer = 0x12031e800] 16:57:46 INFO - ++DOCSHELL 0x12c6dce00 == 13 [pid = 1063] [id = 273] 16:57:46 INFO - ++DOMWINDOW == 34 (0x12087e400) [pid = 1063] [serial = 627] [outer = 0x0] 16:57:46 INFO - ++DOMWINDOW == 35 (0x12664d400) [pid = 1063] [serial = 628] [outer = 0x12087e400] 16:57:46 INFO - ++DOMWINDOW == 36 (0x121ddbc00) [pid = 1063] [serial = 629] [outer = 0x12087e400] 16:57:46 INFO - ++DOCSHELL 0x12c6dfb00 == 14 [pid = 1063] [id = 274] 16:57:46 INFO - ++DOMWINDOW == 37 (0x12c3ea400) [pid = 1063] [serial = 630] [outer = 0x0] 16:57:46 INFO - ++DOMWINDOW == 38 (0x12c41a800) [pid = 1063] [serial = 631] [outer = 0x12c3ea400] 16:57:47 INFO - Block(span)(3)@1296b8eb8: Init: bad caller: width WAS 79406600(0x4bba608) 16:57:47 INFO - Block(span)(0)@130925238: Init: bad caller: width WAS 79400000(0x4bb8c40) 16:57:47 INFO - nsLineLayout: Text(0)"foobaraaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa"@1309256b8 metrics=79400000,840! 16:57:47 INFO - nsLineLayout: Inline(span)(0)@130925640 metrics=79400000,840! 16:57:47 INFO - nsBlockReflowContext: FlexContainer(span)(0)@1309242d0 metrics=79406600,840! 16:57:47 INFO - nsBlockReflowContext: Block(span)(0)@1309366e8 metrics=79406600,840! 16:57:47 INFO - Block(span)(3)@1296b8eb8: Init: bad caller: width WAS 79406600(0x4bba608) 16:57:47 INFO - nsBlockReflowContext: Block(span)(0)@1309366e8 metrics=79406600,840! 16:57:47 INFO - nsBlockReflowContext: Block(span)(0)@1309366e8 metrics=79406600,840! 16:57:47 INFO - Block(span)(3)@1334f0c68: Init: bad caller: width WAS 79406600(0x4bba608) 16:57:47 INFO - nsBlockReflowContext: Block(span)(0)@1309366e8 metrics=79406600,840! 16:57:48 INFO - --DOCSHELL 0x12c6dce00 == 13 [pid = 1063] [id = 273] 16:57:48 INFO - --DOCSHELL 0x12c6dfb00 == 12 [pid = 1063] [id = 274] 16:57:48 INFO - --DOCSHELL 0x127b2ea00 == 11 [pid = 1063] [id = 267] 16:57:48 INFO - --DOCSHELL 0x1201fb300 == 10 [pid = 1063] [id = 266] 16:57:48 INFO - --DOMWINDOW == 37 (0x12f15d800) [pid = 1063] [serial = 610] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:57:48 INFO - --DOMWINDOW == 36 (0x128cf5400) [pid = 1063] [serial = 608] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 35 (0x127bea400) [pid = 1063] [serial = 621] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:48 INFO - --DOMWINDOW == 34 (0x12c50f800) [pid = 1063] [serial = 619] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 33 (0x12be25c00) [pid = 1063] [serial = 606] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 32 (0x121763c00) [pid = 1063] [serial = 604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:48 INFO - --DOMWINDOW == 31 (0x12087e800) [pid = 1063] [serial = 625] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 30 (0x120065000) [pid = 1063] [serial = 612] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 29 (0x12664d400) [pid = 1063] [serial = 628] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 28 (0x120410c00) [pid = 1063] [serial = 615] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:48 INFO - --DOMWINDOW == 27 (0x11fa56000) [pid = 1063] [serial = 611] [outer = 0x0] [url = about:blank] 16:57:48 INFO - --DOMWINDOW == 26 (0x120065c00) [pid = 1063] [serial = 613] [outer = 0x0] [url = data:text/html;charset=utf8,

hello%20bug%20869981] 16:57:48 INFO - MEMORY STAT | vsize 3795MB | residentFast 392MB | heapAllocated 120MB 16:57:48 INFO - 161 INFO TEST-OK | devtools/client/webconsole/test/browser_longstring_hang.js | took 2732ms 16:57:48 INFO - ++DOCSHELL 0x120926f00 == 11 [pid = 1063] [id = 275] 16:57:48 INFO - ++DOMWINDOW == 27 (0x11f9a5c00) [pid = 1063] [serial = 632] [outer = 0x0] 16:57:48 INFO - ++DOMWINDOW == 28 (0x11fe61400) [pid = 1063] [serial = 633] [outer = 0x11f9a5c00] 16:57:48 INFO - 162 INFO TEST-START | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js 16:57:48 INFO - ++DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 276] 16:57:48 INFO - ++DOMWINDOW == 29 (0x120065000) [pid = 1063] [serial = 634] [outer = 0x0] 16:57:49 INFO - ++DOMWINDOW == 30 (0x12082fc00) [pid = 1063] [serial = 635] [outer = 0x120065000] 16:57:49 INFO - ++DOCSHELL 0x129f9a300 == 13 [pid = 1063] [id = 277] 16:57:49 INFO - ++DOMWINDOW == 31 (0x10a465000) [pid = 1063] [serial = 636] [outer = 0x0] 16:57:49 INFO - ++DOMWINDOW == 32 (0x12080d800) [pid = 1063] [serial = 637] [outer = 0x10a465000] 16:57:49 INFO - ++DOMWINDOW == 33 (0x12664d400) [pid = 1063] [serial = 638] [outer = 0x10a465000] 16:57:49 INFO - ++DOCSHELL 0x12c6dce00 == 14 [pid = 1063] [id = 278] 16:57:49 INFO - ++DOMWINDOW == 34 (0x12bbc3c00) [pid = 1063] [serial = 639] [outer = 0x0] 16:57:49 INFO - ++DOMWINDOW == 35 (0x12bbe6c00) [pid = 1063] [serial = 640] [outer = 0x12bbc3c00] 16:57:50 INFO - ++DOMWINDOW == 36 (0x13770b400) [pid = 1063] [serial = 641] [outer = 0x120065000] 16:57:50 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:57:50 INFO - ++DOCSHELL 0x12c6dd300 == 15 [pid = 1063] [id = 279] 16:57:50 INFO - ++DOMWINDOW == 37 (0x130982000) [pid = 1063] [serial = 642] [outer = 0x0] 16:57:50 INFO - ++DOMWINDOW == 38 (0x131bc1400) [pid = 1063] [serial = 643] [outer = 0x130982000] 16:57:50 INFO - ++DOCSHELL 0x1332bf300 == 16 [pid = 1063] [id = 280] 16:57:50 INFO - ++DOMWINDOW == 39 (0x136b8c800) [pid = 1063] [serial = 644] [outer = 0x0] 16:57:50 INFO - ++DOMWINDOW == 40 (0x13779e800) [pid = 1063] [serial = 645] [outer = 0x136b8c800] 16:57:50 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 16:57:50 INFO - --DOCSHELL 0x1332bf300 == 15 [pid = 1063] [id = 280] 16:57:51 INFO - MEMORY STAT | vsize 3797MB | residentFast 398MB | heapAllocated 130MB 16:57:51 INFO - 163 INFO TEST-OK | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js | took 2353ms 16:57:51 INFO - ++DOCSHELL 0x131a42300 == 16 [pid = 1063] [id = 281] 16:57:51 INFO - ++DOMWINDOW == 41 (0x1299fe000) [pid = 1063] [serial = 646] [outer = 0x0] 16:57:51 INFO - ++DOMWINDOW == 42 (0x129e8dc00) [pid = 1063] [serial = 647] [outer = 0x1299fe000] 16:57:51 INFO - 164 INFO TEST-START | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js 16:57:51 INFO - ++DOCSHELL 0x12d530100 == 17 [pid = 1063] [id = 282] 16:57:51 INFO - ++DOMWINDOW == 43 (0x12a0bf000) [pid = 1063] [serial = 648] [outer = 0x0] 16:57:51 INFO - ++DOMWINDOW == 44 (0x12a178000) [pid = 1063] [serial = 649] [outer = 0x12a0bf000] 16:57:51 INFO - ++DOCSHELL 0x12d4bd000 == 18 [pid = 1063] [id = 283] 16:57:51 INFO - ++DOMWINDOW == 45 (0x12a117400) [pid = 1063] [serial = 650] [outer = 0x0] 16:57:51 INFO - ++DOMWINDOW == 46 (0x12b032400) [pid = 1063] [serial = 651] [outer = 0x12a117400] 16:57:51 INFO - ++DOMWINDOW == 47 (0x12ae21400) [pid = 1063] [serial = 652] [outer = 0x12a117400] 16:57:51 INFO - ++DOCSHELL 0x1355f5b00 == 19 [pid = 1063] [id = 284] 16:57:51 INFO - ++DOMWINDOW == 48 (0x12a178400) [pid = 1063] [serial = 653] [outer = 0x0] 16:57:51 INFO - ++DOMWINDOW == 49 (0x133eb7800) [pid = 1063] [serial = 654] [outer = 0x12a178400] 16:57:53 INFO - ++DOCSHELL 0x12ca2d600 == 20 [pid = 1063] [id = 285] 16:57:53 INFO - ++DOMWINDOW == 50 (0x1308b9000) [pid = 1063] [serial = 655] [outer = 0x0] 16:57:53 INFO - ++DOMWINDOW == 51 (0x130a72800) [pid = 1063] [serial = 656] [outer = 0x1308b9000] 16:57:53 INFO - --DOCSHELL 0x12ca2d600 == 19 [pid = 1063] [id = 285] 16:57:54 INFO - --DOCSHELL 0x12c6dce00 == 18 [pid = 1063] [id = 278] 16:57:54 INFO - --DOCSHELL 0x12c6dd300 == 17 [pid = 1063] [id = 279] 16:57:54 INFO - --DOCSHELL 0x1355f5b00 == 16 [pid = 1063] [id = 284] 16:57:54 INFO - --DOCSHELL 0x129f9b700 == 15 [pid = 1063] [id = 272] 16:57:54 INFO - --DOCSHELL 0x1201b0200 == 14 [pid = 1063] [id = 271] 16:57:54 INFO - --DOMWINDOW == 50 (0x121cbac00) [pid = 1063] [serial = 617] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:54 INFO - --DOMWINDOW == 49 (0x12080d000) [pid = 1063] [serial = 614] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 48 (0x136b8c800) [pid = 1063] [serial = 644] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 47 (0x11f8cc800) [pid = 1063] [serial = 622] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 46 (0x12031e800) [pid = 1063] [serial = 624] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 16:57:54 INFO - --DOMWINDOW == 45 (0x11f9a5c00) [pid = 1063] [serial = 632] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 44 (0x120065000) [pid = 1063] [serial = 634] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 16:57:54 INFO - --DOMWINDOW == 43 (0x12080d800) [pid = 1063] [serial = 637] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 42 (0x13779e800) [pid = 1063] [serial = 645] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 41 (0x11fe1ac00) [pid = 1063] [serial = 623] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 40 (0x11fe61400) [pid = 1063] [serial = 633] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 39 (0x12082fc00) [pid = 1063] [serial = 635] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 38 (0x12b032400) [pid = 1063] [serial = 651] [outer = 0x0] [url = about:blank] 16:57:54 INFO - --DOMWINDOW == 37 (0x130982000) [pid = 1063] [serial = 642] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 16:57:54 INFO - --DOMWINDOW == 36 (0x12bbc3c00) [pid = 1063] [serial = 639] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:54 INFO - --DOMWINDOW == 35 (0x10a465000) [pid = 1063] [serial = 636] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:54 INFO - --DOMWINDOW == 34 (0x12087e400) [pid = 1063] [serial = 627] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:54 INFO - --DOMWINDOW == 33 (0x12c3ea400) [pid = 1063] [serial = 630] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:54 INFO - --DOMWINDOW == 32 (0x1308b9000) [pid = 1063] [serial = 655] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:54 INFO - --DOMWINDOW == 31 (0x121df4000) [pid = 1063] [serial = 626] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 16:57:54 INFO - --DOMWINDOW == 30 (0x13770b400) [pid = 1063] [serial = 641] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 16:57:54 INFO - MEMORY STAT | vsize 3796MB | residentFast 396MB | heapAllocated 123MB 16:57:54 INFO - 165 INFO TEST-OK | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js | took 2930ms 16:57:54 INFO - ++DOCSHELL 0x120926000 == 15 [pid = 1063] [id = 286] 16:57:54 INFO - ++DOMWINDOW == 31 (0x120065000) [pid = 1063] [serial = 657] [outer = 0x0] 16:57:54 INFO - ++DOMWINDOW == 32 (0x12031e800) [pid = 1063] [serial = 658] [outer = 0x120065000] 16:57:54 INFO - 166 INFO TEST-START | devtools/client/webconsole/test/browser_output_longstring_expand.js 16:57:54 INFO - ++DOCSHELL 0x129f9b700 == 16 [pid = 1063] [id = 287] 16:57:54 INFO - ++DOMWINDOW == 33 (0x12080d000) [pid = 1063] [serial = 659] [outer = 0x0] 16:57:54 INFO - ++DOMWINDOW == 34 (0x121763c00) [pid = 1063] [serial = 660] [outer = 0x12080d000] 16:57:54 INFO - ++DOCSHELL 0x12c6dc900 == 17 [pid = 1063] [id = 288] 16:57:54 INFO - ++DOMWINDOW == 35 (0x120917c00) [pid = 1063] [serial = 661] [outer = 0x0] 16:57:54 INFO - ++DOMWINDOW == 36 (0x121ddb800) [pid = 1063] [serial = 662] [outer = 0x120917c00] 16:57:54 INFO - ++DOMWINDOW == 37 (0x127a78000) [pid = 1063] [serial = 663] [outer = 0x120917c00] 16:57:55 INFO - ++DOCSHELL 0x12c825600 == 18 [pid = 1063] [id = 289] 16:57:55 INFO - ++DOMWINDOW == 38 (0x12ca21000) [pid = 1063] [serial = 664] [outer = 0x0] 16:57:55 INFO - ++DOMWINDOW == 39 (0x12ca21800) [pid = 1063] [serial = 665] [outer = 0x12ca21000] 16:57:56 INFO - --DOCSHELL 0x127766500 == 17 [pid = 1063] [id = 276] 16:57:56 INFO - --DOCSHELL 0x12c825600 == 16 [pid = 1063] [id = 289] 16:57:56 INFO - --DOCSHELL 0x120926f00 == 15 [pid = 1063] [id = 275] 16:57:56 INFO - --DOCSHELL 0x12d530100 == 14 [pid = 1063] [id = 282] 16:57:56 INFO - --DOCSHELL 0x131a42300 == 13 [pid = 1063] [id = 281] 16:57:56 INFO - --DOCSHELL 0x12d4bd000 == 12 [pid = 1063] [id = 283] 16:57:56 INFO - --DOCSHELL 0x129f9a300 == 11 [pid = 1063] [id = 277] 16:57:56 INFO - --DOMWINDOW == 38 (0x12c41a800) [pid = 1063] [serial = 631] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 37 (0x121ddbc00) [pid = 1063] [serial = 629] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:56 INFO - --DOMWINDOW == 36 (0x12bbe6c00) [pid = 1063] [serial = 640] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 35 (0x12664d400) [pid = 1063] [serial = 638] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:56 INFO - --DOMWINDOW == 34 (0x131bc1400) [pid = 1063] [serial = 643] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 33 (0x130a72800) [pid = 1063] [serial = 656] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:57:56 INFO - --DOMWINDOW == 32 (0x12a178000) [pid = 1063] [serial = 649] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 31 (0x129e8dc00) [pid = 1063] [serial = 647] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 30 (0x121ddb800) [pid = 1063] [serial = 662] [outer = 0x0] [url = about:blank] 16:57:56 INFO - --DOMWINDOW == 29 (0x12a178400) [pid = 1063] [serial = 653] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:56 INFO - --DOMWINDOW == 28 (0x12a117400) [pid = 1063] [serial = 650] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:56 INFO - --DOMWINDOW == 27 (0x12a0bf000) [pid = 1063] [serial = 648] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20773466] 16:57:56 INFO - --DOMWINDOW == 26 (0x1299fe000) [pid = 1063] [serial = 646] [outer = 0x0] [url = about:blank] 16:57:57 INFO - MEMORY STAT | vsize 3796MB | residentFast 396MB | heapAllocated 121MB 16:57:57 INFO - 167 INFO TEST-OK | devtools/client/webconsole/test/browser_output_longstring_expand.js | took 2522ms 16:57:57 INFO - ++DOCSHELL 0x1201fb300 == 12 [pid = 1063] [id = 290] 16:57:57 INFO - ++DOMWINDOW == 27 (0x11fa56000) [pid = 1063] [serial = 666] [outer = 0x0] 16:57:57 INFO - ++DOMWINDOW == 28 (0x120065400) [pid = 1063] [serial = 667] [outer = 0x11fa56000] 16:57:57 INFO - 168 INFO TEST-START | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js 16:57:57 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 291] 16:57:57 INFO - ++DOMWINDOW == 29 (0x120065c00) [pid = 1063] [serial = 668] [outer = 0x0] 16:57:57 INFO - ++DOMWINDOW == 30 (0x12082fc00) [pid = 1063] [serial = 669] [outer = 0x120065c00] 16:57:57 INFO - ++DOMWINDOW == 31 (0x12ae6a000) [pid = 1063] [serial = 670] [outer = 0x120065c00] 16:57:57 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 292] 16:57:57 INFO - ++DOMWINDOW == 32 (0x12080dc00) [pid = 1063] [serial = 671] [outer = 0x0] 16:57:57 INFO - ++DOMWINDOW == 33 (0x127b8b000) [pid = 1063] [serial = 672] [outer = 0x12080dc00] 16:57:57 INFO - ++DOMWINDOW == 34 (0x121ddb400) [pid = 1063] [serial = 673] [outer = 0x12080dc00] 16:57:57 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 293] 16:57:57 INFO - ++DOMWINDOW == 35 (0x12c50f800) [pid = 1063] [serial = 674] [outer = 0x0] 16:57:57 INFO - ++DOMWINDOW == 36 (0x12c52bc00) [pid = 1063] [serial = 675] [outer = 0x12c50f800] 16:57:58 INFO - ++DOMWINDOW == 37 (0x12a01e400) [pid = 1063] [serial = 676] [outer = 0x120065c00] 16:57:58 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:57:59 INFO - --DOCSHELL 0x129f9b700 == 14 [pid = 1063] [id = 287] 16:57:59 INFO - --DOCSHELL 0x12c6dc900 == 13 [pid = 1063] [id = 288] 16:57:59 INFO - --DOCSHELL 0x12ca29000 == 12 [pid = 1063] [id = 293] 16:57:59 INFO - --DOCSHELL 0x120926000 == 11 [pid = 1063] [id = 286] 16:57:59 INFO - --DOMWINDOW == 36 (0x133eb7800) [pid = 1063] [serial = 654] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 35 (0x12ae21400) [pid = 1063] [serial = 652] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:59 INFO - --DOMWINDOW == 34 (0x12082fc00) [pid = 1063] [serial = 669] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 33 (0x121763c00) [pid = 1063] [serial = 660] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 32 (0x12031e800) [pid = 1063] [serial = 658] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 31 (0x127b8b000) [pid = 1063] [serial = 672] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 30 (0x12ca21000) [pid = 1063] [serial = 664] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:57:59 INFO - --DOMWINDOW == 29 (0x120917c00) [pid = 1063] [serial = 661] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:57:59 INFO - --DOMWINDOW == 28 (0x12080d000) [pid = 1063] [serial = 659] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20787981%20-%20check%20that%20long%20strings%20can%20be%20expanded%20in%20the%20output.] 16:57:59 INFO - --DOMWINDOW == 27 (0x120065000) [pid = 1063] [serial = 657] [outer = 0x0] [url = about:blank] 16:57:59 INFO - --DOMWINDOW == 26 (0x12ae6a000) [pid = 1063] [serial = 670] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 16:57:59 INFO - MEMORY STAT | vsize 3798MB | residentFast 399MB | heapAllocated 121MB 16:57:59 INFO - 169 INFO TEST-OK | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js | took 2753ms 16:57:59 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 294] 16:57:59 INFO - ++DOMWINDOW == 27 (0x12014b400) [pid = 1063] [serial = 677] [outer = 0x0] 16:58:00 INFO - ++DOMWINDOW == 28 (0x12080d000) [pid = 1063] [serial = 678] [outer = 0x12014b400] 16:58:00 INFO - 170 INFO TEST-START | devtools/client/webconsole/test/browser_result_format_as_string.js 16:58:00 INFO - ++DOCSHELL 0x12bb2f300 == 13 [pid = 1063] [id = 295] 16:58:00 INFO - ++DOMWINDOW == 29 (0x12080d400) [pid = 1063] [serial = 679] [outer = 0x0] 16:58:00 INFO - ++DOMWINDOW == 30 (0x1216fe400) [pid = 1063] [serial = 680] [outer = 0x12080d400] 16:58:00 INFO - ++DOMWINDOW == 31 (0x127b8b000) [pid = 1063] [serial = 681] [outer = 0x12080d400] 16:58:00 INFO - ++DOCSHELL 0x12c6df600 == 14 [pid = 1063] [id = 296] 16:58:00 INFO - ++DOMWINDOW == 32 (0x120917c00) [pid = 1063] [serial = 682] [outer = 0x0] 16:58:00 INFO - ++DOMWINDOW == 33 (0x127b8b800) [pid = 1063] [serial = 683] [outer = 0x120917c00] 16:58:00 INFO - ++DOMWINDOW == 34 (0x12080d800) [pid = 1063] [serial = 684] [outer = 0x120917c00] 16:58:00 INFO - ++DOCSHELL 0x12d25ba00 == 15 [pid = 1063] [id = 297] 16:58:00 INFO - ++DOMWINDOW == 35 (0x12cbf1400) [pid = 1063] [serial = 685] [outer = 0x0] 16:58:00 INFO - ++DOMWINDOW == 36 (0x12ce44c00) [pid = 1063] [serial = 686] [outer = 0x12cbf1400] 16:58:02 INFO - --DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 291] 16:58:02 INFO - --DOCSHELL 0x12c6dd300 == 13 [pid = 1063] [id = 292] 16:58:02 INFO - --DOCSHELL 0x12d25ba00 == 12 [pid = 1063] [id = 297] 16:58:02 INFO - --DOMWINDOW == 35 (0x12ca21800) [pid = 1063] [serial = 665] [outer = 0x0] [url = about:blank] 16:58:02 INFO - --DOMWINDOW == 34 (0x127a78000) [pid = 1063] [serial = 663] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:02 INFO - --DOMWINDOW == 33 (0x1216fe400) [pid = 1063] [serial = 680] [outer = 0x0] [url = about:blank] 16:58:02 INFO - --DOMWINDOW == 32 (0x120065400) [pid = 1063] [serial = 667] [outer = 0x0] [url = about:blank] 16:58:02 INFO - --DOMWINDOW == 31 (0x127b8b800) [pid = 1063] [serial = 683] [outer = 0x0] [url = about:blank] 16:58:02 INFO - --DOMWINDOW == 30 (0x12c50f800) [pid = 1063] [serial = 674] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:02 INFO - --DOMWINDOW == 29 (0x12080dc00) [pid = 1063] [serial = 671] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:02 INFO - --DOMWINDOW == 28 (0x120065c00) [pid = 1063] [serial = 668] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 16:58:02 INFO - --DOMWINDOW == 27 (0x11fa56000) [pid = 1063] [serial = 666] [outer = 0x0] [url = about:blank] 16:58:02 INFO - --DOMWINDOW == 26 (0x12a01e400) [pid = 1063] [serial = 676] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 16:58:02 INFO - MEMORY STAT | vsize 3793MB | residentFast 397MB | heapAllocated 121MB 16:58:02 INFO - 171 INFO TEST-OK | devtools/client/webconsole/test/browser_result_format_as_string.js | took 2556ms 16:58:02 INFO - ++DOCSHELL 0x1201b0200 == 13 [pid = 1063] [id = 298] 16:58:02 INFO - ++DOMWINDOW == 27 (0x11fadc400) [pid = 1063] [serial = 687] [outer = 0x0] 16:58:02 INFO - ++DOMWINDOW == 28 (0x120065400) [pid = 1063] [serial = 688] [outer = 0x11fadc400] 16:58:02 INFO - 172 INFO TEST-START | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js 16:58:02 INFO - ++DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 299] 16:58:02 INFO - ++DOMWINDOW == 29 (0x120065c00) [pid = 1063] [serial = 689] [outer = 0x0] 16:58:02 INFO - ++DOMWINDOW == 30 (0x12087e800) [pid = 1063] [serial = 690] [outer = 0x120065c00] 16:58:03 INFO - ++DOMWINDOW == 31 (0x1277c2400) [pid = 1063] [serial = 691] [outer = 0x120065c00] 16:58:03 INFO - ++DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 300] 16:58:03 INFO - ++DOMWINDOW == 32 (0x12087e400) [pid = 1063] [serial = 692] [outer = 0x0] 16:58:03 INFO - ++DOMWINDOW == 33 (0x127ace000) [pid = 1063] [serial = 693] [outer = 0x12087e400] 16:58:03 INFO - ++DOMWINDOW == 34 (0x127ac6c00) [pid = 1063] [serial = 694] [outer = 0x12087e400] 16:58:03 INFO - ++DOCSHELL 0x12ca2d600 == 16 [pid = 1063] [id = 301] 16:58:03 INFO - ++DOMWINDOW == 35 (0x12c8e8800) [pid = 1063] [serial = 695] [outer = 0x0] 16:58:03 INFO - ++DOMWINDOW == 36 (0x12c9b4c00) [pid = 1063] [serial = 696] [outer = 0x12c8e8800] 16:58:04 INFO - ++DOMWINDOW == 37 (0x13094bc00) [pid = 1063] [serial = 697] [outer = 0x120065c00] 16:58:04 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:05 INFO - --DOCSHELL 0x121c23e00 == 15 [pid = 1063] [id = 294] 16:58:05 INFO - --DOCSHELL 0x1201fb300 == 14 [pid = 1063] [id = 290] 16:58:05 INFO - --DOCSHELL 0x12bb2f300 == 13 [pid = 1063] [id = 295] 16:58:05 INFO - --DOCSHELL 0x12c6df600 == 12 [pid = 1063] [id = 296] 16:58:05 INFO - --DOCSHELL 0x12ca2d600 == 11 [pid = 1063] [id = 301] 16:58:05 INFO - --DOMWINDOW == 36 (0x12c52bc00) [pid = 1063] [serial = 675] [outer = 0x0] [url = about:blank] 16:58:05 INFO - --DOMWINDOW == 35 (0x121ddb400) [pid = 1063] [serial = 673] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:05 INFO - --DOMWINDOW == 34 (0x12087e800) [pid = 1063] [serial = 690] [outer = 0x0] [url = about:blank] 16:58:05 INFO - --DOMWINDOW == 33 (0x12080d000) [pid = 1063] [serial = 678] [outer = 0x0] [url = about:blank] 16:58:05 INFO - --DOMWINDOW == 32 (0x127ace000) [pid = 1063] [serial = 693] [outer = 0x0] [url = about:blank] 16:58:05 INFO - --DOMWINDOW == 31 (0x1277c2400) [pid = 1063] [serial = 691] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 16:58:05 INFO - --DOMWINDOW == 30 (0x12cbf1400) [pid = 1063] [serial = 685] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:05 INFO - --DOMWINDOW == 29 (0x120917c00) [pid = 1063] [serial = 682] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:05 INFO - --DOMWINDOW == 28 (0x12080d400) [pid = 1063] [serial = 679] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 16:58:05 INFO - --DOMWINDOW == 27 (0x12014b400) [pid = 1063] [serial = 677] [outer = 0x0] [url = about:blank] 16:58:05 INFO - --DOMWINDOW == 26 (0x127b8b000) [pid = 1063] [serial = 681] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 16:58:05 INFO - ++DOMWINDOW == 27 (0x11fe1ac00) [pid = 1063] [serial = 698] [outer = 0x120065c00] 16:58:05 INFO - ++DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 302] 16:58:05 INFO - ++DOMWINDOW == 28 (0x10a467000) [pid = 1063] [serial = 699] [outer = 0x0] 16:58:05 INFO - ++DOMWINDOW == 29 (0x12024a000) [pid = 1063] [serial = 700] [outer = 0x10a467000] 16:58:05 INFO - ++DOMWINDOW == 30 (0x11fa56000) [pid = 1063] [serial = 701] [outer = 0x10a467000] 16:58:05 INFO - ++DOCSHELL 0x12c6ddd00 == 13 [pid = 1063] [id = 303] 16:58:05 INFO - ++DOMWINDOW == 31 (0x12bf01800) [pid = 1063] [serial = 702] [outer = 0x0] 16:58:05 INFO - ++DOMWINDOW == 32 (0x12bf01c00) [pid = 1063] [serial = 703] [outer = 0x12bf01800] 16:58:06 INFO - ++DOMWINDOW == 33 (0x129838400) [pid = 1063] [serial = 704] [outer = 0x120065c00] 16:58:06 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:07 INFO - --DOCSHELL 0x12c6dd800 == 12 [pid = 1063] [id = 300] 16:58:07 INFO - --DOCSHELL 0x12c6ddd00 == 11 [pid = 1063] [id = 303] 16:58:07 INFO - --DOMWINDOW == 32 (0x12ce44c00) [pid = 1063] [serial = 686] [outer = 0x0] [url = about:blank] 16:58:07 INFO - --DOMWINDOW == 31 (0x12080d800) [pid = 1063] [serial = 684] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:07 INFO - --DOMWINDOW == 30 (0x12024a000) [pid = 1063] [serial = 700] [outer = 0x0] [url = about:blank] 16:58:07 INFO - --DOMWINDOW == 29 (0x11fe1ac00) [pid = 1063] [serial = 698] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 16:58:07 INFO - MEMORY STAT | vsize 3794MB | residentFast 398MB | heapAllocated 123MB 16:58:07 INFO - 173 INFO TEST-OK | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js | took 4746ms 16:58:07 INFO - ++DOCSHELL 0x12092a600 == 12 [pid = 1063] [id = 304] 16:58:07 INFO - ++DOMWINDOW == 30 (0x12024a000) [pid = 1063] [serial = 705] [outer = 0x0] 16:58:07 INFO - ++DOMWINDOW == 31 (0x12082f000) [pid = 1063] [serial = 706] [outer = 0x12024a000] 16:58:07 INFO - 174 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js 16:58:07 INFO - MEMORY STAT | vsize 3795MB | residentFast 398MB | heapAllocated 124MB 16:58:07 INFO - 175 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js | took 127ms 16:58:07 INFO - ++DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 305] 16:58:07 INFO - ++DOMWINDOW == 32 (0x128e94000) [pid = 1063] [serial = 707] [outer = 0x0] 16:58:07 INFO - ++DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 708] [outer = 0x128e94000] 16:58:07 INFO - 176 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js 16:58:08 INFO - ++DOCSHELL 0x12c6dd800 == 14 [pid = 1063] [id = 306] 16:58:08 INFO - ++DOMWINDOW == 34 (0x12a0e6800) [pid = 1063] [serial = 709] [outer = 0x0] 16:58:08 INFO - ++DOMWINDOW == 35 (0x12a178400) [pid = 1063] [serial = 710] [outer = 0x12a0e6800] 16:58:08 INFO - ++DOMWINDOW == 36 (0x12b050c00) [pid = 1063] [serial = 711] [outer = 0x12a0e6800] 16:58:08 INFO - ++DOCSHELL 0x12d530100 == 15 [pid = 1063] [id = 307] 16:58:08 INFO - ++DOMWINDOW == 37 (0x12b0f8c00) [pid = 1063] [serial = 712] [outer = 0x0] 16:58:08 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:08 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:08 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:08 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:08 INFO - ++DOMWINDOW == 38 (0x121770000) [pid = 1063] [serial = 713] [outer = 0x12b0f8c00] 16:58:09 INFO - ++DOCSHELL 0x130929d00 == 16 [pid = 1063] [id = 308] 16:58:09 INFO - ++DOMWINDOW == 39 (0x127e59c00) [pid = 1063] [serial = 714] [outer = 0x0] 16:58:09 INFO - ++DOMWINDOW == 40 (0x12bf6e800) [pid = 1063] [serial = 715] [outer = 0x127e59c00] 16:58:09 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:09 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:09 INFO - ++DOMWINDOW == 41 (0x12bbc3000) [pid = 1063] [serial = 716] [outer = 0x127e59c00] 16:58:09 INFO - ++DOCSHELL 0x131a42d00 == 17 [pid = 1063] [id = 309] 16:58:09 INFO - ++DOMWINDOW == 42 (0x1355a2000) [pid = 1063] [serial = 717] [outer = 0x0] 16:58:09 INFO - ++DOMWINDOW == 43 (0x1355a2400) [pid = 1063] [serial = 718] [outer = 0x1355a2000] 16:58:09 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 16:58:10 INFO - --DOCSHELL 0x1201b0200 == 16 [pid = 1063] [id = 298] 16:58:10 INFO - --DOCSHELL 0x129f99400 == 15 [pid = 1063] [id = 302] 16:58:10 INFO - --DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 299] 16:58:10 INFO - --DOCSHELL 0x131a42d00 == 13 [pid = 1063] [id = 309] 16:58:11 INFO - --DOMWINDOW == 42 (0x120065400) [pid = 1063] [serial = 688] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 41 (0x13094bc00) [pid = 1063] [serial = 697] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 16:58:11 INFO - --DOMWINDOW == 40 (0x12082f000) [pid = 1063] [serial = 706] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 39 (0x12a178400) [pid = 1063] [serial = 710] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 38 (0x12bf6e800) [pid = 1063] [serial = 715] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 37 (0x12087e400) [pid = 1063] [serial = 692] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:11 INFO - --DOMWINDOW == 36 (0x12c8e8800) [pid = 1063] [serial = 695] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:11 INFO - --DOMWINDOW == 35 (0x12bf01800) [pid = 1063] [serial = 702] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:11 INFO - --DOMWINDOW == 34 (0x10a467000) [pid = 1063] [serial = 699] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:11 INFO - --DOMWINDOW == 33 (0x11fadc400) [pid = 1063] [serial = 687] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 32 (0x120065c00) [pid = 1063] [serial = 689] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 16:58:11 INFO - --DOMWINDOW == 31 (0x12024a000) [pid = 1063] [serial = 705] [outer = 0x0] [url = about:blank] 16:58:11 INFO - --DOMWINDOW == 30 (0x129838400) [pid = 1063] [serial = 704] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 16:58:11 INFO - MEMORY STAT | vsize 3793MB | residentFast 399MB | heapAllocated 125MB 16:58:11 INFO - 177 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js | took 3259ms 16:58:11 INFO - ++DOCSHELL 0x120929200 == 14 [pid = 1063] [id = 310] 16:58:11 INFO - ++DOMWINDOW == 31 (0x11fe61400) [pid = 1063] [serial = 719] [outer = 0x0] 16:58:11 INFO - ++DOMWINDOW == 32 (0x1200e3000) [pid = 1063] [serial = 720] [outer = 0x11fe61400] 16:58:11 INFO - 178 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_assert.js 16:58:11 INFO - ++DOCSHELL 0x129f9b700 == 15 [pid = 1063] [id = 311] 16:58:11 INFO - ++DOMWINDOW == 33 (0x12024a000) [pid = 1063] [serial = 721] [outer = 0x0] 16:58:11 INFO - ++DOMWINDOW == 34 (0x121cbac00) [pid = 1063] [serial = 722] [outer = 0x12024a000] 16:58:11 INFO - ++DOMWINDOW == 35 (0x127274400) [pid = 1063] [serial = 723] [outer = 0x12024a000] 16:58:11 INFO - ++DOCSHELL 0x12c6df600 == 16 [pid = 1063] [id = 312] 16:58:11 INFO - ++DOMWINDOW == 36 (0x120917c00) [pid = 1063] [serial = 724] [outer = 0x0] 16:58:11 INFO - ++DOMWINDOW == 37 (0x1284e0400) [pid = 1063] [serial = 725] [outer = 0x120917c00] 16:58:11 INFO - ++DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 726] [outer = 0x120917c00] 16:58:11 INFO - ++DOCSHELL 0x12d4bd000 == 17 [pid = 1063] [id = 313] 16:58:11 INFO - ++DOMWINDOW == 39 (0x13094b800) [pid = 1063] [serial = 727] [outer = 0x0] 16:58:11 INFO - ++DOMWINDOW == 40 (0x13094bc00) [pid = 1063] [serial = 728] [outer = 0x13094b800] 16:58:13 INFO - --DOCSHELL 0x12d530100 == 16 [pid = 1063] [id = 307] 16:58:13 INFO - --DOCSHELL 0x12092a600 == 15 [pid = 1063] [id = 304] 16:58:13 INFO - --DOCSHELL 0x12bb2da00 == 14 [pid = 1063] [id = 305] 16:58:13 INFO - --DOCSHELL 0x12c6dd800 == 13 [pid = 1063] [id = 306] 16:58:13 INFO - --DOCSHELL 0x12d4bd000 == 12 [pid = 1063] [id = 313] 16:58:13 INFO - --DOCSHELL 0x130929d00 == 11 [pid = 1063] [id = 308] 16:58:13 INFO - --DOMWINDOW == 39 (0x127ac6c00) [pid = 1063] [serial = 694] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:13 INFO - --DOMWINDOW == 38 (0x11fa56000) [pid = 1063] [serial = 701] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:13 INFO - --DOMWINDOW == 37 (0x12bf01c00) [pid = 1063] [serial = 703] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 36 (0x12c9b4c00) [pid = 1063] [serial = 696] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 35 (0x1284e0400) [pid = 1063] [serial = 725] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 34 (0x12963d400) [pid = 1063] [serial = 708] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 33 (0x121770000) [pid = 1063] [serial = 713] [outer = 0x0] [url = http://example.com/] 16:58:13 INFO - --DOMWINDOW == 32 (0x121cbac00) [pid = 1063] [serial = 722] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 31 (0x127e59c00) [pid = 1063] [serial = 714] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:13 INFO - --DOMWINDOW == 30 (0x1355a2000) [pid = 1063] [serial = 717] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:13 INFO - --DOMWINDOW == 29 (0x128e94000) [pid = 1063] [serial = 707] [outer = 0x0] [url = about:blank] 16:58:13 INFO - --DOMWINDOW == 28 (0x12a0e6800) [pid = 1063] [serial = 709] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 16:58:13 INFO - --DOMWINDOW == 27 (0x12b0f8c00) [pid = 1063] [serial = 712] [outer = 0x0] [url = http://example.com/] 16:58:13 INFO - --DOMWINDOW == 26 (0x12b050c00) [pid = 1063] [serial = 711] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 16:58:13 INFO - MEMORY STAT | vsize 3794MB | residentFast 401MB | heapAllocated 124MB 16:58:13 INFO - 179 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_assert.js | took 2423ms 16:58:13 INFO - ++DOCSHELL 0x1201af300 == 12 [pid = 1063] [id = 314] 16:58:13 INFO - ++DOMWINDOW == 27 (0x12014b400) [pid = 1063] [serial = 729] [outer = 0x0] 16:58:13 INFO - ++DOMWINDOW == 28 (0x12082f000) [pid = 1063] [serial = 730] [outer = 0x12014b400] 16:58:13 INFO - 180 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js 16:58:13 INFO - ++DOCSHELL 0x129bdc500 == 13 [pid = 1063] [id = 315] 16:58:13 INFO - ++DOMWINDOW == 29 (0x121ddb800) [pid = 1063] [serial = 731] [outer = 0x0] 16:58:13 INFO - ++DOMWINDOW == 30 (0x1277c2400) [pid = 1063] [serial = 732] [outer = 0x121ddb800] 16:58:14 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 316] 16:58:14 INFO - ++DOMWINDOW == 31 (0x12775d800) [pid = 1063] [serial = 733] [outer = 0x0] 16:58:14 INFO - ++DOMWINDOW == 32 (0x127e59c00) [pid = 1063] [serial = 734] [outer = 0x12775d800] 16:58:14 INFO - ++DOMWINDOW == 33 (0x128738000) [pid = 1063] [serial = 735] [outer = 0x12775d800] 16:58:14 INFO - ++DOCSHELL 0x12c6dec00 == 15 [pid = 1063] [id = 317] 16:58:14 INFO - ++DOMWINDOW == 34 (0x12ceb3800) [pid = 1063] [serial = 736] [outer = 0x0] 16:58:14 INFO - ++DOMWINDOW == 35 (0x12df6ac00) [pid = 1063] [serial = 737] [outer = 0x12ceb3800] 16:58:16 INFO - --DOCSHELL 0x129f9b700 == 14 [pid = 1063] [id = 311] 16:58:16 INFO - --DOCSHELL 0x120929200 == 13 [pid = 1063] [id = 310] 16:58:16 INFO - --DOCSHELL 0x12c6df600 == 12 [pid = 1063] [id = 312] 16:58:16 INFO - --DOCSHELL 0x12c6dec00 == 11 [pid = 1063] [id = 317] 16:58:16 INFO - --DOMWINDOW == 34 (0x1355a2400) [pid = 1063] [serial = 718] [outer = 0x0] [url = about:blank] 16:58:16 INFO - --DOMWINDOW == 33 (0x12bbc3000) [pid = 1063] [serial = 716] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:16 INFO - --DOMWINDOW == 32 (0x1200e3000) [pid = 1063] [serial = 720] [outer = 0x0] [url = about:blank] 16:58:16 INFO - --DOMWINDOW == 31 (0x127e59c00) [pid = 1063] [serial = 734] [outer = 0x0] [url = about:blank] 16:58:16 INFO - --DOMWINDOW == 30 (0x120917c00) [pid = 1063] [serial = 724] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:16 INFO - --DOMWINDOW == 29 (0x13094b800) [pid = 1063] [serial = 727] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:16 INFO - --DOMWINDOW == 28 (0x12024a000) [pid = 1063] [serial = 721] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 16:58:16 INFO - --DOMWINDOW == 27 (0x11fe61400) [pid = 1063] [serial = 719] [outer = 0x0] [url = about:blank] 16:58:16 INFO - --DOMWINDOW == 26 (0x127274400) [pid = 1063] [serial = 723] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 16:58:16 INFO - MEMORY STAT | vsize 3792MB | residentFast 399MB | heapAllocated 124MB 16:58:16 INFO - 181 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js | took 2608ms 16:58:16 INFO - ++DOCSHELL 0x120926000 == 12 [pid = 1063] [id = 318] 16:58:16 INFO - ++DOMWINDOW == 27 (0x120065400) [pid = 1063] [serial = 738] [outer = 0x0] 16:58:16 INFO - ++DOMWINDOW == 28 (0x12019e400) [pid = 1063] [serial = 739] [outer = 0x120065400] 16:58:16 INFO - 182 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js 16:58:16 INFO - ++DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 319] 16:58:16 INFO - ++DOMWINDOW == 29 (0x12024a000) [pid = 1063] [serial = 740] [outer = 0x0] 16:58:16 INFO - ++DOMWINDOW == 30 (0x121df4000) [pid = 1063] [serial = 741] [outer = 0x12024a000] 16:58:16 INFO - ++DOCSHELL 0x12c6db000 == 14 [pid = 1063] [id = 320] 16:58:16 INFO - ++DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 742] [outer = 0x0] 16:58:16 INFO - ++DOMWINDOW == 32 (0x128ffb000) [pid = 1063] [serial = 743] [outer = 0x121ddb400] 16:58:17 INFO - ++DOMWINDOW == 33 (0x12965a000) [pid = 1063] [serial = 744] [outer = 0x121ddb400] 16:58:17 INFO - ++DOCSHELL 0x12c6de700 == 15 [pid = 1063] [id = 321] 16:58:17 INFO - ++DOMWINDOW == 34 (0x12e8d8800) [pid = 1063] [serial = 745] [outer = 0x0] 16:58:17 INFO - ++DOMWINDOW == 35 (0x12e8d8c00) [pid = 1063] [serial = 746] [outer = 0x12e8d8800] 16:58:18 INFO - [1063] WARNING: We should have hit the document element...: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 16:58:18 INFO - --DOCSHELL 0x129bdc500 == 14 [pid = 1063] [id = 315] 16:58:18 INFO - --DOCSHELL 0x1201af300 == 13 [pid = 1063] [id = 314] 16:58:18 INFO - --DOCSHELL 0x12c6de700 == 12 [pid = 1063] [id = 321] 16:58:18 INFO - --DOCSHELL 0x12bf3f600 == 11 [pid = 1063] [id = 316] 16:58:19 INFO - --DOMWINDOW == 34 (0x13094bc00) [pid = 1063] [serial = 728] [outer = 0x0] [url = about:blank] 16:58:19 INFO - --DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 726] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:19 INFO - --DOMWINDOW == 32 (0x12082f000) [pid = 1063] [serial = 730] [outer = 0x0] [url = about:blank] 16:58:19 INFO - --DOMWINDOW == 31 (0x1277c2400) [pid = 1063] [serial = 732] [outer = 0x0] [url = about:blank] 16:58:19 INFO - --DOMWINDOW == 30 (0x128ffb000) [pid = 1063] [serial = 743] [outer = 0x0] [url = about:blank] 16:58:19 INFO - --DOMWINDOW == 29 (0x12775d800) [pid = 1063] [serial = 733] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:19 INFO - --DOMWINDOW == 28 (0x12ceb3800) [pid = 1063] [serial = 736] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:19 INFO - --DOMWINDOW == 27 (0x12014b400) [pid = 1063] [serial = 729] [outer = 0x0] [url = about:blank] 16:58:19 INFO - --DOMWINDOW == 26 (0x121ddb800) [pid = 1063] [serial = 731] [outer = 0x0] [url = data:text/html;charset=utf8,test%20autocompletion%20with%20$%20or%20_] 16:58:19 INFO - MEMORY STAT | vsize 3792MB | residentFast 399MB | heapAllocated 124MB 16:58:19 INFO - 183 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js | took 2538ms 16:58:19 INFO - ++DOCSHELL 0x1201b1600 == 12 [pid = 1063] [id = 322] 16:58:19 INFO - ++DOMWINDOW == 27 (0x120065c00) [pid = 1063] [serial = 747] [outer = 0x0] 16:58:19 INFO - ++DOMWINDOW == 28 (0x12024a400) [pid = 1063] [serial = 748] [outer = 0x120065c00] 16:58:19 INFO - 184 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js 16:58:19 INFO - ++DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 323] 16:58:19 INFO - ++DOMWINDOW == 29 (0x120538800) [pid = 1063] [serial = 749] [outer = 0x0] 16:58:19 INFO - ++DOMWINDOW == 30 (0x120541800) [pid = 1063] [serial = 750] [outer = 0x120538800] 16:58:19 INFO - ++DOMWINDOW == 31 (0x1208d5800) [pid = 1063] [serial = 751] [outer = 0x120538800] 16:58:19 INFO - ++DOCSHELL 0x12c6de200 == 14 [pid = 1063] [id = 324] 16:58:19 INFO - ++DOMWINDOW == 32 (0x12099ec00) [pid = 1063] [serial = 752] [outer = 0x0] 16:58:19 INFO - ++DOMWINDOW == 33 (0x12099e800) [pid = 1063] [serial = 753] [outer = 0x12099ec00] 16:58:19 INFO - ++DOCSHELL 0x12c6dec00 == 15 [pid = 1063] [id = 325] 16:58:19 INFO - ++DOMWINDOW == 34 (0x120541400) [pid = 1063] [serial = 754] [outer = 0x0] 16:58:19 INFO - ++DOMWINDOW == 35 (0x1216c6400) [pid = 1063] [serial = 755] [outer = 0x120541400] 16:58:19 INFO - ++DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 756] [outer = 0x120541400] 16:58:19 INFO - ++DOCSHELL 0x12d4bd000 == 16 [pid = 1063] [id = 326] 16:58:19 INFO - ++DOMWINDOW == 37 (0x12c345400) [pid = 1063] [serial = 757] [outer = 0x0] 16:58:19 INFO - ++DOMWINDOW == 38 (0x12c3d1000) [pid = 1063] [serial = 758] [outer = 0x12c345400] 16:58:20 INFO - getProperty threw an exception: Error: Permission denied to access property "document" 16:58:20 INFO - Stack: getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:300:20 16:58:20 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:253:13 16:58:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:20 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 16:58:20 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1599:15 16:58:20 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:58:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:20 INFO - Line: 0, column: 0 16:58:21 INFO - --DOCSHELL 0x129f9b200 == 15 [pid = 1063] [id = 319] 16:58:21 INFO - --DOCSHELL 0x120926000 == 14 [pid = 1063] [id = 318] 16:58:21 INFO - --DOCSHELL 0x12d4bd000 == 13 [pid = 1063] [id = 326] 16:58:21 INFO - --DOCSHELL 0x12c6db000 == 12 [pid = 1063] [id = 320] 16:58:21 INFO - --DOMWINDOW == 37 (0x12df6ac00) [pid = 1063] [serial = 737] [outer = 0x0] [url = about:blank] 16:58:21 INFO - --DOMWINDOW == 36 (0x128738000) [pid = 1063] [serial = 735] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:21 INFO - --DOMWINDOW == 35 (0x120541800) [pid = 1063] [serial = 750] [outer = 0x0] [url = about:blank] 16:58:21 INFO - --DOMWINDOW == 34 (0x121df4000) [pid = 1063] [serial = 741] [outer = 0x0] [url = about:blank] 16:58:21 INFO - --DOMWINDOW == 33 (0x12019e400) [pid = 1063] [serial = 739] [outer = 0x0] [url = about:blank] 16:58:21 INFO - --DOMWINDOW == 32 (0x1216c6400) [pid = 1063] [serial = 755] [outer = 0x0] [url = about:blank] 16:58:21 INFO - --DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 742] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:21 INFO - --DOMWINDOW == 30 (0x12e8d8800) [pid = 1063] [serial = 745] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:21 INFO - --DOMWINDOW == 29 (0x12024a000) [pid = 1063] [serial = 740] [outer = 0x0] [url = data:text/html;charset=utf-8,

test%20for%20bug%20642615] 16:58:21 INFO - --DOMWINDOW == 28 (0x120065400) [pid = 1063] [serial = 738] [outer = 0x0] [url = about:blank] 16:58:22 INFO - MEMORY STAT | vsize 3793MB | residentFast 400MB | heapAllocated 124MB 16:58:22 INFO - 185 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js | took 2714ms 16:58:22 INFO - ++DOCSHELL 0x1201af300 == 13 [pid = 1063] [id = 327] 16:58:22 INFO - ++DOMWINDOW == 29 (0x120065400) [pid = 1063] [serial = 759] [outer = 0x0] 16:58:22 INFO - ++DOMWINDOW == 30 (0x12019e400) [pid = 1063] [serial = 760] [outer = 0x120065400] 16:58:22 INFO - 186 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js 16:58:22 INFO - ++DOCSHELL 0x129ea7700 == 14 [pid = 1063] [id = 328] 16:58:22 INFO - ++DOMWINDOW == 31 (0x120541800) [pid = 1063] [serial = 761] [outer = 0x0] 16:58:22 INFO - ++DOMWINDOW == 32 (0x1205f8800) [pid = 1063] [serial = 762] [outer = 0x120541800] 16:58:22 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 763] [outer = 0x120541800] 16:58:22 INFO - ++DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 329] 16:58:22 INFO - ++DOMWINDOW == 34 (0x12054bc00) [pid = 1063] [serial = 764] [outer = 0x0] 16:58:22 INFO - ++DOMWINDOW == 35 (0x12168e400) [pid = 1063] [serial = 765] [outer = 0x12054bc00] 16:58:22 INFO - ++DOMWINDOW == 36 (0x1209c4c00) [pid = 1063] [serial = 766] [outer = 0x12054bc00] 16:58:22 INFO - ++DOCSHELL 0x12cb89b00 == 16 [pid = 1063] [id = 330] 16:58:22 INFO - ++DOMWINDOW == 37 (0x12c695400) [pid = 1063] [serial = 767] [outer = 0x0] 16:58:22 INFO - ++DOMWINDOW == 38 (0x12c6b9400) [pid = 1063] [serial = 768] [outer = 0x12c695400] 16:58:24 INFO - ++DOCSHELL 0x1334e2b00 == 17 [pid = 1063] [id = 331] 16:58:24 INFO - ++DOMWINDOW == 39 (0x1351b2400) [pid = 1063] [serial = 769] [outer = 0x0] 16:58:24 INFO - ++DOMWINDOW == 40 (0x1351cc400) [pid = 1063] [serial = 770] [outer = 0x1351b2400] 16:58:24 INFO - ++DOCSHELL 0x135547200 == 18 [pid = 1063] [id = 332] 16:58:24 INFO - ++DOMWINDOW == 41 (0x136423800) [pid = 1063] [serial = 771] [outer = 0x0] 16:58:24 INFO - ++DOMWINDOW == 42 (0x1365f5800) [pid = 1063] [serial = 772] [outer = 0x136423800] 16:58:26 INFO - Handler function JSPropertyProvider threw an exception: TypeError: aName is not an identifier 16:58:26 INFO - Stack: DebuggerEnvironmentSupport.getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:512:18 16:58:26 INFO - getExactMatch_impl@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:444:16 16:58:26 INFO - getVariableInEnvironment@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:340:10 16:58:26 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:232:11 16:58:26 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:26 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 16:58:26 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1599:15 16:58:26 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 16:58:26 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:26 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 16:58:26 INFO - EventLoop.prototype.enter@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:347:5 16:58:26 INFO - ThreadActor.prototype._pushThreadPause@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:544:5 16:58:26 INFO - ThreadActor.prototype._pauseAndRespond@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:747:7 16:58:26 INFO - ThreadActor.prototype.onDebuggerStatement@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:1819:9 16:58:26 INFO - secondCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:43:9 16:58:26 INFO - firstCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:30:9 16:58:26 INFO - debuggerOpened/<@chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js:231:5 16:58:26 INFO - testScope/test_executeSoon/<.run@chrome://mochikit/content/browser-test.js:966:9 16:58:26 INFO - Line: 512, column: 18 16:58:27 INFO - --DOCSHELL 0x12c6de200 == 17 [pid = 1063] [id = 324] 16:58:27 INFO - --DOCSHELL 0x12bb2da00 == 16 [pid = 1063] [id = 323] 16:58:27 INFO - --DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 329] 16:58:27 INFO - --DOCSHELL 0x12cb89b00 == 14 [pid = 1063] [id = 330] 16:58:27 INFO - --DOCSHELL 0x12c6dec00 == 13 [pid = 1063] [id = 325] 16:58:27 INFO - --DOCSHELL 0x1201b1600 == 12 [pid = 1063] [id = 322] 16:58:27 INFO - --DOCSHELL 0x1334e2b00 == 11 [pid = 1063] [id = 331] 16:58:27 INFO - --DOCSHELL 0x135547200 == 10 [pid = 1063] [id = 332] 16:58:27 INFO - --DOMWINDOW == 41 (0x12e8d8c00) [pid = 1063] [serial = 746] [outer = 0x0] [url = about:blank] 16:58:27 INFO - --DOMWINDOW == 40 (0x12965a000) [pid = 1063] [serial = 744] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:27 INFO - --DOMWINDOW == 39 (0x120541400) [pid = 1063] [serial = 754] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:27 INFO - --DOMWINDOW == 38 (0x12c345400) [pid = 1063] [serial = 757] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:27 INFO - --DOMWINDOW == 37 (0x12099ec00) [pid = 1063] [serial = 752] [outer = 0x0] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 16:58:27 INFO - --DOMWINDOW == 36 (0x120538800) [pid = 1063] [serial = 749] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 16:58:27 INFO - --DOMWINDOW == 35 (0x120065c00) [pid = 1063] [serial = 747] [outer = 0x0] [url = about:blank] 16:58:27 INFO - --DOMWINDOW == 34 (0x136423800) [pid = 1063] [serial = 771] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:58:27 INFO - --DOMWINDOW == 33 (0x1205f8800) [pid = 1063] [serial = 762] [outer = 0x0] [url = about:blank] 16:58:27 INFO - --DOMWINDOW == 32 (0x12024a400) [pid = 1063] [serial = 748] [outer = 0x0] [url = about:blank] 16:58:27 INFO - --DOMWINDOW == 31 (0x12168e400) [pid = 1063] [serial = 765] [outer = 0x0] [url = about:blank] 16:58:27 INFO - --DOMWINDOW == 30 (0x12099e800) [pid = 1063] [serial = 753] [outer = 0x0] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 16:58:27 INFO - --DOMWINDOW == 29 (0x1208d5800) [pid = 1063] [serial = 751] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 16:58:27 INFO - MEMORY STAT | vsize 3786MB | residentFast 398MB | heapAllocated 127MB 16:58:27 INFO - 187 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js | took 5689ms 16:58:27 INFO - ++DOCSHELL 0x12092a600 == 11 [pid = 1063] [id = 333] 16:58:27 INFO - ++DOMWINDOW == 30 (0x11f856c00) [pid = 1063] [serial = 773] [outer = 0x0] 16:58:27 INFO - ++DOMWINDOW == 31 (0x11fe61400) [pid = 1063] [serial = 774] [outer = 0x11f856c00] 16:58:28 INFO - 188 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js 16:58:28 INFO - ++DOCSHELL 0x129f9b200 == 12 [pid = 1063] [id = 334] 16:58:28 INFO - ++DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 775] [outer = 0x0] 16:58:28 INFO - ++DOMWINDOW == 33 (0x1285cb800) [pid = 1063] [serial = 776] [outer = 0x127f4e800] 16:58:28 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 335] 16:58:28 INFO - ++DOMWINDOW == 34 (0x10a465400) [pid = 1063] [serial = 777] [outer = 0x0] 16:58:28 INFO - ++DOMWINDOW == 35 (0x128501c00) [pid = 1063] [serial = 778] [outer = 0x10a465400] 16:58:28 INFO - ++DOMWINDOW == 36 (0x12965a000) [pid = 1063] [serial = 779] [outer = 0x10a465400] 16:58:28 INFO - ++DOCSHELL 0x12c825600 == 14 [pid = 1063] [id = 336] 16:58:28 INFO - ++DOMWINDOW == 37 (0x12ce44c00) [pid = 1063] [serial = 780] [outer = 0x0] 16:58:28 INFO - ++DOMWINDOW == 38 (0x12ceb3400) [pid = 1063] [serial = 781] [outer = 0x12ce44c00] 16:58:29 INFO - ++DOCSHELL 0x12d52ed00 == 15 [pid = 1063] [id = 337] 16:58:29 INFO - ++DOMWINDOW == 39 (0x12031e800) [pid = 1063] [serial = 782] [outer = 0x0] 16:58:29 INFO - ++DOMWINDOW == 40 (0x1299fe000) [pid = 1063] [serial = 783] [outer = 0x12031e800] 16:58:30 INFO - MEMORY STAT | vsize 3791MB | residentFast 398MB | heapAllocated 133MB 16:58:30 INFO - 189 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js | took 2072ms 16:58:30 INFO - ++DOCSHELL 0x135548600 == 16 [pid = 1063] [id = 338] 16:58:30 INFO - ++DOMWINDOW == 41 (0x12b0f8400) [pid = 1063] [serial = 784] [outer = 0x0] 16:58:30 INFO - ++DOMWINDOW == 42 (0x12b110800) [pid = 1063] [serial = 785] [outer = 0x12b0f8400] 16:58:30 INFO - 190 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js 16:58:30 INFO - ++DOCSHELL 0x129ea8100 == 17 [pid = 1063] [id = 339] 16:58:30 INFO - ++DOMWINDOW == 43 (0x12bbc3c00) [pid = 1063] [serial = 786] [outer = 0x0] 16:58:30 INFO - ++DOMWINDOW == 44 (0x12be25400) [pid = 1063] [serial = 787] [outer = 0x12bbc3c00] 16:58:30 INFO - ++DOCSHELL 0x137080800 == 18 [pid = 1063] [id = 340] 16:58:30 INFO - ++DOMWINDOW == 45 (0x12be25000) [pid = 1063] [serial = 788] [outer = 0x0] 16:58:30 INFO - ++DOMWINDOW == 46 (0x12c48e000) [pid = 1063] [serial = 789] [outer = 0x12be25000] 16:58:30 INFO - ++DOMWINDOW == 47 (0x12c777800) [pid = 1063] [serial = 790] [outer = 0x12be25000] 16:58:30 INFO - ++DOCSHELL 0x137081700 == 19 [pid = 1063] [id = 341] 16:58:30 INFO - ++DOMWINDOW == 48 (0x12e3a4400) [pid = 1063] [serial = 791] [outer = 0x0] 16:58:30 INFO - ++DOMWINDOW == 49 (0x12ea9a400) [pid = 1063] [serial = 792] [outer = 0x12e3a4400] 16:58:31 INFO - ++DOMWINDOW == 50 (0x129ac3400) [pid = 1063] [serial = 793] [outer = 0x12bbc3c00] 16:58:31 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:32 INFO - --DOCSHELL 0x1201af300 == 18 [pid = 1063] [id = 327] 16:58:32 INFO - --DOCSHELL 0x129ea7700 == 17 [pid = 1063] [id = 328] 16:58:32 INFO - --DOCSHELL 0x12092a600 == 16 [pid = 1063] [id = 333] 16:58:32 INFO - --DOCSHELL 0x129f9b200 == 15 [pid = 1063] [id = 334] 16:58:32 INFO - --DOCSHELL 0x12c6db500 == 14 [pid = 1063] [id = 335] 16:58:32 INFO - --DOCSHELL 0x12c825600 == 13 [pid = 1063] [id = 336] 16:58:32 INFO - --DOCSHELL 0x12d52ed00 == 12 [pid = 1063] [id = 337] 16:58:32 INFO - --DOCSHELL 0x137080800 == 11 [pid = 1063] [id = 340] 16:58:32 INFO - --DOCSHELL 0x137081700 == 10 [pid = 1063] [id = 341] 16:58:32 INFO - --DOMWINDOW == 49 (0x1216bac00) [pid = 1063] [serial = 756] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:32 INFO - --DOMWINDOW == 48 (0x12c3d1000) [pid = 1063] [serial = 758] [outer = 0x0] [url = about:blank] 16:58:32 INFO - --DOMWINDOW == 47 (0x1365f5800) [pid = 1063] [serial = 772] [outer = 0x0] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 16:58:33 INFO - --DOMWINDOW == 46 (0x1351b2400) [pid = 1063] [serial = 769] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:58:33 INFO - --DOMWINDOW == 45 (0x12c695400) [pid = 1063] [serial = 767] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:33 INFO - --DOMWINDOW == 44 (0x10a465400) [pid = 1063] [serial = 777] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:33 INFO - --DOMWINDOW == 43 (0x12054bc00) [pid = 1063] [serial = 764] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:33 INFO - --DOMWINDOW == 42 (0x120065400) [pid = 1063] [serial = 759] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 41 (0x120541800) [pid = 1063] [serial = 761] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 16:58:33 INFO - --DOMWINDOW == 40 (0x11f856c00) [pid = 1063] [serial = 773] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 39 (0x127f4e800) [pid = 1063] [serial = 775] [outer = 0x0] [url = data:text/html;charset=utf-8,

bug%20900448%20-%20autocomplete%20popup%20closes%20on%20tab%20switch] 16:58:33 INFO - --DOMWINDOW == 38 (0x12031e800) [pid = 1063] [serial = 782] [outer = 0x0] [url = data:text/html;charset=utf-8,

testing%20autocomplete%20closes] 16:58:33 INFO - --DOMWINDOW == 37 (0x128501c00) [pid = 1063] [serial = 778] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 36 (0x12019e400) [pid = 1063] [serial = 760] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 35 (0x11fe61400) [pid = 1063] [serial = 774] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 34 (0x1285cb800) [pid = 1063] [serial = 776] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 33 (0x1299fe000) [pid = 1063] [serial = 783] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 32 (0x12c48e000) [pid = 1063] [serial = 789] [outer = 0x0] [url = about:blank] 16:58:33 INFO - --DOMWINDOW == 31 (0x12ce44c00) [pid = 1063] [serial = 780] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:33 INFO - --DOMWINDOW == 30 (0x120996c00) [pid = 1063] [serial = 763] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 16:58:33 INFO - MEMORY STAT | vsize 3786MB | residentFast 399MB | heapAllocated 126MB 16:58:33 INFO - 191 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js | took 3004ms 16:58:33 INFO - ++DOCSHELL 0x121646100 == 11 [pid = 1063] [id = 342] 16:58:33 INFO - ++DOMWINDOW == 31 (0x11fadc400) [pid = 1063] [serial = 794] [outer = 0x0] 16:58:33 INFO - ++DOMWINDOW == 32 (0x120065400) [pid = 1063] [serial = 795] [outer = 0x11fadc400] 16:58:33 INFO - 192 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js 16:58:33 INFO - ++DOCSHELL 0x12c6dba00 == 12 [pid = 1063] [id = 343] 16:58:33 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 796] [outer = 0x0] 16:58:33 INFO - ++DOMWINDOW == 34 (0x121763c00) [pid = 1063] [serial = 797] [outer = 0x120996c00] 16:58:33 INFO - ++DOMWINDOW == 35 (0x130fb9000) [pid = 1063] [serial = 798] [outer = 0x120996c00] 16:58:33 INFO - ++DOCSHELL 0x12d4c0200 == 13 [pid = 1063] [id = 344] 16:58:33 INFO - ++DOMWINDOW == 36 (0x129838400) [pid = 1063] [serial = 799] [outer = 0x0] 16:58:33 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 16:58:33 INFO - ++DOMWINDOW == 37 (0x1299ea800) [pid = 1063] [serial = 800] [outer = 0x129838400] 16:58:33 INFO - ++DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 345] 16:58:33 INFO - ++DOMWINDOW == 38 (0x121763000) [pid = 1063] [serial = 801] [outer = 0x0] 16:58:33 INFO - ++DOMWINDOW == 39 (0x129ac3c00) [pid = 1063] [serial = 802] [outer = 0x121763000] 16:58:33 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 16:58:33 INFO - ++DOMWINDOW == 40 (0x129ac3000) [pid = 1063] [serial = 803] [outer = 0x121763000] 16:58:34 INFO - ++DOCSHELL 0x130928900 == 15 [pid = 1063] [id = 346] 16:58:34 INFO - ++DOMWINDOW == 41 (0x12df27c00) [pid = 1063] [serial = 804] [outer = 0x0] 16:58:34 INFO - ++DOMWINDOW == 42 (0x12df59800) [pid = 1063] [serial = 805] [outer = 0x12df27c00] 16:58:35 INFO - ++DOMWINDOW == 43 (0x1334d4800) [pid = 1063] [serial = 806] [outer = 0x120996c00] 16:58:35 INFO - [1063] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsDocument.cpp, line 4761 16:58:35 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:35 INFO - ++DOCSHELL 0x136a6fb00 == 16 [pid = 1063] [id = 347] 16:58:35 INFO - ++DOMWINDOW == 44 (0x133500c00) [pid = 1063] [serial = 807] [outer = 0x0] 16:58:35 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:35 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:35 INFO - ++DOMWINDOW == 45 (0x11fe61400) [pid = 1063] [serial = 808] [outer = 0x133500c00] 16:58:35 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:35 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:35 INFO - ++DOMWINDOW == 46 (0x1334d4c00) [pid = 1063] [serial = 809] [outer = 0x133500c00] 16:58:35 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:36 INFO - --DOCSHELL 0x130928900 == 15 [pid = 1063] [id = 346] 16:58:36 INFO - --DOCSHELL 0x135548600 == 14 [pid = 1063] [id = 338] 16:58:36 INFO - --DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 339] 16:58:36 INFO - --DOMWINDOW == 45 (0x1209c4c00) [pid = 1063] [serial = 766] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:36 INFO - --DOMWINDOW == 44 (0x12c6b9400) [pid = 1063] [serial = 768] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 43 (0x12965a000) [pid = 1063] [serial = 779] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:36 INFO - --DOMWINDOW == 42 (0x12ceb3400) [pid = 1063] [serial = 781] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 41 (0x1351cc400) [pid = 1063] [serial = 770] [outer = 0x0] [url = about:blank] 16:58:36 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 16:58:36 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 16:58:36 INFO - --DOMWINDOW == 40 (0x129838400) [pid = 1063] [serial = 799] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 39 (0x1299ea800) [pid = 1063] [serial = 800] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 38 (0x11fe61400) [pid = 1063] [serial = 808] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 37 (0x129ac3c00) [pid = 1063] [serial = 802] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 36 (0x12b110800) [pid = 1063] [serial = 785] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 35 (0x12be25400) [pid = 1063] [serial = 787] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 34 (0x121763c00) [pid = 1063] [serial = 797] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 33 (0x12be25000) [pid = 1063] [serial = 788] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:36 INFO - --DOMWINDOW == 32 (0x12e3a4400) [pid = 1063] [serial = 791] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:36 INFO - --DOMWINDOW == 31 (0x12b0f8400) [pid = 1063] [serial = 784] [outer = 0x0] [url = about:blank] 16:58:36 INFO - --DOMWINDOW == 30 (0x12bbc3c00) [pid = 1063] [serial = 786] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446163110324] 16:58:36 INFO - --DOMWINDOW == 29 (0x129ac3400) [pid = 1063] [serial = 793] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446163110324] 16:58:36 INFO - --DOMWINDOW == 28 (0x130fb9000) [pid = 1063] [serial = 798] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 16:58:36 INFO - MEMORY STAT | vsize 3788MB | residentFast 398MB | heapAllocated 125MB 16:58:36 INFO - 193 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js | took 3412ms 16:58:36 INFO - ++DOCSHELL 0x12092ab00 == 14 [pid = 1063] [id = 348] 16:58:36 INFO - ++DOMWINDOW == 29 (0x120065800) [pid = 1063] [serial = 810] [outer = 0x0] 16:58:36 INFO - ++DOMWINDOW == 30 (0x120343c00) [pid = 1063] [serial = 811] [outer = 0x120065800] 16:58:37 INFO - 194 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js 16:58:37 INFO - ++DOCSHELL 0x12bb31600 == 15 [pid = 1063] [id = 349] 16:58:37 INFO - ++DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 812] [outer = 0x0] 16:58:37 INFO - ++DOMWINDOW == 32 (0x121747c00) [pid = 1063] [serial = 813] [outer = 0x120917c00] 16:58:37 INFO - ++DOCSHELL 0x12c6dce00 == 16 [pid = 1063] [id = 350] 16:58:37 INFO - ++DOMWINDOW == 33 (0x1216c6c00) [pid = 1063] [serial = 814] [outer = 0x0] 16:58:37 INFO - ++DOMWINDOW == 34 (0x1285cb800) [pid = 1063] [serial = 815] [outer = 0x1216c6c00] 16:58:37 INFO - ++DOMWINDOW == 35 (0x127b8b000) [pid = 1063] [serial = 816] [outer = 0x1216c6c00] 16:58:37 INFO - ++DOCSHELL 0x12d25b500 == 17 [pid = 1063] [id = 351] 16:58:37 INFO - ++DOMWINDOW == 36 (0x12ced0800) [pid = 1063] [serial = 817] [outer = 0x0] 16:58:37 INFO - ++DOMWINDOW == 37 (0x12cee8c00) [pid = 1063] [serial = 818] [outer = 0x12ced0800] 16:58:39 INFO - --DOCSHELL 0x12d4c0200 == 16 [pid = 1063] [id = 344] 16:58:39 INFO - --DOCSHELL 0x136a6fb00 == 15 [pid = 1063] [id = 347] 16:58:39 INFO - --DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 345] 16:58:39 INFO - --DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 343] 16:58:39 INFO - --DOCSHELL 0x12d25b500 == 12 [pid = 1063] [id = 351] 16:58:39 INFO - --DOCSHELL 0x121646100 == 11 [pid = 1063] [id = 342] 16:58:39 INFO - --DOMWINDOW == 36 (0x12ea9a400) [pid = 1063] [serial = 792] [outer = 0x0] [url = about:blank] 16:58:39 INFO - --DOMWINDOW == 35 (0x12c777800) [pid = 1063] [serial = 790] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:39 INFO - --DOMWINDOW == 34 (0x1334d4c00) [pid = 1063] [serial = 809] [outer = 0x0] [url = http://example.com/] 16:58:39 INFO - --DOMWINDOW == 33 (0x120065400) [pid = 1063] [serial = 795] [outer = 0x0] [url = about:blank] 16:58:39 INFO - --DOMWINDOW == 32 (0x1285cb800) [pid = 1063] [serial = 815] [outer = 0x0] [url = about:blank] 16:58:39 INFO - --DOMWINDOW == 31 (0x121763000) [pid = 1063] [serial = 801] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:39 INFO - --DOMWINDOW == 30 (0x12df27c00) [pid = 1063] [serial = 804] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:39 INFO - --DOMWINDOW == 29 (0x133500c00) [pid = 1063] [serial = 807] [outer = 0x0] [url = http://example.com/] 16:58:39 INFO - --DOMWINDOW == 28 (0x120996c00) [pid = 1063] [serial = 796] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 16:58:39 INFO - --DOMWINDOW == 27 (0x11fadc400) [pid = 1063] [serial = 794] [outer = 0x0] [url = about:blank] 16:58:39 INFO - --DOMWINDOW == 26 (0x1334d4800) [pid = 1063] [serial = 806] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 16:58:39 INFO - MEMORY STAT | vsize 3789MB | residentFast 400MB | heapAllocated 124MB 16:58:39 INFO - 195 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js | took 2308ms 16:58:39 INFO - ++DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 352] 16:58:39 INFO - ++DOMWINDOW == 27 (0x11fadc400) [pid = 1063] [serial = 819] [outer = 0x0] 16:58:39 INFO - ++DOMWINDOW == 28 (0x120065400) [pid = 1063] [serial = 820] [outer = 0x11fadc400] 16:58:39 INFO - 196 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js 16:58:39 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 353] 16:58:39 INFO - ++DOMWINDOW == 29 (0x1200e3000) [pid = 1063] [serial = 821] [outer = 0x0] 16:58:39 INFO - ++DOMWINDOW == 30 (0x1209c4c00) [pid = 1063] [serial = 822] [outer = 0x1200e3000] 16:58:39 INFO - ++DOCSHELL 0x12bb2f300 == 14 [pid = 1063] [id = 354] 16:58:39 INFO - ++DOMWINDOW == 31 (0x120996c00) [pid = 1063] [serial = 823] [outer = 0x0] 16:58:39 INFO - ++DOMWINDOW == 32 (0x1285cb800) [pid = 1063] [serial = 824] [outer = 0x120996c00] 16:58:39 INFO - ++DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 825] [outer = 0x120996c00] 16:58:39 INFO - ++DOCSHELL 0x12c822e00 == 15 [pid = 1063] [id = 355] 16:58:39 INFO - ++DOMWINDOW == 34 (0x130ffb000) [pid = 1063] [serial = 826] [outer = 0x0] 16:58:39 INFO - ++DOMWINDOW == 35 (0x131636800) [pid = 1063] [serial = 827] [outer = 0x130ffb000] 16:58:40 INFO - ++DOMWINDOW == 36 (0x127f0bc00) [pid = 1063] [serial = 828] [outer = 0x1200e3000] 16:58:40 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:41 INFO - console.log: 16:58:40.769 GET http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html [HTTP/1.1 200 OK 22ms] 16:58:41 INFO - 16:58:40.921 Content Security Policy: The page's settings blocked the loading of a resource at http://some.example.com/test.png ("img-src http://example.com").1 16:58:41 INFO - 16:58:40.922 GET http://some.example.com/test_bug_1010953_cspro.js [14ms] 16:58:41 INFO - 16:58:40.924 Content Security Policy: The page's settings observed the loading of a resource at http://some.example.com/test_bug_1010953_cspro.js ("script-src http://example.com"). A CSP report is being sent.1 16:58:41 INFO - 16:58:40.952 POST https://example.com/ignored/ [HTTP/1.1 200 Connected 205ms] 16:58:41 INFO - --DOCSHELL 0x12c6dce00 == 14 [pid = 1063] [id = 350] 16:58:41 INFO - --DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 349] 16:58:41 INFO - --DOCSHELL 0x12c822e00 == 12 [pid = 1063] [id = 355] 16:58:41 INFO - --DOCSHELL 0x12092ab00 == 11 [pid = 1063] [id = 348] 16:58:42 INFO - --DOMWINDOW == 35 (0x12df59800) [pid = 1063] [serial = 805] [outer = 0x0] [url = about:blank] 16:58:42 INFO - --DOMWINDOW == 34 (0x129ac3000) [pid = 1063] [serial = 803] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:42 INFO - --DOMWINDOW == 33 (0x121747c00) [pid = 1063] [serial = 813] [outer = 0x0] [url = about:blank] 16:58:42 INFO - --DOMWINDOW == 32 (0x120343c00) [pid = 1063] [serial = 811] [outer = 0x0] [url = about:blank] 16:58:42 INFO - --DOMWINDOW == 31 (0x1285cb800) [pid = 1063] [serial = 824] [outer = 0x0] [url = about:blank] 16:58:42 INFO - --DOMWINDOW == 30 (0x1216c6c00) [pid = 1063] [serial = 814] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:42 INFO - --DOMWINDOW == 29 (0x12ced0800) [pid = 1063] [serial = 817] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:42 INFO - --DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 812] [outer = 0x0] [url = data:text/html;charset=utf8,Test%20for%20Bug%201006027] 16:58:42 INFO - --DOMWINDOW == 27 (0x120065800) [pid = 1063] [serial = 810] [outer = 0x0] [url = about:blank] 16:58:42 INFO - MEMORY STAT | vsize 3790MB | residentFast 399MB | heapAllocated 124MB 16:58:42 INFO - 197 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js | took 2831ms 16:58:42 INFO - ++DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 356] 16:58:42 INFO - ++DOMWINDOW == 28 (0x120343c00) [pid = 1063] [serial = 829] [outer = 0x0] 16:58:42 INFO - ++DOMWINDOW == 29 (0x120917c00) [pid = 1063] [serial = 830] [outer = 0x120343c00] 16:58:42 INFO - 198 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js 16:58:42 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 357] 16:58:42 INFO - ++DOMWINDOW == 30 (0x121763c00) [pid = 1063] [serial = 831] [outer = 0x0] 16:58:42 INFO - ++DOMWINDOW == 31 (0x128501c00) [pid = 1063] [serial = 832] [outer = 0x121763c00] 16:58:42 INFO - ++DOMWINDOW == 32 (0x129904400) [pid = 1063] [serial = 833] [outer = 0x121763c00] 16:58:42 INFO - ++DOCSHELL 0x12cb89100 == 14 [pid = 1063] [id = 358] 16:58:42 INFO - ++DOMWINDOW == 33 (0x126671000) [pid = 1063] [serial = 834] [outer = 0x0] 16:58:42 INFO - ++DOMWINDOW == 34 (0x1284e0400) [pid = 1063] [serial = 835] [outer = 0x126671000] 16:58:42 INFO - ++DOMWINDOW == 35 (0x12ae21400) [pid = 1063] [serial = 836] [outer = 0x126671000] 16:58:42 INFO - ++DOCSHELL 0x130928400 == 15 [pid = 1063] [id = 359] 16:58:42 INFO - ++DOMWINDOW == 36 (0x1334d1000) [pid = 1063] [serial = 837] [outer = 0x0] 16:58:42 INFO - ++DOMWINDOW == 37 (0x1334d7000) [pid = 1063] [serial = 838] [outer = 0x1334d1000] 16:58:43 INFO - ++DOCSHELL 0x135284500 == 16 [pid = 1063] [id = 360] 16:58:43 INFO - ++DOMWINDOW == 38 (0x133553800) [pid = 1063] [serial = 839] [outer = 0x0] 16:58:43 INFO - ++DOMWINDOW == 39 (0x1335ff400) [pid = 1063] [serial = 840] [outer = 0x133553800] 16:58:44 INFO - console.warn: notDebuggee: cannot access the environment of this function. 16:58:44 INFO - ++DOCSHELL 0x13674c800 == 17 [pid = 1063] [id = 361] 16:58:44 INFO - ++DOMWINDOW == 40 (0x134862400) [pid = 1063] [serial = 841] [outer = 0x0] 16:58:44 INFO - ++DOMWINDOW == 41 (0x134862c00) [pid = 1063] [serial = 842] [outer = 0x134862400] 16:58:44 INFO - ++DOCSHELL 0x1355f2400 == 18 [pid = 1063] [id = 362] 16:58:44 INFO - ++DOMWINDOW == 42 (0x137f6d800) [pid = 1063] [serial = 843] [outer = 0x0] 16:58:44 INFO - ++DOMWINDOW == 43 (0x13628a000) [pid = 1063] [serial = 844] [outer = 0x137f6d800] 16:58:45 INFO - --DOCSHELL 0x12bb2f300 == 17 [pid = 1063] [id = 354] 16:58:45 INFO - --DOCSHELL 0x129f99400 == 16 [pid = 1063] [id = 353] 16:58:45 INFO - --DOCSHELL 0x1201b0200 == 15 [pid = 1063] [id = 352] 16:58:45 INFO - --DOCSHELL 0x130928400 == 14 [pid = 1063] [id = 359] 16:58:45 INFO - --DOCSHELL 0x135284500 == 13 [pid = 1063] [id = 360] 16:58:45 INFO - --DOCSHELL 0x13674c800 == 12 [pid = 1063] [id = 361] 16:58:45 INFO - --DOCSHELL 0x1355f2400 == 11 [pid = 1063] [id = 362] 16:58:45 INFO - --DOMWINDOW == 42 (0x12cee8c00) [pid = 1063] [serial = 818] [outer = 0x0] [url = about:blank] 16:58:45 INFO - --DOMWINDOW == 41 (0x127b8b000) [pid = 1063] [serial = 816] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:46 INFO - --DOMWINDOW == 40 (0x1200e3000) [pid = 1063] [serial = 821] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 16:58:46 INFO - --DOMWINDOW == 39 (0x11fadc400) [pid = 1063] [serial = 819] [outer = 0x0] [url = about:blank] 16:58:46 INFO - --DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 832] [outer = 0x0] [url = about:blank] 16:58:46 INFO - --DOMWINDOW == 37 (0x1209c4c00) [pid = 1063] [serial = 822] [outer = 0x0] [url = about:blank] 16:58:46 INFO - --DOMWINDOW == 36 (0x120065400) [pid = 1063] [serial = 820] [outer = 0x0] [url = about:blank] 16:58:46 INFO - --DOMWINDOW == 35 (0x1284e0400) [pid = 1063] [serial = 835] [outer = 0x0] [url = about:blank] 16:58:46 INFO - --DOMWINDOW == 34 (0x130ffb000) [pid = 1063] [serial = 826] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:46 INFO - --DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 823] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:46 INFO - --DOMWINDOW == 32 (0x127f0bc00) [pid = 1063] [serial = 828] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 16:58:46 INFO - MEMORY STAT | vsize 3788MB | residentFast 402MB | heapAllocated 127MB 16:58:46 INFO - 199 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js | took 3739ms 16:58:46 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 363] 16:58:46 INFO - ++DOMWINDOW == 33 (0x11fa56000) [pid = 1063] [serial = 845] [outer = 0x0] 16:58:46 INFO - ++DOMWINDOW == 34 (0x120065400) [pid = 1063] [serial = 846] [outer = 0x11fa56000] 16:58:46 INFO - 200 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js 16:58:46 INFO - ++DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 364] 16:58:46 INFO - ++DOMWINDOW == 35 (0x11fe61400) [pid = 1063] [serial = 847] [outer = 0x0] 16:58:46 INFO - ++DOMWINDOW == 36 (0x120541800) [pid = 1063] [serial = 848] [outer = 0x11fe61400] 16:58:46 INFO - ++DOMWINDOW == 37 (0x121747c00) [pid = 1063] [serial = 849] [outer = 0x11fe61400] 16:58:46 INFO - ++DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 365] 16:58:46 INFO - ++DOMWINDOW == 38 (0x120343400) [pid = 1063] [serial = 850] [outer = 0x0] 16:58:46 INFO - ++DOMWINDOW == 39 (0x127274800) [pid = 1063] [serial = 851] [outer = 0x120343400] 16:58:46 INFO - ++DOMWINDOW == 40 (0x121ddb400) [pid = 1063] [serial = 852] [outer = 0x120343400] 16:58:46 INFO - ++DOCSHELL 0x12cb89b00 == 15 [pid = 1063] [id = 366] 16:58:46 INFO - ++DOMWINDOW == 41 (0x130b42800) [pid = 1063] [serial = 853] [outer = 0x0] 16:58:46 INFO - ++DOMWINDOW == 42 (0x130e8b400) [pid = 1063] [serial = 854] [outer = 0x130b42800] 16:58:48 INFO - --DOCSHELL 0x12c6dba00 == 14 [pid = 1063] [id = 357] 16:58:48 INFO - --DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 356] 16:58:48 INFO - --DOCSHELL 0x12cb89b00 == 12 [pid = 1063] [id = 366] 16:58:48 INFO - --DOCSHELL 0x12cb89100 == 11 [pid = 1063] [id = 358] 16:58:48 INFO - --DOMWINDOW == 41 (0x131636800) [pid = 1063] [serial = 827] [outer = 0x0] [url = about:blank] 16:58:48 INFO - --DOMWINDOW == 40 (0x12963d000) [pid = 1063] [serial = 825] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:48 INFO - --DOMWINDOW == 39 (0x134862400) [pid = 1063] [serial = 841] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 16:58:48 INFO - --DOMWINDOW == 38 (0x137f6d800) [pid = 1063] [serial = 843] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 16:58:48 INFO - --DOMWINDOW == 37 (0x133553800) [pid = 1063] [serial = 839] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:58:48 INFO - --DOMWINDOW == 36 (0x120541800) [pid = 1063] [serial = 848] [outer = 0x0] [url = about:blank] 16:58:48 INFO - --DOMWINDOW == 35 (0x120917c00) [pid = 1063] [serial = 830] [outer = 0x0] [url = about:blank] 16:58:48 INFO - --DOMWINDOW == 34 (0x127274800) [pid = 1063] [serial = 851] [outer = 0x0] [url = about:blank] 16:58:48 INFO - --DOMWINDOW == 33 (0x126671000) [pid = 1063] [serial = 834] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:48 INFO - --DOMWINDOW == 32 (0x1334d1000) [pid = 1063] [serial = 837] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:48 INFO - --DOMWINDOW == 31 (0x121763c00) [pid = 1063] [serial = 831] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 16:58:48 INFO - --DOMWINDOW == 30 (0x120343c00) [pid = 1063] [serial = 829] [outer = 0x0] [url = about:blank] 16:58:48 INFO - --DOMWINDOW == 29 (0x129904400) [pid = 1063] [serial = 833] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 16:58:48 INFO - MEMORY STAT | vsize 3790MB | residentFast 402MB | heapAllocated 127MB 16:58:48 INFO - 201 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js | took 2457ms 16:58:48 INFO - ++DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 367] 16:58:48 INFO - ++DOMWINDOW == 30 (0x120917c00) [pid = 1063] [serial = 855] [outer = 0x0] 16:58:48 INFO - ++DOMWINDOW == 31 (0x121763c00) [pid = 1063] [serial = 856] [outer = 0x120917c00] 16:58:48 INFO - 202 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js 16:58:48 INFO - ++DOCSHELL 0x12c6dc900 == 13 [pid = 1063] [id = 368] 16:58:48 INFO - ++DOMWINDOW == 32 (0x127b8b000) [pid = 1063] [serial = 857] [outer = 0x0] 16:58:48 INFO - ++DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 858] [outer = 0x127b8b000] 16:58:49 INFO - ++DOMWINDOW == 34 (0x136211c00) [pid = 1063] [serial = 859] [outer = 0x127b8b000] 16:58:49 INFO - ++DOCSHELL 0x12cb89100 == 14 [pid = 1063] [id = 369] 16:58:49 INFO - ++DOMWINDOW == 35 (0x12965a000) [pid = 1063] [serial = 860] [outer = 0x0] 16:58:49 INFO - ++DOMWINDOW == 36 (0x1299ab000) [pid = 1063] [serial = 861] [outer = 0x12965a000] 16:58:49 INFO - ++DOMWINDOW == 37 (0x1284e0400) [pid = 1063] [serial = 862] [outer = 0x12965a000] 16:58:49 INFO - ++DOCSHELL 0x130928400 == 15 [pid = 1063] [id = 370] 16:58:49 INFO - ++DOMWINDOW == 38 (0x1333da800) [pid = 1063] [serial = 863] [outer = 0x0] 16:58:49 INFO - ++DOMWINDOW == 39 (0x1333dac00) [pid = 1063] [serial = 864] [outer = 0x1333da800] 16:58:51 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 363] 16:58:51 INFO - --DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 364] 16:58:51 INFO - --DOCSHELL 0x130928400 == 12 [pid = 1063] [id = 370] 16:58:51 INFO - --DOCSHELL 0x129ea8100 == 11 [pid = 1063] [id = 365] 16:58:51 INFO - --DOMWINDOW == 38 (0x134862c00) [pid = 1063] [serial = 842] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 37 (0x1334d7000) [pid = 1063] [serial = 838] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 36 (0x12ae21400) [pid = 1063] [serial = 836] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:51 INFO - --DOMWINDOW == 35 (0x1335ff400) [pid = 1063] [serial = 840] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 16:58:51 INFO - --DOMWINDOW == 34 (0x13628a000) [pid = 1063] [serial = 844] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 16:58:51 INFO - --DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 858] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 32 (0x120065400) [pid = 1063] [serial = 846] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 31 (0x1299ab000) [pid = 1063] [serial = 861] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 30 (0x130b42800) [pid = 1063] [serial = 853] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:51 INFO - --DOMWINDOW == 29 (0x120343400) [pid = 1063] [serial = 850] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:51 INFO - --DOMWINDOW == 28 (0x11fe61400) [pid = 1063] [serial = 847] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:51 INFO - --DOMWINDOW == 27 (0x11fa56000) [pid = 1063] [serial = 845] [outer = 0x0] [url = about:blank] 16:58:51 INFO - --DOMWINDOW == 26 (0x121747c00) [pid = 1063] [serial = 849] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:51 INFO - MEMORY STAT | vsize 3789MB | residentFast 401MB | heapAllocated 126MB 16:58:51 INFO - 203 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js | took 2403ms 16:58:51 INFO - ++DOCSHELL 0x121c8e900 == 12 [pid = 1063] [id = 371] 16:58:51 INFO - ++DOMWINDOW == 27 (0x120541800) [pid = 1063] [serial = 865] [outer = 0x0] 16:58:51 INFO - ++DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 866] [outer = 0x120541800] 16:58:51 INFO - 204 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js 16:58:51 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 372] 16:58:51 INFO - ++DOMWINDOW == 29 (0x127f0bc00) [pid = 1063] [serial = 867] [outer = 0x0] 16:58:51 INFO - ++DOMWINDOW == 30 (0x12963d400) [pid = 1063] [serial = 868] [outer = 0x127f0bc00] 16:58:51 INFO - ++DOMWINDOW == 31 (0x12a178000) [pid = 1063] [serial = 869] [outer = 0x127f0bc00] 16:58:51 INFO - ++DOCSHELL 0x12d25ba00 == 14 [pid = 1063] [id = 373] 16:58:51 INFO - ++DOMWINDOW == 32 (0x127f96400) [pid = 1063] [serial = 870] [outer = 0x0] 16:58:51 INFO - ++DOMWINDOW == 33 (0x1285cb800) [pid = 1063] [serial = 871] [outer = 0x127f96400] 16:58:51 INFO - ++DOMWINDOW == 34 (0x11f4c0000) [pid = 1063] [serial = 872] [outer = 0x127f96400] 16:58:51 INFO - ++DOCSHELL 0x130927000 == 15 [pid = 1063] [id = 374] 16:58:51 INFO - ++DOMWINDOW == 35 (0x1333b6c00) [pid = 1063] [serial = 873] [outer = 0x0] 16:58:51 INFO - ++DOMWINDOW == 36 (0x1333da400) [pid = 1063] [serial = 874] [outer = 0x1333b6c00] 16:58:52 INFO - ++DOMWINDOW == 37 (0x1355b4800) [pid = 1063] [serial = 875] [outer = 0x127f0bc00] 16:58:52 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:53 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 16:58:53 INFO - --DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 367] 16:58:53 INFO - --DOCSHELL 0x130927000 == 13 [pid = 1063] [id = 374] 16:58:53 INFO - --DOCSHELL 0x12c6dc900 == 12 [pid = 1063] [id = 368] 16:58:53 INFO - --DOCSHELL 0x12cb89100 == 11 [pid = 1063] [id = 369] 16:58:53 INFO - --DOMWINDOW == 36 (0x130e8b400) [pid = 1063] [serial = 854] [outer = 0x0] [url = about:blank] 16:58:53 INFO - --DOMWINDOW == 35 (0x121ddb400) [pid = 1063] [serial = 852] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:53 INFO - --DOMWINDOW == 34 (0x12963d400) [pid = 1063] [serial = 868] [outer = 0x0] [url = about:blank] 16:58:53 INFO - --DOMWINDOW == 33 (0x121763c00) [pid = 1063] [serial = 856] [outer = 0x0] [url = about:blank] 16:58:53 INFO - --DOMWINDOW == 32 (0x1285cb800) [pid = 1063] [serial = 871] [outer = 0x0] [url = about:blank] 16:58:53 INFO - --DOMWINDOW == 31 (0x12965a000) [pid = 1063] [serial = 860] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:53 INFO - --DOMWINDOW == 30 (0x1333da800) [pid = 1063] [serial = 863] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:53 INFO - --DOMWINDOW == 29 (0x127b8b000) [pid = 1063] [serial = 857] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:53 INFO - --DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 855] [outer = 0x0] [url = about:blank] 16:58:53 INFO - --DOMWINDOW == 27 (0x136211c00) [pid = 1063] [serial = 859] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:54 INFO - MEMORY STAT | vsize 3791MB | residentFast 402MB | heapAllocated 125MB 16:58:54 INFO - 205 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js | took 2563ms 16:58:54 INFO - ++DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 375] 16:58:54 INFO - ++DOMWINDOW == 28 (0x12054bc00) [pid = 1063] [serial = 876] [outer = 0x0] 16:58:54 INFO - ++DOMWINDOW == 29 (0x1209c4c00) [pid = 1063] [serial = 877] [outer = 0x12054bc00] 16:58:54 INFO - 206 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js 16:58:54 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 376] 16:58:54 INFO - ++DOMWINDOW == 30 (0x11fa56000) [pid = 1063] [serial = 878] [outer = 0x0] 16:58:54 INFO - ++DOMWINDOW == 31 (0x127f4e800) [pid = 1063] [serial = 879] [outer = 0x11fa56000] 16:58:54 INFO - ++DOMWINDOW == 32 (0x130fb9000) [pid = 1063] [serial = 880] [outer = 0x11fa56000] 16:58:54 INFO - MEMORY STAT | vsize 3791MB | residentFast 402MB | heapAllocated 127MB 16:58:54 INFO - 207 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js | took 460ms 16:58:54 INFO - ++DOCSHELL 0x12d530100 == 14 [pid = 1063] [id = 377] 16:58:54 INFO - ++DOMWINDOW == 33 (0x12b0f8c00) [pid = 1063] [serial = 881] [outer = 0x0] 16:58:54 INFO - ++DOMWINDOW == 34 (0x12bba2c00) [pid = 1063] [serial = 882] [outer = 0x12b0f8c00] 16:58:54 INFO - 208 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js 16:58:54 INFO - ++DOCSHELL 0x13092ac00 == 15 [pid = 1063] [id = 378] 16:58:54 INFO - ++DOMWINDOW == 35 (0x12bf01c00) [pid = 1063] [serial = 883] [outer = 0x0] 16:58:54 INFO - ++DOMWINDOW == 36 (0x12c26d400) [pid = 1063] [serial = 884] [outer = 0x12bf01c00] 16:58:54 INFO - ++DOCSHELL 0x1334dea00 == 16 [pid = 1063] [id = 379] 16:58:54 INFO - ++DOMWINDOW == 37 (0x12019e400) [pid = 1063] [serial = 885] [outer = 0x0] 16:58:54 INFO - ++DOMWINDOW == 38 (0x12bff8400) [pid = 1063] [serial = 886] [outer = 0x12019e400] 16:58:55 INFO - ++DOMWINDOW == 39 (0x12a1e1400) [pid = 1063] [serial = 887] [outer = 0x12019e400] 16:58:55 INFO - ++DOCSHELL 0x1355f5b00 == 17 [pid = 1063] [id = 380] 16:58:55 INFO - ++DOMWINDOW == 40 (0x1353c5400) [pid = 1063] [serial = 888] [outer = 0x0] 16:58:55 INFO - ++DOMWINDOW == 41 (0x1353ce000) [pid = 1063] [serial = 889] [outer = 0x1353c5400] 16:58:56 INFO - ++DOMWINDOW == 42 (0x12cf7d800) [pid = 1063] [serial = 890] [outer = 0x12bf01c00] 16:58:56 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:58:56 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html, line 17: ReferenceError: fooDuplicateError1 is not defined 16:58:57 INFO - --DOCSHELL 0x121c8e900 == 16 [pid = 1063] [id = 371] 16:58:57 INFO - --DOCSHELL 0x12c6dba00 == 15 [pid = 1063] [id = 372] 16:58:57 INFO - --DOCSHELL 0x12d25ba00 == 14 [pid = 1063] [id = 373] 16:58:57 INFO - --DOCSHELL 0x1355f5b00 == 13 [pid = 1063] [id = 380] 16:58:57 INFO - --DOMWINDOW == 41 (0x1333dac00) [pid = 1063] [serial = 864] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 40 (0x1284e0400) [pid = 1063] [serial = 862] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:57 INFO - --DOMWINDOW == 39 (0x12a178000) [pid = 1063] [serial = 869] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 16:58:57 INFO - --DOMWINDOW == 38 (0x127f4e800) [pid = 1063] [serial = 879] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 37 (0x1209c4c00) [pid = 1063] [serial = 877] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 866] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 35 (0x12bff8400) [pid = 1063] [serial = 886] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 34 (0x127f96400) [pid = 1063] [serial = 870] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:57 INFO - --DOMWINDOW == 33 (0x1333b6c00) [pid = 1063] [serial = 873] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:57 INFO - --DOMWINDOW == 32 (0x11fa56000) [pid = 1063] [serial = 878] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:57 INFO - --DOMWINDOW == 31 (0x12054bc00) [pid = 1063] [serial = 876] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 30 (0x120541800) [pid = 1063] [serial = 865] [outer = 0x0] [url = about:blank] 16:58:57 INFO - --DOMWINDOW == 29 (0x127f0bc00) [pid = 1063] [serial = 867] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 16:58:57 INFO - MEMORY STAT | vsize 3792MB | residentFast 403MB | heapAllocated 126MB 16:58:57 INFO - 209 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js | took 2594ms 16:58:57 INFO - ++DOCSHELL 0x12a05b800 == 14 [pid = 1063] [id = 381] 16:58:57 INFO - ++DOMWINDOW == 30 (0x120917c00) [pid = 1063] [serial = 891] [outer = 0x0] 16:58:57 INFO - ++DOMWINDOW == 31 (0x1216bac00) [pid = 1063] [serial = 892] [outer = 0x120917c00] 16:58:57 INFO - 210 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js 16:58:57 INFO - ++DOCSHELL 0x12c6ddd00 == 15 [pid = 1063] [id = 382] 16:58:57 INFO - ++DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 893] [outer = 0x0] 16:58:57 INFO - ++DOMWINDOW == 33 (0x127f0bc00) [pid = 1063] [serial = 894] [outer = 0x127274800] 16:58:57 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 895] [outer = 0x127274800] 16:58:57 INFO - ++DOCSHELL 0x12d25ba00 == 16 [pid = 1063] [id = 383] 16:58:57 INFO - ++DOMWINDOW == 35 (0x127bea800) [pid = 1063] [serial = 896] [outer = 0x0] 16:58:57 INFO - ++DOMWINDOW == 36 (0x1284e0400) [pid = 1063] [serial = 897] [outer = 0x127bea800] 16:58:57 INFO - ++DOMWINDOW == 37 (0x12963d000) [pid = 1063] [serial = 898] [outer = 0x127bea800] 16:58:58 INFO - ++DOCSHELL 0x130929d00 == 17 [pid = 1063] [id = 384] 16:58:58 INFO - ++DOMWINDOW == 38 (0x1333a2000) [pid = 1063] [serial = 899] [outer = 0x0] 16:58:58 INFO - ++DOMWINDOW == 39 (0x1333a2400) [pid = 1063] [serial = 900] [outer = 0x1333a2000] 16:58:59 INFO - --DOCSHELL 0x128ead000 == 16 [pid = 1063] [id = 375] 16:58:59 INFO - --DOCSHELL 0x12c6db500 == 15 [pid = 1063] [id = 376] 16:58:59 INFO - --DOCSHELL 0x12d530100 == 14 [pid = 1063] [id = 377] 16:58:59 INFO - --DOCSHELL 0x130929d00 == 13 [pid = 1063] [id = 384] 16:58:59 INFO - --DOCSHELL 0x13092ac00 == 12 [pid = 1063] [id = 378] 16:58:59 INFO - --DOCSHELL 0x1334dea00 == 11 [pid = 1063] [id = 379] 16:58:59 INFO - --DOMWINDOW == 38 (0x1333da400) [pid = 1063] [serial = 874] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 37 (0x11f4c0000) [pid = 1063] [serial = 872] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:59 INFO - --DOMWINDOW == 36 (0x1355b4800) [pid = 1063] [serial = 875] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 16:58:59 INFO - --DOMWINDOW == 35 (0x130fb9000) [pid = 1063] [serial = 880] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:58:59 INFO - --DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 894] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 33 (0x12c26d400) [pid = 1063] [serial = 884] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 32 (0x12bba2c00) [pid = 1063] [serial = 882] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 31 (0x1284e0400) [pid = 1063] [serial = 897] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 30 (0x1353c5400) [pid = 1063] [serial = 888] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:58:59 INFO - --DOMWINDOW == 29 (0x12019e400) [pid = 1063] [serial = 885] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:58:59 INFO - --DOMWINDOW == 28 (0x12bf01c00) [pid = 1063] [serial = 883] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 16:58:59 INFO - --DOMWINDOW == 27 (0x12b0f8c00) [pid = 1063] [serial = 881] [outer = 0x0] [url = about:blank] 16:58:59 INFO - --DOMWINDOW == 26 (0x12cf7d800) [pid = 1063] [serial = 890] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 16:58:59 INFO - MEMORY STAT | vsize 3792MB | residentFast 400MB | heapAllocated 125MB 16:58:59 INFO - 211 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js | took 2450ms 16:58:59 INFO - ++DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 385] 16:58:59 INFO - ++DOMWINDOW == 27 (0x120343c00) [pid = 1063] [serial = 901] [outer = 0x0] 16:58:59 INFO - ++DOMWINDOW == 28 (0x1205f8400) [pid = 1063] [serial = 902] [outer = 0x120343c00] 16:59:00 INFO - 212 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js 16:59:00 INFO - ++DOCSHELL 0x12c6dce00 == 13 [pid = 1063] [id = 386] 16:59:00 INFO - ++DOMWINDOW == 29 (0x120996c00) [pid = 1063] [serial = 903] [outer = 0x0] 16:59:00 INFO - ++DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 904] [outer = 0x120996c00] 16:59:00 INFO - ++DOCSHELL 0x12c825600 == 14 [pid = 1063] [id = 387] 16:59:00 INFO - ++DOMWINDOW == 31 (0x126671000) [pid = 1063] [serial = 905] [outer = 0x0] 16:59:00 INFO - ++DOMWINDOW == 32 (0x128738000) [pid = 1063] [serial = 906] [outer = 0x126671000] 16:59:00 INFO - ++DOMWINDOW == 33 (0x1297a0800) [pid = 1063] [serial = 907] [outer = 0x126671000] 16:59:00 INFO - ++DOCSHELL 0x12d4c1100 == 15 [pid = 1063] [id = 388] 16:59:00 INFO - ++DOMWINDOW == 34 (0x131a86000) [pid = 1063] [serial = 908] [outer = 0x0] 16:59:00 INFO - ++DOMWINDOW == 35 (0x131b3ec00) [pid = 1063] [serial = 909] [outer = 0x131a86000] 16:59:02 INFO - --DOCSHELL 0x12a05b800 == 14 [pid = 1063] [id = 381] 16:59:02 INFO - --DOCSHELL 0x12c6ddd00 == 13 [pid = 1063] [id = 382] 16:59:02 INFO - --DOCSHELL 0x12d25ba00 == 12 [pid = 1063] [id = 383] 16:59:02 INFO - --DOCSHELL 0x12d4c1100 == 11 [pid = 1063] [id = 388] 16:59:02 INFO - --DOMWINDOW == 34 (0x1353ce000) [pid = 1063] [serial = 889] [outer = 0x0] [url = about:blank] 16:59:02 INFO - --DOMWINDOW == 33 (0x12a1e1400) [pid = 1063] [serial = 887] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:02 INFO - --DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 893] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 16:59:02 INFO - --DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 891] [outer = 0x0] [url = about:blank] 16:59:02 INFO - --DOMWINDOW == 30 (0x128e94000) [pid = 1063] [serial = 895] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 16:59:02 INFO - --DOMWINDOW == 29 (0x1216bac00) [pid = 1063] [serial = 892] [outer = 0x0] [url = about:blank] 16:59:02 INFO - --DOMWINDOW == 28 (0x128738000) [pid = 1063] [serial = 906] [outer = 0x0] [url = about:blank] 16:59:02 INFO - --DOMWINDOW == 27 (0x1333a2000) [pid = 1063] [serial = 899] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:02 INFO - --DOMWINDOW == 26 (0x127bea800) [pid = 1063] [serial = 896] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:02 INFO - MEMORY STAT | vsize 3791MB | residentFast 401MB | heapAllocated 125MB 16:59:02 INFO - 213 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js | took 2730ms 16:59:02 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 389] 16:59:02 INFO - ++DOMWINDOW == 27 (0x120343400) [pid = 1063] [serial = 910] [outer = 0x0] 16:59:02 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 911] [outer = 0x120343400] 16:59:02 INFO - 214 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js 16:59:02 INFO - ++DOCSHELL 0x12c6db000 == 13 [pid = 1063] [id = 390] 16:59:02 INFO - ++DOMWINDOW == 29 (0x121763c00) [pid = 1063] [serial = 912] [outer = 0x0] 16:59:02 INFO - ++DOMWINDOW == 30 (0x127bea800) [pid = 1063] [serial = 913] [outer = 0x121763c00] 16:59:03 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 391] 16:59:03 INFO - ++DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 914] [outer = 0x0] 16:59:03 INFO - ++DOMWINDOW == 32 (0x1299ab000) [pid = 1063] [serial = 915] [outer = 0x127274800] 16:59:03 INFO - ++DOMWINDOW == 33 (0x129e8d000) [pid = 1063] [serial = 916] [outer = 0x127274800] 16:59:03 INFO - ++DOCSHELL 0x12d25b500 == 15 [pid = 1063] [id = 392] 16:59:03 INFO - ++DOMWINDOW == 34 (0x1332aec00) [pid = 1063] [serial = 917] [outer = 0x0] 16:59:03 INFO - ++DOMWINDOW == 35 (0x133355000) [pid = 1063] [serial = 918] [outer = 0x1332aec00] 16:59:04 INFO - ++DOMWINDOW == 36 (0x1309c1000) [pid = 1063] [serial = 919] [outer = 0x121763c00] 16:59:04 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:05 INFO - --DOCSHELL 0x12c6dce00 == 14 [pid = 1063] [id = 386] 16:59:05 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 385] 16:59:05 INFO - --DOCSHELL 0x12c825600 == 12 [pid = 1063] [id = 387] 16:59:05 INFO - --DOCSHELL 0x12d25b500 == 11 [pid = 1063] [id = 392] 16:59:05 INFO - --DOMWINDOW == 35 (0x1333a2400) [pid = 1063] [serial = 900] [outer = 0x0] [url = about:blank] 16:59:05 INFO - --DOMWINDOW == 34 (0x12963d000) [pid = 1063] [serial = 898] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:05 INFO - --DOMWINDOW == 33 (0x127b8b000) [pid = 1063] [serial = 904] [outer = 0x0] [url = about:blank] 16:59:05 INFO - --DOMWINDOW == 32 (0x1205f8400) [pid = 1063] [serial = 902] [outer = 0x0] [url = about:blank] 16:59:05 INFO - --DOMWINDOW == 31 (0x1299ab000) [pid = 1063] [serial = 915] [outer = 0x0] [url = about:blank] 16:59:05 INFO - --DOMWINDOW == 30 (0x126671000) [pid = 1063] [serial = 905] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:05 INFO - --DOMWINDOW == 29 (0x131a86000) [pid = 1063] [serial = 908] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:05 INFO - --DOMWINDOW == 28 (0x120996c00) [pid = 1063] [serial = 903] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20bug%20585237] 16:59:05 INFO - --DOMWINDOW == 27 (0x120343c00) [pid = 1063] [serial = 901] [outer = 0x0] [url = about:blank] 16:59:05 INFO - MEMORY STAT | vsize 3791MB | residentFast 401MB | heapAllocated 125MB 16:59:05 INFO - 215 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js | took 2439ms 16:59:05 INFO - ++DOCSHELL 0x12bb2da00 == 12 [pid = 1063] [id = 393] 16:59:05 INFO - ++DOMWINDOW == 28 (0x120996c00) [pid = 1063] [serial = 920] [outer = 0x0] 16:59:05 INFO - ++DOMWINDOW == 29 (0x121cbac00) [pid = 1063] [serial = 921] [outer = 0x120996c00] 16:59:05 INFO - 216 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js 16:59:05 INFO - ++DOCSHELL 0x12c6de200 == 13 [pid = 1063] [id = 394] 16:59:05 INFO - ++DOMWINDOW == 30 (0x127f0bc00) [pid = 1063] [serial = 922] [outer = 0x0] 16:59:05 INFO - ++DOMWINDOW == 31 (0x128d3a400) [pid = 1063] [serial = 923] [outer = 0x127f0bc00] 16:59:05 INFO - ++DOCSHELL 0x12cb89b00 == 14 [pid = 1063] [id = 395] 16:59:05 INFO - ++DOMWINDOW == 32 (0x128738000) [pid = 1063] [serial = 924] [outer = 0x0] 16:59:05 INFO - ++DOMWINDOW == 33 (0x12a1e1400) [pid = 1063] [serial = 925] [outer = 0x128738000] 16:59:05 INFO - ++DOMWINDOW == 34 (0x12a178000) [pid = 1063] [serial = 926] [outer = 0x128738000] 16:59:05 INFO - ++DOCSHELL 0x130928400 == 15 [pid = 1063] [id = 396] 16:59:05 INFO - ++DOMWINDOW == 35 (0x1334d1000) [pid = 1063] [serial = 927] [outer = 0x0] 16:59:05 INFO - ++DOMWINDOW == 36 (0x1334d2c00) [pid = 1063] [serial = 928] [outer = 0x1334d1000] 16:59:08 INFO - --DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 391] 16:59:08 INFO - --DOCSHELL 0x121c23e00 == 13 [pid = 1063] [id = 389] 16:59:08 INFO - --DOCSHELL 0x12c6db000 == 12 [pid = 1063] [id = 390] 16:59:08 INFO - --DOCSHELL 0x130928400 == 11 [pid = 1063] [id = 396] 16:59:08 INFO - --DOMWINDOW == 35 (0x131b3ec00) [pid = 1063] [serial = 909] [outer = 0x0] [url = about:blank] 16:59:08 INFO - --DOMWINDOW == 34 (0x1297a0800) [pid = 1063] [serial = 907] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:08 INFO - --DOMWINDOW == 33 (0x120343400) [pid = 1063] [serial = 910] [outer = 0x0] [url = about:blank] 16:59:08 INFO - --DOMWINDOW == 32 (0x127bea800) [pid = 1063] [serial = 913] [outer = 0x0] [url = about:blank] 16:59:08 INFO - --DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 911] [outer = 0x0] [url = about:blank] 16:59:08 INFO - --DOMWINDOW == 30 (0x12a1e1400) [pid = 1063] [serial = 925] [outer = 0x0] [url = about:blank] 16:59:08 INFO - --DOMWINDOW == 29 (0x1332aec00) [pid = 1063] [serial = 917] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:08 INFO - --DOMWINDOW == 28 (0x127274800) [pid = 1063] [serial = 914] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:08 INFO - --DOMWINDOW == 27 (0x121763c00) [pid = 1063] [serial = 912] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 16:59:08 INFO - --DOMWINDOW == 26 (0x1309c1000) [pid = 1063] [serial = 919] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 16:59:08 INFO - MEMORY STAT | vsize 3791MB | residentFast 399MB | heapAllocated 125MB 16:59:08 INFO - 217 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js | took 3409ms 16:59:08 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 397] 16:59:08 INFO - ++DOMWINDOW == 27 (0x120065800) [pid = 1063] [serial = 929] [outer = 0x0] 16:59:08 INFO - ++DOMWINDOW == 28 (0x12031e800) [pid = 1063] [serial = 930] [outer = 0x120065800] 16:59:09 INFO - 218 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js 16:59:09 INFO - ++DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 398] 16:59:09 INFO - ++DOMWINDOW == 29 (0x12054bc00) [pid = 1063] [serial = 931] [outer = 0x0] 16:59:09 INFO - ++DOMWINDOW == 30 (0x1216bac00) [pid = 1063] [serial = 932] [outer = 0x12054bc00] 16:59:09 INFO - ++DOCSHELL 0x12c6dbf00 == 14 [pid = 1063] [id = 399] 16:59:09 INFO - ++DOMWINDOW == 31 (0x1209c4c00) [pid = 1063] [serial = 933] [outer = 0x0] 16:59:09 INFO - ++DOMWINDOW == 32 (0x126671000) [pid = 1063] [serial = 934] [outer = 0x1209c4c00] 16:59:09 INFO - ++DOMWINDOW == 33 (0x127f4e800) [pid = 1063] [serial = 935] [outer = 0x1209c4c00] 16:59:09 INFO - ++DOCSHELL 0x12d4c0200 == 15 [pid = 1063] [id = 400] 16:59:09 INFO - ++DOMWINDOW == 34 (0x131b8dc00) [pid = 1063] [serial = 936] [outer = 0x0] 16:59:09 INFO - ++DOMWINDOW == 35 (0x131bc1400) [pid = 1063] [serial = 937] [outer = 0x131b8dc00] 16:59:11 INFO - --DOCSHELL 0x12c6de200 == 14 [pid = 1063] [id = 394] 16:59:11 INFO - --DOCSHELL 0x12d4c0200 == 13 [pid = 1063] [id = 400] 16:59:11 INFO - --DOCSHELL 0x12bb2da00 == 12 [pid = 1063] [id = 393] 16:59:11 INFO - --DOCSHELL 0x12cb89b00 == 11 [pid = 1063] [id = 395] 16:59:11 INFO - --DOMWINDOW == 34 (0x133355000) [pid = 1063] [serial = 918] [outer = 0x0] [url = about:blank] 16:59:11 INFO - --DOMWINDOW == 33 (0x129e8d000) [pid = 1063] [serial = 916] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:11 INFO - --DOMWINDOW == 32 (0x128d3a400) [pid = 1063] [serial = 923] [outer = 0x0] [url = about:blank] 16:59:11 INFO - --DOMWINDOW == 31 (0x121cbac00) [pid = 1063] [serial = 921] [outer = 0x0] [url = about:blank] 16:59:11 INFO - --DOMWINDOW == 30 (0x126671000) [pid = 1063] [serial = 934] [outer = 0x0] [url = about:blank] 16:59:11 INFO - --DOMWINDOW == 29 (0x128738000) [pid = 1063] [serial = 924] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:11 INFO - --DOMWINDOW == 28 (0x1334d1000) [pid = 1063] [serial = 927] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:11 INFO - --DOMWINDOW == 27 (0x127f0bc00) [pid = 1063] [serial = 922] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20keyboard%20usage%20test] 16:59:11 INFO - --DOMWINDOW == 26 (0x120996c00) [pid = 1063] [serial = 920] [outer = 0x0] [url = about:blank] 16:59:11 INFO - MEMORY STAT | vsize 3788MB | residentFast 400MB | heapAllocated 125MB 16:59:11 INFO - 219 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js | took 2319ms 16:59:11 INFO - ++DOCSHELL 0x121646100 == 12 [pid = 1063] [id = 401] 16:59:11 INFO - ++DOMWINDOW == 27 (0x120343c00) [pid = 1063] [serial = 938] [outer = 0x0] 16:59:11 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 939] [outer = 0x120343c00] 16:59:11 INFO - 220 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js 16:59:11 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 402] 16:59:11 INFO - ++DOMWINDOW == 29 (0x120996c00) [pid = 1063] [serial = 940] [outer = 0x0] 16:59:11 INFO - ++DOMWINDOW == 30 (0x126671000) [pid = 1063] [serial = 941] [outer = 0x120996c00] 16:59:11 INFO - ++DOMWINDOW == 31 (0x128501c00) [pid = 1063] [serial = 942] [outer = 0x120996c00] 16:59:11 INFO - ++DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 403] 16:59:11 INFO - ++DOMWINDOW == 32 (0x121cbac00) [pid = 1063] [serial = 943] [outer = 0x0] 16:59:11 INFO - ++DOMWINDOW == 33 (0x1299ab000) [pid = 1063] [serial = 944] [outer = 0x121cbac00] 16:59:12 INFO - ++DOMWINDOW == 34 (0x11fe61400) [pid = 1063] [serial = 945] [outer = 0x121cbac00] 16:59:12 INFO - ++DOCSHELL 0x12ea32700 == 15 [pid = 1063] [id = 404] 16:59:12 INFO - ++DOMWINDOW == 35 (0x12a03bc00) [pid = 1063] [serial = 946] [outer = 0x0] 16:59:12 INFO - ++DOMWINDOW == 36 (0x12a0bf000) [pid = 1063] [serial = 947] [outer = 0x12a03bc00] 16:59:13 INFO - --DOCSHELL 0x12c6dc400 == 14 [pid = 1063] [id = 398] 16:59:13 INFO - --DOCSHELL 0x12ea32700 == 13 [pid = 1063] [id = 404] 16:59:13 INFO - --DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 397] 16:59:13 INFO - --DOCSHELL 0x12c6dbf00 == 11 [pid = 1063] [id = 399] 16:59:13 INFO - --DOMWINDOW == 35 (0x1334d2c00) [pid = 1063] [serial = 928] [outer = 0x0] [url = about:blank] 16:59:13 INFO - --DOMWINDOW == 34 (0x12a178000) [pid = 1063] [serial = 926] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:13 INFO - --DOMWINDOW == 33 (0x126671000) [pid = 1063] [serial = 941] [outer = 0x0] [url = about:blank] 16:59:13 INFO - --DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 932] [outer = 0x0] [url = about:blank] 16:59:13 INFO - --DOMWINDOW == 31 (0x12031e800) [pid = 1063] [serial = 930] [outer = 0x0] [url = about:blank] 16:59:13 INFO - --DOMWINDOW == 30 (0x1299ab000) [pid = 1063] [serial = 944] [outer = 0x0] [url = about:blank] 16:59:13 INFO - --DOMWINDOW == 29 (0x1209c4c00) [pid = 1063] [serial = 933] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:13 INFO - --DOMWINDOW == 28 (0x131b8dc00) [pid = 1063] [serial = 936] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:13 INFO - --DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 931] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20test] 16:59:13 INFO - --DOMWINDOW == 26 (0x120065800) [pid = 1063] [serial = 929] [outer = 0x0] [url = about:blank] 16:59:14 INFO - MEMORY STAT | vsize 3788MB | residentFast 399MB | heapAllocated 125MB 16:59:14 INFO - 221 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js | took 2567ms 16:59:14 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 405] 16:59:14 INFO - ++DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 948] [outer = 0x0] 16:59:14 INFO - ++DOMWINDOW == 28 (0x1216c6c00) [pid = 1063] [serial = 949] [outer = 0x12054bc00] 16:59:14 INFO - 222 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js 16:59:14 INFO - ++DOCSHELL 0x12c6dbf00 == 13 [pid = 1063] [id = 406] 16:59:14 INFO - ++DOMWINDOW == 29 (0x121763000) [pid = 1063] [serial = 950] [outer = 0x0] 16:59:14 INFO - ++DOMWINDOW == 30 (0x127f0bc00) [pid = 1063] [serial = 951] [outer = 0x121763000] 16:59:14 INFO - ++DOMWINDOW == 31 (0x1365f5000) [pid = 1063] [serial = 952] [outer = 0x121763000] 16:59:14 INFO - ++DOCSHELL 0x12cb89100 == 14 [pid = 1063] [id = 407] 16:59:14 INFO - ++DOMWINDOW == 32 (0x127bea800) [pid = 1063] [serial = 953] [outer = 0x0] 16:59:14 INFO - ++DOMWINDOW == 33 (0x1299ab000) [pid = 1063] [serial = 954] [outer = 0x127bea800] 16:59:14 INFO - ++DOMWINDOW == 34 (0x1299ea800) [pid = 1063] [serial = 955] [outer = 0x127bea800] 16:59:14 INFO - ++DOCSHELL 0x130927000 == 15 [pid = 1063] [id = 408] 16:59:14 INFO - ++DOMWINDOW == 35 (0x1333a2400) [pid = 1063] [serial = 956] [outer = 0x0] 16:59:14 INFO - ++DOMWINDOW == 36 (0x1333a2800) [pid = 1063] [serial = 957] [outer = 0x1333a2400] 16:59:16 INFO - --DOCSHELL 0x121646100 == 14 [pid = 1063] [id = 401] 16:59:16 INFO - --DOCSHELL 0x12cb89600 == 13 [pid = 1063] [id = 403] 16:59:16 INFO - --DOCSHELL 0x12c6db500 == 12 [pid = 1063] [id = 402] 16:59:16 INFO - --DOCSHELL 0x130927000 == 11 [pid = 1063] [id = 408] 16:59:16 INFO - --DOMWINDOW == 35 (0x131bc1400) [pid = 1063] [serial = 937] [outer = 0x0] [url = about:blank] 16:59:16 INFO - --DOMWINDOW == 34 (0x127f4e800) [pid = 1063] [serial = 935] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:16 INFO - --DOMWINDOW == 33 (0x127f0bc00) [pid = 1063] [serial = 951] [outer = 0x0] [url = about:blank] 16:59:16 INFO - --DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 942] [outer = 0x0] [url = http://example.com/] 16:59:16 INFO - --DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 939] [outer = 0x0] [url = about:blank] 16:59:16 INFO - --DOMWINDOW == 30 (0x1299ab000) [pid = 1063] [serial = 954] [outer = 0x0] [url = about:blank] 16:59:16 INFO - --DOMWINDOW == 29 (0x12a03bc00) [pid = 1063] [serial = 946] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:16 INFO - --DOMWINDOW == 28 (0x121cbac00) [pid = 1063] [serial = 943] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:16 INFO - --DOMWINDOW == 27 (0x120996c00) [pid = 1063] [serial = 940] [outer = 0x0] [url = http://example.com/] 16:59:16 INFO - --DOMWINDOW == 26 (0x120343c00) [pid = 1063] [serial = 938] [outer = 0x0] [url = about:blank] 16:59:16 INFO - MEMORY STAT | vsize 3790MB | residentFast 401MB | heapAllocated 125MB 16:59:16 INFO - 223 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js | took 2392ms 16:59:16 INFO - ++DOCSHELL 0x121646100 == 12 [pid = 1063] [id = 409] 16:59:16 INFO - ++DOMWINDOW == 27 (0x120538c00) [pid = 1063] [serial = 958] [outer = 0x0] 16:59:16 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 959] [outer = 0x120538c00] 16:59:16 INFO - 224 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js 16:59:16 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 410] 16:59:16 INFO - ++DOMWINDOW == 29 (0x120996c00) [pid = 1063] [serial = 960] [outer = 0x0] 16:59:16 INFO - ++DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 961] [outer = 0x120996c00] 16:59:16 INFO - ++DOCSHELL 0x12c6de200 == 14 [pid = 1063] [id = 411] 16:59:16 INFO - ++DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 962] [outer = 0x0] 16:59:16 INFO - ++DOMWINDOW == 32 (0x128d3a400) [pid = 1063] [serial = 963] [outer = 0x127274800] 16:59:17 INFO - ++DOMWINDOW == 33 (0x11f9a5c00) [pid = 1063] [serial = 964] [outer = 0x127274800] 16:59:17 INFO - ++DOCSHELL 0x12d25b500 == 15 [pid = 1063] [id = 412] 16:59:17 INFO - ++DOMWINDOW == 34 (0x1317f7800) [pid = 1063] [serial = 965] [outer = 0x0] 16:59:17 INFO - ++DOMWINDOW == 35 (0x131a86000) [pid = 1063] [serial = 966] [outer = 0x1317f7800] 16:59:18 INFO - --DOCSHELL 0x12c6dbf00 == 14 [pid = 1063] [id = 406] 16:59:18 INFO - --DOCSHELL 0x12d25b500 == 13 [pid = 1063] [id = 412] 16:59:18 INFO - --DOCSHELL 0x12cb89100 == 12 [pid = 1063] [id = 407] 16:59:18 INFO - --DOCSHELL 0x121c23e00 == 11 [pid = 1063] [id = 405] 16:59:18 INFO - --DOMWINDOW == 34 (0x12a0bf000) [pid = 1063] [serial = 947] [outer = 0x0] [url = about:blank] 16:59:18 INFO - --DOMWINDOW == 33 (0x11fe61400) [pid = 1063] [serial = 945] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:18 INFO - --DOMWINDOW == 32 (0x1216c6c00) [pid = 1063] [serial = 949] [outer = 0x0] [url = about:blank] 16:59:18 INFO - --DOMWINDOW == 31 (0x128d3a400) [pid = 1063] [serial = 963] [outer = 0x0] [url = about:blank] 16:59:18 INFO - --DOMWINDOW == 30 (0x127bea800) [pid = 1063] [serial = 953] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:18 INFO - --DOMWINDOW == 29 (0x1333a2400) [pid = 1063] [serial = 956] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:18 INFO - --DOMWINDOW == 28 (0x121763000) [pid = 1063] [serial = 950] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:18 INFO - --DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 948] [outer = 0x0] [url = about:blank] 16:59:18 INFO - --DOMWINDOW == 26 (0x1365f5000) [pid = 1063] [serial = 952] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:18 INFO - MEMORY STAT | vsize 3789MB | residentFast 400MB | heapAllocated 125MB 16:59:18 INFO - 225 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js | took 2160ms 16:59:18 INFO - ++DOCSHELL 0x121642f00 == 12 [pid = 1063] [id = 413] 16:59:18 INFO - ++DOMWINDOW == 27 (0x120541800) [pid = 1063] [serial = 967] [outer = 0x0] 16:59:18 INFO - ++DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 968] [outer = 0x120541800] 16:59:19 INFO - 226 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js 16:59:19 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 414] 16:59:19 INFO - ++DOMWINDOW == 29 (0x121cbac00) [pid = 1063] [serial = 969] [outer = 0x0] 16:59:19 INFO - ++DOMWINDOW == 30 (0x127f0bc00) [pid = 1063] [serial = 970] [outer = 0x121cbac00] 16:59:19 INFO - ++DOMWINDOW == 31 (0x136671800) [pid = 1063] [serial = 971] [outer = 0x121cbac00] 16:59:19 INFO - ++DOCSHELL 0x129f9b700 == 14 [pid = 1063] [id = 415] 16:59:19 INFO - ++DOMWINDOW == 32 (0x127bea800) [pid = 1063] [serial = 972] [outer = 0x0] 16:59:19 INFO - ++DOMWINDOW == 33 (0x1297a0800) [pid = 1063] [serial = 973] [outer = 0x127bea800] 16:59:19 INFO - ++DOMWINDOW == 34 (0x128d3a400) [pid = 1063] [serial = 974] [outer = 0x127bea800] 16:59:19 INFO - ++DOCSHELL 0x12d52de00 == 15 [pid = 1063] [id = 416] 16:59:19 INFO - ++DOMWINDOW == 35 (0x1334d2c00) [pid = 1063] [serial = 975] [outer = 0x0] 16:59:19 INFO - ++DOMWINDOW == 36 (0x1334d4800) [pid = 1063] [serial = 976] [outer = 0x1334d2c00] 16:59:21 INFO - --DOCSHELL 0x12c6db500 == 14 [pid = 1063] [id = 410] 16:59:21 INFO - --DOCSHELL 0x121646100 == 13 [pid = 1063] [id = 409] 16:59:21 INFO - --DOCSHELL 0x12d52de00 == 12 [pid = 1063] [id = 416] 16:59:21 INFO - --DOCSHELL 0x12c6de200 == 11 [pid = 1063] [id = 411] 16:59:21 INFO - --DOMWINDOW == 35 (0x1333a2800) [pid = 1063] [serial = 957] [outer = 0x0] [url = about:blank] 16:59:21 INFO - --DOMWINDOW == 34 (0x1299ea800) [pid = 1063] [serial = 955] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:21 INFO - --DOMWINDOW == 33 (0x127f0bc00) [pid = 1063] [serial = 970] [outer = 0x0] [url = about:blank] 16:59:21 INFO - --DOMWINDOW == 32 (0x127b8b000) [pid = 1063] [serial = 961] [outer = 0x0] [url = about:blank] 16:59:21 INFO - --DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 959] [outer = 0x0] [url = about:blank] 16:59:21 INFO - --DOMWINDOW == 30 (0x1297a0800) [pid = 1063] [serial = 973] [outer = 0x0] [url = about:blank] 16:59:21 INFO - --DOMWINDOW == 29 (0x127274800) [pid = 1063] [serial = 962] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:21 INFO - --DOMWINDOW == 28 (0x1317f7800) [pid = 1063] [serial = 965] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:21 INFO - --DOMWINDOW == 27 (0x120996c00) [pid = 1063] [serial = 960] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20588342] 16:59:21 INFO - --DOMWINDOW == 26 (0x120538c00) [pid = 1063] [serial = 958] [outer = 0x0] [url = about:blank] 16:59:21 INFO - MEMORY STAT | vsize 3789MB | residentFast 398MB | heapAllocated 126MB 16:59:21 INFO - 227 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js | took 2415ms 16:59:21 INFO - ++DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 417] 16:59:21 INFO - ++DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 977] [outer = 0x0] 16:59:21 INFO - ++DOMWINDOW == 28 (0x120996c00) [pid = 1063] [serial = 978] [outer = 0x12054bc00] 16:59:21 INFO - 228 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js 16:59:21 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 418] 16:59:21 INFO - ++DOMWINDOW == 29 (0x121747c00) [pid = 1063] [serial = 979] [outer = 0x0] 16:59:21 INFO - ++DOMWINDOW == 30 (0x127f4e800) [pid = 1063] [serial = 980] [outer = 0x121747c00] 16:59:21 INFO - ++DOMWINDOW == 31 (0x1299ab000) [pid = 1063] [serial = 981] [outer = 0x121747c00] 16:59:21 INFO - ++DOCSHELL 0x12cb89b00 == 14 [pid = 1063] [id = 419] 16:59:21 INFO - ++DOMWINDOW == 32 (0x127f0bc00) [pid = 1063] [serial = 982] [outer = 0x0] 16:59:21 INFO - ++DOMWINDOW == 33 (0x129e8d000) [pid = 1063] [serial = 983] [outer = 0x127f0bc00] 16:59:21 INFO - ++DOMWINDOW == 34 (0x12a178000) [pid = 1063] [serial = 984] [outer = 0x127f0bc00] 16:59:22 INFO - ++DOCSHELL 0x12ea31300 == 15 [pid = 1063] [id = 420] 16:59:22 INFO - ++DOMWINDOW == 35 (0x1334d4c00) [pid = 1063] [serial = 985] [outer = 0x0] 16:59:22 INFO - ++DOMWINDOW == 36 (0x1334d7800) [pid = 1063] [serial = 986] [outer = 0x1334d4c00] 16:59:23 INFO - --DOCSHELL 0x121642f00 == 14 [pid = 1063] [id = 413] 16:59:23 INFO - --DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 414] 16:59:23 INFO - --DOCSHELL 0x129f9b700 == 12 [pid = 1063] [id = 415] 16:59:23 INFO - --DOCSHELL 0x12ea31300 == 11 [pid = 1063] [id = 420] 16:59:23 INFO - --DOMWINDOW == 35 (0x131a86000) [pid = 1063] [serial = 966] [outer = 0x0] [url = about:blank] 16:59:23 INFO - --DOMWINDOW == 34 (0x11f9a5c00) [pid = 1063] [serial = 964] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:23 INFO - --DOMWINDOW == 33 (0x127f4e800) [pid = 1063] [serial = 980] [outer = 0x0] [url = about:blank] 16:59:23 INFO - --DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 968] [outer = 0x0] [url = about:blank] 16:59:23 INFO - --DOMWINDOW == 31 (0x129e8d000) [pid = 1063] [serial = 983] [outer = 0x0] [url = about:blank] 16:59:23 INFO - --DOMWINDOW == 30 (0x127bea800) [pid = 1063] [serial = 972] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:23 INFO - --DOMWINDOW == 29 (0x1334d2c00) [pid = 1063] [serial = 975] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:23 INFO - --DOMWINDOW == 28 (0x121cbac00) [pid = 1063] [serial = 969] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:23 INFO - --DOMWINDOW == 27 (0x120541800) [pid = 1063] [serial = 967] [outer = 0x0] [url = about:blank] 16:59:23 INFO - --DOMWINDOW == 26 (0x136671800) [pid = 1063] [serial = 971] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:23 INFO - MEMORY STAT | vsize 3790MB | residentFast 401MB | heapAllocated 125MB 16:59:24 INFO - 229 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js | took 2412ms 16:59:24 INFO - ++DOCSHELL 0x121642f00 == 12 [pid = 1063] [id = 421] 16:59:24 INFO - ++DOMWINDOW == 27 (0x12031e800) [pid = 1063] [serial = 987] [outer = 0x0] 16:59:24 INFO - ++DOMWINDOW == 28 (0x120541800) [pid = 1063] [serial = 988] [outer = 0x12031e800] 16:59:24 INFO - 230 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js 16:59:24 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 422] 16:59:24 INFO - ++DOMWINDOW == 29 (0x1216c6c00) [pid = 1063] [serial = 989] [outer = 0x0] 16:59:24 INFO - ++DOMWINDOW == 30 (0x127274800) [pid = 1063] [serial = 990] [outer = 0x1216c6c00] 16:59:24 INFO - ++DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 423] 16:59:24 INFO - ++DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 991] [outer = 0x0] 16:59:24 INFO - ++DOMWINDOW == 32 (0x128ffb000) [pid = 1063] [serial = 992] [outer = 0x121ddb400] 16:59:24 INFO - ++DOMWINDOW == 33 (0x120065000) [pid = 1063] [serial = 993] [outer = 0x121ddb400] 16:59:24 INFO - ++DOCSHELL 0x12d25b000 == 15 [pid = 1063] [id = 424] 16:59:24 INFO - ++DOMWINDOW == 34 (0x131b3ec00) [pid = 1063] [serial = 994] [outer = 0x0] 16:59:24 INFO - ++DOMWINDOW == 35 (0x131bc1800) [pid = 1063] [serial = 995] [outer = 0x131b3ec00] 16:59:25 INFO - ++DOMWINDOW == 36 (0x12b0f8400) [pid = 1063] [serial = 996] [outer = 0x1216c6c00] 16:59:26 INFO - --DOCSHELL 0x12c6db500 == 14 [pid = 1063] [id = 418] 16:59:26 INFO - --DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 417] 16:59:26 INFO - --DOCSHELL 0x12d25b000 == 12 [pid = 1063] [id = 424] 16:59:26 INFO - --DOCSHELL 0x12cb89b00 == 11 [pid = 1063] [id = 419] 16:59:26 INFO - --DOMWINDOW == 35 (0x1334d4800) [pid = 1063] [serial = 976] [outer = 0x0] [url = about:blank] 16:59:26 INFO - --DOMWINDOW == 34 (0x128d3a400) [pid = 1063] [serial = 974] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:26 INFO - --DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 978] [outer = 0x0] [url = about:blank] 16:59:26 INFO - --DOMWINDOW == 32 (0x128ffb000) [pid = 1063] [serial = 992] [outer = 0x0] [url = about:blank] 16:59:26 INFO - --DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 990] [outer = 0x0] [url = about:blank] 16:59:26 INFO - --DOMWINDOW == 30 (0x127f0bc00) [pid = 1063] [serial = 982] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:26 INFO - --DOMWINDOW == 29 (0x1334d4c00) [pid = 1063] [serial = 985] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:26 INFO - --DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 979] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:26 INFO - --DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 977] [outer = 0x0] [url = about:blank] 16:59:26 INFO - --DOMWINDOW == 26 (0x1299ab000) [pid = 1063] [serial = 981] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:26 INFO - MEMORY STAT | vsize 3789MB | residentFast 400MB | heapAllocated 125MB 16:59:26 INFO - 231 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js | took 2321ms 16:59:26 INFO - ++DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 425] 16:59:26 INFO - ++DOMWINDOW == 27 (0x120917c00) [pid = 1063] [serial = 997] [outer = 0x0] 16:59:26 INFO - ++DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 998] [outer = 0x120917c00] 16:59:26 INFO - 232 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js 16:59:26 INFO - ++DOCSHELL 0x12c6dce00 == 13 [pid = 1063] [id = 426] 16:59:26 INFO - ++DOMWINDOW == 29 (0x11f9a5c00) [pid = 1063] [serial = 999] [outer = 0x0] 16:59:26 INFO - ++DOMWINDOW == 30 (0x127bea800) [pid = 1063] [serial = 1000] [outer = 0x11f9a5c00] 16:59:26 INFO - ++DOCSHELL 0x12c6df600 == 14 [pid = 1063] [id = 427] 16:59:26 INFO - ++DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 1001] [outer = 0x0] 16:59:26 INFO - ++DOMWINDOW == 32 (0x128d3a400) [pid = 1063] [serial = 1002] [outer = 0x127274800] 16:59:26 INFO - ++DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 1003] [outer = 0x127274800] 16:59:27 INFO - ++DOCSHELL 0x12d25ba00 == 15 [pid = 1063] [id = 428] 16:59:27 INFO - ++DOMWINDOW == 34 (0x133355000) [pid = 1063] [serial = 1004] [outer = 0x0] 16:59:27 INFO - ++DOMWINDOW == 35 (0x133355800) [pid = 1063] [serial = 1005] [outer = 0x133355000] 16:59:28 INFO - --DOCSHELL 0x121642f00 == 14 [pid = 1063] [id = 421] 16:59:28 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 423] 16:59:28 INFO - --DOCSHELL 0x12d25ba00 == 12 [pid = 1063] [id = 428] 16:59:28 INFO - --DOCSHELL 0x12c6dba00 == 11 [pid = 1063] [id = 422] 16:59:28 INFO - --DOMWINDOW == 34 (0x1334d7800) [pid = 1063] [serial = 986] [outer = 0x0] [url = about:blank] 16:59:28 INFO - --DOMWINDOW == 33 (0x12a178000) [pid = 1063] [serial = 984] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:28 INFO - --DOMWINDOW == 32 (0x12b0f8400) [pid = 1063] [serial = 996] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 16:59:28 INFO - --DOMWINDOW == 31 (0x120541800) [pid = 1063] [serial = 988] [outer = 0x0] [url = about:blank] 16:59:28 INFO - --DOMWINDOW == 30 (0x128d3a400) [pid = 1063] [serial = 1002] [outer = 0x0] [url = about:blank] 16:59:28 INFO - --DOMWINDOW == 29 (0x121ddb400) [pid = 1063] [serial = 991] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:28 INFO - --DOMWINDOW == 28 (0x131b3ec00) [pid = 1063] [serial = 994] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:28 INFO - --DOMWINDOW == 27 (0x1216c6c00) [pid = 1063] [serial = 989] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 16:59:28 INFO - --DOMWINDOW == 26 (0x12031e800) [pid = 1063] [serial = 987] [outer = 0x0] [url = about:blank] 16:59:28 INFO - MEMORY STAT | vsize 3789MB | residentFast 400MB | heapAllocated 125MB 16:59:28 INFO - 233 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js | took 2190ms 16:59:28 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 429] 16:59:28 INFO - ++DOMWINDOW == 27 (0x120538c00) [pid = 1063] [serial = 1006] [outer = 0x0] 16:59:28 INFO - ++DOMWINDOW == 28 (0x1205f8400) [pid = 1063] [serial = 1007] [outer = 0x120538c00] 16:59:28 INFO - 234 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js 16:59:28 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 430] 16:59:28 INFO - ++DOMWINDOW == 29 (0x11f4c0c00) [pid = 1063] [serial = 1008] [outer = 0x0] 16:59:28 INFO - ++DOMWINDOW == 30 (0x126671000) [pid = 1063] [serial = 1009] [outer = 0x11f4c0c00] 16:59:29 INFO - ++DOMWINDOW == 31 (0x128d3a400) [pid = 1063] [serial = 1010] [outer = 0x11f4c0c00] 16:59:29 INFO - ++DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 431] 16:59:29 INFO - ++DOMWINDOW == 32 (0x129838400) [pid = 1063] [serial = 1011] [outer = 0x0] 16:59:29 INFO - ++DOMWINDOW == 33 (0x1285cb800) [pid = 1063] [serial = 1012] [outer = 0x129838400] 16:59:29 INFO - ++DOCSHELL 0x129f9b200 == 15 [pid = 1063] [id = 432] 16:59:29 INFO - ++DOMWINDOW == 34 (0x121763c00) [pid = 1063] [serial = 1013] [outer = 0x0] 16:59:29 INFO - ++DOMWINDOW == 35 (0x12b110400) [pid = 1063] [serial = 1014] [outer = 0x121763c00] 16:59:29 INFO - ++DOMWINDOW == 36 (0x12b0f8400) [pid = 1063] [serial = 1015] [outer = 0x121763c00] 16:59:29 INFO - ++DOCSHELL 0x12ea31300 == 16 [pid = 1063] [id = 433] 16:59:29 INFO - ++DOMWINDOW == 37 (0x1334d4800) [pid = 1063] [serial = 1016] [outer = 0x0] 16:59:29 INFO - ++DOMWINDOW == 38 (0x133e5c000) [pid = 1063] [serial = 1017] [outer = 0x1334d4800] 16:59:30 INFO - ++DOCSHELL 0x134f99400 == 17 [pid = 1063] [id = 434] 16:59:30 INFO - ++DOMWINDOW == 39 (0x1333a2400) [pid = 1063] [serial = 1018] [outer = 0x0] 16:59:30 INFO - ++DOMWINDOW == 40 (0x134862c00) [pid = 1063] [serial = 1019] [outer = 0x1333a2400] 16:59:30 INFO - ++DOMWINDOW == 41 (0x1309dc400) [pid = 1063] [serial = 1020] [outer = 0x1333a2400] 16:59:30 INFO - ++DOCSHELL 0x13707f400 == 18 [pid = 1063] [id = 435] 16:59:30 INFO - ++DOMWINDOW == 42 (0x1309dcc00) [pid = 1063] [serial = 1021] [outer = 0x0] 16:59:30 INFO - ++DOMWINDOW == 43 (0x1353c5000) [pid = 1063] [serial = 1022] [outer = 0x1309dcc00] 16:59:30 INFO - ++DOMWINDOW == 44 (0x120065800) [pid = 1063] [serial = 1023] [outer = 0x1309dcc00] 16:59:30 INFO - ++DOCSHELL 0x137080d00 == 19 [pid = 1063] [id = 436] 16:59:30 INFO - ++DOMWINDOW == 45 (0x137049400) [pid = 1063] [serial = 1024] [outer = 0x0] 16:59:30 INFO - ++DOMWINDOW == 46 (0x137062c00) [pid = 1063] [serial = 1025] [outer = 0x137049400] 16:59:31 INFO - ++DOMWINDOW == 47 (0x13529b400) [pid = 1063] [serial = 1026] [outer = 0x11f4c0c00] 16:59:31 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:31 INFO - ++DOCSHELL 0x12c6ddd00 == 20 [pid = 1063] [id = 437] 16:59:31 INFO - ++DOMWINDOW == 48 (0x13770b000) [pid = 1063] [serial = 1027] [outer = 0x0] 16:59:31 INFO - ++DOMWINDOW == 49 (0x13770b800) [pid = 1063] [serial = 1028] [outer = 0x13770b000] 16:59:31 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:32 INFO - --DOCSHELL 0x127766500 == 19 [pid = 1063] [id = 425] 16:59:32 INFO - --DOCSHELL 0x12c6dce00 == 18 [pid = 1063] [id = 426] 16:59:32 INFO - --DOCSHELL 0x12c6df600 == 17 [pid = 1063] [id = 427] 16:59:32 INFO - --DOCSHELL 0x137080d00 == 16 [pid = 1063] [id = 436] 16:59:32 INFO - --DOMWINDOW == 48 (0x131bc1800) [pid = 1063] [serial = 995] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 47 (0x120065000) [pid = 1063] [serial = 993] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:32 INFO - --DOMWINDOW == 46 (0x133355000) [pid = 1063] [serial = 1004] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:32 INFO - --DOMWINDOW == 45 (0x11f9a5c00) [pid = 1063] [serial = 999] [outer = 0x0] [url = data:text/html;charset=utf-8,test%20for%20bug%20592442] 16:59:32 INFO - --DOMWINDOW == 44 (0x120917c00) [pid = 1063] [serial = 997] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 43 (0x127274800) [pid = 1063] [serial = 1001] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:32 INFO - --DOMWINDOW == 42 (0x134862c00) [pid = 1063] [serial = 1019] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 41 (0x126671000) [pid = 1063] [serial = 1009] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 40 (0x127bea800) [pid = 1063] [serial = 1000] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 39 (0x121747c00) [pid = 1063] [serial = 998] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 38 (0x12b110400) [pid = 1063] [serial = 1014] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 37 (0x1353c5000) [pid = 1063] [serial = 1022] [outer = 0x0] [url = about:blank] 16:59:32 INFO - --DOMWINDOW == 36 (0x129838400) [pid = 1063] [serial = 1011] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 16:59:32 INFO - --DOCSHELL 0x12ea31300 == 15 [pid = 1063] [id = 433] 16:59:32 INFO - --DOMWINDOW == 35 (0x1285cb800) [pid = 1063] [serial = 1012] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 16:59:32 INFO - --DOMWINDOW == 34 (0x128d3a400) [pid = 1063] [serial = 1010] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 16:59:33 INFO - --DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 431] 16:59:33 INFO - --DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 432] 16:59:33 INFO - --DOCSHELL 0x13707f400 == 12 [pid = 1063] [id = 435] 16:59:33 INFO - --DOCSHELL 0x134f99400 == 11 [pid = 1063] [id = 434] 16:59:33 INFO - --DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 1003] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:33 INFO - --DOMWINDOW == 32 (0x133355800) [pid = 1063] [serial = 1005] [outer = 0x0] [url = about:blank] 16:59:33 INFO - --DOMWINDOW == 31 (0x1333a2400) [pid = 1063] [serial = 1018] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:33 INFO - --DOMWINDOW == 30 (0x1309dcc00) [pid = 1063] [serial = 1021] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:33 INFO - --DOMWINDOW == 29 (0x137049400) [pid = 1063] [serial = 1024] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:33 INFO - --DOCSHELL 0x12c6ddd00 == 10 [pid = 1063] [id = 437] 16:59:33 INFO - --DOMWINDOW == 28 (0x1309dc400) [pid = 1063] [serial = 1020] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 16:59:33 INFO - MEMORY STAT | vsize 3779MB | residentFast 392MB | heapAllocated 124MB 16:59:33 INFO - 235 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js | took 4853ms 16:59:33 INFO - ++DOCSHELL 0x127766500 == 11 [pid = 1063] [id = 438] 16:59:33 INFO - ++DOMWINDOW == 29 (0x120343c00) [pid = 1063] [serial = 1029] [outer = 0x0] 16:59:33 INFO - ++DOMWINDOW == 30 (0x1209c4c00) [pid = 1063] [serial = 1030] [outer = 0x120343c00] 16:59:33 INFO - 236 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js 16:59:33 INFO - ++DOCSHELL 0x12c6db000 == 12 [pid = 1063] [id = 439] 16:59:33 INFO - ++DOMWINDOW == 31 (0x121cbac00) [pid = 1063] [serial = 1031] [outer = 0x0] 16:59:33 INFO - ++DOMWINDOW == 32 (0x127b8b000) [pid = 1063] [serial = 1032] [outer = 0x121cbac00] 16:59:34 INFO - ++DOCSHELL 0x12c6de200 == 13 [pid = 1063] [id = 440] 16:59:34 INFO - ++DOMWINDOW == 33 (0x127274800) [pid = 1063] [serial = 1033] [outer = 0x0] 16:59:34 INFO - ++DOMWINDOW == 34 (0x128738000) [pid = 1063] [serial = 1034] [outer = 0x127274800] 16:59:34 INFO - ++DOMWINDOW == 35 (0x128d3a400) [pid = 1063] [serial = 1035] [outer = 0x127274800] 16:59:34 INFO - ++DOCSHELL 0x12cb89b00 == 14 [pid = 1063] [id = 441] 16:59:34 INFO - ++DOMWINDOW == 36 (0x12cbf1400) [pid = 1063] [serial = 1036] [outer = 0x0] 16:59:34 INFO - ++DOMWINDOW == 37 (0x12ce44400) [pid = 1063] [serial = 1037] [outer = 0x12cbf1400] 16:59:36 INFO - --DOCSHELL 0x121c23e00 == 13 [pid = 1063] [id = 429] 16:59:36 INFO - --DOCSHELL 0x12c6dba00 == 12 [pid = 1063] [id = 430] 16:59:36 INFO - --DOCSHELL 0x12cb89b00 == 11 [pid = 1063] [id = 441] 16:59:36 INFO - --DOMWINDOW == 36 (0x137062c00) [pid = 1063] [serial = 1025] [outer = 0x0] [url = about:blank] 16:59:36 INFO - --DOMWINDOW == 35 (0x120065800) [pid = 1063] [serial = 1023] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:36 INFO - --DOMWINDOW == 34 (0x1205f8400) [pid = 1063] [serial = 1007] [outer = 0x0] [url = about:blank] 16:59:36 INFO - --DOMWINDOW == 33 (0x128738000) [pid = 1063] [serial = 1034] [outer = 0x0] [url = about:blank] 16:59:36 INFO - --DOMWINDOW == 32 (0x121763c00) [pid = 1063] [serial = 1013] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:36 INFO - --DOMWINDOW == 31 (0x1334d4800) [pid = 1063] [serial = 1016] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:36 INFO - --DOMWINDOW == 30 (0x13770b000) [pid = 1063] [serial = 1027] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 16:59:36 INFO - --DOMWINDOW == 29 (0x11f4c0c00) [pid = 1063] [serial = 1008] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 16:59:36 INFO - --DOMWINDOW == 28 (0x120538c00) [pid = 1063] [serial = 1006] [outer = 0x0] [url = about:blank] 16:59:36 INFO - --DOMWINDOW == 27 (0x13770b800) [pid = 1063] [serial = 1028] [outer = 0x0] [url = about:blank] 16:59:36 INFO - --DOMWINDOW == 26 (0x13529b400) [pid = 1063] [serial = 1026] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 16:59:36 INFO - MEMORY STAT | vsize 3781MB | residentFast 394MB | heapAllocated 127MB 16:59:36 INFO - 237 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js | took 2448ms 16:59:36 INFO - ++DOCSHELL 0x1201fdb00 == 12 [pid = 1063] [id = 442] 16:59:36 INFO - ++DOMWINDOW == 27 (0x121763c00) [pid = 1063] [serial = 1038] [outer = 0x0] 16:59:36 INFO - ++DOMWINDOW == 28 (0x127bea800) [pid = 1063] [serial = 1039] [outer = 0x121763c00] 16:59:36 INFO - 238 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js 16:59:36 INFO - ++DOCSHELL 0x12c6dce00 == 13 [pid = 1063] [id = 443] 16:59:36 INFO - ++DOMWINDOW == 29 (0x127f0bc00) [pid = 1063] [serial = 1040] [outer = 0x0] 16:59:36 INFO - ++DOMWINDOW == 30 (0x129838400) [pid = 1063] [serial = 1041] [outer = 0x127f0bc00] 16:59:36 INFO - ++DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 444] 16:59:36 INFO - ++DOMWINDOW == 31 (0x12963d400) [pid = 1063] [serial = 1042] [outer = 0x0] 16:59:36 INFO - ++DOMWINDOW == 32 (0x129f83c00) [pid = 1063] [serial = 1043] [outer = 0x12963d400] 16:59:36 INFO - ++DOMWINDOW == 33 (0x12a01e400) [pid = 1063] [serial = 1044] [outer = 0x12963d400] 16:59:36 INFO - ++DOCSHELL 0x12d4bd000 == 15 [pid = 1063] [id = 445] 16:59:36 INFO - ++DOMWINDOW == 34 (0x130978800) [pid = 1063] [serial = 1045] [outer = 0x0] 16:59:36 INFO - ++DOMWINDOW == 35 (0x130982000) [pid = 1063] [serial = 1046] [outer = 0x130978800] 16:59:37 INFO - ++DOMWINDOW == 36 (0x1334d7000) [pid = 1063] [serial = 1047] [outer = 0x127f0bc00] 16:59:38 INFO - --DOCSHELL 0x12c6db000 == 14 [pid = 1063] [id = 439] 16:59:38 INFO - --DOCSHELL 0x12c6de200 == 13 [pid = 1063] [id = 440] 16:59:38 INFO - --DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 438] 16:59:38 INFO - --DOCSHELL 0x12d4bd000 == 11 [pid = 1063] [id = 445] 16:59:38 INFO - --DOMWINDOW == 35 (0x12b0f8400) [pid = 1063] [serial = 1015] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:38 INFO - --DOMWINDOW == 34 (0x133e5c000) [pid = 1063] [serial = 1017] [outer = 0x0] [url = about:blank] 16:59:38 INFO - --DOMWINDOW == 33 (0x129f83c00) [pid = 1063] [serial = 1043] [outer = 0x0] [url = about:blank] 16:59:38 INFO - --DOMWINDOW == 32 (0x127b8b000) [pid = 1063] [serial = 1032] [outer = 0x0] [url = about:blank] 16:59:38 INFO - --DOMWINDOW == 31 (0x1209c4c00) [pid = 1063] [serial = 1030] [outer = 0x0] [url = about:blank] 16:59:38 INFO - --DOMWINDOW == 30 (0x12cbf1400) [pid = 1063] [serial = 1036] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:38 INFO - --DOMWINDOW == 29 (0x121cbac00) [pid = 1063] [serial = 1031] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20594497%20and%20bug%20619598] 16:59:38 INFO - --DOMWINDOW == 28 (0x120343c00) [pid = 1063] [serial = 1029] [outer = 0x0] [url = about:blank] 16:59:38 INFO - --DOMWINDOW == 27 (0x127274800) [pid = 1063] [serial = 1033] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:38 INFO - MEMORY STAT | vsize 3785MB | residentFast 397MB | heapAllocated 126MB 16:59:38 INFO - 239 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js | took 2488ms 16:59:38 INFO - ++DOCSHELL 0x12c6dc900 == 12 [pid = 1063] [id = 446] 16:59:38 INFO - ++DOMWINDOW == 28 (0x1216c6c00) [pid = 1063] [serial = 1048] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 29 (0x121ddb400) [pid = 1063] [serial = 1049] [outer = 0x1216c6c00] 16:59:39 INFO - 240 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js 16:59:39 INFO - ++DOCSHELL 0x12cb89100 == 13 [pid = 1063] [id = 447] 16:59:39 INFO - ++DOMWINDOW == 30 (0x1285cb800) [pid = 1063] [serial = 1050] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 31 (0x1299ab000) [pid = 1063] [serial = 1051] [outer = 0x1285cb800] 16:59:39 INFO - ++DOCSHELL 0x1201b0200 == 14 [pid = 1063] [id = 448] 16:59:39 INFO - ++DOMWINDOW == 32 (0x1299ea800) [pid = 1063] [serial = 1052] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 33 (0x12a12cc00) [pid = 1063] [serial = 1053] [outer = 0x1299ea800] 16:59:39 INFO - ++DOCSHELL 0x12d4c0200 == 15 [pid = 1063] [id = 449] 16:59:39 INFO - ++DOMWINDOW == 34 (0x12a178c00) [pid = 1063] [serial = 1054] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 35 (0x12b0f8400) [pid = 1063] [serial = 1055] [outer = 0x12a178c00] 16:59:39 INFO - ++DOCSHELL 0x130928400 == 16 [pid = 1063] [id = 450] 16:59:39 INFO - ++DOMWINDOW == 36 (0x12c989000) [pid = 1063] [serial = 1056] [outer = 0x0] 16:59:39 INFO - ++DOCSHELL 0x130928900 == 17 [pid = 1063] [id = 451] 16:59:39 INFO - ++DOMWINDOW == 37 (0x12c9b4c00) [pid = 1063] [serial = 1057] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 38 (0x12cbf1400) [pid = 1063] [serial = 1058] [outer = 0x12c9b4c00] 16:59:39 INFO - ++DOCSHELL 0x130929d00 == 18 [pid = 1063] [id = 452] 16:59:39 INFO - ++DOMWINDOW == 39 (0x12c71e800) [pid = 1063] [serial = 1059] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 40 (0x136385800) [pid = 1063] [serial = 1060] [outer = 0x12c71e800] 16:59:39 INFO - ++DOMWINDOW == 41 (0x12c26d400) [pid = 1063] [serial = 1061] [outer = 0x12c989000] 16:59:39 INFO - ++DOMWINDOW == 42 (0x130978000) [pid = 1063] [serial = 1062] [outer = 0x12c9b4c00] 16:59:39 INFO - ++DOMWINDOW == 43 (0x1365f5800) [pid = 1063] [serial = 1063] [outer = 0x12c71e800] 16:59:39 INFO - ++DOCSHELL 0x131a40f00 == 19 [pid = 1063] [id = 453] 16:59:39 INFO - ++DOMWINDOW == 44 (0x13679f400) [pid = 1063] [serial = 1064] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 45 (0x1367d8400) [pid = 1063] [serial = 1065] [outer = 0x13679f400] 16:59:39 INFO - ++DOCSHELL 0x1332bdf00 == 20 [pid = 1063] [id = 454] 16:59:39 INFO - ++DOMWINDOW == 46 (0x1367e9800) [pid = 1063] [serial = 1066] [outer = 0x0] 16:59:39 INFO - ++DOMWINDOW == 47 (0x1367ed800) [pid = 1063] [serial = 1067] [outer = 0x1367e9800] 16:59:40 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:59:40 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:59:40 INFO - ++DOCSHELL 0x13542af00 == 21 [pid = 1063] [id = 455] 16:59:40 INFO - ++DOMWINDOW == 48 (0x12bb70000) [pid = 1063] [serial = 1068] [outer = 0x0] 16:59:40 INFO - ++DOMWINDOW == 49 (0x12ca21000) [pid = 1063] [serial = 1069] [outer = 0x12bb70000] 16:59:40 INFO - ++DOCSHELL 0x13542aa00 == 22 [pid = 1063] [id = 456] 16:59:40 INFO - ++DOMWINDOW == 50 (0x12a0e6800) [pid = 1063] [serial = 1070] [outer = 0x0] 16:59:40 INFO - ++DOMWINDOW == 51 (0x12ce44c00) [pid = 1063] [serial = 1071] [outer = 0x12a0e6800] 16:59:40 INFO - ++DOCSHELL 0x13542d200 == 23 [pid = 1063] [id = 457] 16:59:40 INFO - ++DOMWINDOW == 52 (0x1367ee800) [pid = 1063] [serial = 1072] [outer = 0x0] 16:59:40 INFO - ++DOMWINDOW == 53 (0x1367eec00) [pid = 1063] [serial = 1073] [outer = 0x1367ee800] 16:59:40 INFO - ++DOCSHELL 0x13542e600 == 24 [pid = 1063] [id = 458] 16:59:40 INFO - ++DOMWINDOW == 54 (0x136a93400) [pid = 1063] [serial = 1074] [outer = 0x0] 16:59:40 INFO - ++DOMWINDOW == 55 (0x136a93800) [pid = 1063] [serial = 1075] [outer = 0x136a93400] 16:59:40 INFO - ++DOCSHELL 0x1201fd600 == 25 [pid = 1063] [id = 459] 16:59:40 INFO - ++DOMWINDOW == 56 (0x13705f400) [pid = 1063] [serial = 1076] [outer = 0x0] 16:59:40 INFO - ++DOMWINDOW == 57 (0x13705f800) [pid = 1063] [serial = 1077] [outer = 0x13705f400] 16:59:40 INFO - ++DOMWINDOW == 58 (0x129900800) [pid = 1063] [serial = 1078] [outer = 0x12bb70000] 16:59:41 INFO - ++DOMWINDOW == 59 (0x136a4c000) [pid = 1063] [serial = 1079] [outer = 0x12a0e6800] 16:59:41 INFO - ++DOMWINDOW == 60 (0x137013000) [pid = 1063] [serial = 1080] [outer = 0x1367ee800] 16:59:41 INFO - ++DOMWINDOW == 61 (0x133384c00) [pid = 1063] [serial = 1081] [outer = 0x136a93400] 16:59:41 INFO - ++DOMWINDOW == 62 (0x129fda000) [pid = 1063] [serial = 1082] [outer = 0x13705f400] 16:59:41 INFO - ++DOCSHELL 0x1377ae400 == 26 [pid = 1063] [id = 460] 16:59:41 INFO - ++DOMWINDOW == 63 (0x12bfb8400) [pid = 1063] [serial = 1083] [outer = 0x0] 16:59:41 INFO - ++DOMWINDOW == 64 (0x12bfb8800) [pid = 1063] [serial = 1084] [outer = 0x12bfb8400] 16:59:41 INFO - ++DOCSHELL 0x1377b0200 == 27 [pid = 1063] [id = 461] 16:59:41 INFO - ++DOMWINDOW == 65 (0x12bfb8000) [pid = 1063] [serial = 1085] [outer = 0x0] 16:59:41 INFO - ++DOMWINDOW == 66 (0x12fda9800) [pid = 1063] [serial = 1086] [outer = 0x12bfb8000] 16:59:41 INFO - ++DOCSHELL 0x1377b1600 == 28 [pid = 1063] [id = 462] 16:59:41 INFO - ++DOMWINDOW == 67 (0x1553f1000) [pid = 1063] [serial = 1087] [outer = 0x0] 16:59:41 INFO - ++DOMWINDOW == 68 (0x1553f1c00) [pid = 1063] [serial = 1088] [outer = 0x1553f1000] 16:59:41 INFO - ++DOCSHELL 0x133ecaa00 == 29 [pid = 1063] [id = 463] 16:59:41 INFO - ++DOMWINDOW == 69 (0x1353fa400) [pid = 1063] [serial = 1089] [outer = 0x0] 16:59:41 INFO - ++DOMWINDOW == 70 (0x13543f400) [pid = 1063] [serial = 1090] [outer = 0x1353fa400] 16:59:45 INFO - MEMORY STAT | vsize 3810MB | residentFast 428MB | heapAllocated 152MB 16:59:45 INFO - 241 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js | took 6082ms 16:59:45 INFO - ++DOCSHELL 0x130927a00 == 30 [pid = 1063] [id = 464] 16:59:45 INFO - ++DOMWINDOW == 71 (0x12bfa2c00) [pid = 1063] [serial = 1091] [outer = 0x0] 16:59:45 INFO - ++DOMWINDOW == 72 (0x130aa9800) [pid = 1063] [serial = 1092] [outer = 0x12bfa2c00] 16:59:45 INFO - 242 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js 16:59:45 INFO - ++DOCSHELL 0x131a44b00 == 31 [pid = 1063] [id = 465] 16:59:45 INFO - ++DOMWINDOW == 73 (0x131bc1400) [pid = 1063] [serial = 1093] [outer = 0x0] 16:59:45 INFO - ++DOMWINDOW == 74 (0x1332aec00) [pid = 1063] [serial = 1094] [outer = 0x131bc1400] 16:59:45 INFO - ++DOCSHELL 0x133eccd00 == 32 [pid = 1063] [id = 466] 16:59:45 INFO - ++DOMWINDOW == 75 (0x131bc1c00) [pid = 1063] [serial = 1095] [outer = 0x0] 16:59:45 INFO - ++DOMWINDOW == 76 (0x1333b6c00) [pid = 1063] [serial = 1096] [outer = 0x131bc1c00] 16:59:45 INFO - ++DOMWINDOW == 77 (0x13347e400) [pid = 1063] [serial = 1097] [outer = 0x131bc1c00] 16:59:46 INFO - ++DOCSHELL 0x134f99400 == 33 [pid = 1063] [id = 467] 16:59:46 INFO - ++DOMWINDOW == 78 (0x133355000) [pid = 1063] [serial = 1098] [outer = 0x0] 16:59:46 INFO - ++DOMWINDOW == 79 (0x137354000) [pid = 1063] [serial = 1099] [outer = 0x133355000] 16:59:47 INFO - ++DOMWINDOW == 80 (0x1377f6c00) [pid = 1063] [serial = 1100] [outer = 0x131bc1400] 16:59:47 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:47 INFO - ++DOMWINDOW == 81 (0x153814800) [pid = 1063] [serial = 1101] [outer = 0x131bc1400] 16:59:47 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:47 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 16:59:47 INFO - ++DOMWINDOW == 82 (0x15bf86000) [pid = 1063] [serial = 1102] [outer = 0x131bc1400] 16:59:47 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:48 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 16:59:48 INFO - ++DOMWINDOW == 83 (0x137010400) [pid = 1063] [serial = 1103] [outer = 0x131bc1400] 16:59:48 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:48 INFO - ++DOMWINDOW == 84 (0x13713bc00) [pid = 1063] [serial = 1104] [outer = 0x131bc1400] 16:59:48 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:49 INFO - ++DOMWINDOW == 85 (0x158976400) [pid = 1063] [serial = 1105] [outer = 0x131bc1400] 16:59:50 INFO - ++DOMWINDOW == 86 (0x129f21000) [pid = 1063] [serial = 1106] [outer = 0x131bc1400] 16:59:51 INFO - ++DOMWINDOW == 87 (0x12e049400) [pid = 1063] [serial = 1107] [outer = 0x131bc1400] 16:59:51 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:51 INFO - --DOCSHELL 0x12c822e00 == 32 [pid = 1063] [id = 444] 16:59:51 INFO - --DOCSHELL 0x12c6dce00 == 31 [pid = 1063] [id = 443] 16:59:51 INFO - --DOMWINDOW == 86 (0x12cbf1400) [pid = 1063] [serial = 1058] [outer = 0x12c9b4c00] [url = about:blank] 16:59:51 INFO - ++DOMWINDOW == 87 (0x130930000) [pid = 1063] [serial = 1108] [outer = 0x131bc1400] 16:59:51 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:51 INFO - ++DOMWINDOW == 88 (0x12c26c400) [pid = 1063] [serial = 1109] [outer = 0x131bc1400] 16:59:51 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:52 INFO - ++DOMWINDOW == 89 (0x136517400) [pid = 1063] [serial = 1110] [outer = 0x131bc1400] 16:59:52 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:52 INFO - ++DOMWINDOW == 90 (0x133365c00) [pid = 1063] [serial = 1111] [outer = 0x131bc1400] 16:59:52 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 16:59:53 INFO - --DOCSHELL 0x134f99400 == 30 [pid = 1063] [id = 467] 16:59:53 INFO - --DOCSHELL 0x1201fdb00 == 29 [pid = 1063] [id = 442] 16:59:53 INFO - --DOCSHELL 0x12c6dc900 == 28 [pid = 1063] [id = 446] 16:59:53 INFO - --DOCSHELL 0x1201b0200 == 27 [pid = 1063] [id = 448] 16:59:53 INFO - --DOCSHELL 0x12cb89100 == 26 [pid = 1063] [id = 447] 16:59:53 INFO - --DOCSHELL 0x1377ae400 == 25 [pid = 1063] [id = 460] 16:59:53 INFO - --DOCSHELL 0x13542d200 == 24 [pid = 1063] [id = 457] 16:59:53 INFO - --DOCSHELL 0x1377b0200 == 23 [pid = 1063] [id = 461] 16:59:53 INFO - --DOCSHELL 0x13542aa00 == 22 [pid = 1063] [id = 456] 16:59:53 INFO - --DOCSHELL 0x12d4c0200 == 21 [pid = 1063] [id = 449] 16:59:53 INFO - --DOCSHELL 0x130929d00 == 20 [pid = 1063] [id = 452] 16:59:53 INFO - --DOCSHELL 0x133ecaa00 == 19 [pid = 1063] [id = 463] 16:59:53 INFO - --DOCSHELL 0x1332bdf00 == 18 [pid = 1063] [id = 454] 16:59:53 INFO - --DOCSHELL 0x130928400 == 17 [pid = 1063] [id = 450] 16:59:53 INFO - --DOCSHELL 0x131a40f00 == 16 [pid = 1063] [id = 453] 16:59:53 INFO - --DOCSHELL 0x1377b1600 == 15 [pid = 1063] [id = 462] 16:59:53 INFO - --DOCSHELL 0x130928900 == 14 [pid = 1063] [id = 451] 16:59:53 INFO - --DOCSHELL 0x13542af00 == 13 [pid = 1063] [id = 455] 16:59:53 INFO - --DOCSHELL 0x13542e600 == 12 [pid = 1063] [id = 458] 16:59:53 INFO - --DOCSHELL 0x1201fd600 == 11 [pid = 1063] [id = 459] 16:59:53 INFO - --DOMWINDOW == 89 (0x12c26d400) [pid = 1063] [serial = 1061] [outer = 0x12c989000] [url = about:blank] 16:59:53 INFO - --DOMWINDOW == 88 (0x12ce44400) [pid = 1063] [serial = 1037] [outer = 0x0] [url = about:blank] 16:59:53 INFO - --DOMWINDOW == 87 (0x128d3a400) [pid = 1063] [serial = 1035] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:53 INFO - --DOMWINDOW == 86 (0x130978000) [pid = 1063] [serial = 1062] [outer = 0x12c9b4c00] [url = about:blank] 16:59:53 INFO - --DOMWINDOW == 85 (0x12c989000) [pid = 1063] [serial = 1056] [outer = 0x0] [url = about:blank] 16:59:53 INFO - --DOMWINDOW == 84 (0x12c9b4c00) [pid = 1063] [serial = 1057] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 83 (0x121763c00) [pid = 1063] [serial = 1038] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 82 (0x127f0bc00) [pid = 1063] [serial = 1040] [outer = 0x0] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 16:59:54 INFO - --DOMWINDOW == 81 (0x12963d400) [pid = 1063] [serial = 1042] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:54 INFO - --DOMWINDOW == 80 (0x130978800) [pid = 1063] [serial = 1045] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:54 INFO - --DOMWINDOW == 79 (0x12a178c00) [pid = 1063] [serial = 1054] [outer = 0x0] [url = chrome://browser/content/browser.xul] 16:59:54 INFO - --DOMWINDOW == 78 (0x136a93400) [pid = 1063] [serial = 1074] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:54 INFO - --DOMWINDOW == 77 (0x1367e9800) [pid = 1063] [serial = 1066] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 16:59:54 INFO - --DOMWINDOW == 76 (0x12bb70000) [pid = 1063] [serial = 1068] [outer = 0x0] [url = about:newtab] 16:59:54 INFO - --DOMWINDOW == 75 (0x12c71e800) [pid = 1063] [serial = 1059] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 74 (0x13679f400) [pid = 1063] [serial = 1064] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 16:59:54 INFO - --DOMWINDOW == 73 (0x1299ea800) [pid = 1063] [serial = 1052] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 16:59:54 INFO - --DOMWINDOW == 72 (0x1285cb800) [pid = 1063] [serial = 1050] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 16:59:54 INFO - --DOMWINDOW == 71 (0x1216c6c00) [pid = 1063] [serial = 1048] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 70 (0x1333b6c00) [pid = 1063] [serial = 1096] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 69 (0x12bfb8400) [pid = 1063] [serial = 1083] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:54 INFO - --DOMWINDOW == 68 (0x1553f1000) [pid = 1063] [serial = 1087] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:54 INFO - --DOMWINDOW == 67 (0x12bfb8000) [pid = 1063] [serial = 1085] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:54 INFO - --DOMWINDOW == 66 (0x1353fa400) [pid = 1063] [serial = 1089] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 16:59:54 INFO - --DOMWINDOW == 65 (0x13705f400) [pid = 1063] [serial = 1076] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:54 INFO - --DOMWINDOW == 64 (0x12a0e6800) [pid = 1063] [serial = 1070] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:54 INFO - --DOMWINDOW == 63 (0x1367ee800) [pid = 1063] [serial = 1072] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 16:59:54 INFO - --DOMWINDOW == 62 (0x127bea800) [pid = 1063] [serial = 1039] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 61 (0x129838400) [pid = 1063] [serial = 1041] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 60 (0x13705f800) [pid = 1063] [serial = 1077] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 59 (0x12ca21000) [pid = 1063] [serial = 1069] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 58 (0x12ce44c00) [pid = 1063] [serial = 1071] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 57 (0x1367eec00) [pid = 1063] [serial = 1073] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 56 (0x136385800) [pid = 1063] [serial = 1060] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 55 (0x136a93800) [pid = 1063] [serial = 1075] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 54 (0x1367d8400) [pid = 1063] [serial = 1065] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 53 (0x129f21000) [pid = 1063] [serial = 1106] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-svg.xhtml] 16:59:54 INFO - --DOMWINDOW == 52 (0x158976400) [pid = 1063] [serial = 1105] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml.xhtml] 16:59:54 INFO - --DOMWINDOW == 51 (0x137010400) [pid = 1063] [serial = 1103] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 16:59:54 INFO - --DOMWINDOW == 50 (0x1332aec00) [pid = 1063] [serial = 1094] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 49 (0x1365f5800) [pid = 1063] [serial = 1063] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 48 (0x12a12cc00) [pid = 1063] [serial = 1053] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 47 (0x1299ab000) [pid = 1063] [serial = 1051] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 46 (0x121ddb400) [pid = 1063] [serial = 1049] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 45 (0x1367ed800) [pid = 1063] [serial = 1067] [outer = 0x0] [url = about:blank] 16:59:54 INFO - --DOMWINDOW == 44 (0x1334d7000) [pid = 1063] [serial = 1047] [outer = 0x0] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 16:59:54 INFO - --DOMWINDOW == 43 (0x12e049400) [pid = 1063] [serial = 1107] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-parser.html] 16:59:54 INFO - --DOMWINDOW == 42 (0x15bf86000) [pid = 1063] [serial = 1102] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 16:59:54 INFO - --DOMWINDOW == 41 (0x153814800) [pid = 1063] [serial = 1101] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-imagemap.html] 16:59:54 INFO - --DOMWINDOW == 40 (0x1377f6c00) [pid = 1063] [serial = 1100] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-loader.html] 16:59:54 INFO - MEMORY STAT | vsize 3776MB | residentFast 395MB | heapAllocated 124MB 16:59:54 INFO - 243 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js | took 9187ms 16:59:54 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 468] 16:59:54 INFO - ++DOMWINDOW == 41 (0x1208ac400) [pid = 1063] [serial = 1112] [outer = 0x0] 16:59:54 INFO - ++DOMWINDOW == 42 (0x1216c6c00) [pid = 1063] [serial = 1113] [outer = 0x1208ac400] 16:59:54 INFO - 244 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js 16:59:54 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 469] 16:59:54 INFO - ++DOMWINDOW == 43 (0x121ddb400) [pid = 1063] [serial = 1114] [outer = 0x0] 16:59:54 INFO - ++DOMWINDOW == 44 (0x127b00800) [pid = 1063] [serial = 1115] [outer = 0x121ddb400] 16:59:54 INFO - ++DOMWINDOW == 45 (0x12ea9ac00) [pid = 1063] [serial = 1116] [outer = 0x121ddb400] 16:59:54 INFO - ++DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 470] 16:59:54 INFO - ++DOMWINDOW == 46 (0x127274800) [pid = 1063] [serial = 1117] [outer = 0x0] 16:59:54 INFO - ++DOMWINDOW == 47 (0x1285cb800) [pid = 1063] [serial = 1118] [outer = 0x127274800] 16:59:55 INFO - ++DOCSHELL 0x12aee2200 == 15 [pid = 1063] [id = 471] 16:59:55 INFO - ++DOMWINDOW == 48 (0x129930c00) [pid = 1063] [serial = 1119] [outer = 0x0] 16:59:55 INFO - ++DOCSHELL 0x12bb2da00 == 16 [pid = 1063] [id = 472] 16:59:55 INFO - ++DOMWINDOW == 49 (0x129932000) [pid = 1063] [serial = 1120] [outer = 0x0] 16:59:55 INFO - ++DOMWINDOW == 50 (0x12996cc00) [pid = 1063] [serial = 1121] [outer = 0x129932000] 16:59:55 INFO - ++DOCSHELL 0x12c6db500 == 17 [pid = 1063] [id = 473] 16:59:55 INFO - ++DOMWINDOW == 51 (0x129930000) [pid = 1063] [serial = 1122] [outer = 0x0] 16:59:55 INFO - ++DOMWINDOW == 52 (0x12ca21800) [pid = 1063] [serial = 1123] [outer = 0x129930000] 16:59:55 INFO - ++DOMWINDOW == 53 (0x12d49c800) [pid = 1063] [serial = 1124] [outer = 0x129930c00] 16:59:55 INFO - ++DOMWINDOW == 54 (0x12d4cd000) [pid = 1063] [serial = 1125] [outer = 0x129932000] 16:59:55 INFO - ++DOMWINDOW == 55 (0x12d4ef000) [pid = 1063] [serial = 1126] [outer = 0x129930000] 16:59:55 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:59:55 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 16:59:55 INFO - ++DOCSHELL 0x13542e600 == 18 [pid = 1063] [id = 474] 16:59:55 INFO - ++DOMWINDOW == 56 (0x1333b6c00) [pid = 1063] [serial = 1127] [outer = 0x0] 16:59:55 INFO - ++DOMWINDOW == 57 (0x134862c00) [pid = 1063] [serial = 1128] [outer = 0x1333b6c00] 16:59:56 INFO - ++DOMWINDOW == 58 (0x1559e9800) [pid = 1063] [serial = 1129] [outer = 0x1333b6c00] 16:59:56 INFO - ++DOCSHELL 0x13659a100 == 19 [pid = 1063] [id = 475] 16:59:56 INFO - ++DOMWINDOW == 59 (0x135590800) [pid = 1063] [serial = 1130] [outer = 0x0] 16:59:56 INFO - ++DOMWINDOW == 60 (0x1355ea800) [pid = 1063] [serial = 1131] [outer = 0x135590800] 16:59:56 INFO - ++DOCSHELL 0x136599200 == 20 [pid = 1063] [id = 476] 16:59:56 INFO - ++DOMWINDOW == 61 (0x136211c00) [pid = 1063] [serial = 1132] [outer = 0x0] 16:59:56 INFO - ++DOMWINDOW == 62 (0x13621a400) [pid = 1063] [serial = 1133] [outer = 0x136211c00] 16:59:56 INFO - ++DOCSHELL 0x136a6fb00 == 21 [pid = 1063] [id = 477] 16:59:56 INFO - ++DOMWINDOW == 63 (0x12df19000) [pid = 1063] [serial = 1134] [outer = 0x0] 16:59:56 INFO - ++DOMWINDOW == 64 (0x12e21f800) [pid = 1063] [serial = 1135] [outer = 0x12df19000] 16:59:56 INFO - ++DOMWINDOW == 65 (0x1362d4c00) [pid = 1063] [serial = 1136] [outer = 0x12df19000] 16:59:56 INFO - ++DOMWINDOW == 66 (0x1355a2000) [pid = 1063] [serial = 1137] [outer = 0x135590800] 16:59:56 INFO - ++DOMWINDOW == 67 (0x1373a3000) [pid = 1063] [serial = 1138] [outer = 0x136211c00] 16:59:56 INFO - ++DOCSHELL 0x137081c00 == 22 [pid = 1063] [id = 478] 16:59:56 INFO - ++DOMWINDOW == 68 (0x1367ec000) [pid = 1063] [serial = 1139] [outer = 0x0] 16:59:56 INFO - ++DOMWINDOW == 69 (0x136a44400) [pid = 1063] [serial = 1140] [outer = 0x1367ec000] 16:59:56 INFO - ++DOCSHELL 0x13715ee00 == 23 [pid = 1063] [id = 479] 16:59:56 INFO - ++DOMWINDOW == 70 (0x137f6d000) [pid = 1063] [serial = 1141] [outer = 0x0] 16:59:56 INFO - ++DOMWINDOW == 71 (0x137fce000) [pid = 1063] [serial = 1142] [outer = 0x137f6d000] 17:00:00 INFO - --DOCSHELL 0x13659a100 == 22 [pid = 1063] [id = 475] 17:00:00 INFO - --DOCSHELL 0x137081c00 == 21 [pid = 1063] [id = 478] 17:00:00 INFO - --DOCSHELL 0x131a44b00 == 20 [pid = 1063] [id = 465] 17:00:00 INFO - --DOCSHELL 0x130927a00 == 19 [pid = 1063] [id = 464] 17:00:00 INFO - --DOCSHELL 0x133eccd00 == 18 [pid = 1063] [id = 466] 17:00:00 INFO - --DOMWINDOW == 70 (0x12b0f8400) [pid = 1063] [serial = 1055] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 69 (0x129900800) [pid = 1063] [serial = 1078] [outer = 0x0] [url = about:newtab] 17:00:00 INFO - --DOMWINDOW == 68 (0x12fda9800) [pid = 1063] [serial = 1086] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 67 (0x12bfb8800) [pid = 1063] [serial = 1084] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 66 (0x137013000) [pid = 1063] [serial = 1080] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 65 (0x136a4c000) [pid = 1063] [serial = 1079] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 64 (0x130982000) [pid = 1063] [serial = 1046] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 63 (0x12a01e400) [pid = 1063] [serial = 1044] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 62 (0x13543f400) [pid = 1063] [serial = 1090] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 61 (0x1553f1c00) [pid = 1063] [serial = 1088] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 60 (0x129fda000) [pid = 1063] [serial = 1082] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 59 (0x133384c00) [pid = 1063] [serial = 1081] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 58 (0x12996cc00) [pid = 1063] [serial = 1121] [outer = 0x129932000] [url = about:blank] 17:00:00 INFO - --DOCSHELL 0x13715ee00 == 17 [pid = 1063] [id = 479] 17:00:00 INFO - --DOMWINDOW == 57 (0x131bc1c00) [pid = 1063] [serial = 1095] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:00 INFO - --DOMWINDOW == 56 (0x133355000) [pid = 1063] [serial = 1098] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:00 INFO - --DOMWINDOW == 55 (0x12bfa2c00) [pid = 1063] [serial = 1091] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 54 (0x130aa9800) [pid = 1063] [serial = 1092] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 53 (0x127b00800) [pid = 1063] [serial = 1115] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 52 (0x13621a400) [pid = 1063] [serial = 1133] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 51 (0x12ca21800) [pid = 1063] [serial = 1123] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 50 (0x134862c00) [pid = 1063] [serial = 1128] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 49 (0x12e21f800) [pid = 1063] [serial = 1135] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 48 (0x1355ea800) [pid = 1063] [serial = 1131] [outer = 0x0] [url = about:blank] 17:00:00 INFO - --DOMWINDOW == 47 (0x131bc1400) [pid = 1063] [serial = 1093] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 17:00:00 INFO - --DOMWINDOW == 46 (0x13713bc00) [pid = 1063] [serial = 1104] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-workers.html] 17:00:00 INFO - --DOMWINDOW == 45 (0x130930000) [pid = 1063] [serial = 1108] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml-external.html] 17:00:00 INFO - --DOMWINDOW == 44 (0x12c26c400) [pid = 1063] [serial = 1109] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-empty-getelementbyid.html] 17:00:00 INFO - --DOMWINDOW == 43 (0x136517400) [pid = 1063] [serial = 1110] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-canvas-css.html] 17:00:00 INFO - --DOMWINDOW == 42 (0x133365c00) [pid = 1063] [serial = 1111] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 17:00:00 INFO - --DOCSHELL 0x136599200 == 16 [pid = 1063] [id = 476] 17:00:01 INFO - --DOMWINDOW == 41 (0x13347e400) [pid = 1063] [serial = 1097] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:01 INFO - --DOMWINDOW == 40 (0x137354000) [pid = 1063] [serial = 1099] [outer = 0x0] [url = about:blank] 17:00:01 INFO - --DOMWINDOW == 39 (0x135590800) [pid = 1063] [serial = 1130] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:01 INFO - --DOMWINDOW == 38 (0x1367ec000) [pid = 1063] [serial = 1139] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:01 INFO - MEMORY STAT | vsize 3797MB | residentFast 414MB | heapAllocated 129MB 17:00:01 INFO - 245 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js | took 6833ms 17:00:01 INFO - ++DOCSHELL 0x11fbe3600 == 17 [pid = 1063] [id = 480] 17:00:01 INFO - ++DOMWINDOW == 39 (0x120541800) [pid = 1063] [serial = 1143] [outer = 0x0] 17:00:01 INFO - ++DOMWINDOW == 40 (0x1216bac00) [pid = 1063] [serial = 1144] [outer = 0x120541800] 17:00:01 INFO - 246 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js 17:00:01 INFO - ++DOCSHELL 0x129f99400 == 18 [pid = 1063] [id = 481] 17:00:01 INFO - ++DOMWINDOW == 41 (0x128738000) [pid = 1063] [serial = 1145] [outer = 0x0] 17:00:01 INFO - ++DOMWINDOW == 42 (0x12965a000) [pid = 1063] [serial = 1146] [outer = 0x128738000] 17:00:01 INFO - ++DOMWINDOW == 43 (0x12996c400) [pid = 1063] [serial = 1147] [outer = 0x128738000] 17:00:02 INFO - ++DOCSHELL 0x12bf3f600 == 19 [pid = 1063] [id = 482] 17:00:02 INFO - ++DOMWINDOW == 44 (0x12963d000) [pid = 1063] [serial = 1148] [outer = 0x0] 17:00:02 INFO - ++DOMWINDOW == 45 (0x12996cc00) [pid = 1063] [serial = 1149] [outer = 0x12963d000] 17:00:02 INFO - ++DOMWINDOW == 46 (0x1299ea000) [pid = 1063] [serial = 1150] [outer = 0x12963d000] 17:00:02 INFO - ++DOCSHELL 0x12ca29000 == 20 [pid = 1063] [id = 483] 17:00:02 INFO - ++DOMWINDOW == 47 (0x12a03b400) [pid = 1063] [serial = 1151] [outer = 0x0] 17:00:02 INFO - ++DOMWINDOW == 48 (0x12a0bf000) [pid = 1063] [serial = 1152] [outer = 0x12a03b400] 17:00:03 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.js, line 12: ReferenceError: bogus is not defined 17:00:03 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 17:00:04 INFO - --DOCSHELL 0x1201ad000 == 19 [pid = 1063] [id = 468] 17:00:04 INFO - --DOCSHELL 0x12ca29000 == 18 [pid = 1063] [id = 483] 17:00:04 INFO - --DOCSHELL 0x128ead000 == 17 [pid = 1063] [id = 469] 17:00:04 INFO - --DOCSHELL 0x11fbe2700 == 16 [pid = 1063] [id = 470] 17:00:04 INFO - --DOCSHELL 0x136a6fb00 == 15 [pid = 1063] [id = 477] 17:00:04 INFO - --DOCSHELL 0x12bb2da00 == 14 [pid = 1063] [id = 472] 17:00:04 INFO - --DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 473] 17:00:04 INFO - --DOCSHELL 0x12aee2200 == 12 [pid = 1063] [id = 471] 17:00:04 INFO - --DOCSHELL 0x13542e600 == 11 [pid = 1063] [id = 474] 17:00:04 INFO - --DOMWINDOW == 47 (0x136a44400) [pid = 1063] [serial = 1140] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 46 (0x1355a2000) [pid = 1063] [serial = 1137] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:04 INFO - --DOMWINDOW == 45 (0x12d49c800) [pid = 1063] [serial = 1124] [outer = 0x129930c00] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 44 (0x12d4cd000) [pid = 1063] [serial = 1125] [outer = 0x129932000] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 43 (0x129930c00) [pid = 1063] [serial = 1119] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 42 (0x129932000) [pid = 1063] [serial = 1120] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 41 (0x12965a000) [pid = 1063] [serial = 1146] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 40 (0x12996cc00) [pid = 1063] [serial = 1149] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 39 (0x121ddb400) [pid = 1063] [serial = 1114] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:00:04 INFO - --DOMWINDOW == 38 (0x12df19000) [pid = 1063] [serial = 1134] [outer = 0x0] [url = about:newtab] 17:00:04 INFO - --DOMWINDOW == 37 (0x1208ac400) [pid = 1063] [serial = 1112] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 36 (0x1216c6c00) [pid = 1063] [serial = 1113] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 35 (0x12d4ef000) [pid = 1063] [serial = 1126] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 34 (0x129930000) [pid = 1063] [serial = 1122] [outer = 0x0] [url = about:blank] 17:00:04 INFO - --DOMWINDOW == 33 (0x1333b6c00) [pid = 1063] [serial = 1127] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:00:04 INFO - --DOMWINDOW == 32 (0x137f6d000) [pid = 1063] [serial = 1141] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:04 INFO - --DOMWINDOW == 31 (0x136211c00) [pid = 1063] [serial = 1132] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:04 INFO - --DOMWINDOW == 30 (0x12ea9ac00) [pid = 1063] [serial = 1116] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:00:04 INFO - --DOMWINDOW == 29 (0x1559e9800) [pid = 1063] [serial = 1129] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:00:04 INFO - MEMORY STAT | vsize 3765MB | residentFast 385MB | heapAllocated 120MB 17:00:04 INFO - 247 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js | took 3226ms 17:00:04 INFO - ++DOCSHELL 0x11fbe0900 == 12 [pid = 1063] [id = 484] 17:00:04 INFO - ++DOMWINDOW == 30 (0x1208ac400) [pid = 1063] [serial = 1153] [outer = 0x0] 17:00:04 INFO - ++DOMWINDOW == 31 (0x1216a2800) [pid = 1063] [serial = 1154] [outer = 0x1208ac400] 17:00:05 INFO - 248 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js 17:00:05 INFO - MEMORY STAT | vsize 3767MB | residentFast 385MB | heapAllocated 120MB 17:00:05 INFO - 249 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js | took 183ms 17:00:05 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 485] 17:00:05 INFO - ++DOMWINDOW == 32 (0x1299fe000) [pid = 1063] [serial = 1155] [outer = 0x0] 17:00:05 INFO - ++DOMWINDOW == 33 (0x129e8d000) [pid = 1063] [serial = 1156] [outer = 0x1299fe000] 17:00:05 INFO - 250 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js 17:00:05 INFO - ++DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 486] 17:00:05 INFO - ++DOMWINDOW == 34 (0x12a178c00) [pid = 1063] [serial = 1157] [outer = 0x0] 17:00:05 INFO - ++DOMWINDOW == 35 (0x12bb66000) [pid = 1063] [serial = 1158] [outer = 0x12a178c00] 17:00:05 INFO - ++DOMWINDOW == 36 (0x12be25c00) [pid = 1063] [serial = 1159] [outer = 0x12a178c00] 17:00:05 INFO - ++DOCSHELL 0x12c6db500 == 15 [pid = 1063] [id = 487] 17:00:05 INFO - ++DOMWINDOW == 37 (0x12ae44400) [pid = 1063] [serial = 1160] [outer = 0x0] 17:00:05 INFO - ++DOMWINDOW == 38 (0x12c26c400) [pid = 1063] [serial = 1161] [outer = 0x12ae44400] 17:00:05 INFO - ++DOMWINDOW == 39 (0x12bbc3c00) [pid = 1063] [serial = 1162] [outer = 0x12ae44400] 17:00:06 INFO - ++DOCSHELL 0x12ca29000 == 16 [pid = 1063] [id = 488] 17:00:06 INFO - ++DOMWINDOW == 40 (0x133355800) [pid = 1063] [serial = 1163] [outer = 0x0] 17:00:06 INFO - ++DOMWINDOW == 41 (0x133384000) [pid = 1063] [serial = 1164] [outer = 0x133355800] 17:00:08 INFO - ++DOMWINDOW == 42 (0x13623b400) [pid = 1063] [serial = 1165] [outer = 0x12a178c00] 17:00:08 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:09 INFO - --DOCSHELL 0x11fbe0900 == 15 [pid = 1063] [id = 484] 17:00:09 INFO - --DOCSHELL 0x11fbe3600 == 14 [pid = 1063] [id = 480] 17:00:09 INFO - --DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 487] 17:00:09 INFO - --DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 481] 17:00:09 INFO - --DOCSHELL 0x12bf3f600 == 11 [pid = 1063] [id = 482] 17:00:09 INFO - --DOCSHELL 0x12ca29000 == 10 [pid = 1063] [id = 488] 17:00:09 INFO - --DOMWINDOW == 41 (0x1362d4c00) [pid = 1063] [serial = 1136] [outer = 0x0] [url = about:newtab] 17:00:09 INFO - --DOMWINDOW == 40 (0x137fce000) [pid = 1063] [serial = 1142] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 39 (0x1373a3000) [pid = 1063] [serial = 1138] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:09 INFO - --DOMWINDOW == 38 (0x12a03b400) [pid = 1063] [serial = 1151] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:09 INFO - --DOMWINDOW == 37 (0x120541800) [pid = 1063] [serial = 1143] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 36 (0x1208ac400) [pid = 1063] [serial = 1153] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 35 (0x128738000) [pid = 1063] [serial = 1145] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 17:00:09 INFO - --DOMWINDOW == 34 (0x127274800) [pid = 1063] [serial = 1117] [outer = 0x0] [url = chrome://browser/content/browser.xul] 17:00:09 INFO - --DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 1148] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:09 INFO - --DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 1144] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 31 (0x1216a2800) [pid = 1063] [serial = 1154] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 30 (0x12bb66000) [pid = 1063] [serial = 1158] [outer = 0x0] [url = about:blank] 17:00:09 INFO - --DOMWINDOW == 29 (0x12c26c400) [pid = 1063] [serial = 1161] [outer = 0x0] [url = about:blank] 17:00:10 INFO - MEMORY STAT | vsize 3786MB | residentFast 403MB | heapAllocated 123MB 17:00:10 INFO - 251 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js | took 4587ms 17:00:10 INFO - ++DOCSHELL 0x11fbe2700 == 11 [pid = 1063] [id = 489] 17:00:10 INFO - ++DOMWINDOW == 30 (0x12082f800) [pid = 1063] [serial = 1166] [outer = 0x0] 17:00:10 INFO - ++DOMWINDOW == 31 (0x1209c4c00) [pid = 1063] [serial = 1167] [outer = 0x12082f800] 17:00:10 INFO - 252 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js 17:00:10 INFO - ++DOCSHELL 0x12bb31600 == 12 [pid = 1063] [id = 490] 17:00:10 INFO - ++DOMWINDOW == 32 (0x121763c00) [pid = 1063] [serial = 1168] [outer = 0x0] 17:00:10 INFO - ++DOMWINDOW == 33 (0x127fe0c00) [pid = 1063] [serial = 1169] [outer = 0x121763c00] 17:00:10 INFO - ++DOMWINDOW == 34 (0x129900c00) [pid = 1063] [serial = 1170] [outer = 0x121763c00] 17:00:10 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 17:00:10 INFO - ++DOCSHELL 0x12092a600 == 13 [pid = 1063] [id = 491] 17:00:10 INFO - ++DOMWINDOW == 35 (0x127fe0400) [pid = 1063] [serial = 1171] [outer = 0x0] 17:00:10 INFO - ++DOMWINDOW == 36 (0x129a2c800) [pid = 1063] [serial = 1172] [outer = 0x127fe0400] 17:00:10 INFO - ++DOMWINDOW == 37 (0x129900400) [pid = 1063] [serial = 1173] [outer = 0x127fe0400] 17:00:10 INFO - ++DOCSHELL 0x12d4c0200 == 14 [pid = 1063] [id = 492] 17:00:10 INFO - ++DOMWINDOW == 38 (0x12d5a6c00) [pid = 1063] [serial = 1174] [outer = 0x0] 17:00:10 INFO - ++DOMWINDOW == 39 (0x12df19000) [pid = 1063] [serial = 1175] [outer = 0x12d5a6c00] 17:00:11 INFO - ++DOMWINDOW == 40 (0x12a1e1400) [pid = 1063] [serial = 1176] [outer = 0x121763c00] 17:00:11 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:11 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 17:00:12 INFO - --DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 485] 17:00:12 INFO - --DOCSHELL 0x12d4c0200 == 12 [pid = 1063] [id = 492] 17:00:12 INFO - --DOCSHELL 0x129ea8100 == 11 [pid = 1063] [id = 486] 17:00:12 INFO - --DOMWINDOW == 39 (0x1285cb800) [pid = 1063] [serial = 1118] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 38 (0x1299ea000) [pid = 1063] [serial = 1150] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:12 INFO - --DOMWINDOW == 37 (0x12a0bf000) [pid = 1063] [serial = 1152] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 36 (0x12996c400) [pid = 1063] [serial = 1147] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 17:00:12 INFO - ++DOCSHELL 0x11fb1f800 == 12 [pid = 1063] [id = 493] 17:00:12 INFO - ++DOMWINDOW == 37 (0x11f8ae000) [pid = 1063] [serial = 1177] [outer = 0x0] 17:00:12 INFO - ++DOMWINDOW == 38 (0x11fe61400) [pid = 1063] [serial = 1178] [outer = 0x11f8ae000] 17:00:12 INFO - --DOMWINDOW == 37 (0x127fe0c00) [pid = 1063] [serial = 1169] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 36 (0x129e8d000) [pid = 1063] [serial = 1156] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 35 (0x129a2c800) [pid = 1063] [serial = 1172] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 34 (0x133355800) [pid = 1063] [serial = 1163] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:12 INFO - --DOMWINDOW == 33 (0x12ae44400) [pid = 1063] [serial = 1160] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:12 INFO - --DOMWINDOW == 32 (0x12a178c00) [pid = 1063] [serial = 1157] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 17:00:12 INFO - --DOMWINDOW == 31 (0x1299fe000) [pid = 1063] [serial = 1155] [outer = 0x0] [url = about:blank] 17:00:12 INFO - --DOMWINDOW == 30 (0x13623b400) [pid = 1063] [serial = 1165] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 17:00:12 INFO - --DOMWINDOW == 29 (0x12be25c00) [pid = 1063] [serial = 1159] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 17:00:12 INFO - ++DOMWINDOW == 30 (0x120541800) [pid = 1063] [serial = 1179] [outer = 0x11f8ae000] 17:00:12 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 17:00:12 INFO - ++DOCSHELL 0x1201ad000 == 13 [pid = 1063] [id = 494] 17:00:12 INFO - ++DOMWINDOW == 31 (0x11f9a5c00) [pid = 1063] [serial = 1180] [outer = 0x0] 17:00:12 INFO - ++DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1181] [outer = 0x11f9a5c00] 17:00:13 INFO - ++DOMWINDOW == 33 (0x127274800) [pid = 1063] [serial = 1182] [outer = 0x11f9a5c00] 17:00:13 INFO - ++DOCSHELL 0x12c6dd800 == 14 [pid = 1063] [id = 495] 17:00:13 INFO - ++DOMWINDOW == 34 (0x12c48e800) [pid = 1063] [serial = 1183] [outer = 0x0] 17:00:13 INFO - ++DOMWINDOW == 35 (0x12c48ec00) [pid = 1063] [serial = 1184] [outer = 0x12c48e800] 17:00:14 INFO - ++DOMWINDOW == 36 (0x12c8e8800) [pid = 1063] [serial = 1185] [outer = 0x11f8ae000] 17:00:14 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:14 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 17:00:14 INFO - --DOCSHELL 0x12092a600 == 13 [pid = 1063] [id = 491] 17:00:14 INFO - --DOCSHELL 0x12bb31600 == 12 [pid = 1063] [id = 490] 17:00:14 INFO - --DOCSHELL 0x12c6dd800 == 11 [pid = 1063] [id = 495] 17:00:14 INFO - --DOMWINDOW == 35 (0x133384000) [pid = 1063] [serial = 1164] [outer = 0x0] [url = about:blank] 17:00:14 INFO - --DOMWINDOW == 34 (0x12bbc3c00) [pid = 1063] [serial = 1162] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:14 INFO - --DOMWINDOW == 33 (0x129900c00) [pid = 1063] [serial = 1170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:14 INFO - --DOMWINDOW == 32 (0x11fe61400) [pid = 1063] [serial = 1178] [outer = 0x0] [url = about:blank] 17:00:14 INFO - --DOMWINDOW == 31 (0x127f4e800) [pid = 1063] [serial = 1181] [outer = 0x0] [url = about:blank] 17:00:14 INFO - --DOMWINDOW == 30 (0x121763c00) [pid = 1063] [serial = 1168] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:15 INFO - --DOMWINDOW == 29 (0x12a1e1400) [pid = 1063] [serial = 1176] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:15 INFO - MEMORY STAT | vsize 3790MB | residentFast 405MB | heapAllocated 121MB 17:00:15 INFO - 253 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js | took 4950ms 17:00:15 INFO - ++DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 496] 17:00:15 INFO - ++DOMWINDOW == 30 (0x120996c00) [pid = 1063] [serial = 1186] [outer = 0x0] 17:00:15 INFO - ++DOMWINDOW == 31 (0x121747c00) [pid = 1063] [serial = 1187] [outer = 0x120996c00] 17:00:15 INFO - 254 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js 17:00:15 INFO - ++DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 497] 17:00:15 INFO - ++DOMWINDOW == 32 (0x120065000) [pid = 1063] [serial = 1188] [outer = 0x0] 17:00:15 INFO - ++DOMWINDOW == 33 (0x1284e0400) [pid = 1063] [serial = 1189] [outer = 0x120065000] 17:00:15 INFO - ++DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 498] 17:00:15 INFO - ++DOMWINDOW == 34 (0x127fb7800) [pid = 1063] [serial = 1190] [outer = 0x0] 17:00:15 INFO - ++DOMWINDOW == 35 (0x129f83800) [pid = 1063] [serial = 1191] [outer = 0x127fb7800] 17:00:15 INFO - ++DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1192] [outer = 0x127fb7800] 17:00:15 INFO - ++DOCSHELL 0x12c6dec00 == 15 [pid = 1063] [id = 499] 17:00:15 INFO - ++DOMWINDOW == 37 (0x1317f7800) [pid = 1063] [serial = 1193] [outer = 0x0] 17:00:15 INFO - ++DOMWINDOW == 38 (0x131a86000) [pid = 1063] [serial = 1194] [outer = 0x1317f7800] 17:00:16 INFO - ++DOMWINDOW == 39 (0x12a178c00) [pid = 1063] [serial = 1195] [outer = 0x120065000] 17:00:16 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:16 INFO - ++DOMWINDOW == 40 (0x12bf01c00) [pid = 1063] [serial = 1196] [outer = 0x120065000] 17:00:16 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:17 INFO - --DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 489] 17:00:17 INFO - --DOCSHELL 0x11fb1f800 == 13 [pid = 1063] [id = 493] 17:00:17 INFO - --DOCSHELL 0x12c6dec00 == 12 [pid = 1063] [id = 499] 17:00:17 INFO - --DOCSHELL 0x1201ad000 == 11 [pid = 1063] [id = 494] 17:00:17 INFO - --DOMWINDOW == 39 (0x120541800) [pid = 1063] [serial = 1179] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:17 INFO - --DOMWINDOW == 38 (0x1209c4c00) [pid = 1063] [serial = 1167] [outer = 0x0] [url = about:blank] 17:00:17 INFO - --DOMWINDOW == 37 (0x129f83800) [pid = 1063] [serial = 1191] [outer = 0x0] [url = about:blank] 17:00:17 INFO - --DOMWINDOW == 36 (0x12a178c00) [pid = 1063] [serial = 1195] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 17:00:17 INFO - --DOMWINDOW == 35 (0x11f9a5c00) [pid = 1063] [serial = 1180] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:17 INFO - --DOMWINDOW == 34 (0x12c48e800) [pid = 1063] [serial = 1183] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:17 INFO - --DOMWINDOW == 33 (0x12d5a6c00) [pid = 1063] [serial = 1174] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:17 INFO - --DOMWINDOW == 32 (0x127fe0400) [pid = 1063] [serial = 1171] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:17 INFO - --DOMWINDOW == 31 (0x11f8ae000) [pid = 1063] [serial = 1177] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:17 INFO - --DOMWINDOW == 30 (0x12082f800) [pid = 1063] [serial = 1166] [outer = 0x0] [url = about:blank] 17:00:17 INFO - --DOMWINDOW == 29 (0x12c8e8800) [pid = 1063] [serial = 1185] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 17:00:18 INFO - MEMORY STAT | vsize 3790MB | residentFast 404MB | heapAllocated 121MB 17:00:18 INFO - 255 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js | took 2815ms 17:00:18 INFO - ++DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 500] 17:00:18 INFO - ++DOMWINDOW == 30 (0x127fe0000) [pid = 1063] [serial = 1197] [outer = 0x0] 17:00:18 INFO - ++DOMWINDOW == 31 (0x128501c00) [pid = 1063] [serial = 1198] [outer = 0x127fe0000] 17:00:18 INFO - 256 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js 17:00:18 INFO - ++DOCSHELL 0x12c6db000 == 13 [pid = 1063] [id = 501] 17:00:18 INFO - ++DOMWINDOW == 32 (0x129900c00) [pid = 1063] [serial = 1199] [outer = 0x0] 17:00:18 INFO - ++DOMWINDOW == 33 (0x12a01e400) [pid = 1063] [serial = 1200] [outer = 0x129900c00] 17:00:18 INFO - ++DOCSHELL 0x12c6dc400 == 14 [pid = 1063] [id = 502] 17:00:18 INFO - ++DOMWINDOW == 34 (0x129f83800) [pid = 1063] [serial = 1201] [outer = 0x0] 17:00:18 INFO - ++DOMWINDOW == 35 (0x12a178c00) [pid = 1063] [serial = 1202] [outer = 0x129f83800] 17:00:18 INFO - ++DOMWINDOW == 36 (0x12b0f8800) [pid = 1063] [serial = 1203] [outer = 0x129f83800] 17:00:18 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 503] 17:00:18 INFO - ++DOMWINDOW == 37 (0x1334d2c00) [pid = 1063] [serial = 1204] [outer = 0x0] 17:00:18 INFO - ++DOMWINDOW == 38 (0x1334d4800) [pid = 1063] [serial = 1205] [outer = 0x1334d2c00] 17:00:19 INFO - ++DOMWINDOW == 39 (0x12bf01800) [pid = 1063] [serial = 1206] [outer = 0x129900c00] 17:00:19 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:20 INFO - --DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 497] 17:00:20 INFO - --DOCSHELL 0x12bb2f800 == 13 [pid = 1063] [id = 498] 17:00:20 INFO - --DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 496] 17:00:20 INFO - --DOCSHELL 0x12cb89600 == 11 [pid = 1063] [id = 503] 17:00:20 INFO - --DOMWINDOW == 38 (0x12df19000) [pid = 1063] [serial = 1175] [outer = 0x0] [url = about:blank] 17:00:20 INFO - --DOMWINDOW == 37 (0x129900400) [pid = 1063] [serial = 1173] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:20 INFO - --DOMWINDOW == 36 (0x12c48ec00) [pid = 1063] [serial = 1184] [outer = 0x0] [url = about:blank] 17:00:20 INFO - --DOMWINDOW == 35 (0x127274800) [pid = 1063] [serial = 1182] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:20 INFO - --DOMWINDOW == 34 (0x12bf01c00) [pid = 1063] [serial = 1196] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 17:00:20 INFO - --DOMWINDOW == 33 (0x1284e0400) [pid = 1063] [serial = 1189] [outer = 0x0] [url = about:blank] 17:00:20 INFO - --DOMWINDOW == 32 (0x121747c00) [pid = 1063] [serial = 1187] [outer = 0x0] [url = about:blank] 17:00:20 INFO - --DOMWINDOW == 31 (0x12a178c00) [pid = 1063] [serial = 1202] [outer = 0x0] [url = about:blank] 17:00:20 INFO - --DOMWINDOW == 30 (0x127fb7800) [pid = 1063] [serial = 1190] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:20 INFO - --DOMWINDOW == 29 (0x1317f7800) [pid = 1063] [serial = 1193] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:20 INFO - --DOMWINDOW == 28 (0x120065000) [pid = 1063] [serial = 1188] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 17:00:20 INFO - --DOMWINDOW == 27 (0x120996c00) [pid = 1063] [serial = 1186] [outer = 0x0] [url = about:blank] 17:00:20 INFO - MEMORY STAT | vsize 3791MB | residentFast 406MB | heapAllocated 121MB 17:00:20 INFO - 257 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js | took 2742ms 17:00:20 INFO - ++DOCSHELL 0x1201fdb00 == 12 [pid = 1063] [id = 504] 17:00:20 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 1207] [outer = 0x0] 17:00:20 INFO - ++DOMWINDOW == 29 (0x1216a2800) [pid = 1063] [serial = 1208] [outer = 0x120917c00] 17:00:21 INFO - 258 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js 17:00:21 INFO - ++DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 505] 17:00:21 INFO - ++DOMWINDOW == 30 (0x12031e800) [pid = 1063] [serial = 1209] [outer = 0x0] 17:00:21 INFO - ++DOMWINDOW == 31 (0x127fb7800) [pid = 1063] [serial = 1210] [outer = 0x12031e800] 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/tilt/tilt.js, line 263: ReferenceError: reference to undefined property this.visualizers[this.currentWindowId] 17:00:21 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 506] 17:00:21 INFO - ++DOMWINDOW == 32 (0x12963d000) [pid = 1063] [serial = 1211] [outer = 0x0] 17:00:21 INFO - ++DOMWINDOW == 33 (0x129e8d000) [pid = 1063] [serial = 1212] [outer = 0x12963d000] 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js, line 949: ReferenceError: reference to undefined property aPacket.type 17:00:21 INFO - ++DOMWINDOW == 34 (0x12a01ec00) [pid = 1063] [serial = 1213] [outer = 0x12963d000] 17:00:21 INFO - ++DOCSHELL 0x12cb89100 == 15 [pid = 1063] [id = 507] 17:00:21 INFO - ++DOMWINDOW == 35 (0x12e2b9800) [pid = 1063] [serial = 1214] [outer = 0x0] 17:00:21 INFO - ++DOMWINDOW == 36 (0x12eb83400) [pid = 1063] [serial = 1215] [outer = 0x12e2b9800] 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/gcli/settings.js, line 185: ReferenceError: reference to undefined property prefSpec.ignoreTypeDifference 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/gcli/commands/commands.js, line 293: ReferenceError: reference to undefined property this.paramSpec.manual 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/gcli/system.js, line 366: ReferenceError: reference to undefined property command.front 17:00:21 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 329: ReferenceError: reference to undefined property this._splitConsole 17:00:22 INFO - ++DOMWINDOW == 37 (0x1308a7c00) [pid = 1063] [serial = 1216] [outer = 0x12031e800] 17:00:22 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:22 INFO - JavaScript strict warning: chrome://mochikit/content/tests/SimpleTest/TestRunner.js, line 237: ReferenceError: reference to undefined property message.level 17:00:22 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 6: ReferenceError: assignment to undeclared variable foobarBug601177strictError 17:00:22 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 8: TypeError: window.foobarBug601177exception is not a function 17:00:22 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 17:00:22 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html, line 8: ReferenceError: reference to undefined property window.undefinedPropertyBug601177 17:00:22 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 17:00:23 INFO - --DOCSHELL 0x12c6db000 == 14 [pid = 1063] [id = 501] 17:00:23 INFO - --DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 502] 17:00:23 INFO - --DOCSHELL 0x12cb89100 == 12 [pid = 1063] [id = 507] 17:00:23 INFO - --DOCSHELL 0x121c23e00 == 11 [pid = 1063] [id = 500] 17:00:23 INFO - --DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1192] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:23 INFO - --DOMWINDOW == 35 (0x131a86000) [pid = 1063] [serial = 1194] [outer = 0x0] [url = about:blank] 17:00:23 INFO - --DOMWINDOW == 34 (0x129e8d000) [pid = 1063] [serial = 1212] [outer = 0x0] [url = about:blank] 17:00:23 INFO - --DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 1198] [outer = 0x0] [url = about:blank] 17:00:23 INFO - --DOMWINDOW == 32 (0x12a01e400) [pid = 1063] [serial = 1200] [outer = 0x0] [url = about:blank] 17:00:23 INFO - --DOMWINDOW == 31 (0x1334d2c00) [pid = 1063] [serial = 1204] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:23 INFO - --DOMWINDOW == 30 (0x129f83800) [pid = 1063] [serial = 1201] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:23 INFO - --DOMWINDOW == 29 (0x127fe0000) [pid = 1063] [serial = 1197] [outer = 0x0] [url = about:blank] 17:00:23 INFO - --DOMWINDOW == 28 (0x129900c00) [pid = 1063] [serial = 1199] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 17:00:23 INFO - --DOMWINDOW == 27 (0x12bf01800) [pid = 1063] [serial = 1206] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 17:00:23 INFO - MEMORY STAT | vsize 3796MB | residentFast 410MB | heapAllocated 125MB 17:00:23 INFO - 259 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js | took 2787ms 17:00:23 INFO - ++DOCSHELL 0x1201fd600 == 12 [pid = 1063] [id = 508] 17:00:23 INFO - ++DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 1217] [outer = 0x0] 17:00:23 INFO - ++DOMWINDOW == 29 (0x121ddb400) [pid = 1063] [serial = 1218] [outer = 0x1216bac00] 17:00:24 INFO - 260 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js 17:00:24 INFO - ++DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 509] 17:00:24 INFO - ++DOMWINDOW == 30 (0x127fe0000) [pid = 1063] [serial = 1219] [outer = 0x0] 17:00:24 INFO - ++DOMWINDOW == 31 (0x128501c00) [pid = 1063] [serial = 1220] [outer = 0x127fe0000] 17:00:24 INFO - ++DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 510] 17:00:24 INFO - ++DOMWINDOW == 32 (0x1284e0400) [pid = 1063] [serial = 1221] [outer = 0x0] 17:00:24 INFO - ++DOMWINDOW == 33 (0x129f83800) [pid = 1063] [serial = 1222] [outer = 0x1284e0400] 17:00:24 INFO - ++DOMWINDOW == 34 (0x12a01e400) [pid = 1063] [serial = 1223] [outer = 0x1284e0400] 17:00:24 INFO - ++DOCSHELL 0x12cb89b00 == 15 [pid = 1063] [id = 511] 17:00:24 INFO - ++DOMWINDOW == 35 (0x130a72800) [pid = 1063] [serial = 1224] [outer = 0x0] 17:00:24 INFO - ++DOMWINDOW == 36 (0x130aa9400) [pid = 1063] [serial = 1225] [outer = 0x130a72800] 17:00:26 INFO - console.debug: 17:00:26 INFO - rectNode 17:00:26 INFO - DOMRect 17:00:26 INFO - - prototype DOMRect 17:00:26 INFO - - height = 20 17:00:26 INFO - - width = 7433.33349609375 17:00:26 INFO - - x = 0 17:00:26 INFO - - y = 167 17:00:26 INFO - - prototype DOMRectReadOnly 17:00:26 INFO - - bottom = 187 17:00:26 INFO - - left = 0 17:00:26 INFO - - right = 7433.33349609375 17:00:26 INFO - - top = 167 17:00:26 INFO - - prototype Object 17:00:26 INFO - rectOutput 17:00:26 INFO - DOMRect 17:00:26 INFO - - prototype DOMRect 17:00:26 INFO - - height = 178 17:00:26 INFO - - width = 1200 17:00:26 INFO - - x = 0 17:00:26 INFO - - y = 24 17:00:26 INFO - - prototype DOMRectReadOnly 17:00:26 INFO - - bottom = 202 17:00:26 INFO - - left = 0 17:00:26 INFO - - right = 1200 17:00:26 INFO - - top = 24 17:00:26 INFO - - prototype Object 17:00:26 INFO - console.log: scrollNode scrollHeight 2060 scrollTop 1897 clientHeight 163 17:00:26 INFO - --DOCSHELL 0x1201fdb00 == 14 [pid = 1063] [id = 504] 17:00:26 INFO - --DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 505] 17:00:26 INFO - --DOCSHELL 0x12cb89b00 == 12 [pid = 1063] [id = 511] 17:00:26 INFO - --DOCSHELL 0x12c6dd300 == 11 [pid = 1063] [id = 506] 17:00:26 INFO - --DOMWINDOW == 35 (0x12b0f8800) [pid = 1063] [serial = 1203] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:26 INFO - --DOMWINDOW == 34 (0x1334d4800) [pid = 1063] [serial = 1205] [outer = 0x0] [url = about:blank] 17:00:26 INFO - --DOMWINDOW == 33 (0x120917c00) [pid = 1063] [serial = 1207] [outer = 0x0] [url = about:blank] 17:00:26 INFO - --DOMWINDOW == 32 (0x12031e800) [pid = 1063] [serial = 1209] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 17:00:26 INFO - --DOMWINDOW == 31 (0x12e2b9800) [pid = 1063] [serial = 1214] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:26 INFO - --DOMWINDOW == 30 (0x12963d000) [pid = 1063] [serial = 1211] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:26 INFO - --DOMWINDOW == 29 (0x1216a2800) [pid = 1063] [serial = 1208] [outer = 0x0] [url = about:blank] 17:00:26 INFO - --DOMWINDOW == 28 (0x127fb7800) [pid = 1063] [serial = 1210] [outer = 0x0] [url = about:blank] 17:00:26 INFO - --DOMWINDOW == 27 (0x129f83800) [pid = 1063] [serial = 1222] [outer = 0x0] [url = about:blank] 17:00:26 INFO - --DOMWINDOW == 26 (0x1308a7c00) [pid = 1063] [serial = 1216] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 17:00:27 INFO - MEMORY STAT | vsize 3795MB | residentFast 411MB | heapAllocated 125MB 17:00:27 INFO - 261 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js | took 3041ms 17:00:27 INFO - ++DOCSHELL 0x11fbe0900 == 12 [pid = 1063] [id = 512] 17:00:27 INFO - ++DOMWINDOW == 27 (0x1208ac800) [pid = 1063] [serial = 1226] [outer = 0x0] 17:00:27 INFO - ++DOMWINDOW == 28 (0x1209c4c00) [pid = 1063] [serial = 1227] [outer = 0x1208ac800] 17:00:27 INFO - 262 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js 17:00:27 INFO - ++DOCSHELL 0x121c8e900 == 13 [pid = 1063] [id = 513] 17:00:27 INFO - ++DOMWINDOW == 29 (0x120996c00) [pid = 1063] [serial = 1228] [outer = 0x0] 17:00:27 INFO - ++DOMWINDOW == 30 (0x127fe0400) [pid = 1063] [serial = 1229] [outer = 0x120996c00] 17:00:27 INFO - ++DOMWINDOW == 31 (0x129e8d000) [pid = 1063] [serial = 1230] [outer = 0x120996c00] 17:00:27 INFO - ++DOCSHELL 0x12c6dbf00 == 14 [pid = 1063] [id = 514] 17:00:27 INFO - ++DOMWINDOW == 32 (0x127fb7800) [pid = 1063] [serial = 1231] [outer = 0x0] 17:00:27 INFO - ++DOMWINDOW == 33 (0x12a178c00) [pid = 1063] [serial = 1232] [outer = 0x127fb7800] 17:00:27 INFO - ++DOMWINDOW == 34 (0x129917000) [pid = 1063] [serial = 1233] [outer = 0x127fb7800] 17:00:27 INFO - ++DOCSHELL 0x12ca2d600 == 15 [pid = 1063] [id = 515] 17:00:27 INFO - ++DOMWINDOW == 35 (0x1308a7c00) [pid = 1063] [serial = 1234] [outer = 0x0] 17:00:27 INFO - ++DOMWINDOW == 36 (0x1308b9800) [pid = 1063] [serial = 1235] [outer = 0x1308a7c00] 17:00:29 INFO - --DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 510] 17:00:29 INFO - --DOCSHELL 0x1201fd600 == 13 [pid = 1063] [id = 508] 17:00:29 INFO - --DOCSHELL 0x12bb31600 == 12 [pid = 1063] [id = 509] 17:00:29 INFO - --DOCSHELL 0x12ca2d600 == 11 [pid = 1063] [id = 515] 17:00:29 INFO - --DOMWINDOW == 35 (0x12eb83400) [pid = 1063] [serial = 1215] [outer = 0x0] [url = about:blank] 17:00:29 INFO - --DOMWINDOW == 34 (0x12a01ec00) [pid = 1063] [serial = 1213] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:30 INFO - --DOMWINDOW == 33 (0x127fe0400) [pid = 1063] [serial = 1229] [outer = 0x0] [url = about:blank] 17:00:30 INFO - --DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 1220] [outer = 0x0] [url = about:blank] 17:00:30 INFO - --DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 1218] [outer = 0x0] [url = about:blank] 17:00:30 INFO - --DOMWINDOW == 30 (0x12a178c00) [pid = 1063] [serial = 1232] [outer = 0x0] [url = about:blank] 17:00:30 INFO - --DOMWINDOW == 29 (0x127fe0000) [pid = 1063] [serial = 1219] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20601352] 17:00:30 INFO - --DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 1217] [outer = 0x0] [url = about:blank] 17:00:30 INFO - MEMORY STAT | vsize 3793MB | residentFast 411MB | heapAllocated 125MB 17:00:30 INFO - 263 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js | took 2988ms 17:00:30 INFO - ++DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 516] 17:00:30 INFO - ++DOMWINDOW == 29 (0x120541800) [pid = 1063] [serial = 1236] [outer = 0x0] 17:00:30 INFO - ++DOMWINDOW == 30 (0x1208ac000) [pid = 1063] [serial = 1237] [outer = 0x120541800] 17:00:30 INFO - 264 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js 17:00:30 INFO - ++DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 517] 17:00:30 INFO - ++DOMWINDOW == 31 (0x1216c6c00) [pid = 1063] [serial = 1238] [outer = 0x0] 17:00:30 INFO - ++DOMWINDOW == 32 (0x121ddb400) [pid = 1063] [serial = 1239] [outer = 0x1216c6c00] 17:00:30 INFO - ++DOCSHELL 0x11fbe3600 == 14 [pid = 1063] [id = 518] 17:00:30 INFO - ++DOMWINDOW == 33 (0x121763c00) [pid = 1063] [serial = 1240] [outer = 0x0] 17:00:30 INFO - ++DOMWINDOW == 34 (0x127fe0800) [pid = 1063] [serial = 1241] [outer = 0x121763c00] 17:00:30 INFO - ++DOMWINDOW == 35 (0x12963d000) [pid = 1063] [serial = 1242] [outer = 0x121763c00] 17:00:30 INFO - ++DOCSHELL 0x12c6ddd00 == 15 [pid = 1063] [id = 519] 17:00:30 INFO - ++DOMWINDOW == 36 (0x12d5a6c00) [pid = 1063] [serial = 1243] [outer = 0x0] 17:00:30 INFO - ++DOMWINDOW == 37 (0x12df19000) [pid = 1063] [serial = 1244] [outer = 0x12d5a6c00] 17:00:31 INFO - ++DOMWINDOW == 38 (0x12ae6a000) [pid = 1063] [serial = 1245] [outer = 0x1216c6c00] 17:00:31 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:31 INFO - ++DOCSHELL 0x131a40f00 == 16 [pid = 1063] [id = 520] 17:00:31 INFO - ++DOMWINDOW == 39 (0x12b0f8400) [pid = 1063] [serial = 1246] [outer = 0x0] 17:00:31 INFO - ++DOMWINDOW == 40 (0x12b110800) [pid = 1063] [serial = 1247] [outer = 0x12b0f8400] 17:00:32 INFO - --DOCSHELL 0x11fbe0900 == 15 [pid = 1063] [id = 512] 17:00:32 INFO - --DOCSHELL 0x12c6dbf00 == 14 [pid = 1063] [id = 514] 17:00:32 INFO - --DOCSHELL 0x12c6ddd00 == 13 [pid = 1063] [id = 519] 17:00:32 INFO - --DOCSHELL 0x121c8e900 == 12 [pid = 1063] [id = 513] 17:00:33 INFO - --DOMWINDOW == 39 (0x129e8d000) [pid = 1063] [serial = 1230] [outer = 0x0] [url = http://example.com/] 17:00:33 INFO - --DOMWINDOW == 38 (0x1209c4c00) [pid = 1063] [serial = 1227] [outer = 0x0] [url = about:blank] 17:00:33 INFO - --DOMWINDOW == 37 (0x127fe0800) [pid = 1063] [serial = 1241] [outer = 0x0] [url = about:blank] 17:00:33 INFO - --DOMWINDOW == 36 (0x1308a7c00) [pid = 1063] [serial = 1234] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:33 INFO - --DOMWINDOW == 35 (0x127fb7800) [pid = 1063] [serial = 1231] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:33 INFO - --DOMWINDOW == 34 (0x120996c00) [pid = 1063] [serial = 1228] [outer = 0x0] [url = http://example.com/] 17:00:33 INFO - --DOMWINDOW == 33 (0x1208ac800) [pid = 1063] [serial = 1226] [outer = 0x0] [url = about:blank] 17:00:33 INFO - MEMORY STAT | vsize 3793MB | residentFast 412MB | heapAllocated 126MB 17:00:33 INFO - 265 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js | took 2856ms 17:00:33 INFO - ++DOCSHELL 0x121642f00 == 13 [pid = 1063] [id = 521] 17:00:33 INFO - ++DOMWINDOW == 34 (0x127f4e800) [pid = 1063] [serial = 1248] [outer = 0x0] 17:00:33 INFO - ++DOMWINDOW == 35 (0x127fe0800) [pid = 1063] [serial = 1249] [outer = 0x127f4e800] 17:00:33 INFO - 266 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_611795.js 17:00:33 INFO - ++DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 522] 17:00:33 INFO - ++DOMWINDOW == 36 (0x1299ab000) [pid = 1063] [serial = 1250] [outer = 0x0] 17:00:33 INFO - ++DOMWINDOW == 37 (0x129f83c00) [pid = 1063] [serial = 1251] [outer = 0x1299ab000] 17:00:33 INFO - ++DOCSHELL 0x12c6dba00 == 15 [pid = 1063] [id = 523] 17:00:33 INFO - ++DOMWINDOW == 38 (0x129f83800) [pid = 1063] [serial = 1252] [outer = 0x0] 17:00:33 INFO - ++DOMWINDOW == 39 (0x12b032800) [pid = 1063] [serial = 1253] [outer = 0x129f83800] 17:00:33 INFO - ++DOMWINDOW == 40 (0x12b0f8800) [pid = 1063] [serial = 1254] [outer = 0x129f83800] 17:00:33 INFO - ++DOCSHELL 0x12ca29000 == 16 [pid = 1063] [id = 524] 17:00:33 INFO - ++DOMWINDOW == 41 (0x131636800) [pid = 1063] [serial = 1255] [outer = 0x0] 17:00:33 INFO - ++DOMWINDOW == 42 (0x1317f7800) [pid = 1063] [serial = 1256] [outer = 0x131636800] 17:00:34 INFO - ++DOMWINDOW == 43 (0x12be38800) [pid = 1063] [serial = 1257] [outer = 0x1299ab000] 17:00:35 INFO - --DOCSHELL 0x131a40f00 == 15 [pid = 1063] [id = 520] 17:00:35 INFO - --DOCSHELL 0x129ea7700 == 14 [pid = 1063] [id = 517] 17:00:35 INFO - --DOCSHELL 0x11fbe3600 == 13 [pid = 1063] [id = 518] 17:00:35 INFO - --DOCSHELL 0x12ca29000 == 12 [pid = 1063] [id = 524] 17:00:35 INFO - --DOMWINDOW == 42 (0x1308b9800) [pid = 1063] [serial = 1235] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 41 (0x129917000) [pid = 1063] [serial = 1233] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:35 INFO - --DOMWINDOW == 40 (0x12b110800) [pid = 1063] [serial = 1247] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 39 (0x121ddb400) [pid = 1063] [serial = 1239] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 38 (0x1208ac000) [pid = 1063] [serial = 1237] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 37 (0x12b032800) [pid = 1063] [serial = 1253] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1251] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 35 (0x12d5a6c00) [pid = 1063] [serial = 1243] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:35 INFO - --DOMWINDOW == 34 (0x121763c00) [pid = 1063] [serial = 1240] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:35 INFO - --DOMWINDOW == 33 (0x12b0f8400) [pid = 1063] [serial = 1246] [outer = 0x0] [url = data:text/html;charset=utf-8,hello%20world!] 17:00:35 INFO - --DOMWINDOW == 32 (0x1216c6c00) [pid = 1063] [serial = 1238] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 17:00:35 INFO - --DOMWINDOW == 31 (0x120541800) [pid = 1063] [serial = 1236] [outer = 0x0] [url = about:blank] 17:00:35 INFO - --DOMWINDOW == 30 (0x12ae6a000) [pid = 1063] [serial = 1245] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 17:00:35 INFO - MEMORY STAT | vsize 3793MB | residentFast 412MB | heapAllocated 125MB 17:00:35 INFO - 267 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_611795.js | took 2541ms 17:00:35 INFO - ++DOCSHELL 0x11fbe2200 == 13 [pid = 1063] [id = 525] 17:00:35 INFO - ++DOMWINDOW == 31 (0x1208ac000) [pid = 1063] [serial = 1258] [outer = 0x0] 17:00:35 INFO - ++DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1259] [outer = 0x1208ac000] 17:00:36 INFO - 268 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js 17:00:36 INFO - ++DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 526] 17:00:36 INFO - ++DOMWINDOW == 33 (0x127f0bc00) [pid = 1063] [serial = 1260] [outer = 0x0] 17:00:36 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 1261] [outer = 0x127f0bc00] 17:00:36 INFO - ++DOMWINDOW == 35 (0x129f83c00) [pid = 1063] [serial = 1262] [outer = 0x127f0bc00] 17:00:36 INFO - ++DOCSHELL 0x12c6db000 == 15 [pid = 1063] [id = 527] 17:00:36 INFO - ++DOMWINDOW == 36 (0x12a178c00) [pid = 1063] [serial = 1263] [outer = 0x0] 17:00:36 INFO - ++DOMWINDOW == 37 (0x12ae6a000) [pid = 1063] [serial = 1264] [outer = 0x12a178c00] 17:00:36 INFO - ++DOCSHELL 0x12c6dec00 == 16 [pid = 1063] [id = 528] 17:00:36 INFO - ++DOMWINDOW == 38 (0x12b110400) [pid = 1063] [serial = 1265] [outer = 0x0] 17:00:36 INFO - ++DOMWINDOW == 39 (0x12b110800) [pid = 1063] [serial = 1266] [outer = 0x12b110400] 17:00:36 INFO - ++DOMWINDOW == 40 (0x129e8dc00) [pid = 1063] [serial = 1267] [outer = 0x12b110400] 17:00:36 INFO - ++DOCSHELL 0x12d25b000 == 17 [pid = 1063] [id = 529] 17:00:36 INFO - ++DOMWINDOW == 41 (0x1333dac00) [pid = 1063] [serial = 1268] [outer = 0x0] 17:00:36 INFO - ++DOMWINDOW == 42 (0x13348f400) [pid = 1063] [serial = 1269] [outer = 0x1333dac00] 17:00:37 INFO - ++DOMWINDOW == 43 (0x12c26c400) [pid = 1063] [serial = 1270] [outer = 0x127f0bc00] 17:00:37 INFO - ++DOCSHELL 0x134f99400 == 18 [pid = 1063] [id = 530] 17:00:37 INFO - ++DOMWINDOW == 44 (0x12bf6e800) [pid = 1063] [serial = 1271] [outer = 0x0] 17:00:37 INFO - [1063] WARNING: No inner window available!: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 17:00:38 INFO - --DOCSHELL 0x11fbe3100 == 17 [pid = 1063] [id = 516] 17:00:38 INFO - --DOCSHELL 0x121642f00 == 16 [pid = 1063] [id = 521] 17:00:38 INFO - --DOCSHELL 0x12bb2f800 == 15 [pid = 1063] [id = 522] 17:00:38 INFO - --DOCSHELL 0x12c6dba00 == 14 [pid = 1063] [id = 523] 17:00:38 INFO - --DOCSHELL 0x12d25b000 == 13 [pid = 1063] [id = 529] 17:00:38 INFO - --DOMWINDOW == 43 (0x12df19000) [pid = 1063] [serial = 1244] [outer = 0x0] [url = about:blank] 17:00:38 INFO - --DOMWINDOW == 42 (0x12963d000) [pid = 1063] [serial = 1242] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:38 INFO - ++DOMWINDOW == 43 (0x11f840c00) [pid = 1063] [serial = 1272] [outer = 0x12bf6e800] 17:00:38 INFO - --DOMWINDOW == 42 (0x128e94000) [pid = 1063] [serial = 1261] [outer = 0x0] [url = about:blank] 17:00:38 INFO - --DOMWINDOW == 41 (0x12be38800) [pid = 1063] [serial = 1257] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 17:00:38 INFO - --DOMWINDOW == 40 (0x127fe0800) [pid = 1063] [serial = 1249] [outer = 0x0] [url = about:blank] 17:00:38 INFO - --DOMWINDOW == 39 (0x12b110800) [pid = 1063] [serial = 1266] [outer = 0x0] [url = about:blank] 17:00:38 INFO - --DOMWINDOW == 38 (0x129f83800) [pid = 1063] [serial = 1252] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:38 INFO - --DOMWINDOW == 37 (0x131636800) [pid = 1063] [serial = 1255] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:38 INFO - --DOMWINDOW == 36 (0x1299ab000) [pid = 1063] [serial = 1250] [outer = 0x0] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 17:00:38 INFO - --DOMWINDOW == 35 (0x127f4e800) [pid = 1063] [serial = 1248] [outer = 0x0] [url = about:blank] 17:00:38 INFO - MEMORY STAT | vsize 3792MB | residentFast 408MB | heapAllocated 125MB 17:00:38 INFO - 269 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js | took 2525ms 17:00:38 INFO - ++DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 531] 17:00:38 INFO - ++DOMWINDOW == 36 (0x1208ac800) [pid = 1063] [serial = 1273] [outer = 0x0] 17:00:38 INFO - ++DOMWINDOW == 37 (0x1216a2800) [pid = 1063] [serial = 1274] [outer = 0x1208ac800] 17:00:38 INFO - 270 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js 17:00:38 INFO - ++DOCSHELL 0x1285b2500 == 15 [pid = 1063] [id = 532] 17:00:38 INFO - ++DOMWINDOW == 38 (0x11fe61400) [pid = 1063] [serial = 1275] [outer = 0x0] 17:00:38 INFO - ++DOMWINDOW == 39 (0x127fe0000) [pid = 1063] [serial = 1276] [outer = 0x11fe61400] 17:00:38 INFO - ++DOCSHELL 0x12bb2da00 == 16 [pid = 1063] [id = 533] 17:00:38 INFO - ++DOMWINDOW == 40 (0x12014b400) [pid = 1063] [serial = 1277] [outer = 0x0] 17:00:38 INFO - ++DOMWINDOW == 41 (0x127f4e800) [pid = 1063] [serial = 1278] [outer = 0x12014b400] 17:00:39 INFO - ++DOMWINDOW == 42 (0x129f83800) [pid = 1063] [serial = 1279] [outer = 0x12014b400] 17:00:39 INFO - ++DOCSHELL 0x12c6dd800 == 17 [pid = 1063] [id = 534] 17:00:39 INFO - ++DOMWINDOW == 43 (0x130a20c00) [pid = 1063] [serial = 1280] [outer = 0x0] 17:00:39 INFO - ++DOMWINDOW == 44 (0x130e8b400) [pid = 1063] [serial = 1281] [outer = 0x130a20c00] 17:00:40 INFO - --DOCSHELL 0x134f99400 == 16 [pid = 1063] [id = 530] 17:00:40 INFO - --DOCSHELL 0x12c6db000 == 15 [pid = 1063] [id = 527] 17:00:40 INFO - --DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 526] 17:00:40 INFO - --DOCSHELL 0x12c6dec00 == 13 [pid = 1063] [id = 528] 17:00:40 INFO - --DOCSHELL 0x12c6dd800 == 12 [pid = 1063] [id = 534] 17:00:40 INFO - --DOMWINDOW == 43 (0x1317f7800) [pid = 1063] [serial = 1256] [outer = 0x0] [url = about:blank] 17:00:40 INFO - --DOMWINDOW == 42 (0x12b0f8800) [pid = 1063] [serial = 1254] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:40 INFO - --DOMWINDOW == 41 (0x12ae6a000) [pid = 1063] [serial = 1264] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 17:00:40 INFO - --DOMWINDOW == 40 (0x11f840c00) [pid = 1063] [serial = 1272] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 17:00:40 INFO - --DOMWINDOW == 39 (0x120996c00) [pid = 1063] [serial = 1259] [outer = 0x0] [url = about:blank] 17:00:40 INFO - --DOMWINDOW == 38 (0x127f4e800) [pid = 1063] [serial = 1278] [outer = 0x0] [url = about:blank] 17:00:40 INFO - --DOMWINDOW == 37 (0x12b110400) [pid = 1063] [serial = 1265] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:40 INFO - --DOMWINDOW == 36 (0x1333dac00) [pid = 1063] [serial = 1268] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:40 INFO - --DOMWINDOW == 35 (0x127f0bc00) [pid = 1063] [serial = 1260] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 17:00:40 INFO - --DOMWINDOW == 34 (0x12a178c00) [pid = 1063] [serial = 1263] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 17:00:40 INFO - --DOMWINDOW == 33 (0x12bf6e800) [pid = 1063] [serial = 1271] [outer = 0x0] [url = data:text/html;charset=utf-8,little%20iframe] 17:00:40 INFO - --DOMWINDOW == 32 (0x1208ac000) [pid = 1063] [serial = 1258] [outer = 0x0] [url = about:blank] 17:00:40 INFO - --DOMWINDOW == 31 (0x12c26c400) [pid = 1063] [serial = 1270] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 17:00:40 INFO - --DOMWINDOW == 30 (0x129f83c00) [pid = 1063] [serial = 1262] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 17:00:40 INFO - MEMORY STAT | vsize 3792MB | residentFast 408MB | heapAllocated 125MB 17:00:40 INFO - 271 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js | took 2260ms 17:00:40 INFO - ++DOCSHELL 0x11fbe1300 == 13 [pid = 1063] [id = 535] 17:00:40 INFO - ++DOMWINDOW == 31 (0x1208ac000) [pid = 1063] [serial = 1282] [outer = 0x0] 17:00:40 INFO - ++DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1283] [outer = 0x1208ac000] 17:00:41 INFO - 272 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js 17:00:41 INFO - ++DOCSHELL 0x127766500 == 14 [pid = 1063] [id = 536] 17:00:41 INFO - ++DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 1284] [outer = 0x0] 17:00:41 INFO - ++DOMWINDOW == 34 (0x127fe0400) [pid = 1063] [serial = 1285] [outer = 0x1216bac00] 17:00:41 INFO - ++DOCSHELL 0x1201b0200 == 15 [pid = 1063] [id = 537] 17:00:41 INFO - ++DOMWINDOW == 35 (0x127fb7800) [pid = 1063] [serial = 1286] [outer = 0x0] 17:00:41 INFO - ++DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1287] [outer = 0x127fb7800] 17:00:41 INFO - ++DOMWINDOW == 37 (0x129900400) [pid = 1063] [serial = 1288] [outer = 0x127fb7800] 17:00:41 INFO - ++DOCSHELL 0x12c6dd300 == 16 [pid = 1063] [id = 538] 17:00:41 INFO - ++DOMWINDOW == 38 (0x12e8fd800) [pid = 1063] [serial = 1289] [outer = 0x0] 17:00:41 INFO - ++DOMWINDOW == 39 (0x12e902c00) [pid = 1063] [serial = 1290] [outer = 0x12e8fd800] 17:00:44 INFO - --DOCSHELL 0x11fbe2700 == 15 [pid = 1063] [id = 531] 17:00:44 INFO - --DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 532] 17:00:44 INFO - --DOCSHELL 0x12c6dd300 == 13 [pid = 1063] [id = 538] 17:00:44 INFO - --DOCSHELL 0x11fbe2200 == 12 [pid = 1063] [id = 525] 17:00:44 INFO - --DOCSHELL 0x12bb2da00 == 11 [pid = 1063] [id = 533] 17:00:44 INFO - --DOMWINDOW == 38 (0x13348f400) [pid = 1063] [serial = 1269] [outer = 0x0] [url = about:blank] 17:00:44 INFO - --DOMWINDOW == 37 (0x129e8dc00) [pid = 1063] [serial = 1267] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:44 INFO - --DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1287] [outer = 0x0] [url = about:blank] 17:00:44 INFO - --DOMWINDOW == 35 (0x130a20c00) [pid = 1063] [serial = 1280] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:44 INFO - --DOMWINDOW == 34 (0x12014b400) [pid = 1063] [serial = 1277] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:44 INFO - --DOMWINDOW == 33 (0x11fe61400) [pid = 1063] [serial = 1275] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613280] 17:00:44 INFO - --DOMWINDOW == 32 (0x1208ac800) [pid = 1063] [serial = 1273] [outer = 0x0] [url = about:blank] 17:00:44 INFO - --DOMWINDOW == 31 (0x127fe0000) [pid = 1063] [serial = 1276] [outer = 0x0] [url = about:blank] 17:00:44 INFO - --DOMWINDOW == 30 (0x1216a2800) [pid = 1063] [serial = 1274] [outer = 0x0] [url = about:blank] 17:00:44 INFO - MEMORY STAT | vsize 3788MB | residentFast 408MB | heapAllocated 126MB 17:00:44 INFO - 273 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js | took 3749ms 17:00:44 INFO - ++DOCSHELL 0x11fbe2700 == 12 [pid = 1063] [id = 539] 17:00:44 INFO - ++DOMWINDOW == 31 (0x1208acc00) [pid = 1063] [serial = 1291] [outer = 0x0] 17:00:44 INFO - ++DOMWINDOW == 32 (0x1216c6c00) [pid = 1063] [serial = 1292] [outer = 0x1208acc00] 17:00:44 INFO - 274 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js 17:00:44 INFO - ++DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 540] 17:00:44 INFO - ++DOMWINDOW == 33 (0x1216a2800) [pid = 1063] [serial = 1293] [outer = 0x0] 17:00:44 INFO - ++DOMWINDOW == 34 (0x127fe0800) [pid = 1063] [serial = 1294] [outer = 0x1216a2800] 17:00:45 INFO - ++DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 541] 17:00:45 INFO - ++DOMWINDOW == 35 (0x127fe0000) [pid = 1063] [serial = 1295] [outer = 0x0] 17:00:45 INFO - ++DOMWINDOW == 36 (0x129e8dc00) [pid = 1063] [serial = 1296] [outer = 0x127fe0000] 17:00:45 INFO - ++DOMWINDOW == 37 (0x129f83c00) [pid = 1063] [serial = 1297] [outer = 0x127fe0000] 17:00:45 INFO - ++DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 542] 17:00:45 INFO - ++DOMWINDOW == 38 (0x12f15d000) [pid = 1063] [serial = 1298] [outer = 0x0] 17:00:45 INFO - ++DOMWINDOW == 39 (0x1308a7400) [pid = 1063] [serial = 1299] [outer = 0x12f15d000] 17:00:48 INFO - --DOCSHELL 0x127766500 == 14 [pid = 1063] [id = 536] 17:00:48 INFO - --DOCSHELL 0x11fbe1300 == 13 [pid = 1063] [id = 535] 17:00:48 INFO - --DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 537] 17:00:48 INFO - --DOCSHELL 0x12c6dd800 == 11 [pid = 1063] [id = 542] 17:00:48 INFO - --DOMWINDOW == 38 (0x130e8b400) [pid = 1063] [serial = 1281] [outer = 0x0] [url = about:blank] 17:00:48 INFO - --DOMWINDOW == 37 (0x129f83800) [pid = 1063] [serial = 1279] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:48 INFO - --DOMWINDOW == 36 (0x129e8dc00) [pid = 1063] [serial = 1296] [outer = 0x0] [url = about:blank] 17:00:48 INFO - --DOMWINDOW == 35 (0x12e8fd800) [pid = 1063] [serial = 1289] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:48 INFO - --DOMWINDOW == 34 (0x127fb7800) [pid = 1063] [serial = 1286] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:48 INFO - --DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 1284] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20remember%20scroll%20location] 17:00:48 INFO - --DOMWINDOW == 32 (0x1208ac000) [pid = 1063] [serial = 1282] [outer = 0x0] [url = about:blank] 17:00:48 INFO - --DOMWINDOW == 31 (0x127fe0400) [pid = 1063] [serial = 1285] [outer = 0x0] [url = about:blank] 17:00:48 INFO - --DOMWINDOW == 30 (0x120996c00) [pid = 1063] [serial = 1283] [outer = 0x0] [url = about:blank] 17:00:48 INFO - MEMORY STAT | vsize 3789MB | residentFast 409MB | heapAllocated 126MB 17:00:48 INFO - 275 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js | took 3607ms 17:00:48 INFO - ++DOCSHELL 0x11fbe1d00 == 12 [pid = 1063] [id = 543] 17:00:48 INFO - ++DOMWINDOW == 31 (0x1208ac800) [pid = 1063] [serial = 1300] [outer = 0x0] 17:00:48 INFO - ++DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 1301] [outer = 0x1208ac800] 17:00:48 INFO - 276 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js 17:00:48 INFO - ++DOCSHELL 0x127768800 == 13 [pid = 1063] [id = 544] 17:00:48 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 1302] [outer = 0x0] 17:00:48 INFO - ++DOMWINDOW == 34 (0x127fe0400) [pid = 1063] [serial = 1303] [outer = 0x120996c00] 17:00:48 INFO - ++DOCSHELL 0x12bb2da00 == 14 [pid = 1063] [id = 545] 17:00:48 INFO - ++DOMWINDOW == 35 (0x127fb7800) [pid = 1063] [serial = 1304] [outer = 0x0] 17:00:48 INFO - ++DOMWINDOW == 36 (0x12a01ec00) [pid = 1063] [serial = 1305] [outer = 0x127fb7800] 17:00:49 INFO - ++DOMWINDOW == 37 (0x129e8d000) [pid = 1063] [serial = 1306] [outer = 0x127fb7800] 17:00:49 INFO - ++DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 546] 17:00:49 INFO - ++DOMWINDOW == 38 (0x1308b9800) [pid = 1063] [serial = 1307] [outer = 0x0] 17:00:49 INFO - ++DOMWINDOW == 39 (0x1309de000) [pid = 1063] [serial = 1308] [outer = 0x1308b9800] 17:00:52 INFO - --DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 539] 17:00:52 INFO - --DOCSHELL 0x12bb2f800 == 13 [pid = 1063] [id = 541] 17:00:52 INFO - --DOCSHELL 0x12c6dd800 == 12 [pid = 1063] [id = 546] 17:00:52 INFO - --DOCSHELL 0x1285b2500 == 11 [pid = 1063] [id = 540] 17:00:52 INFO - --DOMWINDOW == 38 (0x12e902c00) [pid = 1063] [serial = 1290] [outer = 0x0] [url = about:blank] 17:00:52 INFO - --DOMWINDOW == 37 (0x129900400) [pid = 1063] [serial = 1288] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:52 INFO - --DOMWINDOW == 36 (0x12a01ec00) [pid = 1063] [serial = 1305] [outer = 0x0] [url = about:blank] 17:00:52 INFO - --DOMWINDOW == 35 (0x127fe0000) [pid = 1063] [serial = 1295] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:52 INFO - --DOMWINDOW == 34 (0x12f15d000) [pid = 1063] [serial = 1298] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:52 INFO - --DOMWINDOW == 33 (0x1216a2800) [pid = 1063] [serial = 1293] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20maintain%20scroll%20with%20pruning%20of%20old%20messages] 17:00:52 INFO - --DOMWINDOW == 32 (0x1208acc00) [pid = 1063] [serial = 1291] [outer = 0x0] [url = about:blank] 17:00:52 INFO - --DOMWINDOW == 31 (0x127fe0800) [pid = 1063] [serial = 1294] [outer = 0x0] [url = about:blank] 17:00:52 INFO - --DOMWINDOW == 30 (0x1216c6c00) [pid = 1063] [serial = 1292] [outer = 0x0] [url = about:blank] 17:00:52 INFO - MEMORY STAT | vsize 3789MB | residentFast 409MB | heapAllocated 126MB 17:00:52 INFO - 277 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js | took 3641ms 17:00:52 INFO - ++DOCSHELL 0x11fbe1800 == 12 [pid = 1063] [id = 547] 17:00:52 INFO - ++DOMWINDOW == 31 (0x1216a2800) [pid = 1063] [serial = 1309] [outer = 0x0] 17:00:52 INFO - ++DOMWINDOW == 32 (0x121763c00) [pid = 1063] [serial = 1310] [outer = 0x1216a2800] 17:00:52 INFO - 278 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js 17:00:52 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 548] 17:00:52 INFO - ++DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 1311] [outer = 0x0] 17:00:52 INFO - ++DOMWINDOW == 34 (0x1286b6c00) [pid = 1063] [serial = 1312] [outer = 0x128501c00] 17:00:52 INFO - ++DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 549] 17:00:52 INFO - ++DOMWINDOW == 35 (0x1286b6800) [pid = 1063] [serial = 1313] [outer = 0x0] 17:00:52 INFO - ++DOMWINDOW == 36 (0x129e8dc00) [pid = 1063] [serial = 1314] [outer = 0x1286b6800] 17:00:52 INFO - ++DOMWINDOW == 37 (0x12a01ec00) [pid = 1063] [serial = 1315] [outer = 0x1286b6800] 17:00:52 INFO - ++DOCSHELL 0x12c6dd300 == 15 [pid = 1063] [id = 550] 17:00:52 INFO - ++DOMWINDOW == 38 (0x12e913000) [pid = 1063] [serial = 1316] [outer = 0x0] 17:00:52 INFO - ++DOMWINDOW == 39 (0x12f039800) [pid = 1063] [serial = 1317] [outer = 0x12e913000] 17:00:53 INFO - ++DOMWINDOW == 40 (0x11f9a5c00) [pid = 1063] [serial = 1318] [outer = 0x128501c00] 17:00:53 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:00:53 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html, line 14: ReferenceError: bug618078exception is not defined 17:00:54 INFO - --DOCSHELL 0x11fbe1d00 == 14 [pid = 1063] [id = 543] 17:00:54 INFO - --DOCSHELL 0x127768800 == 13 [pid = 1063] [id = 544] 17:00:54 INFO - --DOCSHELL 0x12bb2da00 == 12 [pid = 1063] [id = 545] 17:00:54 INFO - --DOCSHELL 0x12c6dd300 == 11 [pid = 1063] [id = 550] 17:00:54 INFO - --DOMWINDOW == 39 (0x129f83c00) [pid = 1063] [serial = 1297] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:54 INFO - --DOMWINDOW == 38 (0x1308a7400) [pid = 1063] [serial = 1299] [outer = 0x0] [url = about:blank] 17:00:54 INFO - --DOMWINDOW == 37 (0x129e8dc00) [pid = 1063] [serial = 1314] [outer = 0x0] [url = about:blank] 17:00:54 INFO - --DOMWINDOW == 36 (0x127fe0400) [pid = 1063] [serial = 1303] [outer = 0x0] [url = about:blank] 17:00:54 INFO - --DOMWINDOW == 35 (0x1216bac00) [pid = 1063] [serial = 1301] [outer = 0x0] [url = about:blank] 17:00:54 INFO - --DOMWINDOW == 34 (0x127fb7800) [pid = 1063] [serial = 1304] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:54 INFO - --DOMWINDOW == 33 (0x1308b9800) [pid = 1063] [serial = 1307] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:54 INFO - --DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1302] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20614793:%20jsterm%20result%20scroll] 17:00:54 INFO - --DOMWINDOW == 31 (0x1208ac800) [pid = 1063] [serial = 1300] [outer = 0x0] [url = about:blank] 17:00:55 INFO - MEMORY STAT | vsize 3788MB | residentFast 409MB | heapAllocated 126MB 17:00:55 INFO - 279 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js | took 2643ms 17:00:55 INFO - ++DOCSHELL 0x121642f00 == 12 [pid = 1063] [id = 551] 17:00:55 INFO - ++DOMWINDOW == 32 (0x1208ac800) [pid = 1063] [serial = 1319] [outer = 0x0] 17:00:55 INFO - ++DOMWINDOW == 33 (0x1209c4c00) [pid = 1063] [serial = 1320] [outer = 0x1208ac800] 17:00:55 INFO - 280 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js 17:00:55 INFO - ++DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 552] 17:00:55 INFO - ++DOMWINDOW == 34 (0x127fb7800) [pid = 1063] [serial = 1321] [outer = 0x0] 17:00:55 INFO - ++DOMWINDOW == 35 (0x1286b6400) [pid = 1063] [serial = 1322] [outer = 0x127fb7800] 17:00:55 INFO - ++DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 1323] [outer = 0x127fb7800] 17:00:55 INFO - ++DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 553] 17:00:55 INFO - ++DOMWINDOW == 37 (0x1286b6000) [pid = 1063] [serial = 1324] [outer = 0x0] 17:00:55 INFO - ++DOMWINDOW == 38 (0x12a0e6800) [pid = 1063] [serial = 1325] [outer = 0x1286b6000] 17:00:55 INFO - ++DOMWINDOW == 39 (0x12a0bf000) [pid = 1063] [serial = 1326] [outer = 0x1286b6000] 17:00:55 INFO - ++DOCSHELL 0x12ea32700 == 15 [pid = 1063] [id = 554] 17:00:55 INFO - ++DOMWINDOW == 40 (0x130b42800) [pid = 1063] [serial = 1327] [outer = 0x0] 17:00:55 INFO - ++DOMWINDOW == 41 (0x130e8b400) [pid = 1063] [serial = 1328] [outer = 0x130b42800] 17:00:57 INFO - --DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 549] 17:00:57 INFO - --DOCSHELL 0x11fbe1800 == 13 [pid = 1063] [id = 547] 17:00:57 INFO - --DOCSHELL 0x1266a6e00 == 12 [pid = 1063] [id = 548] 17:00:57 INFO - --DOCSHELL 0x12ea32700 == 11 [pid = 1063] [id = 554] 17:00:57 INFO - --DOMWINDOW == 40 (0x129e8d000) [pid = 1063] [serial = 1306] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:57 INFO - --DOMWINDOW == 39 (0x1309de000) [pid = 1063] [serial = 1308] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 38 (0x1286b6400) [pid = 1063] [serial = 1322] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 37 (0x1286b6c00) [pid = 1063] [serial = 1312] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 36 (0x121763c00) [pid = 1063] [serial = 1310] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 35 (0x12a0e6800) [pid = 1063] [serial = 1325] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 34 (0x12e913000) [pid = 1063] [serial = 1316] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:57 INFO - --DOMWINDOW == 33 (0x1286b6800) [pid = 1063] [serial = 1313] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:57 INFO - --DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 1311] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 17:00:57 INFO - --DOMWINDOW == 31 (0x1216a2800) [pid = 1063] [serial = 1309] [outer = 0x0] [url = about:blank] 17:00:57 INFO - --DOMWINDOW == 30 (0x11f9a5c00) [pid = 1063] [serial = 1318] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 17:00:57 INFO - MEMORY STAT | vsize 3792MB | residentFast 412MB | heapAllocated 125MB 17:00:57 INFO - 281 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js | took 2414ms 17:00:57 INFO - ++DOCSHELL 0x11fbe1300 == 12 [pid = 1063] [id = 555] 17:00:57 INFO - ++DOMWINDOW == 31 (0x1205f8400) [pid = 1063] [serial = 1329] [outer = 0x0] 17:00:57 INFO - ++DOMWINDOW == 32 (0x1208acc00) [pid = 1063] [serial = 1330] [outer = 0x1205f8400] 17:00:57 INFO - 282 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js 17:00:57 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 556] 17:00:57 INFO - ++DOMWINDOW == 33 (0x1216c6c00) [pid = 1063] [serial = 1331] [outer = 0x0] 17:00:57 INFO - ++DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 1332] [outer = 0x1216c6c00] 17:00:57 INFO - ++DOMWINDOW == 35 (0x1286b6400) [pid = 1063] [serial = 1333] [outer = 0x1216c6c00] 17:00:57 INFO - ++DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 557] 17:00:57 INFO - ++DOMWINDOW == 36 (0x11f8cc800) [pid = 1063] [serial = 1334] [outer = 0x0] 17:00:57 INFO - ++DOMWINDOW == 37 (0x127274800) [pid = 1063] [serial = 1335] [outer = 0x11f8cc800] 17:00:58 INFO - ++DOMWINDOW == 38 (0x128e94000) [pid = 1063] [serial = 1336] [outer = 0x11f8cc800] 17:00:58 INFO - ++DOCSHELL 0x12c6dd300 == 15 [pid = 1063] [id = 558] 17:00:58 INFO - ++DOMWINDOW == 39 (0x12f039400) [pid = 1063] [serial = 1337] [outer = 0x0] 17:00:58 INFO - ++DOMWINDOW == 40 (0x12f039c00) [pid = 1063] [serial = 1338] [outer = 0x12f039400] 17:00:59 INFO - --DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 552] 17:00:59 INFO - --DOCSHELL 0x121642f00 == 13 [pid = 1063] [id = 551] 17:00:59 INFO - --DOCSHELL 0x12c6dd300 == 12 [pid = 1063] [id = 558] 17:00:59 INFO - --DOCSHELL 0x12c822e00 == 11 [pid = 1063] [id = 553] 17:00:59 INFO - --DOMWINDOW == 39 (0x12f039800) [pid = 1063] [serial = 1317] [outer = 0x0] [url = about:blank] 17:00:59 INFO - --DOMWINDOW == 38 (0x12a01ec00) [pid = 1063] [serial = 1315] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:59 INFO - ++DOCSHELL 0x11f9a8800 == 12 [pid = 1063] [id = 559] 17:00:59 INFO - ++DOMWINDOW == 39 (0x10a467400) [pid = 1063] [serial = 1339] [outer = 0x0] 17:00:59 INFO - ++DOMWINDOW == 40 (0x11f840c00) [pid = 1063] [serial = 1340] [outer = 0x10a467400] 17:00:59 INFO - --DOMWINDOW == 39 (0x127f0bc00) [pid = 1063] [serial = 1332] [outer = 0x0] [url = about:blank] 17:00:59 INFO - --DOMWINDOW == 38 (0x1209c4c00) [pid = 1063] [serial = 1320] [outer = 0x0] [url = about:blank] 17:00:59 INFO - --DOMWINDOW == 37 (0x127274800) [pid = 1063] [serial = 1335] [outer = 0x0] [url = about:blank] 17:00:59 INFO - --DOMWINDOW == 36 (0x130b42800) [pid = 1063] [serial = 1327] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:00:59 INFO - --DOMWINDOW == 35 (0x1286b6000) [pid = 1063] [serial = 1324] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:00:59 INFO - --DOMWINDOW == 34 (0x127fb7800) [pid = 1063] [serial = 1321] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 17:00:59 INFO - --DOMWINDOW == 33 (0x1208ac800) [pid = 1063] [serial = 1319] [outer = 0x0] [url = about:blank] 17:00:59 INFO - --DOMWINDOW == 32 (0x129f83c00) [pid = 1063] [serial = 1323] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 17:00:59 INFO - ++DOMWINDOW == 33 (0x10a465c00) [pid = 1063] [serial = 1341] [outer = 0x10a467400] 17:01:00 INFO - ++DOCSHELL 0x1201fdb00 == 13 [pid = 1063] [id = 560] 17:01:00 INFO - ++DOMWINDOW == 34 (0x12c777800) [pid = 1063] [serial = 1342] [outer = 0x0] 17:01:00 INFO - ++DOMWINDOW == 35 (0x12c78f800) [pid = 1063] [serial = 1343] [outer = 0x12c777800] 17:01:01 INFO - --DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 557] 17:01:01 INFO - --DOCSHELL 0x1201fdb00 == 11 [pid = 1063] [id = 560] 17:01:01 INFO - --DOMWINDOW == 34 (0x130e8b400) [pid = 1063] [serial = 1328] [outer = 0x0] [url = about:blank] 17:01:01 INFO - --DOMWINDOW == 33 (0x12a0bf000) [pid = 1063] [serial = 1326] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:01 INFO - ++DOCSHELL 0x11f9a8d00 == 12 [pid = 1063] [id = 561] 17:01:01 INFO - ++DOMWINDOW == 34 (0x10a467000) [pid = 1063] [serial = 1344] [outer = 0x0] 17:01:01 INFO - ++DOMWINDOW == 35 (0x11f8ae000) [pid = 1063] [serial = 1345] [outer = 0x10a467000] 17:01:01 INFO - --DOMWINDOW == 34 (0x11f840c00) [pid = 1063] [serial = 1340] [outer = 0x0] [url = about:blank] 17:01:01 INFO - ++DOMWINDOW == 35 (0x10a465800) [pid = 1063] [serial = 1346] [outer = 0x10a467000] 17:01:01 INFO - ++DOCSHELL 0x120929200 == 13 [pid = 1063] [id = 562] 17:01:01 INFO - ++DOMWINDOW == 36 (0x12c87d800) [pid = 1063] [serial = 1347] [outer = 0x0] 17:01:01 INFO - ++DOMWINDOW == 37 (0x12c8e8800) [pid = 1063] [serial = 1348] [outer = 0x12c87d800] 17:01:03 INFO - --DOCSHELL 0x11f9a8800 == 12 [pid = 1063] [id = 559] 17:01:03 INFO - --DOCSHELL 0x120929200 == 11 [pid = 1063] [id = 562] 17:01:03 INFO - --DOMWINDOW == 36 (0x11f8ae000) [pid = 1063] [serial = 1345] [outer = 0x0] [url = about:blank] 17:01:03 INFO - MEMORY STAT | vsize 3789MB | residentFast 407MB | heapAllocated 125MB 17:01:03 INFO - 283 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js | took 5490ms 17:01:03 INFO - ++DOCSHELL 0x1201af300 == 12 [pid = 1063] [id = 563] 17:01:03 INFO - ++DOMWINDOW == 37 (0x127274800) [pid = 1063] [serial = 1349] [outer = 0x0] 17:01:03 INFO - ++DOMWINDOW == 38 (0x127fe0400) [pid = 1063] [serial = 1350] [outer = 0x127274800] 17:01:03 INFO - 284 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js 17:01:03 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 564] 17:01:03 INFO - ++DOMWINDOW == 39 (0x1286b6c00) [pid = 1063] [serial = 1351] [outer = 0x0] 17:01:03 INFO - ++DOMWINDOW == 40 (0x129917400) [pid = 1063] [serial = 1352] [outer = 0x1286b6c00] 17:01:03 INFO - ++DOCSHELL 0x11fbe3600 == 14 [pid = 1063] [id = 565] 17:01:03 INFO - ++DOMWINDOW == 41 (0x129917000) [pid = 1063] [serial = 1353] [outer = 0x0] 17:01:03 INFO - ++DOMWINDOW == 42 (0x12a178c00) [pid = 1063] [serial = 1354] [outer = 0x129917000] 17:01:03 INFO - ++DOMWINDOW == 43 (0x12ae6a000) [pid = 1063] [serial = 1355] [outer = 0x129917000] 17:01:03 INFO - ++DOCSHELL 0x12c6ddd00 == 15 [pid = 1063] [id = 566] 17:01:03 INFO - ++DOMWINDOW == 44 (0x1333da400) [pid = 1063] [serial = 1356] [outer = 0x0] 17:01:03 INFO - ++DOMWINDOW == 45 (0x1333da800) [pid = 1063] [serial = 1357] [outer = 0x1333da400] 17:01:04 INFO - ++DOMWINDOW == 46 (0x12c3ea000) [pid = 1063] [serial = 1358] [outer = 0x1286b6c00] 17:01:04 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:05 INFO - --DOCSHELL 0x11f9a8d00 == 14 [pid = 1063] [id = 561] 17:01:05 INFO - --DOCSHELL 0x11fbe1300 == 13 [pid = 1063] [id = 555] 17:01:05 INFO - --DOCSHELL 0x12c6ddd00 == 12 [pid = 1063] [id = 566] 17:01:05 INFO - --DOCSHELL 0x1266a6e00 == 11 [pid = 1063] [id = 556] 17:01:05 INFO - --DOMWINDOW == 45 (0x12a178c00) [pid = 1063] [serial = 1354] [outer = 0x0] [url = about:blank] 17:01:05 INFO - --DOMWINDOW == 44 (0x1208acc00) [pid = 1063] [serial = 1330] [outer = 0x0] [url = about:blank] 17:01:05 INFO - --DOMWINDOW == 43 (0x1286b6400) [pid = 1063] [serial = 1333] [outer = 0x0] [url = about:blank] 17:01:05 INFO - --DOMWINDOW == 42 (0x11f8cc800) [pid = 1063] [serial = 1334] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:05 INFO - --DOMWINDOW == 41 (0x12f039400) [pid = 1063] [serial = 1337] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:05 INFO - --DOMWINDOW == 40 (0x12c87d800) [pid = 1063] [serial = 1347] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:05 INFO - --DOMWINDOW == 39 (0x12c777800) [pid = 1063] [serial = 1342] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:05 INFO - --DOMWINDOW == 38 (0x1205f8400) [pid = 1063] [serial = 1329] [outer = 0x0] [url = about:blank] 17:01:05 INFO - --DOMWINDOW == 37 (0x1216c6c00) [pid = 1063] [serial = 1331] [outer = 0x0] [url = about:blank] 17:01:05 INFO - --DOMWINDOW == 36 (0x10a467000) [pid = 1063] [serial = 1344] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:05 INFO - --DOMWINDOW == 35 (0x10a467400) [pid = 1063] [serial = 1339] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:06 INFO - MEMORY STAT | vsize 3792MB | residentFast 410MB | heapAllocated 126MB 17:01:06 INFO - 285 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js | took 2643ms 17:01:06 INFO - ++DOCSHELL 0x121c8e900 == 12 [pid = 1063] [id = 567] 17:01:06 INFO - ++DOMWINDOW == 36 (0x120996c00) [pid = 1063] [serial = 1359] [outer = 0x0] 17:01:06 INFO - ++DOMWINDOW == 37 (0x127f4e800) [pid = 1063] [serial = 1360] [outer = 0x120996c00] 17:01:06 INFO - 286 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js 17:01:06 INFO - ++DOCSHELL 0x12c6db000 == 13 [pid = 1063] [id = 568] 17:01:06 INFO - ++DOMWINDOW == 38 (0x129900400) [pid = 1063] [serial = 1361] [outer = 0x0] 17:01:06 INFO - ++DOMWINDOW == 39 (0x12a178c00) [pid = 1063] [serial = 1362] [outer = 0x129900400] 17:01:06 INFO - ++DOMWINDOW == 40 (0x12aebb400) [pid = 1063] [serial = 1363] [outer = 0x129900400] 17:01:06 INFO - ++DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 569] 17:01:06 INFO - ++DOMWINDOW == 41 (0x12b0f8c00) [pid = 1063] [serial = 1364] [outer = 0x0] 17:01:06 INFO - ++DOMWINDOW == 42 (0x12bb70000) [pid = 1063] [serial = 1365] [outer = 0x12b0f8c00] 17:01:06 INFO - ++DOMWINDOW == 43 (0x12a0e6800) [pid = 1063] [serial = 1366] [outer = 0x12b0f8c00] 17:01:06 INFO - ++DOCSHELL 0x130929800 == 15 [pid = 1063] [id = 570] 17:01:06 INFO - ++DOMWINDOW == 44 (0x133eb7800) [pid = 1063] [serial = 1367] [outer = 0x0] 17:01:06 INFO - ++DOMWINDOW == 45 (0x133fd2c00) [pid = 1063] [serial = 1368] [outer = 0x133eb7800] 17:01:07 INFO - ++DOCSHELL 0x13542a500 == 16 [pid = 1063] [id = 571] 17:01:07 INFO - ++DOMWINDOW == 46 (0x1334d1000) [pid = 1063] [serial = 1369] [outer = 0x0] 17:01:07 INFO - ++DOMWINDOW == 47 (0x134882800) [pid = 1063] [serial = 1370] [outer = 0x1334d1000] 17:01:07 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:01:09 INFO - --DOCSHELL 0x13542a500 == 15 [pid = 1063] [id = 571] 17:01:09 INFO - --DOCSHELL 0x1201af300 == 14 [pid = 1063] [id = 563] 17:01:09 INFO - --DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 564] 17:01:09 INFO - --DOCSHELL 0x12c822e00 == 12 [pid = 1063] [id = 569] 17:01:09 INFO - --DOCSHELL 0x130929800 == 11 [pid = 1063] [id = 570] 17:01:09 INFO - --DOCSHELL 0x11fbe3600 == 10 [pid = 1063] [id = 565] 17:01:09 INFO - --DOMWINDOW == 46 (0x12c78f800) [pid = 1063] [serial = 1343] [outer = 0x0] [url = about:blank] 17:01:09 INFO - --DOMWINDOW == 45 (0x10a465c00) [pid = 1063] [serial = 1341] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:09 INFO - --DOMWINDOW == 44 (0x12c8e8800) [pid = 1063] [serial = 1348] [outer = 0x0] [url = about:blank] 17:01:09 INFO - --DOMWINDOW == 43 (0x10a465800) [pid = 1063] [serial = 1346] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:09 INFO - --DOMWINDOW == 42 (0x12f039c00) [pid = 1063] [serial = 1338] [outer = 0x0] [url = about:blank] 17:01:09 INFO - --DOMWINDOW == 41 (0x128e94000) [pid = 1063] [serial = 1336] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:10 INFO - --DOMWINDOW == 40 (0x1286b6c00) [pid = 1063] [serial = 1351] [outer = 0x0] [url = http://example.com/redirect-from-bug-630733] 17:01:10 INFO - --DOMWINDOW == 39 (0x127274800) [pid = 1063] [serial = 1349] [outer = 0x0] [url = about:blank] 17:01:10 INFO - --DOMWINDOW == 38 (0x12bb70000) [pid = 1063] [serial = 1365] [outer = 0x0] [url = about:blank] 17:01:10 INFO - --DOMWINDOW == 37 (0x12a178c00) [pid = 1063] [serial = 1362] [outer = 0x0] [url = about:blank] 17:01:10 INFO - --DOMWINDOW == 36 (0x12c3ea000) [pid = 1063] [serial = 1358] [outer = 0x0] [url = http://example.com/redirect-from-bug-630733] 17:01:10 INFO - --DOMWINDOW == 35 (0x129917400) [pid = 1063] [serial = 1352] [outer = 0x0] [url = about:blank] 17:01:10 INFO - --DOMWINDOW == 34 (0x127fe0400) [pid = 1063] [serial = 1350] [outer = 0x0] [url = about:blank] 17:01:10 INFO - --DOMWINDOW == 33 (0x1333da400) [pid = 1063] [serial = 1356] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:10 INFO - --DOMWINDOW == 32 (0x129917000) [pid = 1063] [serial = 1353] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:10 INFO - MEMORY STAT | vsize 3785MB | residentFast 412MB | heapAllocated 131MB 17:01:10 INFO - 287 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js | took 3986ms 17:01:10 INFO - ++DOCSHELL 0x11fbe2200 == 11 [pid = 1063] [id = 572] 17:01:10 INFO - ++DOMWINDOW == 33 (0x120343c00) [pid = 1063] [serial = 1371] [outer = 0x0] 17:01:10 INFO - ++DOMWINDOW == 34 (0x12082f800) [pid = 1063] [serial = 1372] [outer = 0x120343c00] 17:01:10 INFO - 288 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js 17:01:10 INFO - ++DOCSHELL 0x127768800 == 12 [pid = 1063] [id = 573] 17:01:10 INFO - ++DOMWINDOW == 35 (0x1208ac000) [pid = 1063] [serial = 1373] [outer = 0x0] 17:01:10 INFO - ++DOMWINDOW == 36 (0x127274800) [pid = 1063] [serial = 1374] [outer = 0x1208ac000] 17:01:10 INFO - ++DOMWINDOW == 37 (0x1376c5000) [pid = 1063] [serial = 1375] [outer = 0x1208ac000] 17:01:10 INFO - ++DOCSHELL 0x12c6df600 == 13 [pid = 1063] [id = 574] 17:01:10 INFO - ++DOMWINDOW == 38 (0x1216c6c00) [pid = 1063] [serial = 1376] [outer = 0x0] 17:01:10 INFO - ++DOMWINDOW == 39 (0x128738000) [pid = 1063] [serial = 1377] [outer = 0x1216c6c00] 17:01:10 INFO - ++DOMWINDOW == 40 (0x1285cb800) [pid = 1063] [serial = 1378] [outer = 0x1216c6c00] 17:01:10 INFO - ++DOCSHELL 0x12d25ba00 == 14 [pid = 1063] [id = 575] 17:01:10 INFO - ++DOMWINDOW == 41 (0x12d49c800) [pid = 1063] [serial = 1379] [outer = 0x0] 17:01:10 INFO - ++DOMWINDOW == 42 (0x12d4cd000) [pid = 1063] [serial = 1380] [outer = 0x12d49c800] 17:01:11 INFO - ++DOCSHELL 0x135288100 == 15 [pid = 1063] [id = 576] 17:01:11 INFO - ++DOMWINDOW == 43 (0x130982000) [pid = 1063] [serial = 1381] [outer = 0x0] 17:01:11 INFO - ++DOMWINDOW == 44 (0x130982800) [pid = 1063] [serial = 1382] [outer = 0x130982000] 17:01:12 INFO - --DOCSHELL 0x12d25ba00 == 14 [pid = 1063] [id = 575] 17:01:12 INFO - --DOCSHELL 0x121c8e900 == 13 [pid = 1063] [id = 567] 17:01:12 INFO - --DOCSHELL 0x12c6db000 == 12 [pid = 1063] [id = 568] 17:01:12 INFO - --DOCSHELL 0x135288100 == 11 [pid = 1063] [id = 576] 17:01:12 INFO - --DOMWINDOW == 43 (0x1333da800) [pid = 1063] [serial = 1357] [outer = 0x0] [url = about:blank] 17:01:12 INFO - --DOMWINDOW == 42 (0x12ae6a000) [pid = 1063] [serial = 1355] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:13 INFO - --DOMWINDOW == 41 (0x1334d1000) [pid = 1063] [serial = 1369] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:13 INFO - --DOMWINDOW == 40 (0x120996c00) [pid = 1063] [serial = 1359] [outer = 0x0] [url = about:blank] 17:01:13 INFO - --DOMWINDOW == 39 (0x129900400) [pid = 1063] [serial = 1361] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 17:01:13 INFO - --DOMWINDOW == 38 (0x127274800) [pid = 1063] [serial = 1374] [outer = 0x0] [url = about:blank] 17:01:13 INFO - --DOMWINDOW == 37 (0x127f4e800) [pid = 1063] [serial = 1360] [outer = 0x0] [url = about:blank] 17:01:13 INFO - --DOMWINDOW == 36 (0x128738000) [pid = 1063] [serial = 1377] [outer = 0x0] [url = about:blank] 17:01:13 INFO - --DOMWINDOW == 35 (0x133eb7800) [pid = 1063] [serial = 1367] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:13 INFO - --DOMWINDOW == 34 (0x12b0f8c00) [pid = 1063] [serial = 1364] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:13 INFO - MEMORY STAT | vsize 3791MB | residentFast 411MB | heapAllocated 128MB 17:01:13 INFO - 289 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js | took 2887ms 17:01:13 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 577] 17:01:13 INFO - ++DOMWINDOW == 35 (0x120343400) [pid = 1063] [serial = 1383] [outer = 0x0] 17:01:13 INFO - ++DOMWINDOW == 36 (0x1208ac400) [pid = 1063] [serial = 1384] [outer = 0x120343400] 17:01:13 INFO - 290 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632817.js 17:01:13 INFO - ++DOCSHELL 0x12bf3f600 == 13 [pid = 1063] [id = 578] 17:01:13 INFO - ++DOMWINDOW == 37 (0x127f0bc00) [pid = 1063] [serial = 1385] [outer = 0x0] 17:01:13 INFO - ++DOMWINDOW == 38 (0x128696c00) [pid = 1063] [serial = 1386] [outer = 0x127f0bc00] 17:01:13 INFO - ++DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 579] 17:01:13 INFO - ++DOMWINDOW == 39 (0x127fb7800) [pid = 1063] [serial = 1387] [outer = 0x0] 17:01:13 INFO - ++DOMWINDOW == 40 (0x12963d400) [pid = 1063] [serial = 1388] [outer = 0x127fb7800] 17:01:13 INFO - ++DOMWINDOW == 41 (0x129e8dc00) [pid = 1063] [serial = 1389] [outer = 0x127fb7800] 17:01:13 INFO - ++DOCSHELL 0x12ea32700 == 15 [pid = 1063] [id = 580] 17:01:13 INFO - ++DOMWINDOW == 42 (0x13094b800) [pid = 1063] [serial = 1390] [outer = 0x0] 17:01:13 INFO - ++DOMWINDOW == 43 (0x13094bc00) [pid = 1063] [serial = 1391] [outer = 0x13094b800] 17:01:14 INFO - ++DOMWINDOW == 44 (0x129a2c800) [pid = 1063] [serial = 1392] [outer = 0x127f0bc00] 17:01:14 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:15 INFO - ++DOMWINDOW == 45 (0x1365f5800) [pid = 1063] [serial = 1393] [outer = 0x127f0bc00] 17:01:15 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:15 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:01:15 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:01:15 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:01:15 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:01:15 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:01:15 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:01:15 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 17:01:16 INFO - ++DOMWINDOW == 46 (0x11f4c0800) [pid = 1063] [serial = 1394] [outer = 0x127f0bc00] 17:01:16 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:17 INFO - --DOCSHELL 0x127768800 == 14 [pid = 1063] [id = 573] 17:01:17 INFO - --DOCSHELL 0x11fbe2200 == 13 [pid = 1063] [id = 572] 17:01:17 INFO - --DOCSHELL 0x12ea32700 == 12 [pid = 1063] [id = 580] 17:01:17 INFO - --DOCSHELL 0x12c6df600 == 11 [pid = 1063] [id = 574] 17:01:17 INFO - --DOMWINDOW == 45 (0x12a0e6800) [pid = 1063] [serial = 1366] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:17 INFO - --DOMWINDOW == 44 (0x133fd2c00) [pid = 1063] [serial = 1368] [outer = 0x0] [url = about:blank] 17:01:17 INFO - --DOMWINDOW == 43 (0x134882800) [pid = 1063] [serial = 1370] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:17 INFO - --DOMWINDOW == 42 (0x12aebb400) [pid = 1063] [serial = 1363] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 17:01:17 INFO - --DOMWINDOW == 41 (0x12082f800) [pid = 1063] [serial = 1372] [outer = 0x0] [url = about:blank] 17:01:17 INFO - --DOMWINDOW == 40 (0x12963d400) [pid = 1063] [serial = 1388] [outer = 0x0] [url = about:blank] 17:01:17 INFO - --DOMWINDOW == 39 (0x12d49c800) [pid = 1063] [serial = 1379] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:17 INFO - --DOMWINDOW == 38 (0x1216c6c00) [pid = 1063] [serial = 1376] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:17 INFO - --DOMWINDOW == 37 (0x120343c00) [pid = 1063] [serial = 1371] [outer = 0x0] [url = about:blank] 17:01:17 INFO - --DOMWINDOW == 36 (0x1208ac000) [pid = 1063] [serial = 1373] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 17:01:17 INFO - --DOMWINDOW == 35 (0x130982000) [pid = 1063] [serial = 1381] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:17 INFO - --DOMWINDOW == 34 (0x1376c5000) [pid = 1063] [serial = 1375] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 17:01:17 INFO - --DOMWINDOW == 33 (0x129a2c800) [pid = 1063] [serial = 1392] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:01:17 INFO - MEMORY STAT | vsize 3790MB | residentFast 413MB | heapAllocated 127MB 17:01:17 INFO - 291 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632817.js | took 4002ms 17:01:17 INFO - ++DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 581] 17:01:17 INFO - ++DOMWINDOW == 34 (0x1209c4c00) [pid = 1063] [serial = 1395] [outer = 0x0] 17:01:17 INFO - ++DOMWINDOW == 35 (0x127274800) [pid = 1063] [serial = 1396] [outer = 0x1209c4c00] 17:01:17 INFO - 292 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js 17:01:17 INFO - ++DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 582] 17:01:17 INFO - ++DOMWINDOW == 36 (0x12963d400) [pid = 1063] [serial = 1397] [outer = 0x0] 17:01:17 INFO - ++DOMWINDOW == 37 (0x129900800) [pid = 1063] [serial = 1398] [outer = 0x12963d400] 17:01:17 INFO - ++DOCSHELL 0x12ca29000 == 14 [pid = 1063] [id = 583] 17:01:17 INFO - ++DOMWINDOW == 38 (0x129838400) [pid = 1063] [serial = 1399] [outer = 0x0] 17:01:17 INFO - ++DOMWINDOW == 39 (0x1299fe000) [pid = 1063] [serial = 1400] [outer = 0x129838400] 17:01:17 INFO - ++DOMWINDOW == 40 (0x1299ea000) [pid = 1063] [serial = 1401] [outer = 0x129838400] 17:01:17 INFO - ++DOCSHELL 0x12d52de00 == 15 [pid = 1063] [id = 584] 17:01:17 INFO - ++DOMWINDOW == 41 (0x130ffb000) [pid = 1063] [serial = 1402] [outer = 0x0] 17:01:17 INFO - ++DOMWINDOW == 42 (0x131636800) [pid = 1063] [serial = 1403] [outer = 0x130ffb000] 17:01:19 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 577] 17:01:19 INFO - --DOCSHELL 0x12d52de00 == 13 [pid = 1063] [id = 584] 17:01:19 INFO - --DOCSHELL 0x12bf3f600 == 12 [pid = 1063] [id = 578] 17:01:19 INFO - --DOCSHELL 0x12c6dc900 == 11 [pid = 1063] [id = 579] 17:01:19 INFO - --DOMWINDOW == 41 (0x12d4cd000) [pid = 1063] [serial = 1380] [outer = 0x0] [url = about:blank] 17:01:19 INFO - --DOMWINDOW == 40 (0x1285cb800) [pid = 1063] [serial = 1378] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:19 INFO - --DOMWINDOW == 39 (0x130982800) [pid = 1063] [serial = 1382] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:19 INFO - --DOMWINDOW == 38 (0x1299fe000) [pid = 1063] [serial = 1400] [outer = 0x0] [url = about:blank] 17:01:19 INFO - --DOMWINDOW == 37 (0x128696c00) [pid = 1063] [serial = 1386] [outer = 0x0] [url = about:blank] 17:01:19 INFO - --DOMWINDOW == 36 (0x1208ac400) [pid = 1063] [serial = 1384] [outer = 0x0] [url = about:blank] 17:01:19 INFO - --DOMWINDOW == 35 (0x127fb7800) [pid = 1063] [serial = 1387] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:19 INFO - --DOMWINDOW == 34 (0x13094b800) [pid = 1063] [serial = 1390] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:19 INFO - --DOMWINDOW == 33 (0x127f0bc00) [pid = 1063] [serial = 1385] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:01:19 INFO - --DOMWINDOW == 32 (0x120343400) [pid = 1063] [serial = 1383] [outer = 0x0] [url = about:blank] 17:01:19 INFO - MEMORY STAT | vsize 3794MB | residentFast 412MB | heapAllocated 126MB 17:01:19 INFO - 293 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js | took 2306ms 17:01:19 INFO - ++DOCSHELL 0x11fbe1d00 == 12 [pid = 1063] [id = 585] 17:01:19 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 1404] [outer = 0x0] 17:01:19 INFO - ++DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 1405] [outer = 0x120996c00] 17:01:19 INFO - 294 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js 17:01:19 INFO - ++DOCSHELL 0x121c8e900 == 13 [pid = 1063] [id = 586] 17:01:19 INFO - ++DOMWINDOW == 35 (0x127f4e800) [pid = 1063] [serial = 1406] [outer = 0x0] 17:01:19 INFO - ++DOMWINDOW == 36 (0x128e94000) [pid = 1063] [serial = 1407] [outer = 0x127f4e800] 17:01:20 INFO - ++DOCSHELL 0x129f9b700 == 14 [pid = 1063] [id = 587] 17:01:20 INFO - ++DOMWINDOW == 37 (0x120065800) [pid = 1063] [serial = 1408] [outer = 0x0] 17:01:20 INFO - ++DOMWINDOW == 38 (0x1286b6000) [pid = 1063] [serial = 1409] [outer = 0x120065800] 17:01:20 INFO - ++DOMWINDOW == 39 (0x1299ab800) [pid = 1063] [serial = 1410] [outer = 0x120065800] 17:01:20 INFO - ++DOCSHELL 0x12c6dec00 == 15 [pid = 1063] [id = 588] 17:01:20 INFO - ++DOMWINDOW == 40 (0x12f172800) [pid = 1063] [serial = 1411] [outer = 0x0] 17:01:20 INFO - ++DOMWINDOW == 41 (0x1308aac00) [pid = 1063] [serial = 1412] [outer = 0x12f172800] 17:01:21 INFO - ++DOMWINDOW == 42 (0x12fdfc400) [pid = 1063] [serial = 1413] [outer = 0x127f4e800] 17:01:21 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 15: ReferenceError: bar is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar0 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar1 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar2 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar3 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar4 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar5 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar6 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar7 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar8 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar9 is not defined 17:01:21 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar10 is not defined 17:01:22 INFO - --DOCSHELL 0x127766500 == 14 [pid = 1063] [id = 581] 17:01:22 INFO - --DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 582] 17:01:22 INFO - --DOCSHELL 0x12c6dec00 == 12 [pid = 1063] [id = 588] 17:01:22 INFO - --DOCSHELL 0x12ca29000 == 11 [pid = 1063] [id = 583] 17:01:22 INFO - --DOMWINDOW == 41 (0x129e8dc00) [pid = 1063] [serial = 1389] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:22 INFO - --DOMWINDOW == 40 (0x13094bc00) [pid = 1063] [serial = 1391] [outer = 0x0] [url = about:blank] 17:01:22 INFO - --DOMWINDOW == 39 (0x11f4c0800) [pid = 1063] [serial = 1394] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:01:22 INFO - --DOMWINDOW == 38 (0x1365f5800) [pid = 1063] [serial = 1393] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:01:23 INFO - --DOMWINDOW == 37 (0x127274800) [pid = 1063] [serial = 1396] [outer = 0x0] [url = about:blank] 17:01:23 INFO - --DOMWINDOW == 36 (0x129900800) [pid = 1063] [serial = 1398] [outer = 0x0] [url = about:blank] 17:01:23 INFO - --DOMWINDOW == 35 (0x1286b6000) [pid = 1063] [serial = 1409] [outer = 0x0] [url = about:blank] 17:01:23 INFO - --DOMWINDOW == 34 (0x129838400) [pid = 1063] [serial = 1399] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:23 INFO - --DOMWINDOW == 33 (0x130ffb000) [pid = 1063] [serial = 1402] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:23 INFO - --DOMWINDOW == 32 (0x1209c4c00) [pid = 1063] [serial = 1395] [outer = 0x0] [url = about:blank] 17:01:23 INFO - --DOMWINDOW == 31 (0x12963d400) [pid = 1063] [serial = 1397] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>test%20for%20bug%20642108.] 17:01:23 INFO - MEMORY STAT | vsize 3790MB | residentFast 410MB | heapAllocated 127MB 17:01:23 INFO - 295 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js | took 3284ms 17:01:23 INFO - ++DOCSHELL 0x12bb31600 == 12 [pid = 1063] [id = 589] 17:01:23 INFO - ++DOMWINDOW == 32 (0x1286b6400) [pid = 1063] [serial = 1414] [outer = 0x0] 17:01:23 INFO - ++DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 1415] [outer = 0x1286b6400] 17:01:23 INFO - 296 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js 17:01:23 INFO - ++DOCSHELL 0x12c6df100 == 13 [pid = 1063] [id = 590] 17:01:23 INFO - ++DOMWINDOW == 34 (0x129932000) [pid = 1063] [serial = 1416] [outer = 0x0] 17:01:23 INFO - ++DOMWINDOW == 35 (0x129a2c800) [pid = 1063] [serial = 1417] [outer = 0x129932000] 17:01:23 INFO - ++DOCSHELL 0x12cb89100 == 14 [pid = 1063] [id = 591] 17:01:23 INFO - ++DOMWINDOW == 36 (0x129a2a800) [pid = 1063] [serial = 1418] [outer = 0x0] 17:01:23 INFO - ++DOMWINDOW == 37 (0x12a12cc00) [pid = 1063] [serial = 1419] [outer = 0x129a2a800] 17:01:23 INFO - ++DOMWINDOW == 38 (0x12a178000) [pid = 1063] [serial = 1420] [outer = 0x129a2a800] 17:01:23 INFO - ++DOCSHELL 0x130928900 == 15 [pid = 1063] [id = 592] 17:01:23 INFO - ++DOMWINDOW == 39 (0x131a86000) [pid = 1063] [serial = 1421] [outer = 0x0] 17:01:23 INFO - ++DOMWINDOW == 40 (0x131bc2000) [pid = 1063] [serial = 1422] [outer = 0x131a86000] 17:01:24 INFO - ++DOMWINDOW == 41 (0x12b0f8800) [pid = 1063] [serial = 1423] [outer = 0x129932000] 17:01:24 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:01:25 INFO - --DOCSHELL 0x121c8e900 == 14 [pid = 1063] [id = 586] 17:01:25 INFO - --DOCSHELL 0x129f9b700 == 13 [pid = 1063] [id = 587] 17:01:25 INFO - --DOCSHELL 0x130928900 == 12 [pid = 1063] [id = 592] 17:01:25 INFO - --DOMWINDOW == 40 (0x131636800) [pid = 1063] [serial = 1403] [outer = 0x0] [url = about:blank] 17:01:25 INFO - --DOMWINDOW == 39 (0x1299ea000) [pid = 1063] [serial = 1401] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:25 INFO - --DOMWINDOW == 38 (0x127f4e800) [pid = 1063] [serial = 1406] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 17:01:25 INFO - --DOMWINDOW == 37 (0x120996c00) [pid = 1063] [serial = 1404] [outer = 0x0] [url = about:blank] 17:01:25 INFO - --DOMWINDOW == 36 (0x128e94000) [pid = 1063] [serial = 1407] [outer = 0x0] [url = about:blank] 17:01:25 INFO - --DOMWINDOW == 35 (0x127f0bc00) [pid = 1063] [serial = 1405] [outer = 0x0] [url = about:blank] 17:01:25 INFO - --DOMWINDOW == 34 (0x12a12cc00) [pid = 1063] [serial = 1419] [outer = 0x0] [url = about:blank] 17:01:25 INFO - --DOMWINDOW == 33 (0x120065800) [pid = 1063] [serial = 1408] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:25 INFO - --DOMWINDOW == 32 (0x12f172800) [pid = 1063] [serial = 1411] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:26 INFO - MEMORY STAT | vsize 3794MB | residentFast 413MB | heapAllocated 127MB 17:01:26 INFO - 297 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js | took 2655ms 17:01:26 INFO - ++DOCSHELL 0x120929200 == 13 [pid = 1063] [id = 593] 17:01:26 INFO - ++DOMWINDOW == 33 (0x1209c4c00) [pid = 1063] [serial = 1424] [outer = 0x0] 17:01:26 INFO - ++DOMWINDOW == 34 (0x121747c00) [pid = 1063] [serial = 1425] [outer = 0x1209c4c00] 17:01:26 INFO - 298 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js 17:01:26 INFO - ++DOCSHELL 0x12bb2da00 == 14 [pid = 1063] [id = 594] 17:01:26 INFO - ++DOMWINDOW == 35 (0x128696c00) [pid = 1063] [serial = 1426] [outer = 0x0] 17:01:26 INFO - ++DOMWINDOW == 36 (0x128e94000) [pid = 1063] [serial = 1427] [outer = 0x128696c00] 17:01:26 INFO - ++DOCSHELL 0x12c6dd800 == 15 [pid = 1063] [id = 595] 17:01:26 INFO - ++DOMWINDOW == 37 (0x128738000) [pid = 1063] [serial = 1428] [outer = 0x0] 17:01:26 INFO - ++DOMWINDOW == 38 (0x1299ab000) [pid = 1063] [serial = 1429] [outer = 0x128738000] 17:01:26 INFO - ++DOMWINDOW == 39 (0x129aa6c00) [pid = 1063] [serial = 1430] [outer = 0x128738000] 17:01:26 INFO - ++DOCSHELL 0x12d25b500 == 16 [pid = 1063] [id = 596] 17:01:26 INFO - ++DOMWINDOW == 40 (0x130a20c00) [pid = 1063] [serial = 1431] [outer = 0x0] 17:01:26 INFO - ++DOMWINDOW == 41 (0x130b42400) [pid = 1063] [serial = 1432] [outer = 0x130a20c00] 17:01:27 INFO - ++DOCSHELL 0x13542a500 == 17 [pid = 1063] [id = 597] 17:01:27 INFO - ++DOMWINDOW == 42 (0x133fd2c00) [pid = 1063] [serial = 1433] [outer = 0x0] 17:01:27 INFO - ++DOMWINDOW == 43 (0x1355b4800) [pid = 1063] [serial = 1434] [outer = 0x133fd2c00] 17:01:28 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:01:29 INFO - --DOCSHELL 0x11fbe1d00 == 16 [pid = 1063] [id = 585] 17:01:29 INFO - --DOCSHELL 0x12bb31600 == 15 [pid = 1063] [id = 589] 17:01:29 INFO - --DOCSHELL 0x12c6df100 == 14 [pid = 1063] [id = 590] 17:01:29 INFO - --DOCSHELL 0x12cb89100 == 13 [pid = 1063] [id = 591] 17:01:29 INFO - --DOCSHELL 0x12d25b500 == 12 [pid = 1063] [id = 596] 17:01:29 INFO - --DOCSHELL 0x13542a500 == 11 [pid = 1063] [id = 597] 17:01:29 INFO - --DOMWINDOW == 42 (0x1308aac00) [pid = 1063] [serial = 1412] [outer = 0x0] [url = about:blank] 17:01:29 INFO - --DOMWINDOW == 41 (0x1299ab800) [pid = 1063] [serial = 1410] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:29 INFO - --DOMWINDOW == 40 (0x12fdfc400) [pid = 1063] [serial = 1413] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 17:01:29 INFO - --DOMWINDOW == 39 (0x1299ab000) [pid = 1063] [serial = 1429] [outer = 0x0] [url = about:blank] 17:01:29 INFO - --DOMWINDOW == 38 (0x129a2a800) [pid = 1063] [serial = 1418] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:29 INFO - --DOMWINDOW == 37 (0x131a86000) [pid = 1063] [serial = 1421] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:29 INFO - --DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 1416] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 17:01:29 INFO - --DOMWINDOW == 35 (0x1286b6400) [pid = 1063] [serial = 1414] [outer = 0x0] [url = about:blank] 17:01:29 INFO - --DOMWINDOW == 34 (0x129a2c800) [pid = 1063] [serial = 1417] [outer = 0x0] [url = about:blank] 17:01:29 INFO - --DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 1415] [outer = 0x0] [url = about:blank] 17:01:29 INFO - --DOMWINDOW == 32 (0x12b0f8800) [pid = 1063] [serial = 1423] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 17:01:30 INFO - MEMORY STAT | vsize 3790MB | residentFast 409MB | heapAllocated 129MB 17:01:30 INFO - 299 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js | took 3929ms 17:01:30 INFO - ++DOCSHELL 0x11fbe1800 == 12 [pid = 1063] [id = 598] 17:01:30 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 1435] [outer = 0x0] 17:01:30 INFO - ++DOMWINDOW == 34 (0x127274800) [pid = 1063] [serial = 1436] [outer = 0x120996c00] 17:01:30 INFO - 300 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js 17:01:30 INFO - ++DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 599] 17:01:30 INFO - ++DOMWINDOW == 35 (0x127f0bc00) [pid = 1063] [serial = 1437] [outer = 0x0] 17:01:30 INFO - ++DOMWINDOW == 36 (0x1296a6000) [pid = 1063] [serial = 1438] [outer = 0x127f0bc00] 17:01:30 INFO - ++DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 600] 17:01:30 INFO - ++DOMWINDOW == 37 (0x129932000) [pid = 1063] [serial = 1439] [outer = 0x0] 17:01:30 INFO - ++DOMWINDOW == 38 (0x1299fe000) [pid = 1063] [serial = 1440] [outer = 0x129932000] 17:01:30 INFO - ++DOMWINDOW == 39 (0x12a01ec00) [pid = 1063] [serial = 1441] [outer = 0x129932000] 17:01:31 INFO - ++DOCSHELL 0x12d530100 == 15 [pid = 1063] [id = 601] 17:01:31 INFO - ++DOMWINDOW == 40 (0x1366cd400) [pid = 1063] [serial = 1442] [outer = 0x0] 17:01:31 INFO - ++DOMWINDOW == 41 (0x136711000) [pid = 1063] [serial = 1443] [outer = 0x1366cd400] 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - ++DOCSHELL 0x134f9b700 == 16 [pid = 1063] [id = 602] 17:01:31 INFO - ++DOMWINDOW == 42 (0x153814400) [pid = 1063] [serial = 1444] [outer = 0x0] 17:01:31 INFO - ++DOMWINDOW == 43 (0x1538d8400) [pid = 1063] [serial = 1445] [outer = 0x153814400] 17:01:31 INFO - ++DOCSHELL 0x13542af00 == 17 [pid = 1063] [id = 603] 17:01:31 INFO - ++DOMWINDOW == 44 (0x1538d8800) [pid = 1063] [serial = 1446] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x13542b400 == 18 [pid = 1063] [id = 604] 17:01:31 INFO - ++DOMWINDOW == 45 (0x1538d8c00) [pid = 1063] [serial = 1447] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x13542b900 == 19 [pid = 1063] [id = 605] 17:01:31 INFO - ++DOMWINDOW == 46 (0x158995400) [pid = 1063] [serial = 1448] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x13542c300 == 20 [pid = 1063] [id = 606] 17:01:31 INFO - ++DOMWINDOW == 47 (0x158995800) [pid = 1063] [serial = 1449] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x13542c800 == 21 [pid = 1063] [id = 607] 17:01:31 INFO - ++DOMWINDOW == 48 (0x158995c00) [pid = 1063] [serial = 1450] [outer = 0x0] 17:01:31 INFO - ++DOMWINDOW == 49 (0x15bf80000) [pid = 1063] [serial = 1451] [outer = 0x1538d8800] 17:01:31 INFO - ++DOMWINDOW == 50 (0x130b5d400) [pid = 1063] [serial = 1452] [outer = 0x1538d8c00] 17:01:31 INFO - ++DOMWINDOW == 51 (0x130b5dc00) [pid = 1063] [serial = 1453] [outer = 0x158995400] 17:01:31 INFO - ++DOMWINDOW == 52 (0x12b0b2400) [pid = 1063] [serial = 1454] [outer = 0x158995800] 17:01:31 INFO - ++DOMWINDOW == 53 (0x1332f5000) [pid = 1063] [serial = 1455] [outer = 0x158995c00] 17:01:31 INFO - ++DOCSHELL 0x121642f00 == 22 [pid = 1063] [id = 608] 17:01:31 INFO - ++DOMWINDOW == 54 (0x131bc2400) [pid = 1063] [serial = 1456] [outer = 0x0] 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - ++DOCSHELL 0x13092a700 == 23 [pid = 1063] [id = 609] 17:01:31 INFO - ++DOMWINDOW == 55 (0x137031000) [pid = 1063] [serial = 1457] [outer = 0x0] 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - ++DOMWINDOW == 56 (0x137048400) [pid = 1063] [serial = 1458] [outer = 0x131bc2400] 17:01:31 INFO - ++DOMWINDOW == 57 (0x10a467400) [pid = 1063] [serial = 1459] [outer = 0x137031000] 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - ++DOCSHELL 0x135288100 == 24 [pid = 1063] [id = 610] 17:01:31 INFO - ++DOMWINDOW == 58 (0x137f6d800) [pid = 1063] [serial = 1460] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x1355f1a00 == 25 [pid = 1063] [id = 611] 17:01:31 INFO - ++DOMWINDOW == 59 (0x133e66800) [pid = 1063] [serial = 1461] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x1355f2400 == 26 [pid = 1063] [id = 612] 17:01:31 INFO - ++DOMWINDOW == 60 (0x1341d5000) [pid = 1063] [serial = 1462] [outer = 0x0] 17:01:31 INFO - ++DOCSHELL 0x1355f5b00 == 27 [pid = 1063] [id = 613] 17:01:31 INFO - ++DOMWINDOW == 61 (0x1341d5400) [pid = 1063] [serial = 1463] [outer = 0x0] 17:01:31 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:01:31 INFO - ++DOCSHELL 0x13674c800 == 28 [pid = 1063] [id = 614] 17:01:31 INFO - ++DOMWINDOW == 62 (0x1341d5c00) [pid = 1063] [serial = 1464] [outer = 0x0] 17:01:31 INFO - ++DOMWINDOW == 63 (0x1341ea000) [pid = 1063] [serial = 1465] [outer = 0x1341d5c00] 17:01:32 INFO - ++DOMWINDOW == 64 (0x11f8cc800) [pid = 1063] [serial = 1466] [outer = 0x137f6d800] 17:01:32 INFO - ++DOMWINDOW == 65 (0x134831c00) [pid = 1063] [serial = 1467] [outer = 0x133e66800] 17:01:32 INFO - ++DOMWINDOW == 66 (0x1367f0400) [pid = 1063] [serial = 1468] [outer = 0x1341d5000] 17:01:32 INFO - ++DOMWINDOW == 67 (0x137031800) [pid = 1063] [serial = 1469] [outer = 0x1341d5400] 17:01:32 INFO - ++DOMWINDOW == 68 (0x1355ae400) [pid = 1063] [serial = 1470] [outer = 0x1341d5c00] 17:01:33 INFO - ++DOCSHELL 0x15389c900 == 29 [pid = 1063] [id = 615] 17:01:33 INFO - ++DOMWINDOW == 69 (0x130b5d000) [pid = 1063] [serial = 1471] [outer = 0x0] 17:01:33 INFO - ++DOMWINDOW == 70 (0x135451c00) [pid = 1063] [serial = 1472] [outer = 0x130b5d000] 17:01:34 INFO - --DOCSHELL 0x1355f1a00 == 28 [pid = 1063] [id = 611] 17:01:34 INFO - --DOCSHELL 0x1355f2400 == 27 [pid = 1063] [id = 612] 17:01:34 INFO - --DOCSHELL 0x135288100 == 26 [pid = 1063] [id = 610] 17:01:34 INFO - --DOCSHELL 0x1355f5b00 == 25 [pid = 1063] [id = 613] 17:01:34 INFO - --DOCSHELL 0x13092a700 == 24 [pid = 1063] [id = 609] 17:01:34 INFO - --DOCSHELL 0x121642f00 == 23 [pid = 1063] [id = 608] 17:01:34 INFO - console.error: 17:01:34 INFO - Protocol error (noSuchActor): No such actor for ID: server1.conn136.animationsActor23 17:01:34 INFO - MEMORY STAT | vsize 3803MB | residentFast 423MB | heapAllocated 141MB 17:01:34 INFO - 301 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js | took 4353ms 17:01:34 INFO - ++DOCSHELL 0x12c6ddd00 == 24 [pid = 1063] [id = 616] 17:01:34 INFO - ++DOMWINDOW == 71 (0x12bb66000) [pid = 1063] [serial = 1473] [outer = 0x0] 17:01:34 INFO - ++DOMWINDOW == 72 (0x12bff8400) [pid = 1063] [serial = 1474] [outer = 0x12bb66000] 17:01:34 INFO - 302 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js 17:01:34 INFO - ++DOCSHELL 0x12d25b500 == 25 [pid = 1063] [id = 617] 17:01:34 INFO - ++DOMWINDOW == 73 (0x12c46bc00) [pid = 1063] [serial = 1475] [outer = 0x0] 17:01:34 INFO - ++DOMWINDOW == 74 (0x12c48ec00) [pid = 1063] [serial = 1476] [outer = 0x12c46bc00] 17:01:34 INFO - ++DOMWINDOW == 75 (0x12c777800) [pid = 1063] [serial = 1477] [outer = 0x12c46bc00] 17:01:35 INFO - ++DOCSHELL 0x131a44100 == 26 [pid = 1063] [id = 618] 17:01:35 INFO - ++DOMWINDOW == 76 (0x120343c00) [pid = 1063] [serial = 1478] [outer = 0x0] 17:01:35 INFO - ++DOMWINDOW == 77 (0x12c71e800) [pid = 1063] [serial = 1479] [outer = 0x120343c00] 17:01:35 INFO - ++DOMWINDOW == 78 (0x129900800) [pid = 1063] [serial = 1480] [outer = 0x120343c00] 17:01:35 INFO - ++DOCSHELL 0x1332bf300 == 27 [pid = 1063] [id = 619] 17:01:35 INFO - ++DOMWINDOW == 79 (0x136b4ec00) [pid = 1063] [serial = 1481] [outer = 0x0] 17:01:35 INFO - ++DOMWINDOW == 80 (0x137039800) [pid = 1063] [serial = 1482] [outer = 0x136b4ec00] 17:01:36 INFO - ++DOCSHELL 0x136b25300 == 28 [pid = 1063] [id = 620] 17:01:36 INFO - ++DOMWINDOW == 81 (0x1373a3800) [pid = 1063] [serial = 1483] [outer = 0x0] 17:01:36 INFO - ++DOMWINDOW == 82 (0x1373a4c00) [pid = 1063] [serial = 1484] [outer = 0x1373a3800] 17:01:36 INFO - ++DOCSHELL 0x15389dd00 == 29 [pid = 1063] [id = 621] 17:01:36 INFO - ++DOMWINDOW == 83 (0x1373a4400) [pid = 1063] [serial = 1485] [outer = 0x0] 17:01:36 INFO - ++DOMWINDOW == 84 (0x13770b800) [pid = 1063] [serial = 1486] [outer = 0x1373a4400] 17:01:36 INFO - ++DOMWINDOW == 85 (0x1377e8800) [pid = 1063] [serial = 1487] [outer = 0x1373a4400] 17:01:37 INFO - ++DOCSHELL 0x15389f600 == 30 [pid = 1063] [id = 622] 17:01:37 INFO - ++DOMWINDOW == 86 (0x133507400) [pid = 1063] [serial = 1488] [outer = 0x0] 17:01:37 INFO - ++DOMWINDOW == 87 (0x12e19a000) [pid = 1063] [serial = 1489] [outer = 0x133507400] 17:01:37 INFO - ++DOMWINDOW == 88 (0x137e5d000) [pid = 1063] [serial = 1490] [outer = 0x1373a3800] 17:01:38 INFO - ++DOMWINDOW == 89 (0x1352de000) [pid = 1063] [serial = 1491] [outer = 0x1373a3800] 17:01:39 INFO - --DOCSHELL 0x13674c800 == 29 [pid = 1063] [id = 614] 17:01:39 INFO - --DOCSHELL 0x11fbe1800 == 28 [pid = 1063] [id = 598] 17:01:39 INFO - --DOCSHELL 0x127766500 == 27 [pid = 1063] [id = 599] 17:01:39 INFO - --DOCSHELL 0x129f99400 == 26 [pid = 1063] [id = 600] 17:01:39 INFO - --DOCSHELL 0x12bb2da00 == 25 [pid = 1063] [id = 594] 17:01:39 INFO - --DOCSHELL 0x12c6dd800 == 24 [pid = 1063] [id = 595] 17:01:39 INFO - --DOCSHELL 0x12d530100 == 23 [pid = 1063] [id = 601] 17:01:39 INFO - --DOCSHELL 0x120929200 == 22 [pid = 1063] [id = 593] 17:01:39 INFO - --DOCSHELL 0x134f9b700 == 21 [pid = 1063] [id = 602] 17:01:39 INFO - --DOCSHELL 0x15389c900 == 20 [pid = 1063] [id = 615] 17:01:39 INFO - --DOCSHELL 0x13542af00 == 19 [pid = 1063] [id = 603] 17:01:39 INFO - --DOCSHELL 0x13542b400 == 18 [pid = 1063] [id = 604] 17:01:39 INFO - --DOCSHELL 0x13542b900 == 17 [pid = 1063] [id = 605] 17:01:39 INFO - --DOCSHELL 0x13542c300 == 16 [pid = 1063] [id = 606] 17:01:39 INFO - --DOCSHELL 0x13542c800 == 15 [pid = 1063] [id = 607] 17:01:39 INFO - --DOCSHELL 0x15389f600 == 14 [pid = 1063] [id = 622] 17:01:39 INFO - --DOMWINDOW == 88 (0x12a178000) [pid = 1063] [serial = 1420] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:39 INFO - --DOMWINDOW == 87 (0x131bc2000) [pid = 1063] [serial = 1422] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 86 (0x130b5d000) [pid = 1063] [serial = 1471] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:39 INFO - --DOMWINDOW == 85 (0x12c71e800) [pid = 1063] [serial = 1479] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 84 (0x128696c00) [pid = 1063] [serial = 1426] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20autocompletion%20bug%20in%20document.body] 17:01:39 INFO - --DOMWINDOW == 83 (0x133fd2c00) [pid = 1063] [serial = 1433] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:39 INFO - --DOMWINDOW == 82 (0x1209c4c00) [pid = 1063] [serial = 1424] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 81 (0x13770b800) [pid = 1063] [serial = 1486] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 80 (0x130a20c00) [pid = 1063] [serial = 1431] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:39 INFO - --DOMWINDOW == 79 (0x1341d5c00) [pid = 1063] [serial = 1464] [outer = 0x0] [url = data:text/html,<html></html>] 17:01:39 INFO - --DOMWINDOW == 78 (0x128738000) [pid = 1063] [serial = 1428] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:39 INFO - --DOMWINDOW == 77 (0x121747c00) [pid = 1063] [serial = 1425] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 76 (0x1355ae400) [pid = 1063] [serial = 1470] [outer = 0x0] [url = data:text/html,<html></html>] 17:01:39 INFO - --DOMWINDOW == 75 (0x1341ea000) [pid = 1063] [serial = 1465] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 74 (0x12c48ec00) [pid = 1063] [serial = 1476] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 73 (0x1299fe000) [pid = 1063] [serial = 1440] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 72 (0x158995800) [pid = 1063] [serial = 1449] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:01:39 INFO - --DOMWINDOW == 71 (0x158995400) [pid = 1063] [serial = 1448] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:01:39 INFO - --DOMWINDOW == 70 (0x137031000) [pid = 1063] [serial = 1457] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:01:39 INFO - --DOMWINDOW == 69 (0x1538d8c00) [pid = 1063] [serial = 1447] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:01:39 INFO - --DOMWINDOW == 68 (0x1341d5400) [pid = 1063] [serial = 1463] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:01:39 INFO - --DOMWINDOW == 67 (0x137f6d800) [pid = 1063] [serial = 1460] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:01:39 INFO - --DOMWINDOW == 66 (0x1341d5000) [pid = 1063] [serial = 1462] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:01:39 INFO - --DOMWINDOW == 65 (0x133e66800) [pid = 1063] [serial = 1461] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:01:39 INFO - --DOMWINDOW == 64 (0x1538d8800) [pid = 1063] [serial = 1446] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:01:39 INFO - --DOMWINDOW == 63 (0x127274800) [pid = 1063] [serial = 1436] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 62 (0x120996c00) [pid = 1063] [serial = 1435] [outer = 0x0] [url = about:blank] 17:01:39 INFO - --DOMWINDOW == 61 (0x131bc2400) [pid = 1063] [serial = 1456] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:01:39 INFO - --DOCSHELL 0x1332bf300 == 13 [pid = 1063] [id = 619] 17:01:39 INFO - --DOMWINDOW == 60 (0x130b5dc00) [pid = 1063] [serial = 1453] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:01:39 INFO - MEMORY STAT | vsize 3784MB | residentFast 406MB | heapAllocated 121MB 17:01:39 INFO - 303 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js | took 5268ms 17:01:40 INFO - ++DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 623] 17:01:40 INFO - ++DOMWINDOW == 61 (0x120996c00) [pid = 1063] [serial = 1492] [outer = 0x0] 17:01:40 INFO - ++DOMWINDOW == 62 (0x1216c6c00) [pid = 1063] [serial = 1493] [outer = 0x120996c00] 17:01:40 INFO - 304 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js 17:01:40 INFO - ++DOCSHELL 0x12c6dc900 == 15 [pid = 1063] [id = 624] 17:01:40 INFO - ++DOMWINDOW == 63 (0x128696c00) [pid = 1063] [serial = 1494] [outer = 0x0] 17:01:40 INFO - ++DOMWINDOW == 64 (0x12987f800) [pid = 1063] [serial = 1495] [outer = 0x128696c00] 17:01:40 INFO - ++DOCSHELL 0x12cb89100 == 16 [pid = 1063] [id = 625] 17:01:40 INFO - ++DOMWINDOW == 65 (0x129838400) [pid = 1063] [serial = 1496] [outer = 0x0] 17:01:40 INFO - ++DOMWINDOW == 66 (0x1298ee000) [pid = 1063] [serial = 1497] [outer = 0x129838400] 17:01:40 INFO - ++DOMWINDOW == 67 (0x1299ea800) [pid = 1063] [serial = 1498] [outer = 0x129838400] 17:01:40 INFO - ++DOCSHELL 0x12ea31300 == 17 [pid = 1063] [id = 626] 17:01:40 INFO - ++DOMWINDOW == 68 (0x1308b9000) [pid = 1063] [serial = 1499] [outer = 0x0] 17:01:40 INFO - ++DOMWINDOW == 69 (0x13094b800) [pid = 1063] [serial = 1500] [outer = 0x1308b9000] 17:01:41 INFO - ++DOCSHELL 0x1349be900 == 18 [pid = 1063] [id = 627] 17:01:41 INFO - ++DOMWINDOW == 70 (0x1352dec00) [pid = 1063] [serial = 1501] [outer = 0x0] 17:01:41 INFO - ++DOMWINDOW == 71 (0x1355aec00) [pid = 1063] [serial = 1502] [outer = 0x1352dec00] 17:01:41 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:01:45 INFO - --DOCSHELL 0x1349be900 == 17 [pid = 1063] [id = 627] 17:01:46 INFO - --DOCSHELL 0x12cb89100 == 16 [pid = 1063] [id = 625] 17:01:46 INFO - --DOCSHELL 0x12ea31300 == 15 [pid = 1063] [id = 626] 17:01:46 INFO - --DOCSHELL 0x136b25300 == 14 [pid = 1063] [id = 620] 17:01:46 INFO - --DOCSHELL 0x131a44100 == 13 [pid = 1063] [id = 618] 17:01:46 INFO - --DOCSHELL 0x12c6ddd00 == 12 [pid = 1063] [id = 616] 17:01:46 INFO - --DOCSHELL 0x12d25b500 == 11 [pid = 1063] [id = 617] 17:01:46 INFO - --DOCSHELL 0x15389dd00 == 10 [pid = 1063] [id = 621] 17:01:46 INFO - --DOMWINDOW == 70 (0x128e94000) [pid = 1063] [serial = 1427] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 69 (0x135451c00) [pid = 1063] [serial = 1472] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 68 (0x1355b4800) [pid = 1063] [serial = 1434] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:46 INFO - --DOMWINDOW == 67 (0x130b42400) [pid = 1063] [serial = 1432] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 66 (0x129aa6c00) [pid = 1063] [serial = 1430] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:46 INFO - --DOMWINDOW == 65 (0x10a467400) [pid = 1063] [serial = 1459] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:01:46 INFO - --DOMWINDOW == 64 (0x1367f0400) [pid = 1063] [serial = 1468] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:01:46 INFO - --DOMWINDOW == 63 (0x15bf80000) [pid = 1063] [serial = 1451] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:01:46 INFO - --DOMWINDOW == 62 (0x130b5d400) [pid = 1063] [serial = 1452] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:01:46 INFO - --DOMWINDOW == 61 (0x12b0b2400) [pid = 1063] [serial = 1454] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:01:46 INFO - --DOMWINDOW == 60 (0x11f8cc800) [pid = 1063] [serial = 1466] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:01:46 INFO - --DOMWINDOW == 59 (0x137031800) [pid = 1063] [serial = 1469] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:01:46 INFO - --DOMWINDOW == 58 (0x137048400) [pid = 1063] [serial = 1458] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:01:46 INFO - --DOMWINDOW == 57 (0x134831c00) [pid = 1063] [serial = 1467] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:01:46 INFO - --DOMWINDOW == 56 (0x158995c00) [pid = 1063] [serial = 1450] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:01:46 INFO - --DOMWINDOW == 55 (0x153814400) [pid = 1063] [serial = 1444] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:01:46 INFO - --DOMWINDOW == 54 (0x133507400) [pid = 1063] [serial = 1488] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:46 INFO - --DOMWINDOW == 53 (0x120343c00) [pid = 1063] [serial = 1478] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:46 INFO - --DOMWINDOW == 52 (0x1366cd400) [pid = 1063] [serial = 1442] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:01:46 INFO - --DOMWINDOW == 51 (0x136b4ec00) [pid = 1063] [serial = 1481] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:46 INFO - --DOMWINDOW == 50 (0x1373a4400) [pid = 1063] [serial = 1485] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:46 INFO - --DOMWINDOW == 49 (0x129932000) [pid = 1063] [serial = 1439] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:46 INFO - --DOMWINDOW == 48 (0x1373a3800) [pid = 1063] [serial = 1483] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 17:01:46 INFO - --DOMWINDOW == 47 (0x12c46bc00) [pid = 1063] [serial = 1475] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 17:01:46 INFO - --DOMWINDOW == 46 (0x12bb66000) [pid = 1063] [serial = 1473] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 45 (0x127f0bc00) [pid = 1063] [serial = 1437] [outer = 0x0] [url = data:text/html;charset=utf-8,test%20for%20highlighter%20helper%20in%20web%20console] 17:01:46 INFO - --DOMWINDOW == 44 (0x1298ee000) [pid = 1063] [serial = 1497] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 43 (0x1352de000) [pid = 1063] [serial = 1491] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 17:01:46 INFO - --DOMWINDOW == 42 (0x137e5d000) [pid = 1063] [serial = 1490] [outer = 0x0] [url = data:text/html;charset=utf-8,<script>console.time('bTimer');</script>] 17:01:46 INFO - --DOMWINDOW == 41 (0x1373a4c00) [pid = 1063] [serial = 1484] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 40 (0x12bff8400) [pid = 1063] [serial = 1474] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 39 (0x1296a6000) [pid = 1063] [serial = 1438] [outer = 0x0] [url = about:blank] 17:01:46 INFO - --DOMWINDOW == 38 (0x12c777800) [pid = 1063] [serial = 1477] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 17:01:46 INFO - MEMORY STAT | vsize 3788MB | residentFast 417MB | heapAllocated 133MB 17:01:46 INFO - 305 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js | took 6512ms 17:01:46 INFO - ++DOCSHELL 0x11fbe1800 == 11 [pid = 1063] [id = 628] 17:01:46 INFO - ++DOMWINDOW == 39 (0x120343400) [pid = 1063] [serial = 1503] [outer = 0x0] 17:01:46 INFO - ++DOMWINDOW == 40 (0x1205f8400) [pid = 1063] [serial = 1504] [outer = 0x120343400] 17:01:46 INFO - 306 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js 17:01:46 INFO - ++DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 629] 17:01:46 INFO - ++DOMWINDOW == 41 (0x12082f800) [pid = 1063] [serial = 1505] [outer = 0x0] 17:01:46 INFO - ++DOMWINDOW == 42 (0x128501c00) [pid = 1063] [serial = 1506] [outer = 0x12082f800] 17:01:46 INFO - ++DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 630] 17:01:46 INFO - ++DOMWINDOW == 43 (0x127fb7800) [pid = 1063] [serial = 1507] [outer = 0x0] 17:01:46 INFO - ++DOMWINDOW == 44 (0x129932000) [pid = 1063] [serial = 1508] [outer = 0x127fb7800] 17:01:47 INFO - ++DOMWINDOW == 45 (0x1299ab800) [pid = 1063] [serial = 1509] [outer = 0x127fb7800] 17:01:47 INFO - ++DOCSHELL 0x12c6df600 == 14 [pid = 1063] [id = 631] 17:01:47 INFO - ++DOMWINDOW == 46 (0x12d4cd000) [pid = 1063] [serial = 1510] [outer = 0x0] 17:01:47 INFO - ++DOMWINDOW == 47 (0x12d4ef000) [pid = 1063] [serial = 1511] [outer = 0x12d4cd000] 17:01:48 INFO - --DOCSHELL 0x12c6dc900 == 13 [pid = 1063] [id = 624] 17:01:48 INFO - --DOCSHELL 0x129ea8100 == 12 [pid = 1063] [id = 623] 17:01:48 INFO - --DOMWINDOW == 46 (0x12e19a000) [pid = 1063] [serial = 1489] [outer = 0x0] [url = about:blank] 17:01:48 INFO - --DOMWINDOW == 45 (0x129900800) [pid = 1063] [serial = 1480] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:48 INFO - --DOMWINDOW == 44 (0x136711000) [pid = 1063] [serial = 1443] [outer = 0x0] [url = about:blank] 17:01:48 INFO - --DOMWINDOW == 43 (0x1538d8400) [pid = 1063] [serial = 1445] [outer = 0x0] [url = about:blank] 17:01:48 INFO - --DOMWINDOW == 42 (0x1332f5000) [pid = 1063] [serial = 1455] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:01:48 INFO - --DOMWINDOW == 41 (0x137039800) [pid = 1063] [serial = 1482] [outer = 0x0] [url = about:blank] 17:01:48 INFO - --DOMWINDOW == 40 (0x1377e8800) [pid = 1063] [serial = 1487] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:48 INFO - --DOMWINDOW == 39 (0x12a01ec00) [pid = 1063] [serial = 1441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:49 INFO - --DOMWINDOW == 38 (0x1352dec00) [pid = 1063] [serial = 1501] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:49 INFO - --DOMWINDOW == 37 (0x129838400) [pid = 1063] [serial = 1496] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:49 INFO - --DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 1508] [outer = 0x0] [url = about:blank] 17:01:49 INFO - --DOMWINDOW == 35 (0x120996c00) [pid = 1063] [serial = 1492] [outer = 0x0] [url = about:blank] 17:01:49 INFO - --DOMWINDOW == 34 (0x128696c00) [pid = 1063] [serial = 1494] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20659907:%20Expand%20console%20object%20with%20a%20dir%20method] 17:01:49 INFO - --DOMWINDOW == 33 (0x1308b9000) [pid = 1063] [serial = 1499] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:49 INFO - MEMORY STAT | vsize 3784MB | residentFast 411MB | heapAllocated 125MB 17:01:49 INFO - 307 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js | took 2546ms 17:01:49 INFO - ++DOCSHELL 0x11fbe2c00 == 13 [pid = 1063] [id = 632] 17:01:49 INFO - ++DOMWINDOW == 34 (0x120541800) [pid = 1063] [serial = 1512] [outer = 0x0] 17:01:49 INFO - ++DOMWINDOW == 35 (0x1216a2800) [pid = 1063] [serial = 1513] [outer = 0x120541800] 17:01:49 INFO - 308 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js 17:01:49 INFO - ++DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 633] 17:01:49 INFO - ++DOMWINDOW == 36 (0x128696c00) [pid = 1063] [serial = 1514] [outer = 0x0] 17:01:49 INFO - ++DOMWINDOW == 37 (0x1297a0800) [pid = 1063] [serial = 1515] [outer = 0x128696c00] 17:01:49 INFO - ++DOCSHELL 0x1201b0200 == 15 [pid = 1063] [id = 634] 17:01:49 INFO - ++DOMWINDOW == 38 (0x11f8cc800) [pid = 1063] [serial = 1516] [outer = 0x0] 17:01:49 INFO - ++DOMWINDOW == 39 (0x128ffb000) [pid = 1063] [serial = 1517] [outer = 0x11f8cc800] 17:01:49 INFO - ++DOMWINDOW == 40 (0x129900c00) [pid = 1063] [serial = 1518] [outer = 0x11f8cc800] 17:01:49 INFO - ++DOCSHELL 0x12c6dec00 == 16 [pid = 1063] [id = 635] 17:01:49 INFO - ++DOMWINDOW == 41 (0x12e19a800) [pid = 1063] [serial = 1519] [outer = 0x0] 17:01:49 INFO - ++DOMWINDOW == 42 (0x12f15d800) [pid = 1063] [serial = 1520] [outer = 0x12e19a800] 17:01:51 INFO - --DOCSHELL 0x12c6df600 == 15 [pid = 1063] [id = 631] 17:01:51 INFO - --DOCSHELL 0x12c6dec00 == 14 [pid = 1063] [id = 635] 17:01:51 INFO - --DOCSHELL 0x11fbe1800 == 13 [pid = 1063] [id = 628] 17:01:51 INFO - --DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 629] 17:01:51 INFO - --DOCSHELL 0x12bb31600 == 11 [pid = 1063] [id = 630] 17:01:51 INFO - --DOMWINDOW == 41 (0x12987f800) [pid = 1063] [serial = 1495] [outer = 0x0] [url = about:blank] 17:01:51 INFO - --DOMWINDOW == 40 (0x1216c6c00) [pid = 1063] [serial = 1493] [outer = 0x0] [url = about:blank] 17:01:51 INFO - --DOMWINDOW == 39 (0x1355aec00) [pid = 1063] [serial = 1502] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:01:51 INFO - --DOMWINDOW == 38 (0x13094b800) [pid = 1063] [serial = 1500] [outer = 0x0] [url = about:blank] 17:01:51 INFO - --DOMWINDOW == 37 (0x1299ea800) [pid = 1063] [serial = 1498] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:52 INFO - --DOMWINDOW == 36 (0x128501c00) [pid = 1063] [serial = 1506] [outer = 0x0] [url = about:blank] 17:01:52 INFO - --DOMWINDOW == 35 (0x1205f8400) [pid = 1063] [serial = 1504] [outer = 0x0] [url = about:blank] 17:01:52 INFO - --DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 1517] [outer = 0x0] [url = about:blank] 17:01:52 INFO - --DOMWINDOW == 33 (0x12d4cd000) [pid = 1063] [serial = 1510] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:52 INFO - --DOMWINDOW == 32 (0x127fb7800) [pid = 1063] [serial = 1507] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:52 INFO - --DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1505] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>bug%20660806%20-%20history%20navigation%20must%20not%20show%20the%20autocomplete%20popup] 17:01:52 INFO - --DOMWINDOW == 30 (0x120343400) [pid = 1063] [serial = 1503] [outer = 0x0] [url = about:blank] 17:01:52 INFO - MEMORY STAT | vsize 3782MB | residentFast 405MB | heapAllocated 121MB 17:01:52 INFO - 309 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js | took 2744ms 17:01:52 INFO - ++DOCSHELL 0x11fbe2700 == 12 [pid = 1063] [id = 636] 17:01:52 INFO - ++DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1521] [outer = 0x0] 17:01:52 INFO - ++DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 1522] [outer = 0x12082f800] 17:01:52 INFO - 310 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js 17:01:52 INFO - ++DOCSHELL 0x129f9b700 == 13 [pid = 1063] [id = 637] 17:01:52 INFO - ++DOMWINDOW == 33 (0x128e94000) [pid = 1063] [serial = 1523] [outer = 0x0] 17:01:52 INFO - ++DOMWINDOW == 34 (0x129838400) [pid = 1063] [serial = 1524] [outer = 0x128e94000] 17:01:52 INFO - ++DOCSHELL 0x12c6db500 == 14 [pid = 1063] [id = 638] 17:01:52 INFO - ++DOMWINDOW == 35 (0x1285cb800) [pid = 1063] [serial = 1525] [outer = 0x0] 17:01:52 INFO - ++DOMWINDOW == 36 (0x1296a6000) [pid = 1063] [serial = 1526] [outer = 0x1285cb800] 17:01:52 INFO - ++DOMWINDOW == 37 (0x1299fe000) [pid = 1063] [serial = 1527] [outer = 0x1285cb800] 17:01:52 INFO - ++DOCSHELL 0x12c822e00 == 15 [pid = 1063] [id = 639] 17:01:52 INFO - ++DOMWINDOW == 38 (0x131bc1800) [pid = 1063] [serial = 1528] [outer = 0x0] 17:01:52 INFO - ++DOMWINDOW == 39 (0x131bc1c00) [pid = 1063] [serial = 1529] [outer = 0x131bc1800] 17:01:55 INFO - --DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 639] 17:01:55 INFO - --DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 633] 17:01:55 INFO - --DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 634] 17:01:55 INFO - --DOCSHELL 0x11fbe2c00 == 11 [pid = 1063] [id = 632] 17:01:55 INFO - --DOMWINDOW == 38 (0x12d4ef000) [pid = 1063] [serial = 1511] [outer = 0x0] [url = about:blank] 17:01:55 INFO - --DOMWINDOW == 37 (0x1299ab800) [pid = 1063] [serial = 1509] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:55 INFO - --DOMWINDOW == 36 (0x128696c00) [pid = 1063] [serial = 1514] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20664131:%20Expand%20console%20object%20with%20group%20methods] 17:01:55 INFO - --DOMWINDOW == 35 (0x120541800) [pid = 1063] [serial = 1512] [outer = 0x0] [url = about:blank] 17:01:55 INFO - --DOMWINDOW == 34 (0x12e19a800) [pid = 1063] [serial = 1519] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:55 INFO - --DOMWINDOW == 33 (0x11f8cc800) [pid = 1063] [serial = 1516] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:55 INFO - --DOMWINDOW == 32 (0x1296a6000) [pid = 1063] [serial = 1526] [outer = 0x0] [url = about:blank] 17:01:55 INFO - --DOMWINDOW == 31 (0x1297a0800) [pid = 1063] [serial = 1515] [outer = 0x0] [url = about:blank] 17:01:55 INFO - --DOMWINDOW == 30 (0x1216a2800) [pid = 1063] [serial = 1513] [outer = 0x0] [url = about:blank] 17:01:55 INFO - MEMORY STAT | vsize 3783MB | residentFast 406MB | heapAllocated 122MB 17:01:55 INFO - 311 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js | took 3620ms 17:01:55 INFO - ++DOCSHELL 0x11fbe1800 == 12 [pid = 1063] [id = 640] 17:01:55 INFO - ++DOMWINDOW == 31 (0x1205f8400) [pid = 1063] [serial = 1530] [outer = 0x0] 17:01:56 INFO - ++DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 1531] [outer = 0x1205f8400] 17:01:56 INFO - 312 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_704295.js 17:01:56 INFO - ++DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 641] 17:01:56 INFO - ++DOMWINDOW == 33 (0x1216a2800) [pid = 1063] [serial = 1532] [outer = 0x0] 17:01:56 INFO - ++DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 1533] [outer = 0x1216a2800] 17:01:56 INFO - ++DOMWINDOW == 35 (0x1367e9400) [pid = 1063] [serial = 1534] [outer = 0x1216a2800] 17:01:56 INFO - ++DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 642] 17:01:56 INFO - ++DOMWINDOW == 36 (0x128738000) [pid = 1063] [serial = 1535] [outer = 0x0] 17:01:56 INFO - ++DOMWINDOW == 37 (0x1299ea000) [pid = 1063] [serial = 1536] [outer = 0x128738000] 17:01:56 INFO - ++DOMWINDOW == 38 (0x1299ab800) [pid = 1063] [serial = 1537] [outer = 0x128738000] 17:01:56 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 643] 17:01:56 INFO - ++DOMWINDOW == 39 (0x131bc1400) [pid = 1063] [serial = 1538] [outer = 0x0] 17:01:56 INFO - ++DOMWINDOW == 40 (0x1332aec00) [pid = 1063] [serial = 1539] [outer = 0x131bc1400] 17:01:58 INFO - --DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 636] 17:01:58 INFO - --DOCSHELL 0x129f9b700 == 13 [pid = 1063] [id = 637] 17:01:58 INFO - --DOCSHELL 0x12cb89600 == 12 [pid = 1063] [id = 643] 17:01:58 INFO - --DOCSHELL 0x12c6db500 == 11 [pid = 1063] [id = 638] 17:01:58 INFO - --DOMWINDOW == 39 (0x12f15d800) [pid = 1063] [serial = 1520] [outer = 0x0] [url = about:blank] 17:01:58 INFO - --DOMWINDOW == 38 (0x129900c00) [pid = 1063] [serial = 1518] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:58 INFO - --DOMWINDOW == 37 (0x1299ea000) [pid = 1063] [serial = 1536] [outer = 0x0] [url = about:blank] 17:01:58 INFO - --DOMWINDOW == 36 (0x128ffb000) [pid = 1063] [serial = 1533] [outer = 0x0] [url = about:blank] 17:01:58 INFO - --DOMWINDOW == 35 (0x129838400) [pid = 1063] [serial = 1524] [outer = 0x0] [url = about:blank] 17:01:58 INFO - --DOMWINDOW == 34 (0x127274800) [pid = 1063] [serial = 1522] [outer = 0x0] [url = about:blank] 17:01:58 INFO - --DOMWINDOW == 33 (0x1285cb800) [pid = 1063] [serial = 1525] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:01:58 INFO - --DOMWINDOW == 32 (0x131bc1800) [pid = 1063] [serial = 1528] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:01:58 INFO - --DOMWINDOW == 31 (0x128e94000) [pid = 1063] [serial = 1523] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20JSTerm%20Helpers%20autocomplete] 17:01:58 INFO - --DOMWINDOW == 30 (0x12082f800) [pid = 1063] [serial = 1521] [outer = 0x0] [url = about:blank] 17:01:58 INFO - MEMORY STAT | vsize 3787MB | residentFast 405MB | heapAllocated 121MB 17:01:58 INFO - 313 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_704295.js | took 2466ms 17:01:58 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 644] 17:01:58 INFO - ++DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1540] [outer = 0x0] 17:01:58 INFO - ++DOMWINDOW == 32 (0x121747c00) [pid = 1063] [serial = 1541] [outer = 0x12082f800] 17:01:58 INFO - 314 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js 17:01:58 INFO - ++DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 645] 17:01:58 INFO - ++DOMWINDOW == 33 (0x128ffb000) [pid = 1063] [serial = 1542] [outer = 0x0] 17:01:58 INFO - ++DOMWINDOW == 34 (0x129838400) [pid = 1063] [serial = 1543] [outer = 0x128ffb000] 17:01:58 INFO - ++DOMWINDOW == 35 (0x129932400) [pid = 1063] [serial = 1544] [outer = 0x128ffb000] 17:01:58 INFO - ++DOCSHELL 0x12c6db000 == 14 [pid = 1063] [id = 646] 17:01:58 INFO - ++DOMWINDOW == 36 (0x1296a6000) [pid = 1063] [serial = 1545] [outer = 0x0] 17:01:58 INFO - ++DOMWINDOW == 37 (0x129a2c800) [pid = 1063] [serial = 1546] [outer = 0x1296a6000] 17:01:59 INFO - ++DOMWINDOW == 38 (0x1299ab000) [pid = 1063] [serial = 1547] [outer = 0x1296a6000] 17:01:59 INFO - ++DOCSHELL 0x12c6dec00 == 15 [pid = 1063] [id = 647] 17:01:59 INFO - ++DOMWINDOW == 39 (0x131b8dc00) [pid = 1063] [serial = 1548] [outer = 0x0] 17:01:59 INFO - ++DOMWINDOW == 40 (0x131bc1800) [pid = 1063] [serial = 1549] [outer = 0x131b8dc00] 17:02:00 INFO - --DOCSHELL 0x11fbe1800 == 14 [pid = 1063] [id = 640] 17:02:00 INFO - --DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 641] 17:02:00 INFO - --DOCSHELL 0x12c6dc900 == 12 [pid = 1063] [id = 642] 17:02:00 INFO - --DOCSHELL 0x12c6dec00 == 11 [pid = 1063] [id = 647] 17:02:00 INFO - --DOMWINDOW == 39 (0x131bc1c00) [pid = 1063] [serial = 1529] [outer = 0x0] [url = about:blank] 17:02:00 INFO - --DOMWINDOW == 38 (0x1299fe000) [pid = 1063] [serial = 1527] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:00 INFO - --DOMWINDOW == 37 (0x129838400) [pid = 1063] [serial = 1543] [outer = 0x0] [url = about:blank] 17:02:00 INFO - --DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 1531] [outer = 0x0] [url = about:blank] 17:02:00 INFO - --DOMWINDOW == 35 (0x129a2c800) [pid = 1063] [serial = 1546] [outer = 0x0] [url = about:blank] 17:02:00 INFO - --DOMWINDOW == 34 (0x131bc1400) [pid = 1063] [serial = 1538] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:00 INFO - --DOMWINDOW == 33 (0x128738000) [pid = 1063] [serial = 1535] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:00 INFO - --DOMWINDOW == 32 (0x1216a2800) [pid = 1063] [serial = 1532] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:00 INFO - --DOMWINDOW == 31 (0x1205f8400) [pid = 1063] [serial = 1530] [outer = 0x0] [url = about:blank] 17:02:01 INFO - --DOMWINDOW == 30 (0x1367e9400) [pid = 1063] [serial = 1534] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:01 INFO - MEMORY STAT | vsize 3787MB | residentFast 403MB | heapAllocated 120MB 17:02:01 INFO - 315 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js | took 2435ms 17:02:01 INFO - ++DOCSHELL 0x11fbe1800 == 12 [pid = 1063] [id = 648] 17:02:01 INFO - ++DOMWINDOW == 31 (0x120343c00) [pid = 1063] [serial = 1550] [outer = 0x0] 17:02:01 INFO - ++DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1551] [outer = 0x120343c00] 17:02:01 INFO - 316 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js 17:02:01 INFO - ++DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 649] 17:02:01 INFO - ++DOMWINDOW == 33 (0x128696c00) [pid = 1063] [serial = 1552] [outer = 0x0] 17:02:01 INFO - ++DOMWINDOW == 34 (0x129838400) [pid = 1063] [serial = 1553] [outer = 0x128696c00] 17:02:01 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 650] 17:02:01 INFO - ++DOMWINDOW == 35 (0x12963d000) [pid = 1063] [serial = 1554] [outer = 0x0] 17:02:01 INFO - ++DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 1555] [outer = 0x12963d000] 17:02:01 INFO - ++DOMWINDOW == 37 (0x1299ea800) [pid = 1063] [serial = 1556] [outer = 0x12963d000] 17:02:01 INFO - ++DOCSHELL 0x12cb89100 == 15 [pid = 1063] [id = 651] 17:02:01 INFO - ++DOMWINDOW == 38 (0x1333dac00) [pid = 1063] [serial = 1557] [outer = 0x0] 17:02:01 INFO - ++DOMWINDOW == 39 (0x13348f400) [pid = 1063] [serial = 1558] [outer = 0x1333dac00] 17:02:02 INFO - ++DOMWINDOW == 40 (0x12bf6e800) [pid = 1063] [serial = 1559] [outer = 0x128696c00] 17:02:02 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:02:02 INFO - ++DOCSHELL 0x134f99e00 == 16 [pid = 1063] [id = 652] 17:02:02 INFO - ++DOMWINDOW == 41 (0x11f8cc800) [pid = 1063] [serial = 1560] [outer = 0x0] 17:02:02 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:02:02 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:02:02 INFO - ++DOMWINDOW == 42 (0x133e5c000) [pid = 1063] [serial = 1561] [outer = 0x11f8cc800] 17:02:02 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:02:02 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:02:02 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:02:02 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:02:03 INFO - ++DOMWINDOW == 43 (0x133e5cc00) [pid = 1063] [serial = 1562] [outer = 0x11f8cc800] 17:02:03 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:02:03 INFO - [1063] WARNING: Requested underline style is not valid: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5257 17:02:03 INFO - [1063] WARNING: non-IME selection type: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 17:02:04 INFO - --DOCSHELL 0x129ea8100 == 15 [pid = 1063] [id = 645] 17:02:04 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 644] 17:02:04 INFO - --DOCSHELL 0x12c6db000 == 13 [pid = 1063] [id = 646] 17:02:04 INFO - --DOCSHELL 0x12cb89100 == 12 [pid = 1063] [id = 651] 17:02:04 INFO - --DOMWINDOW == 42 (0x1332aec00) [pid = 1063] [serial = 1539] [outer = 0x0] [url = about:blank] 17:02:04 INFO - --DOMWINDOW == 41 (0x1299ab800) [pid = 1063] [serial = 1537] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:04 INFO - --DOMWINDOW == 40 (0x129932400) [pid = 1063] [serial = 1544] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 17:02:04 INFO - --DOMWINDOW == 39 (0x121747c00) [pid = 1063] [serial = 1541] [outer = 0x0] [url = about:blank] 17:02:04 INFO - --DOMWINDOW == 38 (0x129932000) [pid = 1063] [serial = 1555] [outer = 0x0] [url = about:blank] 17:02:04 INFO - --DOMWINDOW == 37 (0x133e5c000) [pid = 1063] [serial = 1561] [outer = 0x0] [url = about:blank] 17:02:04 INFO - --DOMWINDOW == 36 (0x131b8dc00) [pid = 1063] [serial = 1548] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:04 INFO - --DOMWINDOW == 35 (0x1296a6000) [pid = 1063] [serial = 1545] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:04 INFO - --DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 1542] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 17:02:04 INFO - --DOMWINDOW == 33 (0x12082f800) [pid = 1063] [serial = 1540] [outer = 0x0] [url = about:blank] 17:02:04 INFO - MEMORY STAT | vsize 3793MB | residentFast 412MB | heapAllocated 128MB 17:02:04 INFO - 317 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js | took 3071ms 17:02:04 INFO - ++DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 653] 17:02:04 INFO - ++DOMWINDOW == 34 (0x1296a6000) [pid = 1063] [serial = 1563] [outer = 0x0] 17:02:04 INFO - ++DOMWINDOW == 35 (0x129900400) [pid = 1063] [serial = 1564] [outer = 0x1296a6000] 17:02:04 INFO - 318 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js 17:02:04 INFO - ++DOCSHELL 0x12c6dce00 == 14 [pid = 1063] [id = 654] 17:02:04 INFO - ++DOMWINDOW == 36 (0x129a2a800) [pid = 1063] [serial = 1565] [outer = 0x0] 17:02:04 INFO - ++DOMWINDOW == 37 (0x129f83c00) [pid = 1063] [serial = 1566] [outer = 0x129a2a800] 17:02:04 INFO - ++DOMWINDOW == 38 (0x12c26c400) [pid = 1063] [serial = 1567] [outer = 0x129a2a800] 17:02:04 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 655] 17:02:04 INFO - ++DOMWINDOW == 39 (0x12c48ec00) [pid = 1063] [serial = 1568] [outer = 0x0] 17:02:04 INFO - ++DOMWINDOW == 40 (0x12c78f800) [pid = 1063] [serial = 1569] [outer = 0x12c48ec00] 17:02:04 INFO - ++DOCSHELL 0x12d25b000 == 16 [pid = 1063] [id = 656] 17:02:04 INFO - ++DOMWINDOW == 41 (0x129e8d000) [pid = 1063] [serial = 1570] [outer = 0x0] 17:02:04 INFO - ++DOMWINDOW == 42 (0x12c9f5800) [pid = 1063] [serial = 1571] [outer = 0x129e8d000] 17:02:04 INFO - ++DOMWINDOW == 43 (0x12c777800) [pid = 1063] [serial = 1572] [outer = 0x129e8d000] 17:02:05 INFO - ++DOCSHELL 0x130927a00 == 17 [pid = 1063] [id = 657] 17:02:05 INFO - ++DOMWINDOW == 44 (0x13522fc00) [pid = 1063] [serial = 1573] [outer = 0x0] 17:02:05 INFO - ++DOMWINDOW == 45 (0x1352ca400) [pid = 1063] [serial = 1574] [outer = 0x13522fc00] 17:02:05 INFO - ++DOCSHELL 0x1334e0800 == 18 [pid = 1063] [id = 658] 17:02:05 INFO - ++DOMWINDOW == 46 (0x1355a1000) [pid = 1063] [serial = 1575] [outer = 0x0] 17:02:06 INFO - ++DOMWINDOW == 47 (0x1355bc800) [pid = 1063] [serial = 1576] [outer = 0x1355a1000] 17:02:06 INFO - ++DOMWINDOW == 48 (0x1366cd400) [pid = 1063] [serial = 1577] [outer = 0x1355a1000] 17:02:06 INFO - ++DOCSHELL 0x1355f2400 == 19 [pid = 1063] [id = 659] 17:02:06 INFO - ++DOMWINDOW == 49 (0x1367be800) [pid = 1063] [serial = 1578] [outer = 0x0] 17:02:06 INFO - ++DOMWINDOW == 50 (0x1367bc400) [pid = 1063] [serial = 1579] [outer = 0x1367be800] 17:02:06 INFO - ++DOMWINDOW == 51 (0x1367bec00) [pid = 1063] [serial = 1580] [outer = 0x1367be800] 17:02:06 INFO - ++DOCSHELL 0x136a6d800 == 20 [pid = 1063] [id = 660] 17:02:06 INFO - ++DOMWINDOW == 52 (0x1365f5800) [pid = 1063] [serial = 1581] [outer = 0x0] 17:02:06 INFO - ++DOMWINDOW == 53 (0x136b4e800) [pid = 1063] [serial = 1582] [outer = 0x1365f5800] 17:02:06 INFO - ++DOMWINDOW == 54 (0x120538c00) [pid = 1063] [serial = 1583] [outer = 0x1365f5800] 17:02:06 INFO - ++DOCSHELL 0x136b23a00 == 21 [pid = 1063] [id = 661] 17:02:06 INFO - ++DOMWINDOW == 55 (0x153814800) [pid = 1063] [serial = 1584] [outer = 0x0] 17:02:06 INFO - ++DOMWINDOW == 56 (0x1538a5400) [pid = 1063] [serial = 1585] [outer = 0x153814800] 17:02:07 INFO - ++DOCSHELL 0x131a42300 == 22 [pid = 1063] [id = 662] 17:02:07 INFO - ++DOMWINDOW == 57 (0x137031400) [pid = 1063] [serial = 1586] [outer = 0x0] 17:02:07 INFO - ++DOMWINDOW == 58 (0x137047800) [pid = 1063] [serial = 1587] [outer = 0x137031400] 17:02:07 INFO - ++DOMWINDOW == 59 (0x137047c00) [pid = 1063] [serial = 1588] [outer = 0x137031400] 17:02:07 INFO - ++DOCSHELL 0x137080300 == 23 [pid = 1063] [id = 663] 17:02:07 INFO - ++DOMWINDOW == 60 (0x136671c00) [pid = 1063] [serial = 1589] [outer = 0x0] 17:02:07 INFO - ++DOMWINDOW == 61 (0x13710c000) [pid = 1063] [serial = 1590] [outer = 0x136671c00] 17:02:07 INFO - ++DOCSHELL 0x13715f800 == 24 [pid = 1063] [id = 664] 17:02:07 INFO - ++DOMWINDOW == 62 (0x155761800) [pid = 1063] [serial = 1591] [outer = 0x0] 17:02:07 INFO - ++DOMWINDOW == 63 (0x155761c00) [pid = 1063] [serial = 1592] [outer = 0x155761800] 17:02:07 INFO - ++DOMWINDOW == 64 (0x155761000) [pid = 1063] [serial = 1593] [outer = 0x155761800] 17:02:07 INFO - ++DOCSHELL 0x137160c00 == 25 [pid = 1063] [id = 665] 17:02:07 INFO - ++DOMWINDOW == 65 (0x137049800) [pid = 1063] [serial = 1594] [outer = 0x0] 17:02:07 INFO - ++DOMWINDOW == 66 (0x15881f800) [pid = 1063] [serial = 1595] [outer = 0x137049800] 17:02:09 INFO - ++DOCSHELL 0x12cb89b00 == 26 [pid = 1063] [id = 666] 17:02:09 INFO - ++DOMWINDOW == 67 (0x1367e9000) [pid = 1063] [serial = 1596] [outer = 0x0] 17:02:09 INFO - ++DOMWINDOW == 68 (0x136a93c00) [pid = 1063] [serial = 1597] [outer = 0x1367e9000] 17:02:09 INFO - ++DOMWINDOW == 69 (0x13713f800) [pid = 1063] [serial = 1598] [outer = 0x1367e9000] 17:02:09 INFO - ++DOCSHELL 0x130929300 == 27 [pid = 1063] [id = 667] 17:02:09 INFO - ++DOMWINDOW == 70 (0x13713f400) [pid = 1063] [serial = 1599] [outer = 0x0] 17:02:09 INFO - ++DOMWINDOW == 71 (0x136b1b800) [pid = 1063] [serial = 1600] [outer = 0x13713f400] 17:02:09 INFO - ++DOMWINDOW == 72 (0x137039800) [pid = 1063] [serial = 1601] [outer = 0x13713f400] 17:02:09 INFO - ++DOCSHELL 0x130927000 == 28 [pid = 1063] [id = 668] 17:02:09 INFO - ++DOMWINDOW == 73 (0x1362e9400) [pid = 1063] [serial = 1602] [outer = 0x0] 17:02:09 INFO - ++DOMWINDOW == 74 (0x1362e9800) [pid = 1063] [serial = 1603] [outer = 0x1362e9400] 17:02:09 INFO - ++DOMWINDOW == 75 (0x15881fc00) [pid = 1063] [serial = 1604] [outer = 0x1362e9400] 17:02:09 INFO - ++DOCSHELL 0x131a44100 == 29 [pid = 1063] [id = 669] 17:02:09 INFO - ++DOMWINDOW == 76 (0x1367ec000) [pid = 1063] [serial = 1605] [outer = 0x0] 17:02:09 INFO - ++DOMWINDOW == 77 (0x1553af800) [pid = 1063] [serial = 1606] [outer = 0x1367ec000] 17:02:10 INFO - ++DOCSHELL 0x131a44b00 == 30 [pid = 1063] [id = 670] 17:02:10 INFO - ++DOMWINDOW == 78 (0x15bdfc800) [pid = 1063] [serial = 1607] [outer = 0x0] 17:02:10 INFO - ++DOMWINDOW == 79 (0x1587ac400) [pid = 1063] [serial = 1608] [outer = 0x15bdfc800] 17:02:11 INFO - ++DOMWINDOW == 80 (0x15bbdd800) [pid = 1063] [serial = 1609] [outer = 0x15bdfc800] 17:02:11 INFO - ++DOCSHELL 0x15389f600 == 31 [pid = 1063] [id = 671] 17:02:11 INFO - ++DOMWINDOW == 81 (0x15576d000) [pid = 1063] [serial = 1610] [outer = 0x0] 17:02:11 INFO - ++DOMWINDOW == 82 (0x126618800) [pid = 1063] [serial = 1611] [outer = 0x15576d000] 17:02:11 INFO - ++DOMWINDOW == 83 (0x15576d800) [pid = 1063] [serial = 1612] [outer = 0x15576d000] 17:02:11 INFO - ++DOCSHELL 0x158997000 == 32 [pid = 1063] [id = 672] 17:02:11 INFO - ++DOMWINDOW == 84 (0x15596e400) [pid = 1063] [serial = 1613] [outer = 0x0] 17:02:11 INFO - ++DOMWINDOW == 85 (0x15577b800) [pid = 1063] [serial = 1614] [outer = 0x15596e400] 17:02:11 INFO - ++DOCSHELL 0x158999300 == 33 [pid = 1063] [id = 673] 17:02:11 INFO - ++DOMWINDOW == 86 (0x15597a800) [pid = 1063] [serial = 1615] [outer = 0x0] 17:02:11 INFO - ++DOMWINDOW == 87 (0x15597ac00) [pid = 1063] [serial = 1616] [outer = 0x15597a800] 17:02:11 INFO - ++DOMWINDOW == 88 (0x126618400) [pid = 1063] [serial = 1617] [outer = 0x15597a800] 17:02:11 INFO - ++DOCSHELL 0x15899b100 == 34 [pid = 1063] [id = 674] 17:02:11 INFO - ++DOMWINDOW == 89 (0x15bfad000) [pid = 1063] [serial = 1618] [outer = 0x0] 17:02:11 INFO - ++DOMWINDOW == 90 (0x15887a000) [pid = 1063] [serial = 1619] [outer = 0x15bfad000] 17:02:12 INFO - ++DOCSHELL 0x12e039600 == 35 [pid = 1063] [id = 675] 17:02:12 INFO - ++DOMWINDOW == 91 (0x15bdf7c00) [pid = 1063] [serial = 1620] [outer = 0x0] 17:02:12 INFO - ++DOMWINDOW == 92 (0x130b52000) [pid = 1063] [serial = 1621] [outer = 0x15bdf7c00] 17:02:13 INFO - ++DOMWINDOW == 93 (0x13628c000) [pid = 1063] [serial = 1622] [outer = 0x15bdf7c00] 17:02:13 INFO - ++DOCSHELL 0x158844800 == 36 [pid = 1063] [id = 676] 17:02:13 INFO - ++DOMWINDOW == 94 (0x137039c00) [pid = 1063] [serial = 1623] [outer = 0x0] 17:02:13 INFO - ++DOMWINDOW == 95 (0x1365f5400) [pid = 1063] [serial = 1624] [outer = 0x137039c00] 17:02:13 INFO - ++DOMWINDOW == 96 (0x12de4d400) [pid = 1063] [serial = 1625] [outer = 0x137039c00] 17:02:13 INFO - ++DOCSHELL 0x158846600 == 37 [pid = 1063] [id = 677] 17:02:13 INFO - ++DOMWINDOW == 97 (0x12de4d800) [pid = 1063] [serial = 1626] [outer = 0x0] 17:02:13 INFO - ++DOMWINDOW == 98 (0x12de4dc00) [pid = 1063] [serial = 1627] [outer = 0x12de4d800] 17:02:13 INFO - ++DOCSHELL 0x12de5e900 == 38 [pid = 1063] [id = 678] 17:02:13 INFO - ++DOMWINDOW == 99 (0x12de6f400) [pid = 1063] [serial = 1628] [outer = 0x0] 17:02:13 INFO - ++DOMWINDOW == 100 (0x12de6f800) [pid = 1063] [serial = 1629] [outer = 0x12de6f400] 17:02:13 INFO - ++DOMWINDOW == 101 (0x12be25400) [pid = 1063] [serial = 1630] [outer = 0x12de6f400] 17:02:13 INFO - ++DOCSHELL 0x12de5f300 == 39 [pid = 1063] [id = 679] 17:02:13 INFO - ++DOMWINDOW == 102 (0x156379400) [pid = 1063] [serial = 1631] [outer = 0x0] 17:02:13 INFO - ++DOMWINDOW == 103 (0x158173400) [pid = 1063] [serial = 1632] [outer = 0x156379400] 17:02:15 INFO - --DOCSHELL 0x134f99e00 == 38 [pid = 1063] [id = 652] 17:02:16 INFO - --DOCSHELL 0x12de5f300 == 37 [pid = 1063] [id = 679] 17:02:16 INFO - --DOCSHELL 0x11fbe1800 == 36 [pid = 1063] [id = 648] 17:02:16 INFO - --DOCSHELL 0x129f9b200 == 35 [pid = 1063] [id = 649] 17:02:16 INFO - --DOCSHELL 0x12bf3f600 == 34 [pid = 1063] [id = 650] 17:02:16 INFO - --DOMWINDOW == 102 (0x131bc1800) [pid = 1063] [serial = 1549] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 101 (0x1299ab000) [pid = 1063] [serial = 1547] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:16 INFO - --DOMWINDOW == 100 (0x15597ac00) [pid = 1063] [serial = 1616] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 99 (0x1587ac400) [pid = 1063] [serial = 1608] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 98 (0x136b1b800) [pid = 1063] [serial = 1600] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 97 (0x1362e9800) [pid = 1063] [serial = 1603] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 96 (0x136a93c00) [pid = 1063] [serial = 1597] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 95 (0x155761c00) [pid = 1063] [serial = 1592] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 94 (0x12963d000) [pid = 1063] [serial = 1554] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:16 INFO - --DOMWINDOW == 93 (0x1333dac00) [pid = 1063] [serial = 1557] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:16 INFO - --DOMWINDOW == 92 (0x120343c00) [pid = 1063] [serial = 1550] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 91 (0x11f8cc800) [pid = 1063] [serial = 1560] [outer = 0x0] [url = http://example.com/] 17:02:16 INFO - --DOMWINDOW == 90 (0x128696c00) [pid = 1063] [serial = 1552] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 17:02:16 INFO - --DOMWINDOW == 89 (0x137047800) [pid = 1063] [serial = 1587] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 88 (0x1367bc400) [pid = 1063] [serial = 1579] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 87 (0x1355bc800) [pid = 1063] [serial = 1576] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 86 (0x136b4e800) [pid = 1063] [serial = 1582] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 85 (0x129f83c00) [pid = 1063] [serial = 1566] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 84 (0x12c9f5800) [pid = 1063] [serial = 1571] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 83 (0x12de6f800) [pid = 1063] [serial = 1629] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 82 (0x120996c00) [pid = 1063] [serial = 1551] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 81 (0x133e5cc00) [pid = 1063] [serial = 1562] [outer = 0x0] [url = http://example.com/] 17:02:16 INFO - --DOMWINDOW == 80 (0x129838400) [pid = 1063] [serial = 1553] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 79 (0x130b52000) [pid = 1063] [serial = 1621] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 78 (0x1365f5400) [pid = 1063] [serial = 1624] [outer = 0x0] [url = about:blank] 17:02:16 INFO - --DOMWINDOW == 77 (0x126618800) [pid = 1063] [serial = 1611] [outer = 0x0] [url = about:blank] 17:02:17 INFO - --DOCSHELL 0x15899b100 == 33 [pid = 1063] [id = 674] 17:02:17 INFO - --DOCSHELL 0x131a44100 == 32 [pid = 1063] [id = 669] 17:02:17 INFO - --DOCSHELL 0x137160c00 == 31 [pid = 1063] [id = 665] 17:02:17 INFO - --DOCSHELL 0x136b23a00 == 30 [pid = 1063] [id = 661] 17:02:17 INFO - --DOCSHELL 0x130927a00 == 29 [pid = 1063] [id = 657] 17:02:17 INFO - --DOMWINDOW == 76 (0x12bf6e800) [pid = 1063] [serial = 1559] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 17:02:17 INFO - MEMORY STAT | vsize 3784MB | residentFast 417MB | heapAllocated 130MB 17:02:17 INFO - 319 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js | took 13283ms 17:02:17 INFO - ++DOCSHELL 0x12d4c0200 == 30 [pid = 1063] [id = 680] 17:02:17 INFO - ++DOMWINDOW == 77 (0x12a1e1400) [pid = 1063] [serial = 1633] [outer = 0x0] 17:02:17 INFO - ++DOMWINDOW == 78 (0x12b032800) [pid = 1063] [serial = 1634] [outer = 0x12a1e1400] 17:02:17 INFO - 320 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js 17:02:17 INFO - ++DOCSHELL 0x12de5df00 == 31 [pid = 1063] [id = 681] 17:02:17 INFO - ++DOMWINDOW == 79 (0x12c3ea000) [pid = 1063] [serial = 1635] [outer = 0x0] 17:02:17 INFO - ++DOMWINDOW == 80 (0x12c50f800) [pid = 1063] [serial = 1636] [outer = 0x12c3ea000] 17:02:18 INFO - ++DOMWINDOW == 81 (0x11f4c0800) [pid = 1063] [serial = 1637] [outer = 0x12c3ea000] 17:02:18 INFO - ++DOCSHELL 0x12e035a00 == 32 [pid = 1063] [id = 682] 17:02:18 INFO - ++DOMWINDOW == 82 (0x12ca21000) [pid = 1063] [serial = 1638] [outer = 0x0] 17:02:18 INFO - ++DOMWINDOW == 83 (0x12cbf1400) [pid = 1063] [serial = 1639] [outer = 0x12ca21000] 17:02:18 INFO - ++DOCSHELL 0x12cb85000 == 33 [pid = 1063] [id = 683] 17:02:18 INFO - ++DOMWINDOW == 84 (0x12d473000) [pid = 1063] [serial = 1640] [outer = 0x0] 17:02:18 INFO - ++DOMWINDOW == 85 (0x12d48cc00) [pid = 1063] [serial = 1641] [outer = 0x12d473000] 17:02:18 INFO - ++DOMWINDOW == 86 (0x12d4ef800) [pid = 1063] [serial = 1642] [outer = 0x12d473000] 17:02:18 INFO - ++DOCSHELL 0x12e05cb00 == 34 [pid = 1063] [id = 684] 17:02:18 INFO - ++DOMWINDOW == 87 (0x1308f4800) [pid = 1063] [serial = 1643] [outer = 0x0] 17:02:18 INFO - ++DOMWINDOW == 88 (0x13094b800) [pid = 1063] [serial = 1644] [outer = 0x1308f4800] 17:02:20 INFO - --DOCSHELL 0x158844800 == 33 [pid = 1063] [id = 676] 17:02:20 INFO - --DOCSHELL 0x12e05cb00 == 32 [pid = 1063] [id = 684] 17:02:20 INFO - --DOCSHELL 0x13715f800 == 31 [pid = 1063] [id = 664] 17:02:20 INFO - --DOCSHELL 0x12de5e900 == 30 [pid = 1063] [id = 678] 17:02:20 INFO - --DOCSHELL 0x12e039600 == 29 [pid = 1063] [id = 675] 17:02:20 INFO - --DOCSHELL 0x12d25b000 == 28 [pid = 1063] [id = 656] 17:02:20 INFO - --DOCSHELL 0x136a6d800 == 27 [pid = 1063] [id = 660] 17:02:20 INFO - --DOCSHELL 0x158999300 == 26 [pid = 1063] [id = 673] 17:02:20 INFO - --DOCSHELL 0x130927000 == 25 [pid = 1063] [id = 668] 17:02:20 INFO - --DOMWINDOW == 87 (0x1299ea800) [pid = 1063] [serial = 1556] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:20 INFO - --DOMWINDOW == 86 (0x13348f400) [pid = 1063] [serial = 1558] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 85 (0x12de4d800) [pid = 1063] [serial = 1626] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 84 (0x137039c00) [pid = 1063] [serial = 1623] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 17:02:20 INFO - --DOMWINDOW == 83 (0x15bdf7c00) [pid = 1063] [serial = 1620] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 17:02:20 INFO - --DOMWINDOW == 82 (0x15596e400) [pid = 1063] [serial = 1613] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 81 (0x15576d000) [pid = 1063] [serial = 1610] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 17:02:20 INFO - --DOMWINDOW == 80 (0x15bdfc800) [pid = 1063] [serial = 1607] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 17:02:20 INFO - --DOMWINDOW == 79 (0x13713f400) [pid = 1063] [serial = 1599] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 78 (0x1367e9000) [pid = 1063] [serial = 1596] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 17:02:20 INFO - --DOMWINDOW == 77 (0x136671c00) [pid = 1063] [serial = 1589] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 76 (0x137031400) [pid = 1063] [serial = 1586] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 17:02:20 INFO - --DOMWINDOW == 75 (0x1367be800) [pid = 1063] [serial = 1578] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 74 (0x1355a1000) [pid = 1063] [serial = 1575] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 17:02:20 INFO - --DOMWINDOW == 73 (0x12c48ec00) [pid = 1063] [serial = 1568] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 72 (0x129a2a800) [pid = 1063] [serial = 1565] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 17:02:20 INFO - --DOMWINDOW == 71 (0x1296a6000) [pid = 1063] [serial = 1563] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 70 (0x12c50f800) [pid = 1063] [serial = 1636] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 69 (0x129900400) [pid = 1063] [serial = 1564] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 68 (0x12d48cc00) [pid = 1063] [serial = 1641] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 67 (0x12de6f400) [pid = 1063] [serial = 1628] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:20 INFO - --DOMWINDOW == 66 (0x156379400) [pid = 1063] [serial = 1631] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:20 INFO - --DOMWINDOW == 65 (0x12de4dc00) [pid = 1063] [serial = 1627] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 64 (0x12de4d400) [pid = 1063] [serial = 1625] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 17:02:20 INFO - --DOMWINDOW == 63 (0x13628c000) [pid = 1063] [serial = 1622] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 17:02:20 INFO - --DOMWINDOW == 62 (0x15577b800) [pid = 1063] [serial = 1614] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 61 (0x15576d800) [pid = 1063] [serial = 1612] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 17:02:20 INFO - --DOMWINDOW == 60 (0x15bbdd800) [pid = 1063] [serial = 1609] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 17:02:20 INFO - --DOMWINDOW == 59 (0x137039800) [pid = 1063] [serial = 1601] [outer = 0x0] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 58 (0x13713f800) [pid = 1063] [serial = 1598] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 17:02:20 INFO - --DOMWINDOW == 57 (0x13710c000) [pid = 1063] [serial = 1590] [outer = 0x0] [url = about:blank] 17:02:20 INFO - --DOMWINDOW == 56 (0x137047c00) [pid = 1063] [serial = 1588] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 17:02:20 INFO - --DOMWINDOW == 55 (0x1367bec00) [pid = 1063] [serial = 1580] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 54 (0x1366cd400) [pid = 1063] [serial = 1577] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 17:02:20 INFO - --DOMWINDOW == 53 (0x12c78f800) [pid = 1063] [serial = 1569] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 17:02:20 INFO - --DOMWINDOW == 52 (0x12c26c400) [pid = 1063] [serial = 1567] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 17:02:20 INFO - MEMORY STAT | vsize 3787MB | residentFast 413MB | heapAllocated 124MB 17:02:20 INFO - 321 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js | took 2645ms 17:02:20 INFO - ++DOCSHELL 0x1201af300 == 26 [pid = 1063] [id = 685] 17:02:20 INFO - ++DOMWINDOW == 53 (0x1216bac00) [pid = 1063] [serial = 1645] [outer = 0x0] 17:02:20 INFO - ++DOMWINDOW == 54 (0x121ddb400) [pid = 1063] [serial = 1646] [outer = 0x1216bac00] 17:02:20 INFO - 322 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js 17:02:20 INFO - ++DOCSHELL 0x129ea8100 == 27 [pid = 1063] [id = 686] 17:02:20 INFO - ++DOMWINDOW == 55 (0x126618000) [pid = 1063] [serial = 1647] [outer = 0x0] 17:02:20 INFO - ++DOMWINDOW == 56 (0x128501c00) [pid = 1063] [serial = 1648] [outer = 0x126618000] 17:02:20 INFO - ++DOMWINDOW == 57 (0x1297a0800) [pid = 1063] [serial = 1649] [outer = 0x126618000] 17:02:20 INFO - ++DOCSHELL 0x12c6dc900 == 28 [pid = 1063] [id = 687] 17:02:20 INFO - ++DOMWINDOW == 58 (0x127f4e800) [pid = 1063] [serial = 1650] [outer = 0x0] 17:02:20 INFO - ++DOMWINDOW == 59 (0x12987f800) [pid = 1063] [serial = 1651] [outer = 0x127f4e800] 17:02:21 INFO - ++DOMWINDOW == 60 (0x12963d000) [pid = 1063] [serial = 1652] [outer = 0x127f4e800] 17:02:21 INFO - ++DOCSHELL 0x12d25b000 == 29 [pid = 1063] [id = 688] 17:02:21 INFO - ++DOMWINDOW == 61 (0x12e024800) [pid = 1063] [serial = 1653] [outer = 0x0] 17:02:21 INFO - ++DOMWINDOW == 62 (0x12e024c00) [pid = 1063] [serial = 1654] [outer = 0x12e024800] 17:02:22 INFO - ++DOMWINDOW == 63 (0x136b4e800) [pid = 1063] [serial = 1655] [outer = 0x126618000] 17:02:22 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:02:22 INFO - ++DOCSHELL 0x134f9b700 == 30 [pid = 1063] [id = 689] 17:02:22 INFO - ++DOMWINDOW == 64 (0x137178000) [pid = 1063] [serial = 1656] [outer = 0x0] 17:02:22 INFO - ++DOMWINDOW == 65 (0x1372bc000) [pid = 1063] [serial = 1657] [outer = 0x137178000] 17:02:22 INFO - ++DOMWINDOW == 66 (0x128c2a000) [pid = 1063] [serial = 1658] [outer = 0x137178000] 17:02:23 INFO - --DOCSHELL 0x158846600 == 29 [pid = 1063] [id = 677] 17:02:23 INFO - --DOCSHELL 0x137080300 == 28 [pid = 1063] [id = 663] 17:02:23 INFO - --DOCSHELL 0x12ca29000 == 27 [pid = 1063] [id = 655] 17:02:23 INFO - --DOCSHELL 0x130929300 == 26 [pid = 1063] [id = 667] 17:02:23 INFO - --DOCSHELL 0x158997000 == 25 [pid = 1063] [id = 672] 17:02:23 INFO - --DOCSHELL 0x1355f2400 == 24 [pid = 1063] [id = 659] 17:02:23 INFO - --DOCSHELL 0x12e035a00 == 23 [pid = 1063] [id = 682] 17:02:23 INFO - --DOCSHELL 0x131a44b00 == 22 [pid = 1063] [id = 670] 17:02:23 INFO - --DOCSHELL 0x15389f600 == 21 [pid = 1063] [id = 671] 17:02:23 INFO - --DOCSHELL 0x12c6dce00 == 20 [pid = 1063] [id = 654] 17:02:23 INFO - --DOCSHELL 0x127766500 == 19 [pid = 1063] [id = 653] 17:02:23 INFO - --DOCSHELL 0x12cb85000 == 18 [pid = 1063] [id = 683] 17:02:23 INFO - --DOCSHELL 0x12d25b000 == 17 [pid = 1063] [id = 688] 17:02:23 INFO - --DOCSHELL 0x12d4c0200 == 16 [pid = 1063] [id = 680] 17:02:23 INFO - --DOCSHELL 0x12de5df00 == 15 [pid = 1063] [id = 681] 17:02:23 INFO - --DOCSHELL 0x131a42300 == 14 [pid = 1063] [id = 662] 17:02:23 INFO - --DOCSHELL 0x1334e0800 == 13 [pid = 1063] [id = 658] 17:02:23 INFO - --DOCSHELL 0x12cb89b00 == 12 [pid = 1063] [id = 666] 17:02:23 INFO - --DOMWINDOW == 65 (0x158173400) [pid = 1063] [serial = 1632] [outer = 0x0] [url = about:blank] 17:02:23 INFO - --DOMWINDOW == 64 (0x12be25400) [pid = 1063] [serial = 1630] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 63 (0x12a1e1400) [pid = 1063] [serial = 1633] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 62 (0x12c3ea000) [pid = 1063] [serial = 1635] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 17:02:24 INFO - --DOMWINDOW == 61 (0x12ca21000) [pid = 1063] [serial = 1638] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 60 (0x137178000) [pid = 1063] [serial = 1656] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:24 INFO - --DOMWINDOW == 59 (0x12b032800) [pid = 1063] [serial = 1634] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 58 (0x12cbf1400) [pid = 1063] [serial = 1639] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 57 (0x128501c00) [pid = 1063] [serial = 1648] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 56 (0x1372bc000) [pid = 1063] [serial = 1657] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 55 (0x12987f800) [pid = 1063] [serial = 1651] [outer = 0x0] [url = about:blank] 17:02:24 INFO - --DOMWINDOW == 54 (0x153814800) [pid = 1063] [serial = 1584] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 53 (0x1308f4800) [pid = 1063] [serial = 1643] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 52 (0x137049800) [pid = 1063] [serial = 1594] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 51 (0x1367ec000) [pid = 1063] [serial = 1605] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 50 (0x1365f5800) [pid = 1063] [serial = 1581] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 49 (0x12d473000) [pid = 1063] [serial = 1640] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 48 (0x1362e9400) [pid = 1063] [serial = 1602] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 47 (0x15bfad000) [pid = 1063] [serial = 1618] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 46 (0x15597a800) [pid = 1063] [serial = 1615] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 45 (0x129e8d000) [pid = 1063] [serial = 1570] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 44 (0x13522fc00) [pid = 1063] [serial = 1573] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:24 INFO - --DOMWINDOW == 43 (0x155761800) [pid = 1063] [serial = 1591] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:24 INFO - --DOMWINDOW == 42 (0x11f4c0800) [pid = 1063] [serial = 1637] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 17:02:24 INFO - MEMORY STAT | vsize 3788MB | residentFast 413MB | heapAllocated 123MB 17:02:24 INFO - 323 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js | took 3709ms 17:02:24 INFO - ++DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 690] 17:02:24 INFO - ++DOMWINDOW == 43 (0x1296a6000) [pid = 1063] [serial = 1659] [outer = 0x0] 17:02:24 INFO - ++DOMWINDOW == 44 (0x129900c00) [pid = 1063] [serial = 1660] [outer = 0x1296a6000] 17:02:24 INFO - 324 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js 17:02:24 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 691] 17:02:24 INFO - ++DOMWINDOW == 45 (0x129a2a800) [pid = 1063] [serial = 1661] [outer = 0x0] 17:02:24 INFO - ++DOMWINDOW == 46 (0x129e8dc00) [pid = 1063] [serial = 1662] [outer = 0x129a2a800] 17:02:24 INFO - ++DOMWINDOW == 47 (0x12a178000) [pid = 1063] [serial = 1663] [outer = 0x129a2a800] 17:02:24 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-errors.js, line 6: TypeError: document.bar is not a function 17:02:24 INFO - ++DOCSHELL 0x12de5d000 == 15 [pid = 1063] [id = 692] 17:02:24 INFO - ++DOMWINDOW == 48 (0x129e8d000) [pid = 1063] [serial = 1664] [outer = 0x0] 17:02:24 INFO - ++DOMWINDOW == 49 (0x12b0b2000) [pid = 1063] [serial = 1665] [outer = 0x129e8d000] 17:02:25 INFO - ++DOMWINDOW == 50 (0x12b0f8c00) [pid = 1063] [serial = 1666] [outer = 0x129e8d000] 17:02:25 INFO - ++DOCSHELL 0x12e037300 == 16 [pid = 1063] [id = 693] 17:02:25 INFO - ++DOMWINDOW == 51 (0x12e8d8c00) [pid = 1063] [serial = 1667] [outer = 0x0] 17:02:25 INFO - ++DOMWINDOW == 52 (0x12e8fd000) [pid = 1063] [serial = 1668] [outer = 0x12e8d8c00] 17:02:25 INFO - ++DOCSHELL 0x13092b100 == 17 [pid = 1063] [id = 694] 17:02:25 INFO - ++DOMWINDOW == 53 (0x12c48e000) [pid = 1063] [serial = 1669] [outer = 0x0] 17:02:25 INFO - ++DOMWINDOW == 54 (0x1308a7c00) [pid = 1063] [serial = 1670] [outer = 0x12c48e000] 17:02:26 INFO - ++DOCSHELL 0x1332bf300 == 18 [pid = 1063] [id = 695] 17:02:26 INFO - ++DOMWINDOW == 55 (0x15882ac00) [pid = 1063] [serial = 1671] [outer = 0x0] 17:02:26 INFO - ++DOMWINDOW == 56 (0x12d59f400) [pid = 1063] [serial = 1672] [outer = 0x15882ac00] 17:02:28 INFO - --DOCSHELL 0x129ea8100 == 17 [pid = 1063] [id = 686] 17:02:28 INFO - --DOCSHELL 0x134f9b700 == 16 [pid = 1063] [id = 689] 17:02:28 INFO - --DOCSHELL 0x12c6dc900 == 15 [pid = 1063] [id = 687] 17:02:28 INFO - --DOCSHELL 0x12e037300 == 14 [pid = 1063] [id = 693] 17:02:28 INFO - --DOCSHELL 0x1201af300 == 13 [pid = 1063] [id = 685] 17:02:28 INFO - --DOCSHELL 0x13092b100 == 12 [pid = 1063] [id = 694] 17:02:28 INFO - --DOCSHELL 0x1332bf300 == 11 [pid = 1063] [id = 695] 17:02:28 INFO - --DOMWINDOW == 55 (0x1538a5400) [pid = 1063] [serial = 1585] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 54 (0x13094b800) [pid = 1063] [serial = 1644] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 53 (0x15881f800) [pid = 1063] [serial = 1595] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 52 (0x1553af800) [pid = 1063] [serial = 1606] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 51 (0x120538c00) [pid = 1063] [serial = 1583] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 50 (0x12d4ef800) [pid = 1063] [serial = 1642] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 49 (0x15881fc00) [pid = 1063] [serial = 1604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 48 (0x15887a000) [pid = 1063] [serial = 1619] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 47 (0x126618400) [pid = 1063] [serial = 1617] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 46 (0x12c777800) [pid = 1063] [serial = 1572] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 45 (0x1352ca400) [pid = 1063] [serial = 1574] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 44 (0x155761000) [pid = 1063] [serial = 1593] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 43 (0x128c2a000) [pid = 1063] [serial = 1658] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:28 INFO - --DOMWINDOW == 42 (0x1297a0800) [pid = 1063] [serial = 1649] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:28 INFO - --DOMWINDOW == 41 (0x126618000) [pid = 1063] [serial = 1647] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:28 INFO - --DOMWINDOW == 40 (0x1216bac00) [pid = 1063] [serial = 1645] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 39 (0x129e8dc00) [pid = 1063] [serial = 1662] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 38 (0x121ddb400) [pid = 1063] [serial = 1646] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 37 (0x15882ac00) [pid = 1063] [serial = 1671] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:28 INFO - --DOMWINDOW == 36 (0x12e024800) [pid = 1063] [serial = 1653] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:28 INFO - --DOMWINDOW == 35 (0x127f4e800) [pid = 1063] [serial = 1650] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:28 INFO - --DOMWINDOW == 34 (0x12b0b2000) [pid = 1063] [serial = 1665] [outer = 0x0] [url = about:blank] 17:02:28 INFO - --DOMWINDOW == 33 (0x136b4e800) [pid = 1063] [serial = 1655] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:02:28 INFO - MEMORY STAT | vsize 3781MB | residentFast 408MB | heapAllocated 122MB 17:02:28 INFO - 325 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js | took 4217ms 17:02:28 INFO - ++DOCSHELL 0x11fbe2200 == 12 [pid = 1063] [id = 696] 17:02:28 INFO - ++DOMWINDOW == 34 (0x12054bc00) [pid = 1063] [serial = 1673] [outer = 0x0] 17:02:28 INFO - ++DOMWINDOW == 35 (0x121ddb400) [pid = 1063] [serial = 1674] [outer = 0x12054bc00] 17:02:28 INFO - 326 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js 17:02:28 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 697] 17:02:28 INFO - ++DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 1675] [outer = 0x0] 17:02:28 INFO - ++DOMWINDOW == 37 (0x1285cb800) [pid = 1063] [serial = 1676] [outer = 0x1216bac00] 17:02:29 INFO - ++DOCSHELL 0x12c6dba00 == 14 [pid = 1063] [id = 698] 17:02:29 INFO - ++DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 1677] [outer = 0x0] 17:02:29 INFO - ++DOMWINDOW == 39 (0x1297a0800) [pid = 1063] [serial = 1678] [outer = 0x128501c00] 17:02:29 INFO - ++DOMWINDOW == 40 (0x129838400) [pid = 1063] [serial = 1679] [outer = 0x128501c00] 17:02:29 INFO - ++DOCSHELL 0x12cb85000 == 15 [pid = 1063] [id = 699] 17:02:29 INFO - ++DOMWINDOW == 41 (0x12d59fc00) [pid = 1063] [serial = 1680] [outer = 0x0] 17:02:29 INFO - ++DOMWINDOW == 42 (0x12d5a6000) [pid = 1063] [serial = 1681] [outer = 0x12d59fc00] 17:02:30 INFO - ++DOMWINDOW == 43 (0x1216c6c00) [pid = 1063] [serial = 1682] [outer = 0x1216bac00] 17:02:30 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:02:31 INFO - --DOCSHELL 0x12cb85000 == 14 [pid = 1063] [id = 699] 17:02:31 INFO - --DOCSHELL 0x12c6dd300 == 13 [pid = 1063] [id = 691] 17:02:31 INFO - --DOCSHELL 0x129f9b200 == 12 [pid = 1063] [id = 690] 17:02:31 INFO - --DOCSHELL 0x12de5d000 == 11 [pid = 1063] [id = 692] 17:02:31 INFO - --DOMWINDOW == 42 (0x12e024c00) [pid = 1063] [serial = 1654] [outer = 0x0] [url = about:blank] 17:02:31 INFO - --DOMWINDOW == 41 (0x12963d000) [pid = 1063] [serial = 1652] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:31 INFO - --DOMWINDOW == 40 (0x12d59f400) [pid = 1063] [serial = 1672] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:31 INFO - --DOMWINDOW == 39 (0x129900c00) [pid = 1063] [serial = 1660] [outer = 0x0] [url = about:blank] 17:02:31 INFO - --DOMWINDOW == 38 (0x1297a0800) [pid = 1063] [serial = 1678] [outer = 0x0] [url = about:blank] 17:02:31 INFO - --DOMWINDOW == 37 (0x129e8d000) [pid = 1063] [serial = 1664] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:31 INFO - --DOMWINDOW == 36 (0x12e8d8c00) [pid = 1063] [serial = 1667] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:31 INFO - --DOMWINDOW == 35 (0x129a2a800) [pid = 1063] [serial = 1661] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 17:02:31 INFO - --DOMWINDOW == 34 (0x1296a6000) [pid = 1063] [serial = 1659] [outer = 0x0] [url = about:blank] 17:02:31 INFO - --DOMWINDOW == 33 (0x12c48e000) [pid = 1063] [serial = 1669] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 17:02:31 INFO - --DOMWINDOW == 32 (0x12a178000) [pid = 1063] [serial = 1663] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 17:02:31 INFO - MEMORY STAT | vsize 3781MB | residentFast 406MB | heapAllocated 120MB 17:02:31 INFO - 327 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js | took 2725ms 17:02:31 INFO - ++DOCSHELL 0x1285b2500 == 12 [pid = 1063] [id = 700] 17:02:31 INFO - ++DOMWINDOW == 33 (0x127f4e800) [pid = 1063] [serial = 1683] [outer = 0x0] 17:02:31 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 1684] [outer = 0x127f4e800] 17:02:31 INFO - 328 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js 17:02:31 INFO - ++DOCSHELL 0x12c6dc900 == 13 [pid = 1063] [id = 701] 17:02:31 INFO - ++DOMWINDOW == 35 (0x1297a0800) [pid = 1063] [serial = 1685] [outer = 0x0] 17:02:31 INFO - ++DOMWINDOW == 36 (0x129900c00) [pid = 1063] [serial = 1686] [outer = 0x1297a0800] 17:02:31 INFO - ++DOMWINDOW == 37 (0x155761000) [pid = 1063] [serial = 1687] [outer = 0x1297a0800] 17:02:32 INFO - ++DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 702] 17:02:32 INFO - ++DOMWINDOW == 38 (0x129a2c800) [pid = 1063] [serial = 1688] [outer = 0x0] 17:02:32 INFO - ++DOMWINDOW == 39 (0x12a0e6800) [pid = 1063] [serial = 1689] [outer = 0x129a2c800] 17:02:32 INFO - ++DOMWINDOW == 40 (0x129900800) [pid = 1063] [serial = 1690] [outer = 0x129a2c800] 17:02:32 INFO - ++DOCSHELL 0x12de60200 == 15 [pid = 1063] [id = 703] 17:02:32 INFO - ++DOMWINDOW == 41 (0x1308f4400) [pid = 1063] [serial = 1691] [outer = 0x0] 17:02:32 INFO - ++DOMWINDOW == 42 (0x13094b000) [pid = 1063] [serial = 1692] [outer = 0x1308f4400] 17:02:33 INFO - ++DOCSHELL 0x130927000 == 16 [pid = 1063] [id = 704] 17:02:33 INFO - ++DOMWINDOW == 43 (0x134882400) [pid = 1063] [serial = 1693] [outer = 0x0] 17:02:33 INFO - ++DOMWINDOW == 44 (0x134882800) [pid = 1063] [serial = 1694] [outer = 0x134882400] 17:02:33 INFO - ++DOCSHELL 0x130928400 == 17 [pid = 1063] [id = 705] 17:02:33 INFO - ++DOMWINDOW == 45 (0x1355a1000) [pid = 1063] [serial = 1695] [outer = 0x0] 17:02:33 INFO - ++DOMWINDOW == 46 (0x1355b4800) [pid = 1063] [serial = 1696] [outer = 0x1355a1000] 17:02:34 INFO - ++DOCSHELL 0x13674c800 == 18 [pid = 1063] [id = 706] 17:02:34 INFO - ++DOMWINDOW == 47 (0x1587de400) [pid = 1063] [serial = 1697] [outer = 0x0] 17:02:34 INFO - ++DOMWINDOW == 48 (0x130937800) [pid = 1063] [serial = 1698] [outer = 0x1587de400] 17:02:35 INFO - --DOCSHELL 0x1266a6e00 == 17 [pid = 1063] [id = 697] 17:02:35 INFO - --DOCSHELL 0x12c6dba00 == 16 [pid = 1063] [id = 698] 17:02:35 INFO - --DOCSHELL 0x11fbe2200 == 15 [pid = 1063] [id = 696] 17:02:35 INFO - --DOCSHELL 0x12de60200 == 14 [pid = 1063] [id = 703] 17:02:35 INFO - --DOCSHELL 0x130927000 == 13 [pid = 1063] [id = 704] 17:02:35 INFO - --DOCSHELL 0x130928400 == 12 [pid = 1063] [id = 705] 17:02:35 INFO - --DOCSHELL 0x13674c800 == 11 [pid = 1063] [id = 706] 17:02:35 INFO - --DOMWINDOW == 47 (0x12b0f8c00) [pid = 1063] [serial = 1666] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:35 INFO - --DOMWINDOW == 46 (0x12e8fd000) [pid = 1063] [serial = 1668] [outer = 0x0] [url = about:blank] 17:02:35 INFO - --DOMWINDOW == 45 (0x1308a7c00) [pid = 1063] [serial = 1670] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 44 (0x12054bc00) [pid = 1063] [serial = 1673] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 43 (0x1216bac00) [pid = 1063] [serial = 1675] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 17:02:36 INFO - --DOMWINDOW == 42 (0x121ddb400) [pid = 1063] [serial = 1674] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 41 (0x1285cb800) [pid = 1063] [serial = 1676] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 40 (0x129900c00) [pid = 1063] [serial = 1686] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 39 (0x12a0e6800) [pid = 1063] [serial = 1689] [outer = 0x0] [url = about:blank] 17:02:36 INFO - --DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 1677] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:36 INFO - --DOMWINDOW == 37 (0x12d59fc00) [pid = 1063] [serial = 1680] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:36 INFO - --DOMWINDOW == 36 (0x1216c6c00) [pid = 1063] [serial = 1682] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 17:02:36 INFO - MEMORY STAT | vsize 3912MB | residentFast 475MB | heapAllocated 179MB 17:02:36 INFO - 329 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js | took 4463ms 17:02:36 INFO - ++DOCSHELL 0x11fbe2200 == 12 [pid = 1063] [id = 707] 17:02:36 INFO - ++DOMWINDOW == 37 (0x12054bc00) [pid = 1063] [serial = 1699] [outer = 0x0] 17:02:36 INFO - ++DOMWINDOW == 38 (0x1216a2800) [pid = 1063] [serial = 1700] [outer = 0x12054bc00] 17:02:36 INFO - 330 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js 17:02:36 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 708] 17:02:36 INFO - ++DOMWINDOW == 39 (0x1216bac00) [pid = 1063] [serial = 1701] [outer = 0x0] 17:02:36 INFO - ++DOMWINDOW == 40 (0x1285cb800) [pid = 1063] [serial = 1702] [outer = 0x1216bac00] 17:02:36 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 709] 17:02:36 INFO - ++DOMWINDOW == 41 (0x128501c00) [pid = 1063] [serial = 1703] [outer = 0x0] 17:02:36 INFO - ++DOMWINDOW == 42 (0x128ffb000) [pid = 1063] [serial = 1704] [outer = 0x128501c00] 17:02:36 INFO - ++DOMWINDOW == 43 (0x129900400) [pid = 1063] [serial = 1705] [outer = 0x128501c00] 17:02:36 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 710] 17:02:36 INFO - ++DOMWINDOW == 44 (0x12ea9a400) [pid = 1063] [serial = 1706] [outer = 0x0] 17:02:36 INFO - ++DOMWINDOW == 45 (0x12f0c7800) [pid = 1063] [serial = 1707] [outer = 0x12ea9a400] 17:02:38 INFO - --DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 701] 17:02:38 INFO - --DOCSHELL 0x12ca29000 == 13 [pid = 1063] [id = 710] 17:02:38 INFO - --DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 702] 17:02:38 INFO - --DOCSHELL 0x1285b2500 == 11 [pid = 1063] [id = 700] 17:02:38 INFO - --DOMWINDOW == 44 (0x129838400) [pid = 1063] [serial = 1679] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:38 INFO - --DOMWINDOW == 43 (0x12d5a6000) [pid = 1063] [serial = 1681] [outer = 0x0] [url = about:blank] 17:02:39 INFO - --DOMWINDOW == 42 (0x128e94000) [pid = 1063] [serial = 1684] [outer = 0x0] [url = about:blank] 17:02:39 INFO - --DOMWINDOW == 41 (0x128ffb000) [pid = 1063] [serial = 1704] [outer = 0x0] [url = about:blank] 17:02:39 INFO - --DOMWINDOW == 40 (0x129a2c800) [pid = 1063] [serial = 1688] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:39 INFO - --DOMWINDOW == 39 (0x134882400) [pid = 1063] [serial = 1693] [outer = 0x0] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 17:02:39 INFO - --DOMWINDOW == 38 (0x1308f4400) [pid = 1063] [serial = 1691] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:39 INFO - --DOMWINDOW == 37 (0x1297a0800) [pid = 1063] [serial = 1685] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 17:02:39 INFO - --DOMWINDOW == 36 (0x127f4e800) [pid = 1063] [serial = 1683] [outer = 0x0] [url = about:blank] 17:02:39 INFO - --DOMWINDOW == 35 (0x1355a1000) [pid = 1063] [serial = 1695] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:39 INFO - --DOMWINDOW == 34 (0x1587de400) [pid = 1063] [serial = 1697] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:39 INFO - --DOMWINDOW == 33 (0x155761000) [pid = 1063] [serial = 1687] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 17:02:39 INFO - MEMORY STAT | vsize 3813MB | residentFast 410MB | heapAllocated 123MB 17:02:39 INFO - 331 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js | took 2836ms 17:02:39 INFO - ++DOCSHELL 0x1201fdb00 == 12 [pid = 1063] [id = 711] 17:02:39 INFO - ++DOMWINDOW == 34 (0x1216c6c00) [pid = 1063] [serial = 1708] [outer = 0x0] 17:02:39 INFO - ++DOMWINDOW == 35 (0x126618c00) [pid = 1063] [serial = 1709] [outer = 0x1216c6c00] 17:02:39 INFO - 332 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js 17:02:39 INFO - ++DOCSHELL 0x12bb2f300 == 13 [pid = 1063] [id = 712] 17:02:39 INFO - ++DOMWINDOW == 36 (0x128c2a400) [pid = 1063] [serial = 1710] [outer = 0x0] 17:02:39 INFO - ++DOMWINDOW == 37 (0x12963d000) [pid = 1063] [serial = 1711] [outer = 0x128c2a400] 17:02:39 INFO - ++DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 713] 17:02:39 INFO - ++DOMWINDOW == 38 (0x128ffb000) [pid = 1063] [serial = 1712] [outer = 0x0] 17:02:39 INFO - ++DOMWINDOW == 39 (0x129932400) [pid = 1063] [serial = 1713] [outer = 0x128ffb000] 17:02:39 INFO - ++DOMWINDOW == 40 (0x129e8dc00) [pid = 1063] [serial = 1714] [outer = 0x128ffb000] 17:02:39 INFO - ++DOCSHELL 0x12cb85000 == 15 [pid = 1063] [id = 714] 17:02:39 INFO - ++DOMWINDOW == 41 (0x130a20c00) [pid = 1063] [serial = 1715] [outer = 0x0] 17:02:39 INFO - ++DOMWINDOW == 42 (0x130aa9800) [pid = 1063] [serial = 1716] [outer = 0x130a20c00] 17:02:41 INFO - --DOCSHELL 0x11fbe2200 == 14 [pid = 1063] [id = 707] 17:02:41 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 708] 17:02:41 INFO - --DOCSHELL 0x12cb85000 == 12 [pid = 1063] [id = 714] 17:02:41 INFO - --DOCSHELL 0x12bf3f600 == 11 [pid = 1063] [id = 709] 17:02:41 INFO - --DOMWINDOW == 41 (0x129900800) [pid = 1063] [serial = 1690] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:41 INFO - --DOMWINDOW == 40 (0x134882800) [pid = 1063] [serial = 1694] [outer = 0x0] [url = about:blank] 17:02:41 INFO - --DOMWINDOW == 39 (0x13094b000) [pid = 1063] [serial = 1692] [outer = 0x0] [url = about:blank] 17:02:41 INFO - --DOMWINDOW == 38 (0x1355b4800) [pid = 1063] [serial = 1696] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:41 INFO - --DOMWINDOW == 37 (0x130937800) [pid = 1063] [serial = 1698] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:02:41 INFO - --DOMWINDOW == 36 (0x1285cb800) [pid = 1063] [serial = 1702] [outer = 0x0] [url = about:blank] 17:02:41 INFO - --DOMWINDOW == 35 (0x1216a2800) [pid = 1063] [serial = 1700] [outer = 0x0] [url = about:blank] 17:02:41 INFO - --DOMWINDOW == 34 (0x129932400) [pid = 1063] [serial = 1713] [outer = 0x0] [url = about:blank] 17:02:41 INFO - --DOMWINDOW == 33 (0x12ea9a400) [pid = 1063] [serial = 1706] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:41 INFO - --DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 1703] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:41 INFO - --DOMWINDOW == 31 (0x1216bac00) [pid = 1063] [serial = 1701] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20804845%20and%20bug%20619598] 17:02:41 INFO - --DOMWINDOW == 30 (0x12054bc00) [pid = 1063] [serial = 1699] [outer = 0x0] [url = about:blank] 17:02:41 INFO - MEMORY STAT | vsize 3787MB | residentFast 403MB | heapAllocated 120MB 17:02:41 INFO - 333 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js | took 2339ms 17:02:41 INFO - ++DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 715] 17:02:41 INFO - ++DOMWINDOW == 31 (0x12054bc00) [pid = 1063] [serial = 1717] [outer = 0x0] 17:02:41 INFO - ++DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1718] [outer = 0x12054bc00] 17:02:41 INFO - 334 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js 17:02:41 INFO - ++DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 716] 17:02:41 INFO - ++DOMWINDOW == 33 (0x1216a2800) [pid = 1063] [serial = 1719] [outer = 0x0] 17:02:41 INFO - ++DOMWINDOW == 34 (0x127f4e800) [pid = 1063] [serial = 1720] [outer = 0x1216a2800] 17:02:42 INFO - ++DOMWINDOW == 35 (0x1297a0800) [pid = 1063] [serial = 1721] [outer = 0x1216a2800] 17:02:42 INFO - ++DOCSHELL 0x12ca29000 == 14 [pid = 1063] [id = 717] 17:02:42 INFO - ++DOMWINDOW == 36 (0x129900800) [pid = 1063] [serial = 1722] [outer = 0x0] 17:02:42 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 17:02:42 INFO - ++DOMWINDOW == 37 (0x1299ac000) [pid = 1063] [serial = 1723] [outer = 0x129900800] 17:02:42 INFO - ++DOCSHELL 0x12c822e00 == 15 [pid = 1063] [id = 718] 17:02:42 INFO - ++DOMWINDOW == 38 (0x127f0bc00) [pid = 1063] [serial = 1724] [outer = 0x0] 17:02:42 INFO - ++DOMWINDOW == 39 (0x12a01ec00) [pid = 1063] [serial = 1725] [outer = 0x127f0bc00] 17:02:42 INFO - ++DOMWINDOW == 40 (0x129a2c800) [pid = 1063] [serial = 1726] [outer = 0x127f0bc00] 17:02:42 INFO - ++DOCSHELL 0x12d52ed00 == 16 [pid = 1063] [id = 719] 17:02:42 INFO - ++DOMWINDOW == 41 (0x13094bc00) [pid = 1063] [serial = 1727] [outer = 0x0] 17:02:42 INFO - ++DOMWINDOW == 42 (0x130ac5800) [pid = 1063] [serial = 1728] [outer = 0x13094bc00] 17:02:44 INFO - --DOCSHELL 0x1201fdb00 == 15 [pid = 1063] [id = 711] 17:02:44 INFO - --DOCSHELL 0x12bb2f300 == 14 [pid = 1063] [id = 712] 17:02:44 INFO - --DOCSHELL 0x12d52ed00 == 13 [pid = 1063] [id = 719] 17:02:44 INFO - --DOCSHELL 0x12c6dc900 == 12 [pid = 1063] [id = 713] 17:02:44 INFO - --DOMWINDOW == 41 (0x12f0c7800) [pid = 1063] [serial = 1707] [outer = 0x0] [url = about:blank] 17:02:44 INFO - --DOMWINDOW == 40 (0x129900400) [pid = 1063] [serial = 1705] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:44 INFO - --DOMWINDOW == 39 (0x127f4e800) [pid = 1063] [serial = 1720] [outer = 0x0] [url = about:blank] 17:02:44 INFO - --DOMWINDOW == 38 (0x12963d000) [pid = 1063] [serial = 1711] [outer = 0x0] [url = about:blank] 17:02:44 INFO - --DOMWINDOW == 37 (0x126618c00) [pid = 1063] [serial = 1709] [outer = 0x0] [url = about:blank] 17:02:44 INFO - --DOMWINDOW == 36 (0x12a01ec00) [pid = 1063] [serial = 1725] [outer = 0x0] [url = about:blank] 17:02:44 INFO - --DOMWINDOW == 35 (0x128ffb000) [pid = 1063] [serial = 1712] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:44 INFO - --DOMWINDOW == 34 (0x130a20c00) [pid = 1063] [serial = 1715] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:44 INFO - --DOMWINDOW == 33 (0x128c2a400) [pid = 1063] [serial = 1710] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20817834] 17:02:44 INFO - --DOMWINDOW == 32 (0x1216c6c00) [pid = 1063] [serial = 1708] [outer = 0x0] [url = about:blank] 17:02:44 INFO - MEMORY STAT | vsize 3786MB | residentFast 401MB | heapAllocated 120MB 17:02:44 INFO - 335 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js | took 2599ms 17:02:44 INFO - ++DOCSHELL 0x11fbe2c00 == 13 [pid = 1063] [id = 720] 17:02:44 INFO - ++DOMWINDOW == 33 (0x1216c6c00) [pid = 1063] [serial = 1729] [outer = 0x0] 17:02:44 INFO - ++DOMWINDOW == 34 (0x126618400) [pid = 1063] [serial = 1730] [outer = 0x1216c6c00] 17:02:44 INFO - 336 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js 17:02:44 INFO - ++DOCSHELL 0x129ea7700 == 14 [pid = 1063] [id = 721] 17:02:44 INFO - ++DOMWINDOW == 35 (0x128501c00) [pid = 1063] [serial = 1731] [outer = 0x0] 17:02:44 INFO - ++DOMWINDOW == 36 (0x128c2ac00) [pid = 1063] [serial = 1732] [outer = 0x128501c00] 17:02:44 INFO - ++DOCSHELL 0x12c6dba00 == 15 [pid = 1063] [id = 722] 17:02:44 INFO - ++DOMWINDOW == 37 (0x11fadc400) [pid = 1063] [serial = 1733] [outer = 0x0] 17:02:44 INFO - ++DOMWINDOW == 38 (0x128c2a400) [pid = 1063] [serial = 1734] [outer = 0x11fadc400] 17:02:44 INFO - ++DOMWINDOW == 39 (0x129932400) [pid = 1063] [serial = 1735] [outer = 0x11fadc400] 17:02:45 INFO - ++DOCSHELL 0x12c825600 == 16 [pid = 1063] [id = 723] 17:02:45 INFO - ++DOMWINDOW == 40 (0x12fd9d000) [pid = 1063] [serial = 1736] [outer = 0x0] 17:02:45 INFO - ++DOMWINDOW == 41 (0x1308e3400) [pid = 1063] [serial = 1737] [outer = 0x12fd9d000] 17:02:47 INFO - --DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 717] 17:02:47 INFO - --DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 716] 17:02:47 INFO - --DOCSHELL 0x11fbe3100 == 13 [pid = 1063] [id = 715] 17:02:47 INFO - --DOCSHELL 0x12c825600 == 12 [pid = 1063] [id = 723] 17:02:47 INFO - --DOCSHELL 0x12c822e00 == 11 [pid = 1063] [id = 718] 17:02:47 INFO - --DOMWINDOW == 40 (0x129e8dc00) [pid = 1063] [serial = 1714] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:47 INFO - --DOMWINDOW == 39 (0x130aa9800) [pid = 1063] [serial = 1716] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 38 (0x1299ac000) [pid = 1063] [serial = 1723] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 37 (0x120996c00) [pid = 1063] [serial = 1718] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 36 (0x128c2a400) [pid = 1063] [serial = 1734] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 35 (0x127f0bc00) [pid = 1063] [serial = 1724] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:47 INFO - --DOMWINDOW == 34 (0x13094bc00) [pid = 1063] [serial = 1727] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:47 INFO - --DOMWINDOW == 33 (0x129900800) [pid = 1063] [serial = 1722] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 32 (0x1216a2800) [pid = 1063] [serial = 1719] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 17:02:47 INFO - --DOMWINDOW == 31 (0x12054bc00) [pid = 1063] [serial = 1717] [outer = 0x0] [url = about:blank] 17:02:47 INFO - --DOMWINDOW == 30 (0x1297a0800) [pid = 1063] [serial = 1721] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 17:02:47 INFO - MEMORY STAT | vsize 3791MB | residentFast 408MB | heapAllocated 120MB 17:02:47 INFO - 337 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js | took 2698ms 17:02:47 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 724] 17:02:47 INFO - ++DOMWINDOW == 31 (0x120996c00) [pid = 1063] [serial = 1738] [outer = 0x0] 17:02:47 INFO - ++DOMWINDOW == 32 (0x121747c00) [pid = 1063] [serial = 1739] [outer = 0x120996c00] 17:02:47 INFO - 338 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js 17:02:47 INFO - ++DOCSHELL 0x129f9b700 == 13 [pid = 1063] [id = 725] 17:02:47 INFO - ++DOMWINDOW == 33 (0x1285cb800) [pid = 1063] [serial = 1740] [outer = 0x0] 17:02:47 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 1741] [outer = 0x1285cb800] 17:02:47 INFO - ++DOCSHELL 0x121642f00 == 14 [pid = 1063] [id = 726] 17:02:47 INFO - ++DOMWINDOW == 35 (0x128c2a400) [pid = 1063] [serial = 1742] [outer = 0x0] 17:02:47 INFO - ++DOMWINDOW == 36 (0x129900800) [pid = 1063] [serial = 1743] [outer = 0x128c2a400] 17:02:47 INFO - ++DOMWINDOW == 37 (0x129838400) [pid = 1063] [serial = 1744] [outer = 0x128c2a400] 17:02:47 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 727] 17:02:47 INFO - ++DOMWINDOW == 38 (0x1308a3400) [pid = 1063] [serial = 1745] [outer = 0x0] 17:02:47 INFO - ++DOMWINDOW == 39 (0x1308a7c00) [pid = 1063] [serial = 1746] [outer = 0x1308a3400] 17:02:49 INFO - --DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 720] 17:02:49 INFO - --DOCSHELL 0x12ca29000 == 13 [pid = 1063] [id = 727] 17:02:49 INFO - --DOCSHELL 0x12c6dba00 == 12 [pid = 1063] [id = 722] 17:02:49 INFO - --DOCSHELL 0x129ea7700 == 11 [pid = 1063] [id = 721] 17:02:49 INFO - --DOMWINDOW == 38 (0x129a2c800) [pid = 1063] [serial = 1726] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:49 INFO - --DOMWINDOW == 37 (0x130ac5800) [pid = 1063] [serial = 1728] [outer = 0x0] [url = about:blank] 17:02:49 INFO - --DOMWINDOW == 36 (0x128c2ac00) [pid = 1063] [serial = 1732] [outer = 0x0] [url = about:blank] 17:02:49 INFO - --DOMWINDOW == 35 (0x126618400) [pid = 1063] [serial = 1730] [outer = 0x0] [url = about:blank] 17:02:49 INFO - --DOMWINDOW == 34 (0x129900800) [pid = 1063] [serial = 1743] [outer = 0x0] [url = about:blank] 17:02:49 INFO - --DOMWINDOW == 33 (0x11fadc400) [pid = 1063] [serial = 1733] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:49 INFO - --DOMWINDOW == 32 (0x12fd9d000) [pid = 1063] [serial = 1736] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:49 INFO - --DOMWINDOW == 31 (0x128501c00) [pid = 1063] [serial = 1731] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20915141:%20Toggle%20log%20response%20bodies%20with%20keyboard] 17:02:49 INFO - --DOMWINDOW == 30 (0x1216c6c00) [pid = 1063] [serial = 1729] [outer = 0x0] [url = about:blank] 17:02:49 INFO - MEMORY STAT | vsize 3791MB | residentFast 407MB | heapAllocated 121MB 17:02:49 INFO - 339 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js | took 2589ms 17:02:49 INFO - ++DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 728] 17:02:49 INFO - ++DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 1747] [outer = 0x0] 17:02:50 INFO - ++DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 1748] [outer = 0x121ddb400] 17:02:50 INFO - 340 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js 17:02:50 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 729] 17:02:50 INFO - ++DOMWINDOW == 33 (0x128501c00) [pid = 1063] [serial = 1749] [outer = 0x0] 17:02:50 INFO - ++DOMWINDOW == 34 (0x12963d000) [pid = 1063] [serial = 1750] [outer = 0x128501c00] 17:02:50 INFO - ++DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 730] 17:02:50 INFO - ++DOMWINDOW == 35 (0x128ffb000) [pid = 1063] [serial = 1751] [outer = 0x0] 17:02:50 INFO - ++DOMWINDOW == 36 (0x1299ac000) [pid = 1063] [serial = 1752] [outer = 0x128ffb000] 17:02:50 INFO - ++DOMWINDOW == 37 (0x11f4c0800) [pid = 1063] [serial = 1753] [outer = 0x128ffb000] 17:02:50 INFO - ++DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 731] 17:02:50 INFO - ++DOMWINDOW == 38 (0x130978800) [pid = 1063] [serial = 1754] [outer = 0x0] 17:02:50 INFO - ++DOMWINDOW == 39 (0x130982000) [pid = 1063] [serial = 1755] [outer = 0x130978800] 17:02:55 INFO - --DOCSHELL 0x1201ad000 == 14 [pid = 1063] [id = 724] 17:02:55 INFO - --DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 730] 17:02:55 INFO - --DOCSHELL 0x121642f00 == 12 [pid = 1063] [id = 726] 17:02:55 INFO - --DOCSHELL 0x12c825600 == 11 [pid = 1063] [id = 731] 17:02:55 INFO - --DOCSHELL 0x129f9b700 == 10 [pid = 1063] [id = 725] 17:02:55 INFO - --DOMWINDOW == 38 (0x129932400) [pid = 1063] [serial = 1735] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:55 INFO - --DOMWINDOW == 37 (0x1308e3400) [pid = 1063] [serial = 1737] [outer = 0x0] [url = about:blank] 17:02:55 INFO - --DOMWINDOW == 36 (0x128e94000) [pid = 1063] [serial = 1741] [outer = 0x0] [url = about:blank] 17:02:55 INFO - --DOMWINDOW == 35 (0x121747c00) [pid = 1063] [serial = 1739] [outer = 0x0] [url = about:blank] 17:02:55 INFO - --DOMWINDOW == 34 (0x1308a3400) [pid = 1063] [serial = 1745] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:55 INFO - --DOMWINDOW == 33 (0x128c2a400) [pid = 1063] [serial = 1742] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:55 INFO - --DOMWINDOW == 32 (0x1285cb800) [pid = 1063] [serial = 1740] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20922212:%20%20Add%20console.dirxml] 17:02:55 INFO - --DOMWINDOW == 31 (0x120996c00) [pid = 1063] [serial = 1738] [outer = 0x0] [url = about:blank] 17:02:55 INFO - --DOMWINDOW == 30 (0x1299ac000) [pid = 1063] [serial = 1752] [outer = 0x0] [url = about:blank] 17:02:55 INFO - MEMORY STAT | vsize 3788MB | residentFast 407MB | heapAllocated 124MB 17:02:55 INFO - 341 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js | took 5778ms 17:02:55 INFO - ++DOCSHELL 0x1201fdb00 == 11 [pid = 1063] [id = 732] 17:02:55 INFO - ++DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1756] [outer = 0x0] 17:02:55 INFO - ++DOMWINDOW == 32 (0x1216c6c00) [pid = 1063] [serial = 1757] [outer = 0x12082f800] 17:02:56 INFO - 342 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js 17:02:56 INFO - ++DOCSHELL 0x129ea8100 == 12 [pid = 1063] [id = 733] 17:02:56 INFO - ++DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 1758] [outer = 0x0] 17:02:56 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 1759] [outer = 0x1216bac00] 17:02:56 INFO - ++DOMWINDOW == 35 (0x1299ab000) [pid = 1063] [serial = 1760] [outer = 0x1216bac00] 17:02:56 INFO - ++DOCSHELL 0x12c6dba00 == 13 [pid = 1063] [id = 734] 17:02:56 INFO - ++DOMWINDOW == 36 (0x1299ab800) [pid = 1063] [serial = 1761] [outer = 0x0] 17:02:56 INFO - ++DOMWINDOW == 37 (0x129932400) [pid = 1063] [serial = 1762] [outer = 0x1299ab800] 17:02:56 INFO - ++DOCSHELL 0x12c825600 == 14 [pid = 1063] [id = 735] 17:02:56 INFO - ++DOMWINDOW == 38 (0x128c2a400) [pid = 1063] [serial = 1763] [outer = 0x0] 17:02:56 INFO - ++DOMWINDOW == 39 (0x12a178c00) [pid = 1063] [serial = 1764] [outer = 0x128c2a400] 17:02:56 INFO - ++DOMWINDOW == 40 (0x120065800) [pid = 1063] [serial = 1765] [outer = 0x128c2a400] 17:02:56 INFO - ++DOCSHELL 0x12d52de00 == 15 [pid = 1063] [id = 736] 17:02:56 INFO - ++DOMWINDOW == 41 (0x12e376800) [pid = 1063] [serial = 1766] [outer = 0x0] 17:02:56 INFO - ++DOMWINDOW == 42 (0x12e3a4c00) [pid = 1063] [serial = 1767] [outer = 0x12e376800] 17:02:59 INFO - --DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 728] 17:02:59 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 729] 17:02:59 INFO - --DOCSHELL 0x12d52de00 == 12 [pid = 1063] [id = 736] 17:02:59 INFO - --DOMWINDOW == 41 (0x1308a7c00) [pid = 1063] [serial = 1746] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 40 (0x129838400) [pid = 1063] [serial = 1744] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:59 INFO - --DOMWINDOW == 39 (0x127274800) [pid = 1063] [serial = 1748] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 38 (0x12963d000) [pid = 1063] [serial = 1750] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 37 (0x128e94000) [pid = 1063] [serial = 1759] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 36 (0x12a178c00) [pid = 1063] [serial = 1764] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 35 (0x130978800) [pid = 1063] [serial = 1754] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:02:59 INFO - --DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 1751] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:02:59 INFO - --DOMWINDOW == 33 (0x121ddb400) [pid = 1063] [serial = 1747] [outer = 0x0] [url = about:blank] 17:02:59 INFO - --DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 1749] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20cached%20autocompletion%20results] 17:02:59 INFO - MEMORY STAT | vsize 3789MB | residentFast 406MB | heapAllocated 120MB 17:02:59 INFO - 343 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js | took 3731ms 17:02:59 INFO - ++DOCSHELL 0x11fbe3600 == 13 [pid = 1063] [id = 737] 17:02:59 INFO - ++DOMWINDOW == 33 (0x126618000) [pid = 1063] [serial = 1768] [outer = 0x0] 17:02:59 INFO - ++DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 1769] [outer = 0x126618000] 17:02:59 INFO - 344 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js 17:02:59 INFO - ++DOCSHELL 0x129f99400 == 14 [pid = 1063] [id = 738] 17:02:59 INFO - ++DOMWINDOW == 35 (0x120065000) [pid = 1063] [serial = 1770] [outer = 0x0] 17:02:59 INFO - ++DOMWINDOW == 36 (0x128ffb000) [pid = 1063] [serial = 1771] [outer = 0x120065000] 17:03:00 INFO - ++DOCSHELL 0x12c6db000 == 15 [pid = 1063] [id = 739] 17:03:00 INFO - ++DOMWINDOW == 37 (0x128696c00) [pid = 1063] [serial = 1772] [outer = 0x0] 17:03:00 INFO - ++DOMWINDOW == 38 (0x129900c00) [pid = 1063] [serial = 1773] [outer = 0x128696c00] 17:03:00 INFO - ++DOMWINDOW == 39 (0x1299fe000) [pid = 1063] [serial = 1774] [outer = 0x128696c00] 17:03:00 INFO - ++DOCSHELL 0x12ca2d600 == 16 [pid = 1063] [id = 740] 17:03:00 INFO - ++DOMWINDOW == 40 (0x12df19000) [pid = 1063] [serial = 1775] [outer = 0x0] 17:03:00 INFO - ++DOMWINDOW == 41 (0x12df27000) [pid = 1063] [serial = 1776] [outer = 0x12df19000] 17:03:01 INFO - ++DOMWINDOW == 42 (0x12bfa7000) [pid = 1063] [serial = 1777] [outer = 0x120065000] 17:03:01 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:01 INFO - ++DOMWINDOW == 43 (0x134fa0400) [pid = 1063] [serial = 1778] [outer = 0x120065000] 17:03:02 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:02 INFO - ++DOMWINDOW == 44 (0x12d59fc00) [pid = 1063] [serial = 1779] [outer = 0x120065000] 17:03:02 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:03 INFO - ++DOMWINDOW == 45 (0x129932800) [pid = 1063] [serial = 1780] [outer = 0x120065000] 17:03:03 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:04 INFO - --DOCSHELL 0x12c6dba00 == 15 [pid = 1063] [id = 734] 17:03:04 INFO - --DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 733] 17:03:04 INFO - --DOCSHELL 0x1201fdb00 == 13 [pid = 1063] [id = 732] 17:03:04 INFO - --DOCSHELL 0x12ca2d600 == 12 [pid = 1063] [id = 740] 17:03:04 INFO - --DOCSHELL 0x12c825600 == 11 [pid = 1063] [id = 735] 17:03:04 INFO - --DOMWINDOW == 44 (0x130982000) [pid = 1063] [serial = 1755] [outer = 0x0] [url = about:blank] 17:03:04 INFO - --DOMWINDOW == 43 (0x11f4c0800) [pid = 1063] [serial = 1753] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:04 INFO - --DOMWINDOW == 42 (0x129900c00) [pid = 1063] [serial = 1773] [outer = 0x0] [url = about:blank] 17:03:04 INFO - --DOMWINDOW == 41 (0x1216c6c00) [pid = 1063] [serial = 1757] [outer = 0x0] [url = about:blank] 17:03:04 INFO - --DOMWINDOW == 40 (0x128ffb000) [pid = 1063] [serial = 1771] [outer = 0x0] [url = about:blank] 17:03:04 INFO - --DOMWINDOW == 39 (0x12e376800) [pid = 1063] [serial = 1766] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:04 INFO - --DOMWINDOW == 38 (0x128c2a400) [pid = 1063] [serial = 1763] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:04 INFO - --DOMWINDOW == 37 (0x1299ab800) [pid = 1063] [serial = 1761] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 17:03:04 INFO - --DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 1758] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 17:03:04 INFO - --DOMWINDOW == 35 (0x12082f800) [pid = 1063] [serial = 1756] [outer = 0x0] [url = about:blank] 17:03:04 INFO - --DOMWINDOW == 34 (0x129932400) [pid = 1063] [serial = 1762] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 17:03:04 INFO - --DOMWINDOW == 33 (0x1299ab000) [pid = 1063] [serial = 1760] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 17:03:04 INFO - MEMORY STAT | vsize 3786MB | residentFast 404MB | heapAllocated 121MB 17:03:04 INFO - 345 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js | took 4687ms 17:03:04 INFO - ++DOCSHELL 0x1266a6e00 == 12 [pid = 1063] [id = 741] 17:03:04 INFO - ++DOMWINDOW == 34 (0x12054bc00) [pid = 1063] [serial = 1781] [outer = 0x0] 17:03:04 INFO - ++DOMWINDOW == 35 (0x1209c4c00) [pid = 1063] [serial = 1782] [outer = 0x12054bc00] 17:03:04 INFO - 346 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_change_font_size.js 17:03:04 INFO - ++DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 742] 17:03:04 INFO - ++DOMWINDOW == 36 (0x121747c00) [pid = 1063] [serial = 1783] [outer = 0x0] 17:03:04 INFO - ++DOMWINDOW == 37 (0x128738000) [pid = 1063] [serial = 1784] [outer = 0x121747c00] 17:03:04 INFO - ++DOMWINDOW == 38 (0x128ffb000) [pid = 1063] [serial = 1785] [outer = 0x121747c00] 17:03:05 INFO - ++DOCSHELL 0x12ca2d600 == 14 [pid = 1063] [id = 743] 17:03:05 INFO - ++DOMWINDOW == 39 (0x126618800) [pid = 1063] [serial = 1786] [outer = 0x0] 17:03:05 INFO - ++DOMWINDOW == 40 (0x12987f800) [pid = 1063] [serial = 1787] [outer = 0x126618800] 17:03:05 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:03:05 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:03:05 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 17:03:06 INFO - MEMORY STAT | vsize 3773MB | residentFast 391MB | heapAllocated 125MB 17:03:06 INFO - 347 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_change_font_size.js | took 1353ms 17:03:06 INFO - ++DOCSHELL 0x12d25b000 == 15 [pid = 1063] [id = 744] 17:03:06 INFO - ++DOMWINDOW == 41 (0x12a178000) [pid = 1063] [serial = 1788] [outer = 0x0] 17:03:06 INFO - ++DOMWINDOW == 42 (0x12ae6a000) [pid = 1063] [serial = 1789] [outer = 0x12a178000] 17:03:06 INFO - 348 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_chrome.js 17:03:06 INFO - ++DOCSHELL 0x12de61100 == 16 [pid = 1063] [id = 745] 17:03:06 INFO - ++DOMWINDOW == 43 (0x12b0f8800) [pid = 1063] [serial = 1790] [outer = 0x0] 17:03:06 INFO - ++DOMWINDOW == 44 (0x12bb66800) [pid = 1063] [serial = 1791] [outer = 0x12b0f8800] 17:03:06 INFO - ++DOMWINDOW == 45 (0x128501c00) [pid = 1063] [serial = 1792] [outer = 0x12b0f8800] 17:03:06 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 17:03:06 INFO - ++DOCSHELL 0x131a40f00 == 17 [pid = 1063] [id = 746] 17:03:06 INFO - ++DOMWINDOW == 46 (0x12ca21000) [pid = 1063] [serial = 1793] [outer = 0x0] 17:03:06 INFO - ++DOMWINDOW == 47 (0x12ce44c00) [pid = 1063] [serial = 1794] [outer = 0x12ca21000] 17:03:06 INFO - ++DOMWINDOW == 48 (0x12d59f000) [pid = 1063] [serial = 1795] [outer = 0x12ca21000] 17:03:07 INFO - ++DOCSHELL 0x1332bdf00 == 18 [pid = 1063] [id = 747] 17:03:07 INFO - ++DOMWINDOW == 49 (0x12d5a6800) [pid = 1063] [serial = 1796] [outer = 0x0] 17:03:07 INFO - ++DOMWINDOW == 50 (0x12df27c00) [pid = 1063] [serial = 1797] [outer = 0x12d5a6800] 17:03:08 INFO - --DOCSHELL 0x12c6db000 == 17 [pid = 1063] [id = 739] 17:03:08 INFO - --DOCSHELL 0x129f99400 == 16 [pid = 1063] [id = 738] 17:03:08 INFO - --DOCSHELL 0x1332bdf00 == 15 [pid = 1063] [id = 747] 17:03:08 INFO - --DOMWINDOW == 49 (0x12e3a4c00) [pid = 1063] [serial = 1767] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 48 (0x120065800) [pid = 1063] [serial = 1765] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:08 INFO - --DOMWINDOW == 47 (0x127f0bc00) [pid = 1063] [serial = 1769] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 46 (0x1209c4c00) [pid = 1063] [serial = 1782] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 45 (0x128738000) [pid = 1063] [serial = 1784] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 44 (0x128ffb000) [pid = 1063] [serial = 1785] [outer = 0x0] [url = http://example.com/] 17:03:08 INFO - --DOMWINDOW == 43 (0x12bb66800) [pid = 1063] [serial = 1791] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 42 (0x1284e0400) [pid = 1063] [serial = 1221] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:08 INFO - --DOMWINDOW == 41 (0x12ce44c00) [pid = 1063] [serial = 1794] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 40 (0x130a72800) [pid = 1063] [serial = 1224] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:08 INFO - --DOMWINDOW == 39 (0x12df19000) [pid = 1063] [serial = 1775] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:08 INFO - --DOMWINDOW == 38 (0x128696c00) [pid = 1063] [serial = 1772] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:08 INFO - --DOMWINDOW == 37 (0x126618000) [pid = 1063] [serial = 1768] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 36 (0x120065000) [pid = 1063] [serial = 1770] [outer = 0x0] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 17:03:08 INFO - --DOMWINDOW == 35 (0x12054bc00) [pid = 1063] [serial = 1781] [outer = 0x0] [url = about:blank] 17:03:08 INFO - --DOMWINDOW == 34 (0x121747c00) [pid = 1063] [serial = 1783] [outer = 0x0] [url = http://example.com/] 17:03:09 INFO - --DOMWINDOW == 33 (0x12bfa7000) [pid = 1063] [serial = 1777] [outer = 0x0] [url = https://sha1ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 17:03:09 INFO - --DOMWINDOW == 32 (0x134fa0400) [pid = 1063] [serial = 1778] [outer = 0x0] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 17:03:09 INFO - --DOMWINDOW == 31 (0x12d59fc00) [pid = 1063] [serial = 1779] [outer = 0x0] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html?] 17:03:09 INFO - --DOMWINDOW == 30 (0x129932800) [pid = 1063] [serial = 1780] [outer = 0x0] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 17:03:09 INFO - MEMORY STAT | vsize 3787MB | residentFast 401MB | heapAllocated 123MB 17:03:09 INFO - 349 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_chrome.js | took 2846ms 17:03:09 INFO - ++DOCSHELL 0x11fbe2200 == 16 [pid = 1063] [id = 748] 17:03:09 INFO - ++DOMWINDOW == 31 (0x12054bc00) [pid = 1063] [serial = 1798] [outer = 0x0] 17:03:09 INFO - ++DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1799] [outer = 0x12054bc00] 17:03:09 INFO - 350 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js 17:03:09 INFO - ++DOCSHELL 0x1285b2500 == 17 [pid = 1063] [id = 749] 17:03:09 INFO - ++DOMWINDOW == 33 (0x121763000) [pid = 1063] [serial = 1800] [outer = 0x0] 17:03:09 INFO - ++DOMWINDOW == 34 (0x126618c00) [pid = 1063] [serial = 1801] [outer = 0x121763000] 17:03:09 INFO - ++DOCSHELL 0x12bb2f300 == 18 [pid = 1063] [id = 750] 17:03:09 INFO - ++DOMWINDOW == 35 (0x126618400) [pid = 1063] [serial = 1802] [outer = 0x0] 17:03:09 INFO - ++DOMWINDOW == 36 (0x127b00800) [pid = 1063] [serial = 1803] [outer = 0x126618400] 17:03:09 INFO - ++DOMWINDOW == 37 (0x11f4c0800) [pid = 1063] [serial = 1804] [outer = 0x126618400] 17:03:09 INFO - ++DOCSHELL 0x12c6df100 == 19 [pid = 1063] [id = 751] 17:03:09 INFO - ++DOMWINDOW == 38 (0x12e824400) [pid = 1063] [serial = 1805] [outer = 0x0] 17:03:09 INFO - ++DOMWINDOW == 39 (0x12e8d8800) [pid = 1063] [serial = 1806] [outer = 0x12e824400] 17:03:10 INFO - ++DOCSHELL 0x131a44b00 == 20 [pid = 1063] [id = 752] 17:03:10 INFO - ++DOMWINDOW == 40 (0x129838400) [pid = 1063] [serial = 1807] [outer = 0x0] 17:03:10 INFO - ++DOMWINDOW == 41 (0x12a12cc00) [pid = 1063] [serial = 1808] [outer = 0x129838400] 17:03:10 INFO - ++DOMWINDOW == 42 (0x12f15d800) [pid = 1063] [serial = 1809] [outer = 0x129838400] 17:03:11 INFO - ++DOCSHELL 0x13542c800 == 21 [pid = 1063] [id = 753] 17:03:11 INFO - ++DOMWINDOW == 43 (0x137048800) [pid = 1063] [serial = 1810] [outer = 0x0] 17:03:11 INFO - ++DOMWINDOW == 44 (0x1370b7000) [pid = 1063] [serial = 1811] [outer = 0x137048800] 17:03:11 INFO - ++DOMWINDOW == 45 (0x137165800) [pid = 1063] [serial = 1812] [outer = 0x137048800] 17:03:12 INFO - ++DOCSHELL 0x12de5ee00 == 22 [pid = 1063] [id = 754] 17:03:12 INFO - ++DOMWINDOW == 46 (0x137e5dc00) [pid = 1063] [serial = 1813] [outer = 0x0] 17:03:12 INFO - ++DOMWINDOW == 47 (0x137ef0000) [pid = 1063] [serial = 1814] [outer = 0x137e5dc00] 17:03:12 INFO - ++DOMWINDOW == 48 (0x121ddb400) [pid = 1063] [serial = 1815] [outer = 0x137e5dc00] 17:03:13 INFO - ++DOCSHELL 0x12d52de00 == 23 [pid = 1063] [id = 755] 17:03:13 INFO - ++DOMWINDOW == 49 (0x134862000) [pid = 1063] [serial = 1816] [outer = 0x0] 17:03:13 INFO - ++DOMWINDOW == 50 (0x137049800) [pid = 1063] [serial = 1817] [outer = 0x134862000] 17:03:13 INFO - ++DOMWINDOW == 51 (0x1372f7000) [pid = 1063] [serial = 1818] [outer = 0x134862000] 17:03:14 INFO - ++DOCSHELL 0x134f99400 == 24 [pid = 1063] [id = 756] 17:03:14 INFO - ++DOMWINDOW == 52 (0x12e305800) [pid = 1063] [serial = 1819] [outer = 0x0] 17:03:14 INFO - ++DOMWINDOW == 53 (0x12ea3e800) [pid = 1063] [serial = 1820] [outer = 0x12e305800] 17:03:14 INFO - ++DOMWINDOW == 54 (0x130b43000) [pid = 1063] [serial = 1821] [outer = 0x12e305800] 17:03:15 INFO - ++DOCSHELL 0x136b24900 == 25 [pid = 1063] [id = 757] 17:03:15 INFO - ++DOMWINDOW == 55 (0x15bf80800) [pid = 1063] [serial = 1822] [outer = 0x0] 17:03:15 INFO - ++DOMWINDOW == 56 (0x157ff2c00) [pid = 1063] [serial = 1823] [outer = 0x15bf80800] 17:03:15 INFO - ++DOMWINDOW == 57 (0x15883b000) [pid = 1063] [serial = 1824] [outer = 0x15bf80800] 17:03:16 INFO - ++DOCSHELL 0x137081c00 == 26 [pid = 1063] [id = 758] 17:03:16 INFO - ++DOMWINDOW == 58 (0x136b76800) [pid = 1063] [serial = 1825] [outer = 0x0] 17:03:16 INFO - ++DOMWINDOW == 59 (0x1367dcc00) [pid = 1063] [serial = 1826] [outer = 0x136b76800] 17:03:16 INFO - ++DOMWINDOW == 60 (0x15897f000) [pid = 1063] [serial = 1827] [outer = 0x136b76800] 17:03:18 INFO - --DOCSHELL 0x12ca2d600 == 25 [pid = 1063] [id = 743] 17:03:18 INFO - --DOCSHELL 0x11fbe3600 == 24 [pid = 1063] [id = 737] 17:03:18 INFO - --DOCSHELL 0x12c6dc400 == 23 [pid = 1063] [id = 742] 17:03:18 INFO - --DOCSHELL 0x1266a6e00 == 22 [pid = 1063] [id = 741] 17:03:18 INFO - --DOCSHELL 0x12c6df100 == 21 [pid = 1063] [id = 751] 17:03:18 INFO - --DOCSHELL 0x12d25b000 == 20 [pid = 1063] [id = 744] 17:03:18 INFO - --DOCSHELL 0x12de61100 == 19 [pid = 1063] [id = 745] 17:03:18 INFO - --DOCSHELL 0x131a40f00 == 18 [pid = 1063] [id = 746] 17:03:18 INFO - --DOMWINDOW == 59 (0x12a01e400) [pid = 1063] [serial = 1223] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:18 INFO - --DOMWINDOW == 58 (0x130aa9400) [pid = 1063] [serial = 1225] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 57 (0x12df27000) [pid = 1063] [serial = 1776] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 56 (0x1299fe000) [pid = 1063] [serial = 1774] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:18 INFO - --DOMWINDOW == 55 (0x12b0f8800) [pid = 1063] [serial = 1790] [outer = 0x0] [url = about:config] 17:03:18 INFO - --DOMWINDOW == 54 (0x137e5dc00) [pid = 1063] [serial = 1813] [outer = 0x0] [url = https://example.com/] 17:03:18 INFO - --DOMWINDOW == 53 (0x137ef0000) [pid = 1063] [serial = 1814] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 52 (0x12d5a6800) [pid = 1063] [serial = 1796] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:18 INFO - --DOMWINDOW == 51 (0x126618800) [pid = 1063] [serial = 1786] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:18 INFO - --DOMWINDOW == 50 (0x12ca21000) [pid = 1063] [serial = 1793] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:18 INFO - --DOMWINDOW == 49 (0x137048800) [pid = 1063] [serial = 1810] [outer = 0x0] [url = https://example.com/] 17:03:18 INFO - --DOMWINDOW == 48 (0x129838400) [pid = 1063] [serial = 1807] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 47 (0x12a178000) [pid = 1063] [serial = 1788] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 46 (0x121ddb400) [pid = 1063] [serial = 1815] [outer = 0x0] [url = https://example.com/] 17:03:18 INFO - --DOMWINDOW == 45 (0x137165800) [pid = 1063] [serial = 1812] [outer = 0x0] [url = https://example.com/] 17:03:18 INFO - --DOMWINDOW == 44 (0x1370b7000) [pid = 1063] [serial = 1811] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 43 (0x12f15d800) [pid = 1063] [serial = 1809] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 42 (0x12a12cc00) [pid = 1063] [serial = 1808] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 41 (0x12ae6a000) [pid = 1063] [serial = 1789] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 40 (0x12e305800) [pid = 1063] [serial = 1819] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 39 (0x12ea3e800) [pid = 1063] [serial = 1820] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 38 (0x130b43000) [pid = 1063] [serial = 1821] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 37 (0x134862000) [pid = 1063] [serial = 1816] [outer = 0x0] [url = http://example.com/foo] 17:03:18 INFO - --DOMWINDOW == 36 (0x137049800) [pid = 1063] [serial = 1817] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 35 (0x1372f7000) [pid = 1063] [serial = 1818] [outer = 0x0] [url = http://example.com/foo] 17:03:18 INFO - --DOMWINDOW == 34 (0x15bf80800) [pid = 1063] [serial = 1822] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 33 (0x157ff2c00) [pid = 1063] [serial = 1823] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 32 (0x15883b000) [pid = 1063] [serial = 1824] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 31 (0x15897f000) [pid = 1063] [serial = 1827] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 30 (0x136b76800) [pid = 1063] [serial = 1825] [outer = 0x0] [url = http://example.com/] 17:03:18 INFO - --DOMWINDOW == 29 (0x1367dcc00) [pid = 1063] [serial = 1826] [outer = 0x0] [url = about:blank] 17:03:18 INFO - --DOMWINDOW == 28 (0x127b00800) [pid = 1063] [serial = 1803] [outer = 0x0] [url = about:blank] 17:03:18 INFO - MEMORY STAT | vsize 3800MB | residentFast 417MB | heapAllocated 126MB 17:03:18 INFO - 351 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js | took 9725ms 17:03:18 INFO - ++DOCSHELL 0x1201b0200 == 19 [pid = 1063] [id = 759] 17:03:18 INFO - ++DOMWINDOW == 29 (0x121ddb400) [pid = 1063] [serial = 1828] [outer = 0x0] 17:03:18 INFO - ++DOMWINDOW == 30 (0x127b00800) [pid = 1063] [serial = 1829] [outer = 0x121ddb400] 17:03:19 INFO - 352 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js 17:03:19 INFO - ++DOCSHELL 0x129f99400 == 20 [pid = 1063] [id = 760] 17:03:19 INFO - ++DOMWINDOW == 31 (0x120065400) [pid = 1063] [serial = 1830] [outer = 0x0] 17:03:19 INFO - ++DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1831] [outer = 0x120065400] 17:03:19 INFO - ++DOMWINDOW == 33 (0x128e94000) [pid = 1063] [serial = 1832] [outer = 0x120065400] 17:03:19 INFO - ++DOCSHELL 0x12c6ddd00 == 21 [pid = 1063] [id = 761] 17:03:19 INFO - ++DOMWINDOW == 34 (0x127f0b400) [pid = 1063] [serial = 1833] [outer = 0x0] 17:03:19 INFO - ++DOMWINDOW == 35 (0x128c2a000) [pid = 1063] [serial = 1834] [outer = 0x127f0b400] 17:03:19 INFO - ++DOMWINDOW == 36 (0x129932400) [pid = 1063] [serial = 1835] [outer = 0x127f0b400] 17:03:19 INFO - ++DOCSHELL 0x12d25ba00 == 22 [pid = 1063] [id = 762] 17:03:19 INFO - ++DOMWINDOW == 37 (0x12e2b9800) [pid = 1063] [serial = 1836] [outer = 0x0] 17:03:19 INFO - ++DOMWINDOW == 38 (0x12e2b9c00) [pid = 1063] [serial = 1837] [outer = 0x12e2b9800] 17:03:20 INFO - ++DOCSHELL 0x13542a500 == 23 [pid = 1063] [id = 763] 17:03:20 INFO - ++DOMWINDOW == 39 (0x136211800) [pid = 1063] [serial = 1838] [outer = 0x0] 17:03:20 INFO - ++DOMWINDOW == 40 (0x136211c00) [pid = 1063] [serial = 1839] [outer = 0x136211800] 17:03:20 INFO - ++DOCSHELL 0x127b2ea00 == 24 [pid = 1063] [id = 764] 17:03:20 INFO - ++DOMWINDOW == 41 (0x13666c800) [pid = 1063] [serial = 1840] [outer = 0x0] 17:03:20 INFO - ++DOMWINDOW == 42 (0x136792000) [pid = 1063] [serial = 1841] [outer = 0x13666c800] 17:03:22 INFO - ++DOCSHELL 0x137ee3800 == 25 [pid = 1063] [id = 765] 17:03:22 INFO - ++DOMWINDOW == 43 (0x1587bcc00) [pid = 1063] [serial = 1842] [outer = 0x0] 17:03:22 INFO - ++DOMWINDOW == 44 (0x15881f400) [pid = 1063] [serial = 1843] [outer = 0x1587bcc00] 17:03:22 INFO - [1063] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 17:03:22 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 17:03:23 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js, line 3548: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 17:03:27 INFO - --DOCSHELL 0x11fbe2200 == 24 [pid = 1063] [id = 748] 17:03:27 INFO - --DOCSHELL 0x12bb2f300 == 23 [pid = 1063] [id = 750] 17:03:27 INFO - --DOCSHELL 0x12c6ddd00 == 22 [pid = 1063] [id = 761] 17:03:27 INFO - --DOCSHELL 0x1285b2500 == 21 [pid = 1063] [id = 749] 17:03:27 INFO - --DOCSHELL 0x131a44b00 == 20 [pid = 1063] [id = 752] 17:03:27 INFO - --DOCSHELL 0x12d25ba00 == 19 [pid = 1063] [id = 762] 17:03:27 INFO - --DOCSHELL 0x12d52de00 == 18 [pid = 1063] [id = 755] 17:03:27 INFO - --DOCSHELL 0x134f99400 == 17 [pid = 1063] [id = 756] 17:03:27 INFO - --DOCSHELL 0x136b24900 == 16 [pid = 1063] [id = 757] 17:03:27 INFO - --DOCSHELL 0x13542a500 == 15 [pid = 1063] [id = 763] 17:03:27 INFO - --DOCSHELL 0x137081c00 == 14 [pid = 1063] [id = 758] 17:03:27 INFO - --DOCSHELL 0x12de5ee00 == 13 [pid = 1063] [id = 754] 17:03:27 INFO - --DOCSHELL 0x127b2ea00 == 12 [pid = 1063] [id = 764] 17:03:27 INFO - --DOCSHELL 0x13542c800 == 11 [pid = 1063] [id = 753] 17:03:27 INFO - --DOCSHELL 0x137ee3800 == 10 [pid = 1063] [id = 765] 17:03:27 INFO - --DOMWINDOW == 43 (0x128501c00) [pid = 1063] [serial = 1792] [outer = 0x0] [url = about:config] 17:03:27 INFO - --DOMWINDOW == 42 (0x12df27c00) [pid = 1063] [serial = 1797] [outer = 0x0] [url = about:blank] 17:03:27 INFO - --DOMWINDOW == 41 (0x12d59f000) [pid = 1063] [serial = 1795] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:27 INFO - --DOMWINDOW == 40 (0x12987f800) [pid = 1063] [serial = 1787] [outer = 0x0] [url = about:blank] 17:03:28 INFO - --DOMWINDOW == 39 (0x12e824400) [pid = 1063] [serial = 1805] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:28 INFO - --DOMWINDOW == 38 (0x126618400) [pid = 1063] [serial = 1802] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:28 INFO - --DOMWINDOW == 37 (0x12054bc00) [pid = 1063] [serial = 1798] [outer = 0x0] [url = about:blank] 17:03:28 INFO - --DOMWINDOW == 36 (0x121763000) [pid = 1063] [serial = 1800] [outer = 0x0] [url = data:text/html;charset=utf8,Bug%201005909%20-%20Clickable%20URLS] 17:03:28 INFO - --DOMWINDOW == 35 (0x13666c800) [pid = 1063] [serial = 1840] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:03:28 INFO - --DOMWINDOW == 34 (0x120996c00) [pid = 1063] [serial = 1799] [outer = 0x0] [url = about:blank] 17:03:28 INFO - --DOMWINDOW == 33 (0x126618c00) [pid = 1063] [serial = 1801] [outer = 0x0] [url = about:blank] 17:03:28 INFO - --DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1831] [outer = 0x0] [url = about:blank] 17:03:28 INFO - --DOMWINDOW == 31 (0x128c2a000) [pid = 1063] [serial = 1834] [outer = 0x0] [url = about:blank] 17:03:28 INFO - MEMORY STAT | vsize 3791MB | residentFast 421MB | heapAllocated 134MB 17:03:28 INFO - 353 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js | took 9173ms 17:03:28 INFO - ++DOCSHELL 0x11fbe1800 == 11 [pid = 1063] [id = 766] 17:03:28 INFO - ++DOMWINDOW == 32 (0x120538c00) [pid = 1063] [serial = 1844] [outer = 0x0] 17:03:28 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 1845] [outer = 0x120538c00] 17:03:28 INFO - 354 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_column_numbers.js 17:03:28 INFO - ++DOCSHELL 0x1266a6e00 == 12 [pid = 1063] [id = 767] 17:03:28 INFO - ++DOMWINDOW == 34 (0x11f9a5c00) [pid = 1063] [serial = 1846] [outer = 0x0] 17:03:28 INFO - ++DOMWINDOW == 35 (0x126618400) [pid = 1063] [serial = 1847] [outer = 0x11f9a5c00] 17:03:28 INFO - ++DOMWINDOW == 36 (0x136a37400) [pid = 1063] [serial = 1848] [outer = 0x11f9a5c00] 17:03:28 INFO - ++DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 768] 17:03:28 INFO - ++DOMWINDOW == 37 (0x1216c6c00) [pid = 1063] [serial = 1849] [outer = 0x0] 17:03:28 INFO - ++DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 1850] [outer = 0x1216c6c00] 17:03:28 INFO - ++DOMWINDOW == 39 (0x10a465800) [pid = 1063] [serial = 1851] [outer = 0x1216c6c00] 17:03:28 INFO - ++DOCSHELL 0x12ca2d600 == 14 [pid = 1063] [id = 769] 17:03:28 INFO - ++DOMWINDOW == 40 (0x12e3cdc00) [pid = 1063] [serial = 1852] [outer = 0x0] 17:03:28 INFO - ++DOMWINDOW == 41 (0x12e824400) [pid = 1063] [serial = 1853] [outer = 0x12e3cdc00] 17:03:30 INFO - --DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 760] 17:03:30 INFO - --DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 759] 17:03:30 INFO - --DOMWINDOW == 40 (0x12e8d8800) [pid = 1063] [serial = 1806] [outer = 0x0] [url = about:blank] 17:03:30 INFO - --DOMWINDOW == 39 (0x11f4c0800) [pid = 1063] [serial = 1804] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:30 INFO - --DOMWINDOW == 38 (0x136792000) [pid = 1063] [serial = 1841] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:03:31 INFO - --DOMWINDOW == 37 (0x1587bcc00) [pid = 1063] [serial = 1842] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:03:31 INFO - --DOMWINDOW == 36 (0x128501c00) [pid = 1063] [serial = 1850] [outer = 0x0] [url = about:blank] 17:03:31 INFO - --DOMWINDOW == 35 (0x120065400) [pid = 1063] [serial = 1830] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 17:03:31 INFO - --DOMWINDOW == 34 (0x127f0b400) [pid = 1063] [serial = 1833] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:31 INFO - --DOMWINDOW == 33 (0x126618400) [pid = 1063] [serial = 1847] [outer = 0x0] [url = about:blank] 17:03:31 INFO - --DOMWINDOW == 32 (0x121ddb400) [pid = 1063] [serial = 1828] [outer = 0x0] [url = about:blank] 17:03:31 INFO - --DOMWINDOW == 31 (0x136211800) [pid = 1063] [serial = 1838] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 17:03:31 INFO - --DOMWINDOW == 30 (0x12e2b9800) [pid = 1063] [serial = 1836] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:31 INFO - MEMORY STAT | vsize 3787MB | residentFast 409MB | heapAllocated 122MB 17:03:31 INFO - 355 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_column_numbers.js | took 2774ms 17:03:31 INFO - ++DOCSHELL 0x1201af300 == 13 [pid = 1063] [id = 770] 17:03:31 INFO - ++DOMWINDOW == 31 (0x12054bc00) [pid = 1063] [serial = 1854] [outer = 0x0] 17:03:31 INFO - ++DOMWINDOW == 32 (0x1209c4c00) [pid = 1063] [serial = 1855] [outer = 0x12054bc00] 17:03:31 INFO - 356 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_completion.js 17:03:31 INFO - ++DOCSHELL 0x127768800 == 14 [pid = 1063] [id = 771] 17:03:31 INFO - ++DOMWINDOW == 33 (0x121ddb400) [pid = 1063] [serial = 1856] [outer = 0x0] 17:03:31 INFO - ++DOMWINDOW == 34 (0x126671000) [pid = 1063] [serial = 1857] [outer = 0x121ddb400] 17:03:31 INFO - ++DOCSHELL 0x12bb2da00 == 15 [pid = 1063] [id = 772] 17:03:31 INFO - ++DOMWINDOW == 35 (0x126618c00) [pid = 1063] [serial = 1858] [outer = 0x0] 17:03:31 INFO - ++DOMWINDOW == 36 (0x127f4e800) [pid = 1063] [serial = 1859] [outer = 0x126618c00] 17:03:31 INFO - ++DOMWINDOW == 37 (0x128501c00) [pid = 1063] [serial = 1860] [outer = 0x126618c00] 17:03:31 INFO - ++DOCSHELL 0x12c6dce00 == 16 [pid = 1063] [id = 773] 17:03:31 INFO - ++DOMWINDOW == 38 (0x12c989000) [pid = 1063] [serial = 1861] [outer = 0x0] 17:03:31 INFO - ++DOMWINDOW == 39 (0x12c9b4000) [pid = 1063] [serial = 1862] [outer = 0x12c989000] 17:03:33 INFO - --DOCSHELL 0x12ca2d600 == 15 [pid = 1063] [id = 769] 17:03:33 INFO - --DOCSHELL 0x1266a6e00 == 14 [pid = 1063] [id = 767] 17:03:33 INFO - --DOCSHELL 0x12c6dc400 == 13 [pid = 1063] [id = 768] 17:03:33 INFO - --DOCSHELL 0x11fbe1800 == 12 [pid = 1063] [id = 766] 17:03:33 INFO - --DOCSHELL 0x12c6dce00 == 11 [pid = 1063] [id = 773] 17:03:33 INFO - --DOMWINDOW == 38 (0x15881f400) [pid = 1063] [serial = 1843] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:03:33 INFO - --DOMWINDOW == 37 (0x127b00800) [pid = 1063] [serial = 1829] [outer = 0x0] [url = about:blank] 17:03:33 INFO - --DOMWINDOW == 36 (0x128e94000) [pid = 1063] [serial = 1832] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 17:03:33 INFO - --DOMWINDOW == 35 (0x12e2b9c00) [pid = 1063] [serial = 1837] [outer = 0x0] [url = about:blank] 17:03:33 INFO - --DOMWINDOW == 34 (0x129932400) [pid = 1063] [serial = 1835] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:33 INFO - --DOMWINDOW == 33 (0x136211c00) [pid = 1063] [serial = 1839] [outer = 0x0] [url = about:blank] 17:03:33 INFO - --DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 1845] [outer = 0x0] [url = about:blank] 17:03:33 INFO - --DOMWINDOW == 31 (0x127f4e800) [pid = 1063] [serial = 1859] [outer = 0x0] [url = about:blank] 17:03:33 INFO - --DOMWINDOW == 30 (0x11f9a5c00) [pid = 1063] [serial = 1846] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 17:03:33 INFO - --DOMWINDOW == 29 (0x120538c00) [pid = 1063] [serial = 1844] [outer = 0x0] [url = about:blank] 17:03:34 INFO - --DOMWINDOW == 28 (0x136a37400) [pid = 1063] [serial = 1848] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 17:03:34 INFO - MEMORY STAT | vsize 3788MB | residentFast 409MB | heapAllocated 122MB 17:03:34 INFO - 357 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_completion.js | took 2784ms 17:03:34 INFO - ++DOCSHELL 0x1201fb300 == 12 [pid = 1063] [id = 774] 17:03:34 INFO - ++DOMWINDOW == 29 (0x121747c00) [pid = 1063] [serial = 1863] [outer = 0x0] 17:03:34 INFO - ++DOMWINDOW == 30 (0x127274800) [pid = 1063] [serial = 1864] [outer = 0x121747c00] 17:03:34 INFO - 358 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js 17:03:34 INFO - ++DOCSHELL 0x129f9b700 == 13 [pid = 1063] [id = 775] 17:03:34 INFO - ++DOMWINDOW == 31 (0x127b00800) [pid = 1063] [serial = 1865] [outer = 0x0] 17:03:34 INFO - ++DOMWINDOW == 32 (0x128696c00) [pid = 1063] [serial = 1866] [outer = 0x127b00800] 17:03:34 INFO - ++DOMWINDOW == 33 (0x12987f800) [pid = 1063] [serial = 1867] [outer = 0x127b00800] 17:03:34 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 776] 17:03:34 INFO - ++DOMWINDOW == 34 (0x1285cb800) [pid = 1063] [serial = 1868] [outer = 0x0] 17:03:34 INFO - ++DOMWINDOW == 35 (0x1299ab000) [pid = 1063] [serial = 1869] [outer = 0x1285cb800] 17:03:34 INFO - ++DOMWINDOW == 36 (0x129900c00) [pid = 1063] [serial = 1870] [outer = 0x1285cb800] 17:03:34 INFO - ++DOCSHELL 0x12d25ba00 == 15 [pid = 1063] [id = 777] 17:03:34 INFO - ++DOMWINDOW == 37 (0x1333b6c00) [pid = 1063] [serial = 1871] [outer = 0x0] 17:03:34 INFO - ++DOMWINDOW == 38 (0x1333da400) [pid = 1063] [serial = 1872] [outer = 0x1333b6c00] 17:03:36 INFO - --DOCSHELL 0x1201af300 == 14 [pid = 1063] [id = 770] 17:03:36 INFO - --DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 772] 17:03:36 INFO - --DOCSHELL 0x127768800 == 12 [pid = 1063] [id = 771] 17:03:36 INFO - --DOMWINDOW == 37 (0x1299ab000) [pid = 1063] [serial = 1869] [outer = 0x0] [url = about:blank] 17:03:36 INFO - --DOMWINDOW == 36 (0x12054bc00) [pid = 1063] [serial = 1854] [outer = 0x0] [url = about:blank] 17:03:36 INFO - --DOMWINDOW == 35 (0x126618c00) [pid = 1063] [serial = 1858] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:36 INFO - --DOMWINDOW == 34 (0x126671000) [pid = 1063] [serial = 1857] [outer = 0x0] [url = about:blank] 17:03:36 INFO - --DOMWINDOW == 33 (0x121ddb400) [pid = 1063] [serial = 1856] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20code%20completion] 17:03:36 INFO - --DOMWINDOW == 32 (0x128696c00) [pid = 1063] [serial = 1866] [outer = 0x0] [url = about:blank] 17:03:36 INFO - --DOMWINDOW == 31 (0x12c989000) [pid = 1063] [serial = 1861] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:36 INFO - --DOMWINDOW == 30 (0x12e3cdc00) [pid = 1063] [serial = 1852] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:36 INFO - --DOMWINDOW == 29 (0x1216c6c00) [pid = 1063] [serial = 1849] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:36 INFO - MEMORY STAT | vsize 3789MB | residentFast 411MB | heapAllocated 122MB 17:03:36 INFO - 359 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js | took 2493ms 17:03:36 INFO - ++DOCSHELL 0x11fbe3100 == 13 [pid = 1063] [id = 778] 17:03:36 INFO - ++DOMWINDOW == 30 (0x120541800) [pid = 1063] [serial = 1873] [outer = 0x0] 17:03:36 INFO - ++DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1874] [outer = 0x120541800] 17:03:36 INFO - 360 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js 17:03:36 INFO - ++DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 779] 17:03:36 INFO - ++DOMWINDOW == 32 (0x121ddb400) [pid = 1063] [serial = 1875] [outer = 0x0] 17:03:36 INFO - ++DOMWINDOW == 33 (0x127b8b000) [pid = 1063] [serial = 1876] [outer = 0x121ddb400] 17:03:37 INFO - ++DOCSHELL 0x11fbe2200 == 15 [pid = 1063] [id = 780] 17:03:37 INFO - ++DOMWINDOW == 34 (0x126671000) [pid = 1063] [serial = 1877] [outer = 0x0] 17:03:37 INFO - ++DOMWINDOW == 35 (0x12963d000) [pid = 1063] [serial = 1878] [outer = 0x126671000] 17:03:37 INFO - ++DOMWINDOW == 36 (0x1297a0800) [pid = 1063] [serial = 1879] [outer = 0x126671000] 17:03:37 INFO - ++DOCSHELL 0x12c6df100 == 16 [pid = 1063] [id = 781] 17:03:37 INFO - ++DOMWINDOW == 37 (0x1332aec00) [pid = 1063] [serial = 1880] [outer = 0x0] 17:03:37 INFO - ++DOMWINDOW == 38 (0x133355c00) [pid = 1063] [serial = 1881] [outer = 0x1332aec00] 17:03:39 INFO - --DOCSHELL 0x12d25ba00 == 15 [pid = 1063] [id = 777] 17:03:39 INFO - --DOCSHELL 0x129f9b700 == 14 [pid = 1063] [id = 775] 17:03:39 INFO - --DOCSHELL 0x1201fb300 == 13 [pid = 1063] [id = 774] 17:03:39 INFO - --DOCSHELL 0x12c6dd300 == 12 [pid = 1063] [id = 776] 17:03:39 INFO - --DOCSHELL 0x12c6df100 == 11 [pid = 1063] [id = 781] 17:03:39 INFO - --DOMWINDOW == 37 (0x128501c00) [pid = 1063] [serial = 1860] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:39 INFO - --DOMWINDOW == 36 (0x12c9b4000) [pid = 1063] [serial = 1862] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 35 (0x12e824400) [pid = 1063] [serial = 1853] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 34 (0x10a465800) [pid = 1063] [serial = 1851] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:39 INFO - --DOMWINDOW == 33 (0x1209c4c00) [pid = 1063] [serial = 1855] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 1864] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 31 (0x12963d000) [pid = 1063] [serial = 1878] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 30 (0x1333b6c00) [pid = 1063] [serial = 1871] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:39 INFO - --DOMWINDOW == 29 (0x1285cb800) [pid = 1063] [serial = 1868] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:39 INFO - --DOMWINDOW == 28 (0x127b00800) [pid = 1063] [serial = 1865] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 17:03:39 INFO - --DOMWINDOW == 27 (0x121747c00) [pid = 1063] [serial = 1863] [outer = 0x0] [url = about:blank] 17:03:39 INFO - --DOMWINDOW == 26 (0x12987f800) [pid = 1063] [serial = 1867] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 17:03:39 INFO - MEMORY STAT | vsize 3785MB | residentFast 407MB | heapAllocated 121MB 17:03:39 INFO - 361 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js | took 2454ms 17:03:39 INFO - ++DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 782] 17:03:39 INFO - ++DOMWINDOW == 27 (0x120538c00) [pid = 1063] [serial = 1882] [outer = 0x0] 17:03:39 INFO - ++DOMWINDOW == 28 (0x1209c4c00) [pid = 1063] [serial = 1883] [outer = 0x120538c00] 17:03:39 INFO - 362 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_extras.js 17:03:39 INFO - ++DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 783] 17:03:39 INFO - ++DOMWINDOW == 29 (0x11f4c0000) [pid = 1063] [serial = 1884] [outer = 0x0] 17:03:39 INFO - ++DOMWINDOW == 30 (0x126618c00) [pid = 1063] [serial = 1885] [outer = 0x11f4c0000] 17:03:39 INFO - ++DOMWINDOW == 31 (0x127f0bc00) [pid = 1063] [serial = 1886] [outer = 0x11f4c0000] 17:03:39 INFO - ++DOCSHELL 0x1201fcc00 == 14 [pid = 1063] [id = 784] 17:03:39 INFO - ++DOMWINDOW == 32 (0x126618400) [pid = 1063] [serial = 1887] [outer = 0x0] 17:03:39 INFO - ++DOMWINDOW == 33 (0x128696c00) [pid = 1063] [serial = 1888] [outer = 0x126618400] 17:03:39 INFO - ++DOMWINDOW == 34 (0x128c2a000) [pid = 1063] [serial = 1889] [outer = 0x126618400] 17:03:40 INFO - ++DOCSHELL 0x12cb85000 == 15 [pid = 1063] [id = 785] 17:03:40 INFO - ++DOMWINDOW == 35 (0x12eb83400) [pid = 1063] [serial = 1890] [outer = 0x0] 17:03:40 INFO - ++DOMWINDOW == 36 (0x12f10a800) [pid = 1063] [serial = 1891] [outer = 0x12eb83400] 17:03:41 INFO - --DOCSHELL 0x129ea8100 == 14 [pid = 1063] [id = 779] 17:03:41 INFO - --DOCSHELL 0x11fbe2200 == 13 [pid = 1063] [id = 780] 17:03:41 INFO - --DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 778] 17:03:41 INFO - --DOCSHELL 0x12cb85000 == 11 [pid = 1063] [id = 785] 17:03:41 INFO - --DOMWINDOW == 35 (0x1333da400) [pid = 1063] [serial = 1872] [outer = 0x0] [url = about:blank] 17:03:41 INFO - --DOMWINDOW == 34 (0x129900c00) [pid = 1063] [serial = 1870] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:41 INFO - --DOMWINDOW == 33 (0x126618c00) [pid = 1063] [serial = 1885] [outer = 0x0] [url = about:blank] 17:03:41 INFO - --DOMWINDOW == 32 (0x127b8b000) [pid = 1063] [serial = 1876] [outer = 0x0] [url = about:blank] 17:03:41 INFO - --DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 1874] [outer = 0x0] [url = about:blank] 17:03:41 INFO - --DOMWINDOW == 30 (0x128696c00) [pid = 1063] [serial = 1888] [outer = 0x0] [url = about:blank] 17:03:41 INFO - --DOMWINDOW == 29 (0x126671000) [pid = 1063] [serial = 1877] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:41 INFO - --DOMWINDOW == 28 (0x1332aec00) [pid = 1063] [serial = 1880] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:41 INFO - --DOMWINDOW == 27 (0x121ddb400) [pid = 1063] [serial = 1875] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20for%20console.log('%ccustom%20styles',%20'color:red')] 17:03:41 INFO - --DOMWINDOW == 26 (0x120541800) [pid = 1063] [serial = 1873] [outer = 0x0] [url = about:blank] 17:03:41 INFO - MEMORY STAT | vsize 3788MB | residentFast 410MB | heapAllocated 120MB 17:03:41 INFO - 363 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_extras.js | took 2418ms 17:03:41 INFO - ++DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 786] 17:03:41 INFO - ++DOMWINDOW == 27 (0x121747c00) [pid = 1063] [serial = 1892] [outer = 0x0] 17:03:41 INFO - ++DOMWINDOW == 28 (0x126618c00) [pid = 1063] [serial = 1893] [outer = 0x121747c00] 17:03:42 INFO - 364 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js 17:03:42 INFO - ++DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 787] 17:03:42 INFO - ++DOMWINDOW == 29 (0x126671000) [pid = 1063] [serial = 1894] [outer = 0x0] 17:03:42 INFO - ++DOMWINDOW == 30 (0x128696c00) [pid = 1063] [serial = 1895] [outer = 0x126671000] 17:03:42 INFO - ++DOMWINDOW == 31 (0x13348f400) [pid = 1063] [serial = 1896] [outer = 0x126671000] 17:03:42 INFO - ++DOCSHELL 0x12c6dce00 == 14 [pid = 1063] [id = 788] 17:03:42 INFO - ++DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1897] [outer = 0x0] 17:03:42 INFO - ++DOMWINDOW == 33 (0x1296a6000) [pid = 1063] [serial = 1898] [outer = 0x127f4e800] 17:03:42 INFO - ++DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 1899] [outer = 0x127f4e800] 17:03:42 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 789] 17:03:42 INFO - ++DOMWINDOW == 35 (0x1333a2800) [pid = 1063] [serial = 1900] [outer = 0x0] 17:03:42 INFO - ++DOMWINDOW == 36 (0x1333b6000) [pid = 1063] [serial = 1901] [outer = 0x1333a2800] 17:03:45 INFO - --DOCSHELL 0x1201b0200 == 14 [pid = 1063] [id = 782] 17:03:45 INFO - --DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 783] 17:03:45 INFO - --DOCSHELL 0x1201fcc00 == 12 [pid = 1063] [id = 784] 17:03:45 INFO - --DOCSHELL 0x12ca29000 == 11 [pid = 1063] [id = 789] 17:03:45 INFO - --DOMWINDOW == 35 (0x133355c00) [pid = 1063] [serial = 1881] [outer = 0x0] [url = about:blank] 17:03:45 INFO - --DOMWINDOW == 34 (0x1297a0800) [pid = 1063] [serial = 1879] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:45 INFO - --DOMWINDOW == 33 (0x1209c4c00) [pid = 1063] [serial = 1883] [outer = 0x0] [url = about:blank] 17:03:45 INFO - --DOMWINDOW == 32 (0x128696c00) [pid = 1063] [serial = 1895] [outer = 0x0] [url = about:blank] 17:03:45 INFO - --DOMWINDOW == 31 (0x1296a6000) [pid = 1063] [serial = 1898] [outer = 0x0] [url = about:blank] 17:03:45 INFO - --DOMWINDOW == 30 (0x126618400) [pid = 1063] [serial = 1887] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:45 INFO - --DOMWINDOW == 29 (0x12eb83400) [pid = 1063] [serial = 1890] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:45 INFO - --DOMWINDOW == 28 (0x120538c00) [pid = 1063] [serial = 1882] [outer = 0x0] [url = about:blank] 17:03:45 INFO - --DOMWINDOW == 27 (0x11f4c0000) [pid = 1063] [serial = 1884] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 17:03:45 INFO - MEMORY STAT | vsize 3788MB | residentFast 411MB | heapAllocated 121MB 17:03:45 INFO - 365 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js | took 3411ms 17:03:45 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 790] 17:03:45 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 1902] [outer = 0x0] 17:03:45 INFO - ++DOMWINDOW == 29 (0x1216bac00) [pid = 1063] [serial = 1903] [outer = 0x120917c00] 17:03:45 INFO - 366 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js 17:03:45 INFO - ++DOCSHELL 0x129ea7700 == 13 [pid = 1063] [id = 791] 17:03:45 INFO - ++DOMWINDOW == 30 (0x1216c6c00) [pid = 1063] [serial = 1904] [outer = 0x0] 17:03:45 INFO - ++DOMWINDOW == 31 (0x1284e0400) [pid = 1063] [serial = 1905] [outer = 0x1216c6c00] 17:03:45 INFO - ++DOMWINDOW == 32 (0x1296a6000) [pid = 1063] [serial = 1906] [outer = 0x1216c6c00] 17:03:45 INFO - ++DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 792] 17:03:45 INFO - ++DOMWINDOW == 33 (0x127bea800) [pid = 1063] [serial = 1907] [outer = 0x0] 17:03:45 INFO - ++DOMWINDOW == 34 (0x12ae6a000) [pid = 1063] [serial = 1908] [outer = 0x127bea800] 17:03:46 INFO - ++DOMWINDOW == 35 (0x12b0f8800) [pid = 1063] [serial = 1909] [outer = 0x127bea800] 17:03:46 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 793] 17:03:46 INFO - ++DOMWINDOW == 36 (0x13351f800) [pid = 1063] [serial = 1910] [outer = 0x0] 17:03:46 INFO - ++DOMWINDOW == 37 (0x133553400) [pid = 1063] [serial = 1911] [outer = 0x13351f800] 17:03:47 INFO - --DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 786] 17:03:47 INFO - --DOCSHELL 0x12c6ddd00 == 13 [pid = 1063] [id = 792] 17:03:47 INFO - --DOCSHELL 0x12c6dce00 == 12 [pid = 1063] [id = 788] 17:03:47 INFO - --DOCSHELL 0x12cb89600 == 11 [pid = 1063] [id = 793] 17:03:47 INFO - --DOCSHELL 0x1285b2500 == 10 [pid = 1063] [id = 787] 17:03:47 INFO - --DOMWINDOW == 36 (0x128c2a000) [pid = 1063] [serial = 1889] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:47 INFO - --DOMWINDOW == 35 (0x12f10a800) [pid = 1063] [serial = 1891] [outer = 0x0] [url = about:blank] 17:03:47 INFO - --DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 1886] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 17:03:47 INFO - --DOMWINDOW == 33 (0x1333a2800) [pid = 1063] [serial = 1900] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:47 INFO - --DOMWINDOW == 32 (0x126671000) [pid = 1063] [serial = 1894] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:03:47 INFO - --DOMWINDOW == 31 (0x1284e0400) [pid = 1063] [serial = 1905] [outer = 0x0] [url = about:blank] 17:03:47 INFO - --DOMWINDOW == 30 (0x12ae6a000) [pid = 1063] [serial = 1908] [outer = 0x0] [url = about:blank] 17:03:47 INFO - --DOMWINDOW == 29 (0x121747c00) [pid = 1063] [serial = 1892] [outer = 0x0] [url = about:blank] 17:03:47 INFO - --DOMWINDOW == 28 (0x126618c00) [pid = 1063] [serial = 1893] [outer = 0x0] [url = about:blank] 17:03:47 INFO - --DOMWINDOW == 27 (0x127f4e800) [pid = 1063] [serial = 1897] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:48 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:03:48 INFO - --DOMWINDOW == 26 (0x13348f400) [pid = 1063] [serial = 1896] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:03:48 INFO - MEMORY STAT | vsize 3786MB | residentFast 406MB | heapAllocated 121MB 17:03:48 INFO - 367 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js | took 2530ms 17:03:48 INFO - ++DOCSHELL 0x120929200 == 11 [pid = 1063] [id = 794] 17:03:48 INFO - ++DOMWINDOW == 27 (0x12082f800) [pid = 1063] [serial = 1912] [outer = 0x0] 17:03:48 INFO - ++DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 1913] [outer = 0x12082f800] 17:03:48 INFO - 368 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js 17:03:48 INFO - ++DOCSHELL 0x12bb2f300 == 12 [pid = 1063] [id = 795] 17:03:48 INFO - ++DOMWINDOW == 29 (0x121ddb400) [pid = 1063] [serial = 1914] [outer = 0x0] 17:03:48 INFO - ++DOMWINDOW == 30 (0x127f0bc00) [pid = 1063] [serial = 1915] [outer = 0x121ddb400] 17:03:48 INFO - ++DOCSHELL 0x11fbe2700 == 13 [pid = 1063] [id = 796] 17:03:48 INFO - ++DOMWINDOW == 31 (0x127f0b400) [pid = 1063] [serial = 1916] [outer = 0x0] 17:03:48 INFO - ++DOMWINDOW == 32 (0x128c2a000) [pid = 1063] [serial = 1917] [outer = 0x127f0b400] 17:03:48 INFO - ++DOMWINDOW == 33 (0x128ffb000) [pid = 1063] [serial = 1918] [outer = 0x127f0b400] 17:03:48 INFO - ++DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 797] 17:03:48 INFO - ++DOMWINDOW == 34 (0x12d59f000) [pid = 1063] [serial = 1919] [outer = 0x0] 17:03:48 INFO - ++DOMWINDOW == 35 (0x12d59f400) [pid = 1063] [serial = 1920] [outer = 0x12d59f000] 17:03:49 INFO - ++DOMWINDOW == 36 (0x13082a000) [pid = 1063] [serial = 1921] [outer = 0x121ddb400] 17:03:49 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:50 INFO - MEMORY STAT | vsize 3790MB | residentFast 410MB | heapAllocated 128MB 17:03:50 INFO - 369 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js | took 1918ms 17:03:50 INFO - ++DOCSHELL 0x131b2a200 == 15 [pid = 1063] [id = 798] 17:03:50 INFO - ++DOMWINDOW == 37 (0x12b0f8c00) [pid = 1063] [serial = 1922] [outer = 0x0] 17:03:50 INFO - ++DOMWINDOW == 38 (0x12be25000) [pid = 1063] [serial = 1923] [outer = 0x12b0f8c00] 17:03:50 INFO - 370 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js 17:03:50 INFO - ++DOCSHELL 0x12de5df00 == 16 [pid = 1063] [id = 799] 17:03:50 INFO - ++DOMWINDOW == 39 (0x12c345400) [pid = 1063] [serial = 1924] [outer = 0x0] 17:03:50 INFO - ++DOMWINDOW == 40 (0x12c41a800) [pid = 1063] [serial = 1925] [outer = 0x12c345400] 17:03:50 INFO - ++DOCSHELL 0x13542dc00 == 17 [pid = 1063] [id = 800] 17:03:50 INFO - ++DOMWINDOW == 41 (0x12666b000) [pid = 1063] [serial = 1926] [outer = 0x0] 17:03:50 INFO - ++DOMWINDOW == 42 (0x12c3ea400) [pid = 1063] [serial = 1927] [outer = 0x12666b000] 17:03:50 INFO - ++DOMWINDOW == 43 (0x12f10ac00) [pid = 1063] [serial = 1928] [outer = 0x12666b000] 17:03:50 INFO - ++DOCSHELL 0x1355f5b00 == 18 [pid = 1063] [id = 801] 17:03:50 INFO - ++DOMWINDOW == 44 (0x130b42800) [pid = 1063] [serial = 1929] [outer = 0x0] 17:03:50 INFO - ++DOMWINDOW == 45 (0x130b52400) [pid = 1063] [serial = 1930] [outer = 0x130b42800] 17:03:51 INFO - ++DOMWINDOW == 46 (0x157fdd400) [pid = 1063] [serial = 1931] [outer = 0x12c345400] 17:03:51 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:03:52 INFO - --DOCSHELL 0x11fbe3600 == 17 [pid = 1063] [id = 790] 17:03:52 INFO - --DOCSHELL 0x120929200 == 16 [pid = 1063] [id = 794] 17:03:52 INFO - --DOCSHELL 0x129ea7700 == 15 [pid = 1063] [id = 791] 17:03:52 INFO - --DOCSHELL 0x12bb2f300 == 14 [pid = 1063] [id = 795] 17:03:52 INFO - --DOCSHELL 0x11fbe2700 == 13 [pid = 1063] [id = 796] 17:03:52 INFO - --DOCSHELL 0x12c6ddd00 == 12 [pid = 1063] [id = 797] 17:03:52 INFO - --DOCSHELL 0x13542dc00 == 11 [pid = 1063] [id = 800] 17:03:52 INFO - --DOCSHELL 0x1355f5b00 == 10 [pid = 1063] [id = 801] 17:03:52 INFO - --DOMWINDOW == 45 (0x1333b6000) [pid = 1063] [serial = 1901] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 44 (0x128e94000) [pid = 1063] [serial = 1899] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:52 INFO - --DOMWINDOW == 43 (0x121ddb400) [pid = 1063] [serial = 1914] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 17:03:52 INFO - --DOMWINDOW == 42 (0x12d59f000) [pid = 1063] [serial = 1919] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:52 INFO - --DOMWINDOW == 41 (0x127f0b400) [pid = 1063] [serial = 1916] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:52 INFO - --DOMWINDOW == 40 (0x13351f800) [pid = 1063] [serial = 1910] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:03:52 INFO - --DOMWINDOW == 39 (0x127bea800) [pid = 1063] [serial = 1907] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:03:52 INFO - --DOMWINDOW == 38 (0x120917c00) [pid = 1063] [serial = 1902] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 37 (0x1216c6c00) [pid = 1063] [serial = 1904] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 17:03:52 INFO - --DOMWINDOW == 36 (0x12082f800) [pid = 1063] [serial = 1912] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 35 (0x128c2a000) [pid = 1063] [serial = 1917] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 34 (0x1216bac00) [pid = 1063] [serial = 1903] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 33 (0x121747c00) [pid = 1063] [serial = 1913] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 32 (0x127f0bc00) [pid = 1063] [serial = 1915] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 31 (0x12c3ea400) [pid = 1063] [serial = 1927] [outer = 0x0] [url = about:blank] 17:03:52 INFO - --DOMWINDOW == 30 (0x1296a6000) [pid = 1063] [serial = 1906] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 17:03:53 INFO - MEMORY STAT | vsize 3782MB | residentFast 406MB | heapAllocated 126MB 17:03:53 INFO - 371 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js | took 2797ms 17:03:53 INFO - ++DOCSHELL 0x12bb2f300 == 11 [pid = 1063] [id = 802] 17:03:53 INFO - ++DOMWINDOW == 31 (0x1216bac00) [pid = 1063] [serial = 1932] [outer = 0x0] 17:03:53 INFO - ++DOMWINDOW == 32 (0x121763000) [pid = 1063] [serial = 1933] [outer = 0x1216bac00] 17:03:53 INFO - 372 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js 17:03:53 INFO - ++DOCSHELL 0x12c6ddd00 == 12 [pid = 1063] [id = 803] 17:03:53 INFO - ++DOMWINDOW == 33 (0x1284e0400) [pid = 1063] [serial = 1934] [outer = 0x0] 17:03:53 INFO - ++DOMWINDOW == 34 (0x128c2ac00) [pid = 1063] [serial = 1935] [outer = 0x1284e0400] 17:03:53 INFO - ++DOCSHELL 0x127768800 == 13 [pid = 1063] [id = 804] 17:03:53 INFO - ++DOMWINDOW == 35 (0x128c2a000) [pid = 1063] [serial = 1936] [outer = 0x0] 17:03:53 INFO - ++DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 1937] [outer = 0x128c2a000] 17:03:53 INFO - ++DOMWINDOW == 37 (0x129932800) [pid = 1063] [serial = 1938] [outer = 0x128c2a000] 17:03:53 INFO - ++DOCSHELL 0x12d4c0200 == 14 [pid = 1063] [id = 805] 17:03:53 INFO - ++DOMWINDOW == 38 (0x12e1ecc00) [pid = 1063] [serial = 1939] [outer = 0x0] 17:03:53 INFO - ++DOMWINDOW == 39 (0x12e21f800) [pid = 1063] [serial = 1940] [outer = 0x12e1ecc00] 17:03:55 INFO - MEMORY STAT | vsize 3792MB | residentFast 403MB | heapAllocated 132MB 17:03:55 INFO - 373 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js | took 1789ms 17:03:55 INFO - ++DOCSHELL 0x1332bf300 == 15 [pid = 1063] [id = 806] 17:03:55 INFO - ++DOMWINDOW == 40 (0x12c26c400) [pid = 1063] [serial = 1941] [outer = 0x0] 17:03:55 INFO - ++DOMWINDOW == 41 (0x12c3ea400) [pid = 1063] [serial = 1942] [outer = 0x12c26c400] 17:03:55 INFO - 374 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js 17:03:55 INFO - ++DOCSHELL 0x12de61100 == 16 [pid = 1063] [id = 807] 17:03:55 INFO - ++DOMWINDOW == 42 (0x12c52bc00) [pid = 1063] [serial = 1943] [outer = 0x0] 17:03:55 INFO - ++DOMWINDOW == 43 (0x12c777400) [pid = 1063] [serial = 1944] [outer = 0x12c52bc00] 17:03:55 INFO - ++DOCSHELL 0x13542c800 == 17 [pid = 1063] [id = 808] 17:03:55 INFO - ++DOMWINDOW == 44 (0x12c76f800) [pid = 1063] [serial = 1945] [outer = 0x0] 17:03:55 INFO - ++DOMWINDOW == 45 (0x12c9b4000) [pid = 1063] [serial = 1946] [outer = 0x12c76f800] 17:03:55 INFO - ++DOMWINDOW == 46 (0x12c9f5800) [pid = 1063] [serial = 1947] [outer = 0x12c76f800] 17:03:55 INFO - ++DOCSHELL 0x13542d700 == 18 [pid = 1063] [id = 809] 17:03:55 INFO - ++DOMWINDOW == 47 (0x12d59fc00) [pid = 1063] [serial = 1948] [outer = 0x0] 17:03:55 INFO - ++DOMWINDOW == 48 (0x12d5a6800) [pid = 1063] [serial = 1949] [outer = 0x12d59fc00] 17:03:57 INFO - MEMORY STAT | vsize 3793MB | residentFast 412MB | heapAllocated 133MB 17:03:57 INFO - 375 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js | took 1975ms 17:03:57 INFO - ++DOCSHELL 0x1285b2500 == 19 [pid = 1063] [id = 810] 17:03:57 INFO - ++DOMWINDOW == 49 (0x12c6b9800) [pid = 1063] [serial = 1950] [outer = 0x0] 17:03:57 INFO - ++DOMWINDOW == 50 (0x12d5a6000) [pid = 1063] [serial = 1951] [outer = 0x12c6b9800] 17:03:57 INFO - 376 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_count.js 17:03:57 INFO - ++DOCSHELL 0x12c6dd300 == 20 [pid = 1063] [id = 811] 17:03:57 INFO - ++DOMWINDOW == 51 (0x12df27c00) [pid = 1063] [serial = 1952] [outer = 0x0] 17:03:57 INFO - ++DOMWINDOW == 52 (0x12e376000) [pid = 1063] [serial = 1953] [outer = 0x12df27c00] 17:03:57 INFO - ++DOMWINDOW == 53 (0x1333a2800) [pid = 1063] [serial = 1954] [outer = 0x12df27c00] 17:03:57 INFO - ++DOCSHELL 0x12de5d500 == 21 [pid = 1063] [id = 812] 17:03:57 INFO - ++DOMWINDOW == 54 (0x1333b6000) [pid = 1063] [serial = 1955] [outer = 0x0] 17:03:57 INFO - ++DOMWINDOW == 55 (0x1334d2c00) [pid = 1063] [serial = 1956] [outer = 0x1333b6000] 17:03:57 INFO - ++DOMWINDOW == 56 (0x133e5c000) [pid = 1063] [serial = 1957] [outer = 0x1333b6000] 17:03:58 INFO - ++DOCSHELL 0x12e035a00 == 22 [pid = 1063] [id = 813] 17:03:58 INFO - ++DOMWINDOW == 57 (0x157fdd800) [pid = 1063] [serial = 1958] [outer = 0x0] 17:03:58 INFO - ++DOMWINDOW == 58 (0x15bf80000) [pid = 1063] [serial = 1959] [outer = 0x157fdd800] 17:04:00 INFO - --DOCSHELL 0x12bb2f300 == 21 [pid = 1063] [id = 802] 17:04:00 INFO - --DOCSHELL 0x12c6ddd00 == 20 [pid = 1063] [id = 803] 17:04:00 INFO - --DOCSHELL 0x127768800 == 19 [pid = 1063] [id = 804] 17:04:00 INFO - --DOCSHELL 0x12d4c0200 == 18 [pid = 1063] [id = 805] 17:04:00 INFO - --DOCSHELL 0x131b2a200 == 17 [pid = 1063] [id = 798] 17:04:00 INFO - --DOCSHELL 0x1332bf300 == 16 [pid = 1063] [id = 806] 17:04:00 INFO - --DOCSHELL 0x12de61100 == 15 [pid = 1063] [id = 807] 17:04:00 INFO - --DOCSHELL 0x13542c800 == 14 [pid = 1063] [id = 808] 17:04:00 INFO - --DOCSHELL 0x13542d700 == 13 [pid = 1063] [id = 809] 17:04:00 INFO - --DOCSHELL 0x12de5df00 == 12 [pid = 1063] [id = 799] 17:04:00 INFO - --DOCSHELL 0x12e035a00 == 11 [pid = 1063] [id = 813] 17:04:00 INFO - --DOMWINDOW == 57 (0x13082a000) [pid = 1063] [serial = 1921] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 17:04:00 INFO - --DOMWINDOW == 56 (0x12d59f400) [pid = 1063] [serial = 1920] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 55 (0x128ffb000) [pid = 1063] [serial = 1918] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:00 INFO - --DOMWINDOW == 54 (0x133553400) [pid = 1063] [serial = 1911] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 53 (0x12b0f8800) [pid = 1063] [serial = 1909] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:00 INFO - --DOMWINDOW == 52 (0x12e1ecc00) [pid = 1063] [serial = 1939] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:00 INFO - --DOMWINDOW == 51 (0x12c26c400) [pid = 1063] [serial = 1941] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 50 (0x12c52bc00) [pid = 1063] [serial = 1943] [outer = 0x0] [url = data:text/html,<script>%20%20window.bar%20=%20{%20baz:%201%20};%20%20console.log("foo");%20%20console.log("foo",%20window.bar);</script>] 17:04:00 INFO - --DOMWINDOW == 49 (0x12c3ea400) [pid = 1063] [serial = 1942] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 48 (0x12c777400) [pid = 1063] [serial = 1944] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 47 (0x12666b000) [pid = 1063] [serial = 1926] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:00 INFO - --DOMWINDOW == 46 (0x130b42800) [pid = 1063] [serial = 1929] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:00 INFO - --DOMWINDOW == 45 (0x128c2a000) [pid = 1063] [serial = 1936] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:00 INFO - --DOMWINDOW == 44 (0x12b0f8c00) [pid = 1063] [serial = 1922] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 43 (0x12c345400) [pid = 1063] [serial = 1924] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 17:04:00 INFO - --DOMWINDOW == 42 (0x1216bac00) [pid = 1063] [serial = 1932] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 41 (0x1284e0400) [pid = 1063] [serial = 1934] [outer = 0x0] [url = data:text/html,<script>%20%20console.log("foo");%20%20console.log("foo",%20window);</script>] 17:04:00 INFO - --DOMWINDOW == 40 (0x12e376000) [pid = 1063] [serial = 1953] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 39 (0x1334d2c00) [pid = 1063] [serial = 1956] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 38 (0x129932000) [pid = 1063] [serial = 1937] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 37 (0x12be25000) [pid = 1063] [serial = 1923] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 36 (0x12c41a800) [pid = 1063] [serial = 1925] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 35 (0x121763000) [pid = 1063] [serial = 1933] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 34 (0x128c2ac00) [pid = 1063] [serial = 1935] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 33 (0x12c9b4000) [pid = 1063] [serial = 1946] [outer = 0x0] [url = about:blank] 17:04:00 INFO - --DOMWINDOW == 32 (0x157fdd400) [pid = 1063] [serial = 1931] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 17:04:00 INFO - MEMORY STAT | vsize 3789MB | residentFast 412MB | heapAllocated 128MB 17:04:00 INFO - 377 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_count.js | took 3276ms 17:04:00 INFO - ++DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 814] 17:04:00 INFO - ++DOMWINDOW == 33 (0x120996c00) [pid = 1063] [serial = 1960] [outer = 0x0] 17:04:00 INFO - ++DOMWINDOW == 34 (0x1216bac00) [pid = 1063] [serial = 1961] [outer = 0x120996c00] 17:04:00 INFO - 378 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js 17:04:00 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 815] 17:04:00 INFO - ++DOMWINDOW == 35 (0x121747c00) [pid = 1063] [serial = 1962] [outer = 0x0] 17:04:00 INFO - ++DOMWINDOW == 36 (0x12666b000) [pid = 1063] [serial = 1963] [outer = 0x121747c00] 17:04:00 INFO - ++DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 816] 17:04:00 INFO - ++DOMWINDOW == 37 (0x126618c00) [pid = 1063] [serial = 1964] [outer = 0x0] 17:04:00 INFO - ++DOMWINDOW == 38 (0x128501c00) [pid = 1063] [serial = 1965] [outer = 0x126618c00] 17:04:01 INFO - ++DOMWINDOW == 39 (0x1285cb800) [pid = 1063] [serial = 1966] [outer = 0x126618c00] 17:04:01 INFO - ++DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 817] 17:04:01 INFO - ++DOMWINDOW == 40 (0x12df59800) [pid = 1063] [serial = 1967] [outer = 0x0] 17:04:01 INFO - ++DOMWINDOW == 41 (0x12e1ecc00) [pid = 1063] [serial = 1968] [outer = 0x12df59800] 17:04:01 INFO - ++DOMWINDOW == 42 (0x134862000) [pid = 1063] [serial = 1969] [outer = 0x121747c00] 17:04:01 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:02 INFO - --DOCSHELL 0x12c825600 == 14 [pid = 1063] [id = 817] 17:04:02 INFO - --DOCSHELL 0x1285b2500 == 13 [pid = 1063] [id = 810] 17:04:02 INFO - --DOCSHELL 0x12c6dd300 == 12 [pid = 1063] [id = 811] 17:04:02 INFO - --DOCSHELL 0x12de5d500 == 11 [pid = 1063] [id = 812] 17:04:02 INFO - --DOMWINDOW == 41 (0x12f10ac00) [pid = 1063] [serial = 1928] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:02 INFO - --DOMWINDOW == 40 (0x12e21f800) [pid = 1063] [serial = 1940] [outer = 0x0] [url = about:blank] 17:04:02 INFO - --DOMWINDOW == 39 (0x130b52400) [pid = 1063] [serial = 1930] [outer = 0x0] [url = about:blank] 17:04:02 INFO - --DOMWINDOW == 38 (0x129932800) [pid = 1063] [serial = 1938] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:03 INFO - --DOMWINDOW == 37 (0x12c6b9800) [pid = 1063] [serial = 1950] [outer = 0x0] [url = about:blank] 17:04:03 INFO - --DOMWINDOW == 36 (0x128501c00) [pid = 1063] [serial = 1965] [outer = 0x0] [url = about:blank] 17:04:03 INFO - --DOMWINDOW == 35 (0x12d5a6000) [pid = 1063] [serial = 1951] [outer = 0x0] [url = about:blank] 17:04:03 INFO - --DOMWINDOW == 34 (0x12d59fc00) [pid = 1063] [serial = 1948] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:03 INFO - --DOMWINDOW == 33 (0x1333b6000) [pid = 1063] [serial = 1955] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:03 INFO - --DOMWINDOW == 32 (0x157fdd800) [pid = 1063] [serial = 1958] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:03 INFO - --DOMWINDOW == 31 (0x12c76f800) [pid = 1063] [serial = 1945] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:03 INFO - --DOMWINDOW == 30 (0x12df27c00) [pid = 1063] [serial = 1952] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 17:04:03 INFO - MEMORY STAT | vsize 3794MB | residentFast 417MB | heapAllocated 130MB 17:04:03 INFO - 379 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js | took 2628ms 17:04:03 INFO - ++DOCSHELL 0x1285b2500 == 12 [pid = 1063] [id = 818] 17:04:03 INFO - ++DOMWINDOW == 31 (0x127b00800) [pid = 1063] [serial = 1970] [outer = 0x0] 17:04:03 INFO - ++DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1971] [outer = 0x127b00800] 17:04:03 INFO - 380 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js 17:04:03 INFO - ++DOCSHELL 0x12c6dd800 == 13 [pid = 1063] [id = 819] 17:04:03 INFO - ++DOMWINDOW == 33 (0x12054bc00) [pid = 1063] [serial = 1972] [outer = 0x0] 17:04:03 INFO - ++DOMWINDOW == 34 (0x1296a6000) [pid = 1063] [serial = 1973] [outer = 0x12054bc00] 17:04:03 INFO - ++DOMWINDOW == 35 (0x129932000) [pid = 1063] [serial = 1974] [outer = 0x12054bc00] 17:04:03 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html, line 21: ReferenceError: nonExistingMethodCall is not defined 17:04:03 INFO - ++DOCSHELL 0x12d25b000 == 14 [pid = 1063] [id = 820] 17:04:03 INFO - ++DOMWINDOW == 36 (0x12963d000) [pid = 1063] [serial = 1975] [outer = 0x0] 17:04:03 INFO - ++DOMWINDOW == 37 (0x129e8dc00) [pid = 1063] [serial = 1976] [outer = 0x12963d000] 17:04:03 INFO - ++DOMWINDOW == 38 (0x1299ab800) [pid = 1063] [serial = 1977] [outer = 0x12963d000] 17:04:04 INFO - ++DOCSHELL 0x12e035a00 == 15 [pid = 1063] [id = 821] 17:04:04 INFO - ++DOMWINDOW == 39 (0x12f18f000) [pid = 1063] [serial = 1978] [outer = 0x0] 17:04:04 INFO - ++DOMWINDOW == 40 (0x12f18f400) [pid = 1063] [serial = 1979] [outer = 0x12f18f000] 17:04:05 INFO - --DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 814] 17:04:05 INFO - --DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 815] 17:04:05 INFO - --DOCSHELL 0x12e035a00 == 12 [pid = 1063] [id = 821] 17:04:05 INFO - --DOCSHELL 0x12bb2f800 == 11 [pid = 1063] [id = 816] 17:04:05 INFO - --DOMWINDOW == 39 (0x12d5a6800) [pid = 1063] [serial = 1949] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 38 (0x133e5c000) [pid = 1063] [serial = 1957] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:05 INFO - --DOMWINDOW == 37 (0x15bf80000) [pid = 1063] [serial = 1959] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 36 (0x12c9f5800) [pid = 1063] [serial = 1947] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:05 INFO - --DOMWINDOW == 35 (0x1333a2800) [pid = 1063] [serial = 1954] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 17:04:05 INFO - --DOMWINDOW == 34 (0x1296a6000) [pid = 1063] [serial = 1973] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 33 (0x12666b000) [pid = 1063] [serial = 1963] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 1961] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 31 (0x129e8dc00) [pid = 1063] [serial = 1976] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 30 (0x126618c00) [pid = 1063] [serial = 1964] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:05 INFO - --DOMWINDOW == 29 (0x12df59800) [pid = 1063] [serial = 1967] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:05 INFO - --DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 1962] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446163440711] 17:04:05 INFO - --DOMWINDOW == 27 (0x120996c00) [pid = 1063] [serial = 1960] [outer = 0x0] [url = about:blank] 17:04:05 INFO - --DOMWINDOW == 26 (0x134862000) [pid = 1063] [serial = 1969] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446163440711] 17:04:05 INFO - MEMORY STAT | vsize 3793MB | residentFast 416MB | heapAllocated 128MB 17:04:05 INFO - 381 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js | took 2386ms 17:04:05 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 822] 17:04:05 INFO - ++DOMWINDOW == 27 (0x12082f800) [pid = 1063] [serial = 1980] [outer = 0x0] 17:04:05 INFO - ++DOMWINDOW == 28 (0x1209c4c00) [pid = 1063] [serial = 1981] [outer = 0x12082f800] 17:04:06 INFO - 382 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_execution_scope.js 17:04:06 INFO - ++DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 823] 17:04:06 INFO - ++DOMWINDOW == 29 (0x121747c00) [pid = 1063] [serial = 1982] [outer = 0x0] 17:04:06 INFO - ++DOMWINDOW == 30 (0x126671000) [pid = 1063] [serial = 1983] [outer = 0x121747c00] 17:04:06 INFO - ++DOMWINDOW == 31 (0x12a1d4800) [pid = 1063] [serial = 1984] [outer = 0x121747c00] 17:04:06 INFO - ++DOCSHELL 0x1201fdb00 == 14 [pid = 1063] [id = 824] 17:04:06 INFO - ++DOMWINDOW == 32 (0x12666b000) [pid = 1063] [serial = 1985] [outer = 0x0] 17:04:06 INFO - ++DOMWINDOW == 33 (0x128c2ac00) [pid = 1063] [serial = 1986] [outer = 0x12666b000] 17:04:06 INFO - ++DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 1987] [outer = 0x12666b000] 17:04:06 INFO - ++DOCSHELL 0x12d25b500 == 15 [pid = 1063] [id = 825] 17:04:06 INFO - ++DOMWINDOW == 35 (0x12df86000) [pid = 1063] [serial = 1988] [outer = 0x0] 17:04:06 INFO - ++DOMWINDOW == 36 (0x12e21f800) [pid = 1063] [serial = 1989] [outer = 0x12df86000] 17:04:08 INFO - --DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 818] 17:04:08 INFO - --DOCSHELL 0x12c6dd800 == 13 [pid = 1063] [id = 819] 17:04:08 INFO - --DOCSHELL 0x12d25b000 == 12 [pid = 1063] [id = 820] 17:04:08 INFO - --DOCSHELL 0x12d25b500 == 11 [pid = 1063] [id = 825] 17:04:08 INFO - --DOMWINDOW == 35 (0x1285cb800) [pid = 1063] [serial = 1966] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:08 INFO - --DOMWINDOW == 34 (0x12e1ecc00) [pid = 1063] [serial = 1968] [outer = 0x0] [url = about:blank] 17:04:08 INFO - --DOMWINDOW == 33 (0x126671000) [pid = 1063] [serial = 1983] [outer = 0x0] [url = about:blank] 17:04:08 INFO - --DOMWINDOW == 32 (0x127f4e800) [pid = 1063] [serial = 1971] [outer = 0x0] [url = about:blank] 17:04:08 INFO - --DOMWINDOW == 31 (0x128c2ac00) [pid = 1063] [serial = 1986] [outer = 0x0] [url = about:blank] 17:04:08 INFO - --DOMWINDOW == 30 (0x12f18f000) [pid = 1063] [serial = 1978] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:08 INFO - --DOMWINDOW == 29 (0x12963d000) [pid = 1063] [serial = 1975] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:08 INFO - --DOMWINDOW == 28 (0x12054bc00) [pid = 1063] [serial = 1972] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 17:04:08 INFO - --DOMWINDOW == 27 (0x127b00800) [pid = 1063] [serial = 1970] [outer = 0x0] [url = about:blank] 17:04:08 INFO - --DOMWINDOW == 26 (0x129932000) [pid = 1063] [serial = 1974] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 17:04:08 INFO - MEMORY STAT | vsize 3794MB | residentFast 416MB | heapAllocated 128MB 17:04:08 INFO - 383 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_execution_scope.js | took 2385ms 17:04:08 INFO - ++DOCSHELL 0x11fbe2200 == 12 [pid = 1063] [id = 826] 17:04:08 INFO - ++DOMWINDOW == 27 (0x1216bac00) [pid = 1063] [serial = 1990] [outer = 0x0] 17:04:08 INFO - ++DOMWINDOW == 28 (0x126618000) [pid = 1063] [serial = 1991] [outer = 0x1216bac00] 17:04:08 INFO - 384 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js 17:04:08 INFO - ++DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 827] 17:04:08 INFO - ++DOMWINDOW == 29 (0x126618400) [pid = 1063] [serial = 1992] [outer = 0x0] 17:04:08 INFO - ++DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 1993] [outer = 0x126618400] 17:04:08 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 828] 17:04:08 INFO - ++DOMWINDOW == 31 (0x11fadc400) [pid = 1063] [serial = 1994] [outer = 0x0] 17:04:08 INFO - ++DOMWINDOW == 32 (0x127b00800) [pid = 1063] [serial = 1995] [outer = 0x11fadc400] 17:04:08 INFO - ++DOMWINDOW == 33 (0x128c2ac00) [pid = 1063] [serial = 1996] [outer = 0x11fadc400] 17:04:08 INFO - ++DOCSHELL 0x12c822e00 == 15 [pid = 1063] [id = 829] 17:04:08 INFO - ++DOMWINDOW == 34 (0x12d5a6800) [pid = 1063] [serial = 1997] [outer = 0x0] 17:04:08 INFO - ++DOMWINDOW == 35 (0x12df19000) [pid = 1063] [serial = 1998] [outer = 0x12d5a6800] 17:04:09 INFO - ++DOCSHELL 0x12e036400 == 16 [pid = 1063] [id = 830] 17:04:09 INFO - ++DOMWINDOW == 36 (0x12a1e1400) [pid = 1063] [serial = 1999] [outer = 0x0] 17:04:09 INFO - ++DOMWINDOW == 37 (0x12ae6ac00) [pid = 1063] [serial = 2000] [outer = 0x12a1e1400] 17:04:10 INFO - Handler function threw an exception: TypeError: this.disableJSNode is null 17:04:10 INFO - Stack: OptionsPanel.prototype.populatePreferences/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox-options.js:320:9 17:04:10 INFO - DebuggerClient.prototype.attachTab/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:433:39 17:04:10 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 17:04:10 INFO - Line: 320, column: 9 17:04:10 INFO - --DOCSHELL 0x11fbe3600 == 15 [pid = 1063] [id = 822] 17:04:10 INFO - --DOCSHELL 0x1201fdb00 == 14 [pid = 1063] [id = 824] 17:04:10 INFO - --DOCSHELL 0x12c822e00 == 13 [pid = 1063] [id = 829] 17:04:10 INFO - --DOCSHELL 0x12bb2da00 == 12 [pid = 1063] [id = 823] 17:04:10 INFO - --DOCSHELL 0x12e036400 == 11 [pid = 1063] [id = 830] 17:04:10 INFO - --DOMWINDOW == 36 (0x12f18f400) [pid = 1063] [serial = 1979] [outer = 0x0] [url = about:blank] 17:04:10 INFO - --DOMWINDOW == 35 (0x1299ab800) [pid = 1063] [serial = 1977] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:10 INFO - --DOMWINDOW == 34 (0x1209c4c00) [pid = 1063] [serial = 1981] [outer = 0x0] [url = about:blank] 17:04:10 INFO - --DOMWINDOW == 33 (0x127b00800) [pid = 1063] [serial = 1995] [outer = 0x0] [url = about:blank] 17:04:10 INFO - --DOMWINDOW == 32 (0x12666b000) [pid = 1063] [serial = 1985] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:10 INFO - --DOMWINDOW == 31 (0x12df86000) [pid = 1063] [serial = 1988] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:10 INFO - --DOMWINDOW == 30 (0x121747c00) [pid = 1063] [serial = 1982] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:10 INFO - --DOMWINDOW == 29 (0x12082f800) [pid = 1063] [serial = 1980] [outer = 0x0] [url = about:blank] 17:04:10 INFO - --DOMWINDOW == 28 (0x12a1d4800) [pid = 1063] [serial = 1984] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:10 INFO - MEMORY STAT | vsize 3793MB | residentFast 414MB | heapAllocated 128MB 17:04:10 INFO - 385 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js | took 2457ms 17:04:10 INFO - ++DOCSHELL 0x11fbe1d00 == 12 [pid = 1063] [id = 831] 17:04:10 INFO - ++DOMWINDOW == 29 (0x1209c4c00) [pid = 1063] [serial = 2001] [outer = 0x0] 17:04:11 INFO - ++DOMWINDOW == 30 (0x121763000) [pid = 1063] [serial = 2002] [outer = 0x1209c4c00] 17:04:11 INFO - 386 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js 17:04:11 INFO - ++DOCSHELL 0x1266a6e00 == 13 [pid = 1063] [id = 832] 17:04:11 INFO - ++DOMWINDOW == 31 (0x11f840c00) [pid = 1063] [serial = 2003] [outer = 0x0] 17:04:11 INFO - ++DOMWINDOW == 32 (0x127bea800) [pid = 1063] [serial = 2004] [outer = 0x11f840c00] 17:04:11 INFO - ++DOMWINDOW == 33 (0x12987f800) [pid = 1063] [serial = 2005] [outer = 0x11f840c00] 17:04:11 INFO - ++DOCSHELL 0x120929200 == 14 [pid = 1063] [id = 833] 17:04:11 INFO - ++DOMWINDOW == 34 (0x1276eb400) [pid = 1063] [serial = 2006] [outer = 0x0] 17:04:11 INFO - ++DOMWINDOW == 35 (0x1299ab800) [pid = 1063] [serial = 2007] [outer = 0x1276eb400] 17:04:11 INFO - ++DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 2008] [outer = 0x1276eb400] 17:04:11 INFO - ++DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 834] 17:04:11 INFO - ++DOMWINDOW == 37 (0x12a03b400) [pid = 1063] [serial = 2009] [outer = 0x0] 17:04:11 INFO - ++DOMWINDOW == 38 (0x12a0e6800) [pid = 1063] [serial = 2010] [outer = 0x12a03b400] 17:04:14 INFO - --DOCSHELL 0x11fbe2200 == 14 [pid = 1063] [id = 826] 17:04:14 INFO - --DOCSHELL 0x12c825600 == 13 [pid = 1063] [id = 834] 17:04:14 INFO - --DOCSHELL 0x127766500 == 12 [pid = 1063] [id = 827] 17:04:14 INFO - --DOCSHELL 0x12bf3f600 == 11 [pid = 1063] [id = 828] 17:04:14 INFO - --DOMWINDOW == 37 (0x128ffb000) [pid = 1063] [serial = 1987] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:14 INFO - --DOMWINDOW == 36 (0x12e21f800) [pid = 1063] [serial = 1989] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 35 (0x126618000) [pid = 1063] [serial = 1991] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 34 (0x127b8b000) [pid = 1063] [serial = 1993] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 33 (0x127bea800) [pid = 1063] [serial = 2004] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 32 (0x1299ab800) [pid = 1063] [serial = 2007] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 31 (0x12a1e1400) [pid = 1063] [serial = 1999] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-options.xul] 17:04:14 INFO - --DOMWINDOW == 30 (0x11fadc400) [pid = 1063] [serial = 1994] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:14 INFO - --DOMWINDOW == 29 (0x12d5a6800) [pid = 1063] [serial = 1997] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:14 INFO - --DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 1990] [outer = 0x0] [url = about:blank] 17:04:14 INFO - --DOMWINDOW == 27 (0x126618400) [pid = 1063] [serial = 1992] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20722267%20-%20preference%20for%20toggling%20timestamps%20in%20messages] 17:04:14 INFO - MEMORY STAT | vsize 3794MB | residentFast 414MB | heapAllocated 129MB 17:04:14 INFO - 387 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js | took 3150ms 17:04:14 INFO - ++DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 835] 17:04:14 INFO - ++DOMWINDOW == 28 (0x12054bc00) [pid = 1063] [serial = 2011] [outer = 0x0] 17:04:14 INFO - ++DOMWINDOW == 29 (0x120996c00) [pid = 1063] [serial = 2012] [outer = 0x12054bc00] 17:04:14 INFO - 388 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_for_of.js 17:04:14 INFO - ++DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 836] 17:04:14 INFO - ++DOMWINDOW == 30 (0x1216a2800) [pid = 1063] [serial = 2013] [outer = 0x0] 17:04:14 INFO - ++DOMWINDOW == 31 (0x127b8b000) [pid = 1063] [serial = 2014] [outer = 0x1216a2800] 17:04:14 INFO - ++DOMWINDOW == 32 (0x128501c00) [pid = 1063] [serial = 2015] [outer = 0x1216a2800] 17:04:14 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 837] 17:04:14 INFO - ++DOMWINDOW == 33 (0x121cbac00) [pid = 1063] [serial = 2016] [outer = 0x0] 17:04:14 INFO - ++DOMWINDOW == 34 (0x127bea800) [pid = 1063] [serial = 2017] [outer = 0x121cbac00] 17:04:14 INFO - ++DOMWINDOW == 35 (0x128ffb000) [pid = 1063] [serial = 2018] [outer = 0x121cbac00] 17:04:14 INFO - ++DOCSHELL 0x12ca29000 == 15 [pid = 1063] [id = 838] 17:04:14 INFO - ++DOMWINDOW == 36 (0x13082a800) [pid = 1063] [serial = 2019] [outer = 0x0] 17:04:14 INFO - ++DOMWINDOW == 37 (0x1308b9800) [pid = 1063] [serial = 2020] [outer = 0x13082a800] 17:04:16 INFO - --DOCSHELL 0x120929200 == 14 [pid = 1063] [id = 833] 17:04:16 INFO - --DOCSHELL 0x12ca29000 == 13 [pid = 1063] [id = 838] 17:04:16 INFO - --DOCSHELL 0x1266a6e00 == 12 [pid = 1063] [id = 832] 17:04:16 INFO - --DOCSHELL 0x11fbe1d00 == 11 [pid = 1063] [id = 831] 17:04:16 INFO - --DOMWINDOW == 36 (0x12ae6ac00) [pid = 1063] [serial = 2000] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 35 (0x128c2ac00) [pid = 1063] [serial = 1996] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:16 INFO - --DOMWINDOW == 34 (0x12df19000) [pid = 1063] [serial = 1998] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 33 (0x127bea800) [pid = 1063] [serial = 2017] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 32 (0x121763000) [pid = 1063] [serial = 2002] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 31 (0x12987f800) [pid = 1063] [serial = 2005] [outer = 0x0] [url = http://example.com/] 17:04:16 INFO - --DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 2014] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 29 (0x1276eb400) [pid = 1063] [serial = 2006] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:16 INFO - --DOMWINDOW == 28 (0x12a03b400) [pid = 1063] [serial = 2009] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:16 INFO - --DOMWINDOW == 27 (0x1209c4c00) [pid = 1063] [serial = 2001] [outer = 0x0] [url = about:blank] 17:04:16 INFO - --DOMWINDOW == 26 (0x11f840c00) [pid = 1063] [serial = 2003] [outer = 0x0] [url = http://example.com/] 17:04:16 INFO - MEMORY STAT | vsize 3794MB | residentFast 414MB | heapAllocated 129MB 17:04:16 INFO - 389 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_for_of.js | took 2368ms 17:04:16 INFO - ++DOCSHELL 0x11fbe2700 == 12 [pid = 1063] [id = 839] 17:04:16 INFO - ++DOMWINDOW == 27 (0x1205f8400) [pid = 1063] [serial = 2021] [outer = 0x0] 17:04:16 INFO - ++DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 2022] [outer = 0x1205f8400] 17:04:16 INFO - 390 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_history.js 17:04:16 INFO - ++DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 840] 17:04:16 INFO - ++DOMWINDOW == 29 (0x12666b000) [pid = 1063] [serial = 2023] [outer = 0x0] 17:04:16 INFO - ++DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 2024] [outer = 0x12666b000] 17:04:17 INFO - ++DOMWINDOW == 31 (0x13522f000) [pid = 1063] [serial = 2025] [outer = 0x12666b000] 17:04:17 INFO - ++DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 841] 17:04:17 INFO - ++DOMWINDOW == 32 (0x127b00800) [pid = 1063] [serial = 2026] [outer = 0x0] 17:04:17 INFO - ++DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 2027] [outer = 0x127b00800] 17:04:17 INFO - ++DOMWINDOW == 34 (0x1297a0800) [pid = 1063] [serial = 2028] [outer = 0x127b00800] 17:04:17 INFO - ++DOCSHELL 0x12ca2d600 == 15 [pid = 1063] [id = 842] 17:04:17 INFO - ++DOMWINDOW == 35 (0x12df27800) [pid = 1063] [serial = 2029] [outer = 0x0] 17:04:17 INFO - ++DOMWINDOW == 36 (0x12df27c00) [pid = 1063] [serial = 2030] [outer = 0x12df27800] 17:04:19 INFO - --DOCSHELL 0x11fbe3100 == 14 [pid = 1063] [id = 835] 17:04:19 INFO - --DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 836] 17:04:19 INFO - --DOCSHELL 0x12ca2d600 == 12 [pid = 1063] [id = 842] 17:04:19 INFO - --DOCSHELL 0x12c6dd300 == 11 [pid = 1063] [id = 837] 17:04:19 INFO - --DOMWINDOW == 35 (0x129932000) [pid = 1063] [serial = 2008] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:19 INFO - --DOMWINDOW == 34 (0x12a0e6800) [pid = 1063] [serial = 2010] [outer = 0x0] [url = about:blank] 17:04:19 INFO - --DOMWINDOW == 33 (0x127b8b000) [pid = 1063] [serial = 2024] [outer = 0x0] [url = about:blank] 17:04:19 INFO - --DOMWINDOW == 32 (0x120996c00) [pid = 1063] [serial = 2012] [outer = 0x0] [url = about:blank] 17:04:19 INFO - --DOMWINDOW == 31 (0x12963d000) [pid = 1063] [serial = 2027] [outer = 0x0] [url = about:blank] 17:04:19 INFO - --DOMWINDOW == 30 (0x121cbac00) [pid = 1063] [serial = 2016] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:19 INFO - --DOMWINDOW == 29 (0x13082a800) [pid = 1063] [serial = 2019] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:19 INFO - --DOMWINDOW == 28 (0x1216a2800) [pid = 1063] [serial = 2013] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 17:04:19 INFO - --DOMWINDOW == 27 (0x12054bc00) [pid = 1063] [serial = 2011] [outer = 0x0] [url = about:blank] 17:04:19 INFO - --DOMWINDOW == 26 (0x128501c00) [pid = 1063] [serial = 2015] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 17:04:19 INFO - MEMORY STAT | vsize 3792MB | residentFast 414MB | heapAllocated 129MB 17:04:19 INFO - 391 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_history.js | took 2598ms 17:04:19 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 843] 17:04:19 INFO - ++DOMWINDOW == 27 (0x120917c00) [pid = 1063] [serial = 2031] [outer = 0x0] 17:04:19 INFO - ++DOMWINDOW == 28 (0x121763000) [pid = 1063] [serial = 2032] [outer = 0x120917c00] 17:04:19 INFO - 392 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js 17:04:19 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 844] 17:04:19 INFO - ++DOMWINDOW == 29 (0x121cbac00) [pid = 1063] [serial = 2033] [outer = 0x0] 17:04:19 INFO - ++DOMWINDOW == 30 (0x127f0b400) [pid = 1063] [serial = 2034] [outer = 0x121cbac00] 17:04:19 INFO - ++DOCSHELL 0x12c6dba00 == 14 [pid = 1063] [id = 845] 17:04:19 INFO - ++DOMWINDOW == 31 (0x127bea800) [pid = 1063] [serial = 2035] [outer = 0x0] 17:04:19 INFO - ++DOMWINDOW == 32 (0x12987f800) [pid = 1063] [serial = 2036] [outer = 0x127bea800] 17:04:19 INFO - ++DOMWINDOW == 33 (0x129932000) [pid = 1063] [serial = 2037] [outer = 0x127bea800] 17:04:20 INFO - ++DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 846] 17:04:20 INFO - ++DOMWINDOW == 34 (0x12df86000) [pid = 1063] [serial = 2038] [outer = 0x0] 17:04:20 INFO - ++DOMWINDOW == 35 (0x12df86800) [pid = 1063] [serial = 2039] [outer = 0x12df86000] 17:04:20 INFO - ++DOMWINDOW == 36 (0x12a0e6800) [pid = 1063] [serial = 2040] [outer = 0x121cbac00] 17:04:20 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:21 INFO - ++DOMWINDOW == 37 (0x12fdfcc00) [pid = 1063] [serial = 2041] [outer = 0x121cbac00] 17:04:21 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:21 INFO - ++DOMWINDOW == 38 (0x1351b2000) [pid = 1063] [serial = 2042] [outer = 0x121cbac00] 17:04:21 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:22 INFO - ++DOMWINDOW == 39 (0x136725400) [pid = 1063] [serial = 2043] [outer = 0x121cbac00] 17:04:22 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:22 INFO - ++DOMWINDOW == 40 (0x1370a1800) [pid = 1063] [serial = 2044] [outer = 0x121cbac00] 17:04:22 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:22 INFO - ++DOMWINDOW == 41 (0x12e240800) [pid = 1063] [serial = 2045] [outer = 0x121cbac00] 17:04:22 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:23 INFO - ++DOMWINDOW == 42 (0x1362d4c00) [pid = 1063] [serial = 2046] [outer = 0x121cbac00] 17:04:23 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:23 INFO - ++DOMWINDOW == 43 (0x12b0f8c00) [pid = 1063] [serial = 2047] [outer = 0x121cbac00] 17:04:23 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:24 INFO - ++DOMWINDOW == 44 (0x1353ce000) [pid = 1063] [serial = 2048] [outer = 0x121cbac00] 17:04:24 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:25 INFO - --DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 839] 17:04:25 INFO - --DOCSHELL 0x127766500 == 13 [pid = 1063] [id = 840] 17:04:25 INFO - --DOCSHELL 0x12c825600 == 12 [pid = 1063] [id = 846] 17:04:25 INFO - --DOCSHELL 0x12c6dc900 == 11 [pid = 1063] [id = 841] 17:04:25 INFO - --DOMWINDOW == 43 (0x1308b9800) [pid = 1063] [serial = 2020] [outer = 0x0] [url = about:blank] 17:04:25 INFO - --DOMWINDOW == 42 (0x128ffb000) [pid = 1063] [serial = 2018] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:25 INFO - --DOMWINDOW == 41 (0x12666b000) [pid = 1063] [serial = 2023] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:25 INFO - --DOMWINDOW == 40 (0x1205f8400) [pid = 1063] [serial = 2021] [outer = 0x0] [url = about:blank] 17:04:25 INFO - --DOMWINDOW == 39 (0x127b00800) [pid = 1063] [serial = 2026] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:25 INFO - --DOMWINDOW == 38 (0x127f0b400) [pid = 1063] [serial = 2034] [outer = 0x0] [url = about:blank] 17:04:25 INFO - --DOMWINDOW == 37 (0x12a0e6800) [pid = 1063] [serial = 2040] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?badSyntax] 17:04:25 INFO - --DOMWINDOW == 36 (0x12fdfcc00) [pid = 1063] [serial = 2041] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?noMaxAge] 17:04:25 INFO - --DOMWINDOW == 35 (0x1351b2000) [pid = 1063] [serial = 2042] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidIncludeSubDomains] 17:04:25 INFO - --DOMWINDOW == 34 (0x136725400) [pid = 1063] [serial = 2043] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidMaxAge] 17:04:25 INFO - --DOMWINDOW == 33 (0x1370a1800) [pid = 1063] [serial = 2044] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleIncludeSubDomains] 17:04:25 INFO - --DOMWINDOW == 32 (0x12987f800) [pid = 1063] [serial = 2036] [outer = 0x0] [url = about:blank] 17:04:25 INFO - --DOMWINDOW == 31 (0x1216bac00) [pid = 1063] [serial = 2022] [outer = 0x0] [url = about:blank] 17:04:25 INFO - --DOMWINDOW == 30 (0x12b0f8c00) [pid = 1063] [serial = 2047] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 17:04:25 INFO - --DOMWINDOW == 29 (0x12e240800) [pid = 1063] [serial = 2045] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleMaxAge] 17:04:25 INFO - --DOMWINDOW == 28 (0x1362d4c00) [pid = 1063] [serial = 2046] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleReportURIs] 17:04:25 INFO - --DOMWINDOW == 27 (0x12df27800) [pid = 1063] [serial = 2029] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:25 INFO - --DOMWINDOW == 26 (0x13522f000) [pid = 1063] [serial = 2025] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:25 INFO - MEMORY STAT | vsize 3791MB | residentFast 417MB | heapAllocated 130MB 17:04:25 INFO - 393 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js | took 5876ms 17:04:25 INFO - ++DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 847] 17:04:25 INFO - ++DOMWINDOW == 27 (0x12031e800) [pid = 1063] [serial = 2049] [outer = 0x0] 17:04:25 INFO - ++DOMWINDOW == 28 (0x120541800) [pid = 1063] [serial = 2050] [outer = 0x12031e800] 17:04:25 INFO - 394 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js 17:04:25 INFO - ++DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 848] 17:04:25 INFO - ++DOMWINDOW == 29 (0x11f8cc800) [pid = 1063] [serial = 2051] [outer = 0x0] 17:04:25 INFO - ++DOMWINDOW == 30 (0x1216c6c00) [pid = 1063] [serial = 2052] [outer = 0x11f8cc800] 17:04:25 INFO - ++DOCSHELL 0x12c6db500 == 14 [pid = 1063] [id = 849] 17:04:25 INFO - ++DOMWINDOW == 31 (0x1209c4c00) [pid = 1063] [serial = 2053] [outer = 0x0] 17:04:25 INFO - ++DOMWINDOW == 32 (0x1285cb800) [pid = 1063] [serial = 2054] [outer = 0x1209c4c00] 17:04:26 INFO - ++DOMWINDOW == 33 (0x128c2a000) [pid = 1063] [serial = 2055] [outer = 0x1209c4c00] 17:04:26 INFO - ++DOCSHELL 0x12c6df600 == 15 [pid = 1063] [id = 850] 17:04:26 INFO - ++DOMWINDOW == 34 (0x12c9f5800) [pid = 1063] [serial = 2056] [outer = 0x0] 17:04:26 INFO - ++DOMWINDOW == 35 (0x12ca21000) [pid = 1063] [serial = 2057] [outer = 0x12c9f5800] 17:04:27 INFO - ++DOMWINDOW == 36 (0x135172c00) [pid = 1063] [serial = 2058] [outer = 0x11f8cc800] 17:04:27 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:27 INFO - ++DOMWINDOW == 37 (0x13628c800) [pid = 1063] [serial = 2059] [outer = 0x11f8cc800] 17:04:27 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:27 INFO - ++DOMWINDOW == 38 (0x129e8dc00) [pid = 1063] [serial = 2060] [outer = 0x11f8cc800] 17:04:27 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:28 INFO - ++DOMWINDOW == 39 (0x137048800) [pid = 1063] [serial = 2061] [outer = 0x11f8cc800] 17:04:28 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:28 INFO - ++DOMWINDOW == 40 (0x1559de400) [pid = 1063] [serial = 2062] [outer = 0x11f8cc800] 17:04:28 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:29 INFO - ++DOMWINDOW == 41 (0x137049800) [pid = 1063] [serial = 2063] [outer = 0x11f8cc800] 17:04:29 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:30 INFO - --DOCSHELL 0x11fbe3600 == 14 [pid = 1063] [id = 843] 17:04:30 INFO - --DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 844] 17:04:30 INFO - --DOCSHELL 0x12c6db500 == 12 [pid = 1063] [id = 849] 17:04:30 INFO - --DOCSHELL 0x12c6df600 == 11 [pid = 1063] [id = 850] 17:04:30 INFO - --DOCSHELL 0x12c6dba00 == 10 [pid = 1063] [id = 845] 17:04:30 INFO - --DOMWINDOW == 40 (0x12df27c00) [pid = 1063] [serial = 2030] [outer = 0x0] [url = about:blank] 17:04:30 INFO - --DOMWINDOW == 39 (0x1297a0800) [pid = 1063] [serial = 2028] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:30 INFO - --DOMWINDOW == 38 (0x127bea800) [pid = 1063] [serial = 2035] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:30 INFO - --DOMWINDOW == 37 (0x121763000) [pid = 1063] [serial = 2032] [outer = 0x0] [url = about:blank] 17:04:30 INFO - --DOMWINDOW == 36 (0x1353ce000) [pid = 1063] [serial = 2048] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 17:04:30 INFO - --DOMWINDOW == 35 (0x1216c6c00) [pid = 1063] [serial = 2052] [outer = 0x0] [url = about:blank] 17:04:30 INFO - --DOMWINDOW == 34 (0x135172c00) [pid = 1063] [serial = 2058] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?badSyntax] 17:04:30 INFO - --DOMWINDOW == 33 (0x13628c800) [pid = 1063] [serial = 2059] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?noMaxAge] 17:04:30 INFO - --DOMWINDOW == 32 (0x129e8dc00) [pid = 1063] [serial = 2060] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidIncludeSubDomains] 17:04:30 INFO - --DOMWINDOW == 31 (0x137048800) [pid = 1063] [serial = 2061] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidMaxAge] 17:04:30 INFO - --DOMWINDOW == 30 (0x1285cb800) [pid = 1063] [serial = 2054] [outer = 0x0] [url = about:blank] 17:04:30 INFO - --DOMWINDOW == 29 (0x1559de400) [pid = 1063] [serial = 2062] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleIncludeSubDomains] 17:04:30 INFO - --DOMWINDOW == 28 (0x12df86000) [pid = 1063] [serial = 2038] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:30 INFO - --DOMWINDOW == 27 (0x120917c00) [pid = 1063] [serial = 2031] [outer = 0x0] [url = about:blank] 17:04:30 INFO - --DOMWINDOW == 26 (0x121cbac00) [pid = 1063] [serial = 2033] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 17:04:30 INFO - MEMORY STAT | vsize 3787MB | residentFast 412MB | heapAllocated 129MB 17:04:30 INFO - 395 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js | took 4812ms 17:04:30 INFO - ++DOCSHELL 0x11fbe2200 == 11 [pid = 1063] [id = 851] 17:04:30 INFO - ++DOMWINDOW == 27 (0x1216bac00) [pid = 1063] [serial = 2064] [outer = 0x0] 17:04:30 INFO - ++DOMWINDOW == 28 (0x121cbac00) [pid = 1063] [serial = 2065] [outer = 0x1216bac00] 17:04:30 INFO - 396 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js 17:04:30 INFO - ++DOCSHELL 0x12bb2f800 == 12 [pid = 1063] [id = 852] 17:04:30 INFO - ++DOMWINDOW == 29 (0x121763000) [pid = 1063] [serial = 2066] [outer = 0x0] 17:04:30 INFO - ++DOMWINDOW == 30 (0x127f0b400) [pid = 1063] [serial = 2067] [outer = 0x121763000] 17:04:30 INFO - ++DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 853] 17:04:30 INFO - ++DOMWINDOW == 31 (0x127bea800) [pid = 1063] [serial = 2068] [outer = 0x0] 17:04:30 INFO - ++DOMWINDOW == 32 (0x128e94000) [pid = 1063] [serial = 2069] [outer = 0x127bea800] 17:04:30 INFO - ++DOMWINDOW == 33 (0x128ffb000) [pid = 1063] [serial = 2070] [outer = 0x127bea800] 17:04:31 INFO - ++DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 854] 17:04:31 INFO - ++DOMWINDOW == 34 (0x12c9b4c00) [pid = 1063] [serial = 2071] [outer = 0x0] 17:04:31 INFO - ++DOMWINDOW == 35 (0x12ce44c00) [pid = 1063] [serial = 2072] [outer = 0x12c9b4c00] 17:04:31 INFO - ++DOCSHELL 0x131a41e00 == 15 [pid = 1063] [id = 855] 17:04:31 INFO - ++DOMWINDOW == 36 (0x134862400) [pid = 1063] [serial = 2073] [outer = 0x0] 17:04:31 INFO - ++DOMWINDOW == 37 (0x134862c00) [pid = 1063] [serial = 2074] [outer = 0x134862400] 17:04:32 INFO - ++DOCSHELL 0x1201fdb00 == 16 [pid = 1063] [id = 856] 17:04:32 INFO - ++DOMWINDOW == 38 (0x1299ab800) [pid = 1063] [serial = 2075] [outer = 0x0] 17:04:32 INFO - ++DOMWINDOW == 39 (0x1299ea800) [pid = 1063] [serial = 2076] [outer = 0x1299ab800] 17:04:33 INFO - --DOCSHELL 0x1201b0200 == 15 [pid = 1063] [id = 847] 17:04:33 INFO - --DOCSHELL 0x12c822e00 == 14 [pid = 1063] [id = 854] 17:04:33 INFO - --DOCSHELL 0x12bb2da00 == 13 [pid = 1063] [id = 848] 17:04:33 INFO - --DOCSHELL 0x131a41e00 == 12 [pid = 1063] [id = 855] 17:04:33 INFO - --DOMWINDOW == 38 (0x12df86800) [pid = 1063] [serial = 2039] [outer = 0x0] [url = about:blank] 17:04:33 INFO - --DOCSHELL 0x1201fdb00 == 11 [pid = 1063] [id = 856] 17:04:33 INFO - --DOMWINDOW == 37 (0x129932000) [pid = 1063] [serial = 2037] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:33 INFO - --DOMWINDOW == 36 (0x1209c4c00) [pid = 1063] [serial = 2053] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:33 INFO - --DOMWINDOW == 35 (0x137049800) [pid = 1063] [serial = 2063] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 17:04:33 INFO - --DOMWINDOW == 34 (0x120541800) [pid = 1063] [serial = 2050] [outer = 0x0] [url = about:blank] 17:04:33 INFO - --DOMWINDOW == 33 (0x128e94000) [pid = 1063] [serial = 2069] [outer = 0x0] [url = about:blank] 17:04:33 INFO - --DOMWINDOW == 32 (0x12c9f5800) [pid = 1063] [serial = 2056] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:33 INFO - --DOMWINDOW == 31 (0x11f8cc800) [pid = 1063] [serial = 2051] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 17:04:33 INFO - --DOMWINDOW == 30 (0x12031e800) [pid = 1063] [serial = 2049] [outer = 0x0] [url = about:blank] 17:04:33 INFO - MEMORY STAT | vsize 3790MB | residentFast 416MB | heapAllocated 131MB 17:04:33 INFO - 397 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js | took 2885ms 17:04:33 INFO - ++DOCSHELL 0x1201af300 == 12 [pid = 1063] [id = 857] 17:04:33 INFO - ++DOMWINDOW == 31 (0x120538c00) [pid = 1063] [serial = 2077] [outer = 0x0] 17:04:33 INFO - ++DOMWINDOW == 32 (0x1209c4c00) [pid = 1063] [serial = 2078] [outer = 0x120538c00] 17:04:33 INFO - 398 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js 17:04:33 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 858] 17:04:33 INFO - ++DOMWINDOW == 33 (0x121ddb400) [pid = 1063] [serial = 2079] [outer = 0x0] 17:04:33 INFO - ++DOMWINDOW == 34 (0x127f4e800) [pid = 1063] [serial = 2080] [outer = 0x121ddb400] 17:04:33 INFO - ++DOCSHELL 0x12c6dba00 == 14 [pid = 1063] [id = 859] 17:04:33 INFO - ++DOMWINDOW == 35 (0x127f0bc00) [pid = 1063] [serial = 2081] [outer = 0x0] 17:04:33 INFO - ++DOMWINDOW == 36 (0x129932000) [pid = 1063] [serial = 2082] [outer = 0x127f0bc00] 17:04:33 INFO - ++DOMWINDOW == 37 (0x129932400) [pid = 1063] [serial = 2083] [outer = 0x127f0bc00] 17:04:34 INFO - ++DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 860] 17:04:34 INFO - ++DOMWINDOW == 38 (0x130a72800) [pid = 1063] [serial = 2084] [outer = 0x0] 17:04:34 INFO - ++DOMWINDOW == 39 (0x130aa9400) [pid = 1063] [serial = 2085] [outer = 0x130a72800] 17:04:35 INFO - ++DOCSHELL 0x131a44100 == 16 [pid = 1063] [id = 861] 17:04:35 INFO - ++DOMWINDOW == 40 (0x128e94000) [pid = 1063] [serial = 2086] [outer = 0x0] 17:04:35 INFO - ++DOMWINDOW == 41 (0x12bb66800) [pid = 1063] [serial = 2087] [outer = 0x128e94000] 17:04:35 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:04:35 INFO - ++DOCSHELL 0x13542be00 == 17 [pid = 1063] [id = 862] 17:04:35 INFO - ++DOMWINDOW == 42 (0x136337800) [pid = 1063] [serial = 2088] [outer = 0x0] 17:04:35 INFO - ++DOMWINDOW == 43 (0x136337c00) [pid = 1063] [serial = 2089] [outer = 0x136337800] 17:04:36 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:04:36 INFO - ++DOCSHELL 0x13542cd00 == 18 [pid = 1063] [id = 863] 17:04:36 INFO - ++DOMWINDOW == 44 (0x1355a3800) [pid = 1063] [serial = 2090] [outer = 0x0] 17:04:36 INFO - ++DOMWINDOW == 45 (0x1355a3c00) [pid = 1063] [serial = 2091] [outer = 0x1355a3800] 17:04:36 INFO - [1063] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3473 17:04:37 INFO - MEMORY STAT | vsize 3793MB | residentFast 422MB | heapAllocated 142MB 17:04:37 INFO - 399 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js | took 3712ms 17:04:37 INFO - ++DOCSHELL 0x11f881400 == 19 [pid = 1063] [id = 864] 17:04:37 INFO - ++DOMWINDOW == 46 (0x12764e000) [pid = 1063] [serial = 2092] [outer = 0x0] 17:04:37 INFO - ++DOMWINDOW == 47 (0x1284e0400) [pid = 1063] [serial = 2093] [outer = 0x12764e000] 17:04:37 INFO - 400 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js 17:04:37 INFO - ++DOCSHELL 0x12092a600 == 20 [pid = 1063] [id = 865] 17:04:37 INFO - ++DOMWINDOW == 48 (0x129f83800) [pid = 1063] [serial = 2094] [outer = 0x0] 17:04:37 INFO - ++DOMWINDOW == 49 (0x12b050c00) [pid = 1063] [serial = 2095] [outer = 0x129f83800] 17:04:37 INFO - ++DOMWINDOW == 50 (0x12bf6e800) [pid = 1063] [serial = 2096] [outer = 0x129f83800] 17:04:37 INFO - ++DOCSHELL 0x12ca29000 == 21 [pid = 1063] [id = 866] 17:04:37 INFO - ++DOMWINDOW == 51 (0x12b032800) [pid = 1063] [serial = 2097] [outer = 0x0] 17:04:37 INFO - ++DOMWINDOW == 52 (0x12bff8400) [pid = 1063] [serial = 2098] [outer = 0x12b032800] 17:04:38 INFO - ++DOMWINDOW == 53 (0x12c26d400) [pid = 1063] [serial = 2099] [outer = 0x12b032800] 17:04:38 INFO - ++DOCSHELL 0x12d4c0200 == 22 [pid = 1063] [id = 867] 17:04:38 INFO - ++DOMWINDOW == 54 (0x13488b800) [pid = 1063] [serial = 2100] [outer = 0x0] 17:04:38 INFO - ++DOMWINDOW == 55 (0x13488bc00) [pid = 1063] [serial = 2101] [outer = 0x13488b800] 17:04:40 INFO - --DOCSHELL 0x1201af300 == 21 [pid = 1063] [id = 857] 17:04:40 INFO - --DOCSHELL 0x12bb2f800 == 20 [pid = 1063] [id = 852] 17:04:40 INFO - --DOCSHELL 0x128ead000 == 19 [pid = 1063] [id = 858] 17:04:40 INFO - --DOCSHELL 0x12c6dba00 == 18 [pid = 1063] [id = 859] 17:04:40 INFO - --DOCSHELL 0x12c825600 == 17 [pid = 1063] [id = 860] 17:04:40 INFO - --DOCSHELL 0x11fbe2200 == 16 [pid = 1063] [id = 851] 17:04:40 INFO - --DOCSHELL 0x131a44100 == 15 [pid = 1063] [id = 861] 17:04:40 INFO - --DOCSHELL 0x129f9b200 == 14 [pid = 1063] [id = 853] 17:04:40 INFO - --DOCSHELL 0x13542be00 == 13 [pid = 1063] [id = 862] 17:04:40 INFO - --DOCSHELL 0x13542cd00 == 12 [pid = 1063] [id = 863] 17:04:40 INFO - --DOCSHELL 0x12d4c0200 == 11 [pid = 1063] [id = 867] 17:04:40 INFO - --DOMWINDOW == 54 (0x12ca21000) [pid = 1063] [serial = 2057] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 53 (0x128c2a000) [pid = 1063] [serial = 2055] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:40 INFO - --DOMWINDOW == 52 (0x12b050c00) [pid = 1063] [serial = 2095] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 51 (0x120538c00) [pid = 1063] [serial = 2077] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 50 (0x121ddb400) [pid = 1063] [serial = 2079] [outer = 0x0] [url = data:text/html;charset=utf8,browser_webconsole_inspect-parsed-documents.js] 17:04:40 INFO - --DOMWINDOW == 49 (0x1355a3800) [pid = 1063] [serial = 2090] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:40 INFO - --DOMWINDOW == 48 (0x130a72800) [pid = 1063] [serial = 2084] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:40 INFO - --DOMWINDOW == 47 (0x1209c4c00) [pid = 1063] [serial = 2078] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 46 (0x127f0bc00) [pid = 1063] [serial = 2081] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:40 INFO - --DOMWINDOW == 45 (0x129932000) [pid = 1063] [serial = 2082] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 44 (0x121cbac00) [pid = 1063] [serial = 2065] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 43 (0x127f0b400) [pid = 1063] [serial = 2067] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 42 (0x121763000) [pid = 1063] [serial = 2066] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello] 17:04:40 INFO - --DOMWINDOW == 41 (0x134862400) [pid = 1063] [serial = 2073] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 17:04:40 INFO - --DOMWINDOW == 40 (0x12c9b4c00) [pid = 1063] [serial = 2071] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:40 INFO - --DOMWINDOW == 39 (0x1216bac00) [pid = 1063] [serial = 2064] [outer = 0x0] [url = about:blank] 17:04:40 INFO - --DOMWINDOW == 38 (0x128e94000) [pid = 1063] [serial = 2086] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:40 INFO - --DOMWINDOW == 37 (0x1299ab800) [pid = 1063] [serial = 2075] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:04:40 INFO - --DOMWINDOW == 36 (0x127bea800) [pid = 1063] [serial = 2068] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:40 INFO - --DOMWINDOW == 35 (0x136337800) [pid = 1063] [serial = 2088] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:40 INFO - --DOMWINDOW == 34 (0x12bff8400) [pid = 1063] [serial = 2098] [outer = 0x0] [url = about:blank] 17:04:40 INFO - MEMORY STAT | vsize 3786MB | residentFast 413MB | heapAllocated 129MB 17:04:40 INFO - 401 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js | took 3237ms 17:04:40 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 868] 17:04:40 INFO - ++DOMWINDOW == 35 (0x120343c00) [pid = 1063] [serial = 2102] [outer = 0x0] 17:04:40 INFO - ++DOMWINDOW == 36 (0x1205f8400) [pid = 1063] [serial = 2103] [outer = 0x120343c00] 17:04:40 INFO - 402 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_jsterm.js 17:04:40 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 869] 17:04:40 INFO - ++DOMWINDOW == 37 (0x12082f800) [pid = 1063] [serial = 2104] [outer = 0x0] 17:04:40 INFO - ++DOMWINDOW == 38 (0x121763000) [pid = 1063] [serial = 2105] [outer = 0x12082f800] 17:04:41 INFO - ++DOMWINDOW == 39 (0x135477000) [pid = 1063] [serial = 2106] [outer = 0x12082f800] 17:04:41 INFO - ++DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 870] 17:04:41 INFO - ++DOMWINDOW == 40 (0x1216c6c00) [pid = 1063] [serial = 2107] [outer = 0x0] 17:04:41 INFO - ++DOMWINDOW == 41 (0x12764e800) [pid = 1063] [serial = 2108] [outer = 0x1216c6c00] 17:04:41 INFO - ++DOMWINDOW == 42 (0x127f0bc00) [pid = 1063] [serial = 2109] [outer = 0x1216c6c00] 17:04:41 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 871] 17:04:41 INFO - ++DOMWINDOW == 43 (0x130b42400) [pid = 1063] [serial = 2110] [outer = 0x0] 17:04:41 INFO - ++DOMWINDOW == 44 (0x130b42800) [pid = 1063] [serial = 2111] [outer = 0x130b42400] 17:04:44 INFO - --DOCSHELL 0x12cb89600 == 14 [pid = 1063] [id = 871] 17:04:44 INFO - --DOCSHELL 0x12ca29000 == 13 [pid = 1063] [id = 866] 17:04:44 INFO - --DOCSHELL 0x11f881400 == 12 [pid = 1063] [id = 864] 17:04:44 INFO - --DOCSHELL 0x12092a600 == 11 [pid = 1063] [id = 865] 17:04:44 INFO - --DOMWINDOW == 43 (0x130aa9400) [pid = 1063] [serial = 2085] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 42 (0x127f4e800) [pid = 1063] [serial = 2080] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 41 (0x1355a3c00) [pid = 1063] [serial = 2091] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:44 INFO - --DOMWINDOW == 40 (0x136337c00) [pid = 1063] [serial = 2089] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:44 INFO - --DOMWINDOW == 39 (0x12bb66800) [pid = 1063] [serial = 2087] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:04:44 INFO - --DOMWINDOW == 38 (0x129932400) [pid = 1063] [serial = 2083] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:44 INFO - --DOMWINDOW == 37 (0x1299ea800) [pid = 1063] [serial = 2076] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:04:44 INFO - --DOMWINDOW == 36 (0x134862c00) [pid = 1063] [serial = 2074] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 35 (0x12ce44c00) [pid = 1063] [serial = 2072] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 34 (0x128ffb000) [pid = 1063] [serial = 2070] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:44 INFO - --DOMWINDOW == 33 (0x1284e0400) [pid = 1063] [serial = 2093] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 32 (0x121763000) [pid = 1063] [serial = 2105] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 31 (0x12764e800) [pid = 1063] [serial = 2108] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 30 (0x13488b800) [pid = 1063] [serial = 2100] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:44 INFO - --DOMWINDOW == 29 (0x12764e000) [pid = 1063] [serial = 2092] [outer = 0x0] [url = about:blank] 17:04:44 INFO - --DOMWINDOW == 28 (0x129f83800) [pid = 1063] [serial = 2094] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:44 INFO - --DOMWINDOW == 27 (0x12b032800) [pid = 1063] [serial = 2097] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:44 INFO - --DOMWINDOW == 26 (0x12bf6e800) [pid = 1063] [serial = 2096] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:45 INFO - MEMORY STAT | vsize 3785MB | residentFast 412MB | heapAllocated 127MB 17:04:45 INFO - 403 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_jsterm.js | took 4102ms 17:04:45 INFO - ++DOCSHELL 0x11fbe2c00 == 12 [pid = 1063] [id = 872] 17:04:45 INFO - ++DOMWINDOW == 27 (0x120917c00) [pid = 1063] [serial = 2112] [outer = 0x0] 17:04:45 INFO - ++DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 2113] [outer = 0x120917c00] 17:04:45 INFO - 404 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js 17:04:45 INFO - ++DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 873] 17:04:45 INFO - ++DOMWINDOW == 29 (0x126671000) [pid = 1063] [serial = 2114] [outer = 0x0] 17:04:45 INFO - ++DOMWINDOW == 30 (0x1276eb400) [pid = 1063] [serial = 2115] [outer = 0x126671000] 17:04:45 INFO - ++DOMWINDOW == 31 (0x128738000) [pid = 1063] [serial = 2116] [outer = 0x126671000] 17:04:45 INFO - ++DOCSHELL 0x12c6dd800 == 14 [pid = 1063] [id = 874] 17:04:45 INFO - ++DOMWINDOW == 32 (0x12764ec00) [pid = 1063] [serial = 2117] [outer = 0x0] 17:04:45 INFO - ++DOMWINDOW == 33 (0x128c2ac00) [pid = 1063] [serial = 2118] [outer = 0x12764ec00] 17:04:45 INFO - ++DOMWINDOW == 34 (0x128c2a000) [pid = 1063] [serial = 2119] [outer = 0x12764ec00] 17:04:45 INFO - ++DOCSHELL 0x12d25b000 == 15 [pid = 1063] [id = 875] 17:04:45 INFO - ++DOMWINDOW == 35 (0x12c9b4c00) [pid = 1063] [serial = 2120] [outer = 0x0] 17:04:45 INFO - ++DOMWINDOW == 36 (0x12c9f5800) [pid = 1063] [serial = 2121] [outer = 0x12c9b4c00] 17:04:47 INFO - --DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 870] 17:04:47 INFO - --DOCSHELL 0x12d25b000 == 13 [pid = 1063] [id = 875] 17:04:47 INFO - --DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 868] 17:04:47 INFO - --DOCSHELL 0x129f99400 == 11 [pid = 1063] [id = 869] 17:04:47 INFO - --DOMWINDOW == 35 (0x13488bc00) [pid = 1063] [serial = 2101] [outer = 0x0] [url = about:blank] 17:04:47 INFO - --DOMWINDOW == 34 (0x12c26d400) [pid = 1063] [serial = 2099] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:47 INFO - --DOMWINDOW == 33 (0x130b42400) [pid = 1063] [serial = 2110] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:47 INFO - --DOMWINDOW == 32 (0x12082f800) [pid = 1063] [serial = 2104] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:47 INFO - --DOMWINDOW == 31 (0x1216c6c00) [pid = 1063] [serial = 2107] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:47 INFO - --DOMWINDOW == 30 (0x1276eb400) [pid = 1063] [serial = 2115] [outer = 0x0] [url = about:blank] 17:04:47 INFO - --DOMWINDOW == 29 (0x128c2ac00) [pid = 1063] [serial = 2118] [outer = 0x0] [url = about:blank] 17:04:47 INFO - --DOMWINDOW == 28 (0x1205f8400) [pid = 1063] [serial = 2103] [outer = 0x0] [url = about:blank] 17:04:47 INFO - --DOMWINDOW == 27 (0x120343c00) [pid = 1063] [serial = 2102] [outer = 0x0] [url = about:blank] 17:04:47 INFO - --DOMWINDOW == 26 (0x135477000) [pid = 1063] [serial = 2106] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:47 INFO - MEMORY STAT | vsize 3791MB | residentFast 413MB | heapAllocated 126MB 17:04:47 INFO - 405 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js | took 2693ms 17:04:47 INFO - ++DOCSHELL 0x11fbe2700 == 12 [pid = 1063] [id = 876] 17:04:47 INFO - ++DOMWINDOW == 27 (0x12031e800) [pid = 1063] [serial = 2122] [outer = 0x0] 17:04:47 INFO - ++DOMWINDOW == 28 (0x120541800) [pid = 1063] [serial = 2123] [outer = 0x12031e800] 17:04:47 INFO - 406 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js 17:04:48 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 877] 17:04:48 INFO - ++DOMWINDOW == 29 (0x1216c6c00) [pid = 1063] [serial = 2124] [outer = 0x0] 17:04:48 INFO - ++DOMWINDOW == 30 (0x12764e800) [pid = 1063] [serial = 2125] [outer = 0x1216c6c00] 17:04:48 INFO - ++DOMWINDOW == 31 (0x13351f800) [pid = 1063] [serial = 2126] [outer = 0x1216c6c00] 17:04:48 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 878] 17:04:48 INFO - ++DOMWINDOW == 32 (0x12764e000) [pid = 1063] [serial = 2127] [outer = 0x0] 17:04:48 INFO - ++DOMWINDOW == 33 (0x127f0b400) [pid = 1063] [serial = 2128] [outer = 0x12764e000] 17:04:48 INFO - ++DOMWINDOW == 34 (0x1284e0400) [pid = 1063] [serial = 2129] [outer = 0x12764e000] 17:04:48 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 879] 17:04:48 INFO - ++DOMWINDOW == 35 (0x12c989000) [pid = 1063] [serial = 2130] [outer = 0x0] 17:04:48 INFO - ++DOMWINDOW == 36 (0x12c9b4800) [pid = 1063] [serial = 2131] [outer = 0x12c989000] 17:04:50 INFO - --DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 872] 17:04:50 INFO - --DOCSHELL 0x129ea8100 == 13 [pid = 1063] [id = 873] 17:04:50 INFO - --DOCSHELL 0x12cb89600 == 12 [pid = 1063] [id = 879] 17:04:50 INFO - --DOCSHELL 0x12c6dd800 == 11 [pid = 1063] [id = 874] 17:04:50 INFO - --DOMWINDOW == 35 (0x130b42800) [pid = 1063] [serial = 2111] [outer = 0x0] [url = about:blank] 17:04:50 INFO - --DOMWINDOW == 34 (0x127f0bc00) [pid = 1063] [serial = 2109] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:50 INFO - --DOMWINDOW == 33 (0x12764ec00) [pid = 1063] [serial = 2117] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:50 INFO - --DOMWINDOW == 32 (0x12c9b4c00) [pid = 1063] [serial = 2120] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:50 INFO - --DOMWINDOW == 31 (0x126671000) [pid = 1063] [serial = 2114] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:50 INFO - --DOMWINDOW == 30 (0x120917c00) [pid = 1063] [serial = 2112] [outer = 0x0] [url = about:blank] 17:04:50 INFO - --DOMWINDOW == 29 (0x12764e800) [pid = 1063] [serial = 2125] [outer = 0x0] [url = about:blank] 17:04:50 INFO - --DOMWINDOW == 28 (0x121747c00) [pid = 1063] [serial = 2113] [outer = 0x0] [url = about:blank] 17:04:50 INFO - --DOMWINDOW == 27 (0x127f0b400) [pid = 1063] [serial = 2128] [outer = 0x0] [url = about:blank] 17:04:50 INFO - --DOMWINDOW == 26 (0x128738000) [pid = 1063] [serial = 2116] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:50 INFO - MEMORY STAT | vsize 3792MB | residentFast 415MB | heapAllocated 126MB 17:04:50 INFO - 407 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js | took 2999ms 17:04:50 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 880] 17:04:50 INFO - ++DOMWINDOW == 27 (0x120343400) [pid = 1063] [serial = 2132] [outer = 0x0] 17:04:51 INFO - ++DOMWINDOW == 28 (0x120917c00) [pid = 1063] [serial = 2133] [outer = 0x120343400] 17:04:51 INFO - 408 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js 17:04:51 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 881] 17:04:51 INFO - ++DOMWINDOW == 29 (0x121763000) [pid = 1063] [serial = 2134] [outer = 0x0] 17:04:51 INFO - ++DOMWINDOW == 30 (0x127274800) [pid = 1063] [serial = 2135] [outer = 0x121763000] 17:04:51 INFO - ++DOMWINDOW == 31 (0x127f0bc00) [pid = 1063] [serial = 2136] [outer = 0x121763000] 17:04:51 INFO - ++DOCSHELL 0x12bf3f600 == 14 [pid = 1063] [id = 882] 17:04:51 INFO - ++DOMWINDOW == 32 (0x126671000) [pid = 1063] [serial = 2137] [outer = 0x0] 17:04:51 INFO - ++DOMWINDOW == 33 (0x127b00800) [pid = 1063] [serial = 2138] [outer = 0x126671000] 17:04:51 INFO - ++DOMWINDOW == 34 (0x12965a000) [pid = 1063] [serial = 2139] [outer = 0x126671000] 17:04:51 INFO - ++DOCSHELL 0x12d25b000 == 15 [pid = 1063] [id = 883] 17:04:51 INFO - ++DOMWINDOW == 35 (0x1308aac00) [pid = 1063] [serial = 2140] [outer = 0x0] 17:04:51 INFO - ++DOMWINDOW == 36 (0x1308b9000) [pid = 1063] [serial = 2141] [outer = 0x1308aac00] 17:04:53 INFO - --DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 877] 17:04:53 INFO - --DOCSHELL 0x11fbe2700 == 13 [pid = 1063] [id = 876] 17:04:53 INFO - --DOCSHELL 0x12d25b000 == 12 [pid = 1063] [id = 883] 17:04:53 INFO - --DOCSHELL 0x12c6dd300 == 11 [pid = 1063] [id = 878] 17:04:53 INFO - --DOMWINDOW == 35 (0x12c9f5800) [pid = 1063] [serial = 2121] [outer = 0x0] [url = about:blank] 17:04:53 INFO - --DOMWINDOW == 34 (0x128c2a000) [pid = 1063] [serial = 2119] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:53 INFO - --DOMWINDOW == 33 (0x127b00800) [pid = 1063] [serial = 2138] [outer = 0x0] [url = about:blank] 17:04:53 INFO - --DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 2135] [outer = 0x0] [url = about:blank] 17:04:53 INFO - --DOMWINDOW == 31 (0x120541800) [pid = 1063] [serial = 2123] [outer = 0x0] [url = about:blank] 17:04:53 INFO - --DOMWINDOW == 30 (0x12764e000) [pid = 1063] [serial = 2127] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:53 INFO - --DOMWINDOW == 29 (0x12c989000) [pid = 1063] [serial = 2130] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:53 INFO - --DOMWINDOW == 28 (0x1216c6c00) [pid = 1063] [serial = 2124] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:53 INFO - --DOMWINDOW == 27 (0x12031e800) [pid = 1063] [serial = 2122] [outer = 0x0] [url = about:blank] 17:04:53 INFO - --DOMWINDOW == 26 (0x13351f800) [pid = 1063] [serial = 2126] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:53 INFO - MEMORY STAT | vsize 3790MB | residentFast 414MB | heapAllocated 126MB 17:04:53 INFO - 409 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js | took 2415ms 17:04:53 INFO - ++DOCSHELL 0x11fbe2700 == 12 [pid = 1063] [id = 884] 17:04:53 INFO - ++DOMWINDOW == 27 (0x120538c00) [pid = 1063] [serial = 2142] [outer = 0x0] 17:04:53 INFO - ++DOMWINDOW == 28 (0x1216bac00) [pid = 1063] [serial = 2143] [outer = 0x120538c00] 17:04:53 INFO - 410 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_message_node_id.js 17:04:53 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 885] 17:04:53 INFO - ++DOMWINDOW == 29 (0x12666b000) [pid = 1063] [serial = 2144] [outer = 0x0] 17:04:53 INFO - ++DOMWINDOW == 30 (0x127f0b400) [pid = 1063] [serial = 2145] [outer = 0x12666b000] 17:04:53 INFO - ++DOMWINDOW == 31 (0x12963d000) [pid = 1063] [serial = 2146] [outer = 0x12666b000] 17:04:53 INFO - ++DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 886] 17:04:53 INFO - ++DOMWINDOW == 32 (0x127bea800) [pid = 1063] [serial = 2147] [outer = 0x0] 17:04:53 INFO - ++DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 2148] [outer = 0x127bea800] 17:04:54 INFO - ++DOMWINDOW == 34 (0x128738000) [pid = 1063] [serial = 2149] [outer = 0x127bea800] 17:04:54 INFO - ++DOCSHELL 0x12cb89b00 == 15 [pid = 1063] [id = 887] 17:04:54 INFO - ++DOMWINDOW == 35 (0x12f10ac00) [pid = 1063] [serial = 2150] [outer = 0x0] 17:04:54 INFO - ++DOMWINDOW == 36 (0x12f172800) [pid = 1063] [serial = 2151] [outer = 0x12f10ac00] 17:04:55 INFO - --DOCSHELL 0x11fbe3600 == 14 [pid = 1063] [id = 880] 17:04:55 INFO - --DOCSHELL 0x12cb89b00 == 13 [pid = 1063] [id = 887] 17:04:55 INFO - --DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 881] 17:04:55 INFO - --DOCSHELL 0x12bf3f600 == 11 [pid = 1063] [id = 882] 17:04:55 INFO - --DOMWINDOW == 35 (0x1284e0400) [pid = 1063] [serial = 2129] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:55 INFO - --DOMWINDOW == 34 (0x12c9b4800) [pid = 1063] [serial = 2131] [outer = 0x0] [url = about:blank] 17:04:55 INFO - --DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 2148] [outer = 0x0] [url = about:blank] 17:04:55 INFO - --DOMWINDOW == 32 (0x127f0b400) [pid = 1063] [serial = 2145] [outer = 0x0] [url = about:blank] 17:04:55 INFO - --DOMWINDOW == 31 (0x120917c00) [pid = 1063] [serial = 2133] [outer = 0x0] [url = about:blank] 17:04:55 INFO - --DOMWINDOW == 30 (0x1308aac00) [pid = 1063] [serial = 2140] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:55 INFO - --DOMWINDOW == 29 (0x126671000) [pid = 1063] [serial = 2137] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:55 INFO - --DOMWINDOW == 28 (0x121763000) [pid = 1063] [serial = 2134] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 17:04:55 INFO - --DOMWINDOW == 27 (0x120343400) [pid = 1063] [serial = 2132] [outer = 0x0] [url = about:blank] 17:04:55 INFO - --DOMWINDOW == 26 (0x127f0bc00) [pid = 1063] [serial = 2136] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 17:04:56 INFO - MEMORY STAT | vsize 3790MB | residentFast 413MB | heapAllocated 126MB 17:04:56 INFO - 411 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_message_node_id.js | took 2397ms 17:04:56 INFO - ++DOCSHELL 0x1201ad000 == 12 [pid = 1063] [id = 888] 17:04:56 INFO - ++DOMWINDOW == 27 (0x12082f800) [pid = 1063] [serial = 2152] [outer = 0x0] 17:04:56 INFO - ++DOMWINDOW == 28 (0x1216a2800) [pid = 1063] [serial = 2153] [outer = 0x12082f800] 17:04:56 INFO - 412 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging.js 17:04:56 INFO - ++DOCSHELL 0x129f99400 == 13 [pid = 1063] [id = 889] 17:04:56 INFO - ++DOMWINDOW == 29 (0x10a467400) [pid = 1063] [serial = 2154] [outer = 0x0] 17:04:56 INFO - ++DOMWINDOW == 30 (0x127b8b000) [pid = 1063] [serial = 2155] [outer = 0x10a467400] 17:04:56 INFO - ++DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 890] 17:04:56 INFO - ++DOMWINDOW == 31 (0x11f840c00) [pid = 1063] [serial = 2156] [outer = 0x0] 17:04:56 INFO - ++DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 2157] [outer = 0x11f840c00] 17:04:56 INFO - ++DOMWINDOW == 33 (0x128c2ac00) [pid = 1063] [serial = 2158] [outer = 0x11f840c00] 17:04:56 INFO - ++DOCSHELL 0x12c6df600 == 15 [pid = 1063] [id = 891] 17:04:56 INFO - ++DOMWINDOW == 34 (0x12df86800) [pid = 1063] [serial = 2159] [outer = 0x0] 17:04:56 INFO - ++DOMWINDOW == 35 (0x12eb47800) [pid = 1063] [serial = 2160] [outer = 0x12df86800] 17:04:57 INFO - ++DOMWINDOW == 36 (0x129f83c00) [pid = 1063] [serial = 2161] [outer = 0x10a467400] 17:04:57 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:57 INFO - ++DOMWINDOW == 37 (0x133553000) [pid = 1063] [serial = 2162] [outer = 0x10a467400] 17:04:57 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:58 INFO - ++DOMWINDOW == 38 (0x1367ed400) [pid = 1063] [serial = 2163] [outer = 0x10a467400] 17:04:58 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:04:58 INFO - ++DOCSHELL 0x1332bf300 == 16 [pid = 1063] [id = 892] 17:04:58 INFO - ++DOMWINDOW == 39 (0x136b4e400) [pid = 1063] [serial = 2164] [outer = 0x0] 17:04:58 INFO - ++DOMWINDOW == 40 (0x1370b7c00) [pid = 1063] [serial = 2165] [outer = 0x136b4e400] 17:04:58 INFO - ++DOCSHELL 0x134f99e00 == 17 [pid = 1063] [id = 893] 17:04:58 INFO - ++DOMWINDOW == 41 (0x131bc2800) [pid = 1063] [serial = 2166] [outer = 0x0] 17:04:58 INFO - ++DOMWINDOW == 42 (0x133480800) [pid = 1063] [serial = 2167] [outer = 0x131bc2800] 17:04:58 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:04:58 INFO - --DOCSHELL 0x134f99e00 == 16 [pid = 1063] [id = 893] 17:04:59 INFO - --DOCSHELL 0x11fbe2700 == 15 [pid = 1063] [id = 884] 17:04:59 INFO - --DOCSHELL 0x12c6df600 == 14 [pid = 1063] [id = 891] 17:04:59 INFO - --DOCSHELL 0x12c6ddd00 == 13 [pid = 1063] [id = 886] 17:04:59 INFO - --DOCSHELL 0x128ead000 == 12 [pid = 1063] [id = 885] 17:04:59 INFO - --DOCSHELL 0x1332bf300 == 11 [pid = 1063] [id = 892] 17:04:59 INFO - --DOMWINDOW == 41 (0x1308b9000) [pid = 1063] [serial = 2141] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 40 (0x12965a000) [pid = 1063] [serial = 2139] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:59 INFO - --DOMWINDOW == 39 (0x127bea800) [pid = 1063] [serial = 2147] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:04:59 INFO - --DOMWINDOW == 38 (0x12f10ac00) [pid = 1063] [serial = 2150] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:04:59 INFO - --DOMWINDOW == 37 (0x12666b000) [pid = 1063] [serial = 2144] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:04:59 INFO - --DOMWINDOW == 36 (0x120538c00) [pid = 1063] [serial = 2142] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 35 (0x1216bac00) [pid = 1063] [serial = 2143] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 34 (0x127274800) [pid = 1063] [serial = 2157] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 33 (0x131bc2800) [pid = 1063] [serial = 2166] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 32 (0x133480800) [pid = 1063] [serial = 2167] [outer = 0x0] [url = about:blank] 17:04:59 INFO - --DOMWINDOW == 31 (0x129f83c00) [pid = 1063] [serial = 2161] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:04:59 INFO - --DOMWINDOW == 30 (0x12963d000) [pid = 1063] [serial = 2146] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:05:00 INFO - MEMORY STAT | vsize 3787MB | residentFast 412MB | heapAllocated 128MB 17:05:00 INFO - 413 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging.js | took 3863ms 17:05:00 INFO - ++DOCSHELL 0x1201af300 == 12 [pid = 1063] [id = 894] 17:05:00 INFO - ++DOMWINDOW == 31 (0x12031e800) [pid = 1063] [serial = 2168] [outer = 0x0] 17:05:00 INFO - ++DOMWINDOW == 32 (0x120541800) [pid = 1063] [serial = 2169] [outer = 0x12031e800] 17:05:00 INFO - 414 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js 17:05:00 INFO - ++DOCSHELL 0x12bb2f800 == 13 [pid = 1063] [id = 895] 17:05:00 INFO - ++DOMWINDOW == 33 (0x12054bc00) [pid = 1063] [serial = 2170] [outer = 0x0] 17:05:00 INFO - ++DOMWINDOW == 34 (0x121763000) [pid = 1063] [serial = 2171] [outer = 0x12054bc00] 17:05:00 INFO - ++DOCSHELL 0x12c6dc900 == 14 [pid = 1063] [id = 896] 17:05:00 INFO - ++DOMWINDOW == 35 (0x121747c00) [pid = 1063] [serial = 2172] [outer = 0x0] 17:05:00 INFO - ++DOMWINDOW == 36 (0x127bea800) [pid = 1063] [serial = 2173] [outer = 0x121747c00] 17:05:00 INFO - ++DOMWINDOW == 37 (0x127f0b400) [pid = 1063] [serial = 2174] [outer = 0x121747c00] 17:05:00 INFO - ++DOCSHELL 0x1201fd600 == 15 [pid = 1063] [id = 897] 17:05:00 INFO - ++DOMWINDOW == 38 (0x1216c6c00) [pid = 1063] [serial = 2175] [outer = 0x0] 17:05:00 INFO - ++DOMWINDOW == 39 (0x121cbac00) [pid = 1063] [serial = 2176] [outer = 0x1216c6c00] 17:05:01 INFO - ++DOMWINDOW == 40 (0x12965a000) [pid = 1063] [serial = 2177] [outer = 0x12054bc00] 17:05:01 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:05:02 INFO - ++DOCSHELL 0x12e038700 == 16 [pid = 1063] [id = 898] 17:05:02 INFO - ++DOMWINDOW == 41 (0x1333a2400) [pid = 1063] [serial = 2178] [outer = 0x0] 17:05:02 INFO - ++DOMWINDOW == 42 (0x1333b6000) [pid = 1063] [serial = 2179] [outer = 0x1333a2400] 17:05:02 INFO - ++DOCSHELL 0x12e039600 == 17 [pid = 1063] [id = 899] 17:05:02 INFO - ++DOMWINDOW == 43 (0x137312400) [pid = 1063] [serial = 2180] [outer = 0x0] 17:05:02 INFO - ++DOMWINDOW == 44 (0x133e28800) [pid = 1063] [serial = 2181] [outer = 0x137312400] 17:05:02 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:05:02 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:05:02 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:05:03 INFO - --DOCSHELL 0x12e039600 == 16 [pid = 1063] [id = 899] 17:05:03 INFO - --DOCSHELL 0x12bb31600 == 15 [pid = 1063] [id = 890] 17:05:03 INFO - --DOCSHELL 0x1201fd600 == 14 [pid = 1063] [id = 897] 17:05:03 INFO - --DOCSHELL 0x1201ad000 == 13 [pid = 1063] [id = 888] 17:05:03 INFO - --DOCSHELL 0x129f99400 == 12 [pid = 1063] [id = 889] 17:05:03 INFO - --DOCSHELL 0x12e038700 == 11 [pid = 1063] [id = 898] 17:05:03 INFO - --DOMWINDOW == 43 (0x128738000) [pid = 1063] [serial = 2149] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:03 INFO - --DOMWINDOW == 42 (0x12f172800) [pid = 1063] [serial = 2151] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 41 (0x10a467400) [pid = 1063] [serial = 2154] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:05:04 INFO - --DOMWINDOW == 40 (0x11f840c00) [pid = 1063] [serial = 2156] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:04 INFO - --DOMWINDOW == 39 (0x127b8b000) [pid = 1063] [serial = 2155] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 38 (0x127bea800) [pid = 1063] [serial = 2173] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 37 (0x1216a2800) [pid = 1063] [serial = 2153] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 36 (0x12082f800) [pid = 1063] [serial = 2152] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 35 (0x12df86800) [pid = 1063] [serial = 2159] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:04 INFO - --DOMWINDOW == 34 (0x136b4e400) [pid = 1063] [serial = 2164] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 17:05:04 INFO - --DOMWINDOW == 33 (0x133e28800) [pid = 1063] [serial = 2181] [outer = 0x0] [url = about:blank] 17:05:04 INFO - --DOMWINDOW == 32 (0x137312400) [pid = 1063] [serial = 2180] [outer = 0x0] [url = about:blank] 17:05:04 INFO - MEMORY STAT | vsize 3790MB | residentFast 415MB | heapAllocated 128MB 17:05:04 INFO - 415 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js | took 3997ms 17:05:04 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 900] 17:05:04 INFO - ++DOMWINDOW == 33 (0x1216a2800) [pid = 1063] [serial = 2182] [outer = 0x0] 17:05:04 INFO - ++DOMWINDOW == 34 (0x12666b000) [pid = 1063] [serial = 2183] [outer = 0x1216a2800] 17:05:04 INFO - 416 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_notifications.js 17:05:04 INFO - ++DOCSHELL 0x129f9b200 == 13 [pid = 1063] [id = 901] 17:05:04 INFO - ++DOMWINDOW == 35 (0x10a467400) [pid = 1063] [serial = 2184] [outer = 0x0] 17:05:04 INFO - ++DOMWINDOW == 36 (0x127f0bc00) [pid = 1063] [serial = 2185] [outer = 0x10a467400] 17:05:04 INFO - ++DOCSHELL 0x12c6dd800 == 14 [pid = 1063] [id = 902] 17:05:04 INFO - ++DOMWINDOW == 37 (0x1276eb400) [pid = 1063] [serial = 2186] [outer = 0x0] 17:05:04 INFO - ++DOMWINDOW == 38 (0x12963d400) [pid = 1063] [serial = 2187] [outer = 0x1276eb400] 17:05:04 INFO - ++DOMWINDOW == 39 (0x128c2a000) [pid = 1063] [serial = 2188] [outer = 0x1276eb400] 17:05:04 INFO - ++DOCSHELL 0x12d52ed00 == 15 [pid = 1063] [id = 903] 17:05:04 INFO - ++DOMWINDOW == 40 (0x12f15d000) [pid = 1063] [serial = 2189] [outer = 0x0] 17:05:04 INFO - ++DOMWINDOW == 41 (0x12f15d800) [pid = 1063] [serial = 2190] [outer = 0x12f15d000] 17:05:06 INFO - --DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 895] 17:05:06 INFO - --DOCSHELL 0x12c6dc900 == 13 [pid = 1063] [id = 896] 17:05:06 INFO - --DOCSHELL 0x12d52ed00 == 12 [pid = 1063] [id = 903] 17:05:06 INFO - --DOMWINDOW == 40 (0x12eb47800) [pid = 1063] [serial = 2160] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 39 (0x128c2ac00) [pid = 1063] [serial = 2158] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:06 INFO - --DOMWINDOW == 38 (0x1370b7c00) [pid = 1063] [serial = 2165] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 37 (0x133553000) [pid = 1063] [serial = 2162] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:05:06 INFO - --DOMWINDOW == 36 (0x1367ed400) [pid = 1063] [serial = 2163] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:05:06 INFO - --DOMWINDOW == 35 (0x121763000) [pid = 1063] [serial = 2171] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 34 (0x120541800) [pid = 1063] [serial = 2169] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 33 (0x12963d400) [pid = 1063] [serial = 2187] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 32 (0x121747c00) [pid = 1063] [serial = 2172] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:06 INFO - --DOMWINDOW == 31 (0x1216c6c00) [pid = 1063] [serial = 2175] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:06 INFO - --DOMWINDOW == 30 (0x12054bc00) [pid = 1063] [serial = 2170] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 17:05:06 INFO - --DOMWINDOW == 29 (0x12031e800) [pid = 1063] [serial = 2168] [outer = 0x0] [url = about:blank] 17:05:06 INFO - --DOMWINDOW == 28 (0x1333a2400) [pid = 1063] [serial = 2178] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 17:05:06 INFO - --DOMWINDOW == 27 (0x12965a000) [pid = 1063] [serial = 2177] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 17:05:06 INFO - MEMORY STAT | vsize 3788MB | residentFast 413MB | heapAllocated 127MB 17:05:06 INFO - 417 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_notifications.js | took 2276ms 17:05:06 INFO - ++DOCSHELL 0x11fbe2700 == 13 [pid = 1063] [id = 904] 17:05:06 INFO - ++DOMWINDOW == 28 (0x120538c00) [pid = 1063] [serial = 2191] [outer = 0x0] 17:05:06 INFO - ++DOMWINDOW == 29 (0x1209c4c00) [pid = 1063] [serial = 2192] [outer = 0x120538c00] 17:05:06 INFO - 418 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js 17:05:06 INFO - ++DOCSHELL 0x129ea7700 == 14 [pid = 1063] [id = 905] 17:05:06 INFO - ++DOMWINDOW == 30 (0x127b00800) [pid = 1063] [serial = 2193] [outer = 0x0] 17:05:06 INFO - ++DOMWINDOW == 31 (0x1284e0400) [pid = 1063] [serial = 2194] [outer = 0x127b00800] 17:05:06 INFO - ++DOMWINDOW == 32 (0x1297a0800) [pid = 1063] [serial = 2195] [outer = 0x127b00800] 17:05:07 INFO - ++DOCSHELL 0x12c6df100 == 15 [pid = 1063] [id = 906] 17:05:07 INFO - ++DOMWINDOW == 33 (0x129900400) [pid = 1063] [serial = 2196] [outer = 0x0] 17:05:07 INFO - ++DOMWINDOW == 34 (0x129932400) [pid = 1063] [serial = 2197] [outer = 0x129900400] 17:05:07 INFO - ++DOMWINDOW == 35 (0x127f4e800) [pid = 1063] [serial = 2198] [outer = 0x129900400] 17:05:07 INFO - ++DOCSHELL 0x12d25b500 == 16 [pid = 1063] [id = 907] 17:05:07 INFO - ++DOMWINDOW == 36 (0x12f172800) [pid = 1063] [serial = 2199] [outer = 0x0] 17:05:07 INFO - ++DOMWINDOW == 37 (0x1308a7000) [pid = 1063] [serial = 2200] [outer = 0x12f172800] 17:05:08 INFO - --DOCSHELL 0x1201af300 == 15 [pid = 1063] [id = 894] 17:05:08 INFO - --DOCSHELL 0x129f9b200 == 14 [pid = 1063] [id = 901] 17:05:08 INFO - --DOCSHELL 0x12c6dd800 == 13 [pid = 1063] [id = 902] 17:05:08 INFO - --DOCSHELL 0x12d25b500 == 12 [pid = 1063] [id = 907] 17:05:08 INFO - --DOCSHELL 0x11fbe3600 == 11 [pid = 1063] [id = 900] 17:05:08 INFO - --DOMWINDOW == 36 (0x121cbac00) [pid = 1063] [serial = 2176] [outer = 0x0] [url = about:blank] 17:05:08 INFO - --DOMWINDOW == 35 (0x127f0b400) [pid = 1063] [serial = 2174] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:08 INFO - --DOMWINDOW == 34 (0x1333b6000) [pid = 1063] [serial = 2179] [outer = 0x0] [url = about:blank] 17:05:09 INFO - --DOMWINDOW == 33 (0x1284e0400) [pid = 1063] [serial = 2194] [outer = 0x0] [url = about:blank] 17:05:09 INFO - --DOMWINDOW == 32 (0x127f0bc00) [pid = 1063] [serial = 2185] [outer = 0x0] [url = about:blank] 17:05:09 INFO - --DOMWINDOW == 31 (0x12666b000) [pid = 1063] [serial = 2183] [outer = 0x0] [url = about:blank] 17:05:09 INFO - --DOMWINDOW == 30 (0x129932400) [pid = 1063] [serial = 2197] [outer = 0x0] [url = about:blank] 17:05:09 INFO - --DOMWINDOW == 29 (0x12f15d000) [pid = 1063] [serial = 2189] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:09 INFO - --DOMWINDOW == 28 (0x1276eb400) [pid = 1063] [serial = 2186] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:09 INFO - --DOMWINDOW == 27 (0x10a467400) [pid = 1063] [serial = 2184] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20notifications] 17:05:09 INFO - --DOMWINDOW == 26 (0x1216a2800) [pid = 1063] [serial = 2182] [outer = 0x0] [url = about:blank] 17:05:09 INFO - MEMORY STAT | vsize 3788MB | residentFast 413MB | heapAllocated 126MB 17:05:09 INFO - 419 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js | took 2464ms 17:05:09 INFO - ++DOCSHELL 0x11fbe3600 == 12 [pid = 1063] [id = 908] 17:05:09 INFO - ++DOMWINDOW == 27 (0x120541800) [pid = 1063] [serial = 2201] [outer = 0x0] 17:05:09 INFO - ++DOMWINDOW == 28 (0x1216a2800) [pid = 1063] [serial = 2202] [outer = 0x120541800] 17:05:09 INFO - 420 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_01.js 17:05:09 INFO - ++DOCSHELL 0x128ead000 == 13 [pid = 1063] [id = 909] 17:05:09 INFO - ++DOMWINDOW == 29 (0x1216bac00) [pid = 1063] [serial = 2203] [outer = 0x0] 17:05:09 INFO - ++DOMWINDOW == 30 (0x1276eb400) [pid = 1063] [serial = 2204] [outer = 0x1216bac00] 17:05:09 INFO - ++DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 910] 17:05:09 INFO - ++DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 2205] [outer = 0x0] 17:05:09 INFO - ++DOMWINDOW == 32 (0x12963d000) [pid = 1063] [serial = 2206] [outer = 0x127274800] 17:05:09 INFO - ++DOMWINDOW == 33 (0x128c2ac00) [pid = 1063] [serial = 2207] [outer = 0x127274800] 17:05:09 INFO - ++DOCSHELL 0x12c822e00 == 15 [pid = 1063] [id = 911] 17:05:09 INFO - ++DOMWINDOW == 34 (0x12eb83400) [pid = 1063] [serial = 2208] [outer = 0x0] 17:05:09 INFO - ++DOMWINDOW == 35 (0x12f029400) [pid = 1063] [serial = 2209] [outer = 0x12eb83400] 17:05:12 INFO - ++DOCSHELL 0x11fbdf000 == 16 [pid = 1063] [id = 912] 17:05:12 INFO - ++DOMWINDOW == 36 (0x1373a3c00) [pid = 1063] [serial = 2210] [outer = 0x0] 17:05:12 INFO - ++DOMWINDOW == 37 (0x1373a4400) [pid = 1063] [serial = 2211] [outer = 0x1373a3c00] 17:05:14 INFO - --DOCSHELL 0x11fbe2700 == 15 [pid = 1063] [id = 904] 17:05:14 INFO - --DOCSHELL 0x12bb31600 == 14 [pid = 1063] [id = 910] 17:05:14 INFO - --DOCSHELL 0x12c822e00 == 13 [pid = 1063] [id = 911] 17:05:14 INFO - --DOCSHELL 0x12c6df100 == 12 [pid = 1063] [id = 906] 17:05:14 INFO - --DOCSHELL 0x129ea7700 == 11 [pid = 1063] [id = 905] 17:05:14 INFO - --DOCSHELL 0x11fbdf000 == 10 [pid = 1063] [id = 912] 17:05:14 INFO - --DOMWINDOW == 36 (0x128c2a000) [pid = 1063] [serial = 2188] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:14 INFO - --DOMWINDOW == 35 (0x12f15d800) [pid = 1063] [serial = 2190] [outer = 0x0] [url = about:blank] 17:05:14 INFO - --DOMWINDOW == 34 (0x1209c4c00) [pid = 1063] [serial = 2192] [outer = 0x0] [url = about:blank] 17:05:14 INFO - --DOMWINDOW == 33 (0x12963d000) [pid = 1063] [serial = 2206] [outer = 0x0] [url = about:blank] 17:05:14 INFO - --DOMWINDOW == 32 (0x1373a3c00) [pid = 1063] [serial = 2210] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:14 INFO - --DOMWINDOW == 31 (0x129900400) [pid = 1063] [serial = 2196] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:14 INFO - --DOMWINDOW == 30 (0x12f172800) [pid = 1063] [serial = 2199] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:14 INFO - --DOMWINDOW == 29 (0x120538c00) [pid = 1063] [serial = 2191] [outer = 0x0] [url = about:blank] 17:05:14 INFO - --DOMWINDOW == 28 (0x127b00800) [pid = 1063] [serial = 2193] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:05:14 INFO - --DOMWINDOW == 27 (0x1297a0800) [pid = 1063] [serial = 2195] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:05:14 INFO - MEMORY STAT | vsize 3787MB | residentFast 411MB | heapAllocated 127MB 17:05:14 INFO - 421 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_01.js | took 4977ms 17:05:14 INFO - ++DOCSHELL 0x11fbe2700 == 11 [pid = 1063] [id = 913] 17:05:14 INFO - ++DOMWINDOW == 28 (0x120065800) [pid = 1063] [serial = 2212] [outer = 0x0] 17:05:14 INFO - ++DOMWINDOW == 29 (0x120343c00) [pid = 1063] [serial = 2213] [outer = 0x120065800] 17:05:14 INFO - 422 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_02.js 17:05:14 INFO - ++DOCSHELL 0x129ea7700 == 12 [pid = 1063] [id = 914] 17:05:14 INFO - ++DOMWINDOW == 30 (0x120538c00) [pid = 1063] [serial = 2214] [outer = 0x0] 17:05:14 INFO - ++DOMWINDOW == 31 (0x121ddb400) [pid = 1063] [serial = 2215] [outer = 0x120538c00] 17:05:14 INFO - ++DOMWINDOW == 32 (0x12c8e8800) [pid = 1063] [serial = 2216] [outer = 0x120538c00] 17:05:14 INFO - ++DOCSHELL 0x12c6dec00 == 13 [pid = 1063] [id = 915] 17:05:14 INFO - ++DOMWINDOW == 33 (0x1216c6c00) [pid = 1063] [serial = 2217] [outer = 0x0] 17:05:14 INFO - ++DOMWINDOW == 34 (0x127f0b400) [pid = 1063] [serial = 2218] [outer = 0x1216c6c00] 17:05:14 INFO - ++DOMWINDOW == 35 (0x129900400) [pid = 1063] [serial = 2219] [outer = 0x1216c6c00] 17:05:15 INFO - ++DOCSHELL 0x12d4c0200 == 14 [pid = 1063] [id = 916] 17:05:15 INFO - ++DOMWINDOW == 36 (0x12d5a6800) [pid = 1063] [serial = 2220] [outer = 0x0] 17:05:15 INFO - ++DOMWINDOW == 37 (0x12d5a6c00) [pid = 1063] [serial = 2221] [outer = 0x12d5a6800] 17:05:16 INFO - ++DOCSHELL 0x131a44b00 == 15 [pid = 1063] [id = 917] 17:05:16 INFO - ++DOMWINDOW == 38 (0x13347e400) [pid = 1063] [serial = 2222] [outer = 0x0] 17:05:16 INFO - ++DOMWINDOW == 39 (0x133480800) [pid = 1063] [serial = 2223] [outer = 0x13347e400] 17:05:16 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj28 17:05:16 INFO - ++DOCSHELL 0x1349be900 == 16 [pid = 1063] [id = 918] 17:05:16 INFO - ++DOMWINDOW == 40 (0x134882400) [pid = 1063] [serial = 2224] [outer = 0x0] 17:05:16 INFO - ++DOMWINDOW == 41 (0x134882c00) [pid = 1063] [serial = 2225] [outer = 0x134882400] 17:05:16 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj31 17:05:16 INFO - ++DOCSHELL 0x13542b400 == 17 [pid = 1063] [id = 919] 17:05:16 INFO - ++DOMWINDOW == 42 (0x1355b4800) [pid = 1063] [serial = 2226] [outer = 0x0] 17:05:16 INFO - ++DOMWINDOW == 43 (0x1355bc800) [pid = 1063] [serial = 2227] [outer = 0x1355b4800] 17:05:17 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj35 17:05:17 INFO - ++DOCSHELL 0x13542c800 == 18 [pid = 1063] [id = 920] 17:05:17 INFO - ++DOMWINDOW == 44 (0x1366cd000) [pid = 1063] [serial = 2228] [outer = 0x0] 17:05:17 INFO - ++DOMWINDOW == 45 (0x1366cd400) [pid = 1063] [serial = 2229] [outer = 0x1366cd000] 17:05:17 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj39 17:05:17 INFO - ++DOCSHELL 0x12cb89600 == 19 [pid = 1063] [id = 921] 17:05:17 INFO - ++DOMWINDOW == 46 (0x136b4ec00) [pid = 1063] [serial = 2230] [outer = 0x0] 17:05:17 INFO - ++DOMWINDOW == 47 (0x136b61000) [pid = 1063] [serial = 2231] [outer = 0x136b4ec00] 17:05:17 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn203.obj43 17:05:17 INFO - ++DOCSHELL 0x13542eb00 == 20 [pid = 1063] [id = 922] 17:05:17 INFO - ++DOMWINDOW == 48 (0x1370a1400) [pid = 1063] [serial = 2232] [outer = 0x0] 17:05:17 INFO - ++DOMWINDOW == 49 (0x1370a1800) [pid = 1063] [serial = 2233] [outer = 0x1370a1400] 17:05:18 INFO - ++DOCSHELL 0x11fbe0900 == 21 [pid = 1063] [id = 923] 17:05:18 INFO - ++DOMWINDOW == 50 (0x12031e800) [pid = 1063] [serial = 2234] [outer = 0x0] 17:05:18 INFO - ++DOMWINDOW == 51 (0x12666b000) [pid = 1063] [serial = 2235] [outer = 0x12031e800] 17:05:18 INFO - ++DOCSHELL 0x12ca2d600 == 22 [pid = 1063] [id = 924] 17:05:18 INFO - ++DOMWINDOW == 52 (0x128738000) [pid = 1063] [serial = 2236] [outer = 0x0] 17:05:18 INFO - ++DOMWINDOW == 53 (0x1333b6c00) [pid = 1063] [serial = 2237] [outer = 0x128738000] 17:05:19 INFO - ++DOCSHELL 0x12e035000 == 23 [pid = 1063] [id = 925] 17:05:19 INFO - ++DOMWINDOW == 54 (0x1377e8800) [pid = 1063] [serial = 2238] [outer = 0x0] 17:05:19 INFO - ++DOMWINDOW == 55 (0x13710c400) [pid = 1063] [serial = 2239] [outer = 0x1377e8800] 17:05:19 INFO - ++DOCSHELL 0x12e039600 == 24 [pid = 1063] [id = 926] 17:05:19 INFO - ++DOMWINDOW == 56 (0x130826000) [pid = 1063] [serial = 2240] [outer = 0x0] 17:05:19 INFO - ++DOMWINDOW == 57 (0x130826c00) [pid = 1063] [serial = 2241] [outer = 0x130826000] 17:05:20 INFO - ++DOCSHELL 0x12c6db000 == 25 [pid = 1063] [id = 927] 17:05:20 INFO - ++DOMWINDOW == 58 (0x131a9e800) [pid = 1063] [serial = 2242] [outer = 0x0] 17:05:20 INFO - ++DOMWINDOW == 59 (0x131a9ec00) [pid = 1063] [serial = 2243] [outer = 0x131a9e800] 17:05:21 INFO - ++DOCSHELL 0x131a44100 == 26 [pid = 1063] [id = 928] 17:05:21 INFO - ++DOMWINDOW == 60 (0x134876c00) [pid = 1063] [serial = 2244] [outer = 0x0] 17:05:21 INFO - ++DOMWINDOW == 61 (0x134876000) [pid = 1063] [serial = 2245] [outer = 0x134876c00] 17:05:21 INFO - ++DOCSHELL 0x1334def00 == 27 [pid = 1063] [id = 929] 17:05:21 INFO - ++DOMWINDOW == 62 (0x1367eac00) [pid = 1063] [serial = 2246] [outer = 0x0] 17:05:21 INFO - ++DOMWINDOW == 63 (0x136a37800) [pid = 1063] [serial = 2247] [outer = 0x1367eac00] 17:05:22 INFO - ++DOCSHELL 0x1334e0800 == 28 [pid = 1063] [id = 930] 17:05:22 INFO - ++DOMWINDOW == 64 (0x137165800) [pid = 1063] [serial = 2248] [outer = 0x0] 17:05:22 INFO - ++DOMWINDOW == 65 (0x137165400) [pid = 1063] [serial = 2249] [outer = 0x137165800] 17:05:22 INFO - ++DOCSHELL 0x135284500 == 29 [pid = 1063] [id = 931] 17:05:22 INFO - ++DOMWINDOW == 66 (0x1538a7800) [pid = 1063] [serial = 2250] [outer = 0x0] 17:05:22 INFO - ++DOMWINDOW == 67 (0x1559e9800) [pid = 1063] [serial = 2251] [outer = 0x1538a7800] 17:05:23 INFO - --DOCSHELL 0x128ead000 == 28 [pid = 1063] [id = 909] 17:05:23 INFO - --DOCSHELL 0x11fbe3600 == 27 [pid = 1063] [id = 908] 17:05:23 INFO - --DOCSHELL 0x12c6dec00 == 26 [pid = 1063] [id = 915] 17:05:23 INFO - --DOCSHELL 0x12d4c0200 == 25 [pid = 1063] [id = 916] 17:05:23 INFO - --DOCSHELL 0x131a44b00 == 24 [pid = 1063] [id = 917] 17:05:23 INFO - --DOCSHELL 0x1349be900 == 23 [pid = 1063] [id = 918] 17:05:23 INFO - --DOCSHELL 0x13542b400 == 22 [pid = 1063] [id = 919] 17:05:23 INFO - --DOCSHELL 0x13542c800 == 21 [pid = 1063] [id = 920] 17:05:23 INFO - --DOCSHELL 0x12cb89600 == 20 [pid = 1063] [id = 921] 17:05:23 INFO - --DOCSHELL 0x13542eb00 == 19 [pid = 1063] [id = 922] 17:05:23 INFO - --DOCSHELL 0x11fbe0900 == 18 [pid = 1063] [id = 923] 17:05:23 INFO - --DOCSHELL 0x12ca2d600 == 17 [pid = 1063] [id = 924] 17:05:23 INFO - --DOCSHELL 0x12e035000 == 16 [pid = 1063] [id = 925] 17:05:23 INFO - --DOMWINDOW == 66 (0x127f4e800) [pid = 1063] [serial = 2198] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:23 INFO - --DOMWINDOW == 65 (0x1308a7000) [pid = 1063] [serial = 2200] [outer = 0x0] [url = about:blank] 17:05:23 INFO - --DOMWINDOW == 64 (0x1373a4400) [pid = 1063] [serial = 2211] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 63 (0x120541800) [pid = 1063] [serial = 2201] [outer = 0x0] [url = about:blank] 17:05:23 INFO - --DOMWINDOW == 62 (0x1216bac00) [pid = 1063] [serial = 2203] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2001] 17:05:23 INFO - --DOMWINDOW == 61 (0x1366cd000) [pid = 1063] [serial = 2228] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 60 (0x1370a1400) [pid = 1063] [serial = 2232] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 59 (0x134882400) [pid = 1063] [serial = 2224] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 58 (0x13347e400) [pid = 1063] [serial = 2222] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 57 (0x1355b4800) [pid = 1063] [serial = 2226] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 56 (0x136b4ec00) [pid = 1063] [serial = 2230] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:23 INFO - --DOMWINDOW == 55 (0x127274800) [pid = 1063] [serial = 2205] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:23 INFO - --DOMWINDOW == 54 (0x12eb83400) [pid = 1063] [serial = 2208] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:23 INFO - --DOMWINDOW == 53 (0x1216a2800) [pid = 1063] [serial = 2202] [outer = 0x0] [url = about:blank] 17:05:23 INFO - --DOMWINDOW == 52 (0x1276eb400) [pid = 1063] [serial = 2204] [outer = 0x0] [url = about:blank] 17:05:23 INFO - --DOMWINDOW == 51 (0x121ddb400) [pid = 1063] [serial = 2215] [outer = 0x0] [url = about:blank] 17:05:23 INFO - --DOMWINDOW == 50 (0x127f0b400) [pid = 1063] [serial = 2218] [outer = 0x0] [url = about:blank] 17:05:23 INFO - MEMORY STAT | vsize 3791MB | residentFast 419MB | heapAllocated 132MB 17:05:23 INFO - 423 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_02.js | took 9466ms 17:05:23 INFO - ++DOCSHELL 0x1201fb300 == 17 [pid = 1063] [id = 932] 17:05:23 INFO - ++DOMWINDOW == 51 (0x12054bc00) [pid = 1063] [serial = 2252] [outer = 0x0] 17:05:23 INFO - ++DOMWINDOW == 52 (0x1216bac00) [pid = 1063] [serial = 2253] [outer = 0x12054bc00] 17:05:24 INFO - 424 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_03.js 17:05:24 INFO - ++DOCSHELL 0x129ea8100 == 18 [pid = 1063] [id = 933] 17:05:24 INFO - ++DOMWINDOW == 53 (0x1209c4c00) [pid = 1063] [serial = 2254] [outer = 0x0] 17:05:24 INFO - ++DOMWINDOW == 54 (0x1276eb400) [pid = 1063] [serial = 2255] [outer = 0x1209c4c00] 17:05:24 INFO - ++DOMWINDOW == 55 (0x1284e0400) [pid = 1063] [serial = 2256] [outer = 0x1209c4c00] 17:05:24 INFO - ++DOCSHELL 0x12c822e00 == 19 [pid = 1063] [id = 934] 17:05:24 INFO - ++DOMWINDOW == 56 (0x127274800) [pid = 1063] [serial = 2257] [outer = 0x0] 17:05:24 INFO - ++DOMWINDOW == 57 (0x128e94000) [pid = 1063] [serial = 2258] [outer = 0x127274800] 17:05:24 INFO - ++DOMWINDOW == 58 (0x1299ea800) [pid = 1063] [serial = 2259] [outer = 0x127274800] 17:05:24 INFO - ++DOCSHELL 0x12d25ba00 == 20 [pid = 1063] [id = 935] 17:05:24 INFO - ++DOMWINDOW == 59 (0x12df86800) [pid = 1063] [serial = 2260] [outer = 0x0] 17:05:24 INFO - ++DOMWINDOW == 60 (0x12e21f800) [pid = 1063] [serial = 2261] [outer = 0x12df86800] 17:05:26 INFO - ++DOCSHELL 0x134f99e00 == 21 [pid = 1063] [id = 936] 17:05:26 INFO - ++DOMWINDOW == 61 (0x13628c800) [pid = 1063] [serial = 2262] [outer = 0x0] 17:05:26 INFO - ++DOMWINDOW == 62 (0x1362d4c00) [pid = 1063] [serial = 2263] [outer = 0x13628c800] 17:05:26 INFO - ++DOCSHELL 0x13542c300 == 22 [pid = 1063] [id = 937] 17:05:26 INFO - ++DOMWINDOW == 63 (0x13679fc00) [pid = 1063] [serial = 2264] [outer = 0x0] 17:05:26 INFO - ++DOMWINDOW == 64 (0x1367bb400) [pid = 1063] [serial = 2265] [outer = 0x13679fc00] 17:05:27 INFO - ++DOCSHELL 0x13542e600 == 23 [pid = 1063] [id = 938] 17:05:27 INFO - ++DOMWINDOW == 65 (0x136ba7000) [pid = 1063] [serial = 2266] [outer = 0x0] 17:05:27 INFO - ++DOMWINDOW == 66 (0x136ba7400) [pid = 1063] [serial = 2267] [outer = 0x136ba7000] 17:05:27 INFO - ++DOCSHELL 0x11fbe2200 == 24 [pid = 1063] [id = 939] 17:05:27 INFO - ++DOMWINDOW == 67 (0x129932400) [pid = 1063] [serial = 2268] [outer = 0x0] 17:05:27 INFO - ++DOMWINDOW == 68 (0x129932000) [pid = 1063] [serial = 2269] [outer = 0x129932400] 17:05:28 INFO - ++DOCSHELL 0x12c6ddd00 == 25 [pid = 1063] [id = 940] 17:05:28 INFO - ++DOMWINDOW == 69 (0x133eb7800) [pid = 1063] [serial = 2270] [outer = 0x0] 17:05:28 INFO - ++DOMWINDOW == 70 (0x133553400) [pid = 1063] [serial = 2271] [outer = 0x133eb7800] 17:05:29 INFO - ++DOCSHELL 0x12e035a00 == 26 [pid = 1063] [id = 941] 17:05:29 INFO - ++DOMWINDOW == 71 (0x1538a7000) [pid = 1063] [serial = 2272] [outer = 0x0] 17:05:29 INFO - ++DOMWINDOW == 72 (0x155961c00) [pid = 1063] [serial = 2273] [outer = 0x1538a7000] 17:05:29 INFO - ++DOCSHELL 0x131a42800 == 27 [pid = 1063] [id = 942] 17:05:29 INFO - ++DOMWINDOW == 73 (0x13710d400) [pid = 1063] [serial = 2274] [outer = 0x0] 17:05:29 INFO - ++DOMWINDOW == 74 (0x137063c00) [pid = 1063] [serial = 2275] [outer = 0x13710d400] 17:05:30 INFO - ++DOCSHELL 0x1332be900 == 28 [pid = 1063] [id = 943] 17:05:30 INFO - ++DOMWINDOW == 75 (0x158939c00) [pid = 1063] [serial = 2276] [outer = 0x0] 17:05:30 INFO - ++DOMWINDOW == 76 (0x158939400) [pid = 1063] [serial = 2277] [outer = 0x158939c00] 17:05:30 INFO - ++DOCSHELL 0x1332c1600 == 29 [pid = 1063] [id = 944] 17:05:30 INFO - ++DOMWINDOW == 77 (0x1367d3800) [pid = 1063] [serial = 2278] [outer = 0x0] 17:05:30 INFO - ++DOMWINDOW == 78 (0x1367d3c00) [pid = 1063] [serial = 2279] [outer = 0x1367d3800] 17:05:31 INFO - --DOCSHELL 0x11fbe2700 == 28 [pid = 1063] [id = 913] 17:05:31 INFO - --DOCSHELL 0x1334def00 == 27 [pid = 1063] [id = 929] 17:05:31 INFO - --DOCSHELL 0x12c822e00 == 26 [pid = 1063] [id = 934] 17:05:31 INFO - --DOCSHELL 0x12d25ba00 == 25 [pid = 1063] [id = 935] 17:05:31 INFO - --DOCSHELL 0x135284500 == 24 [pid = 1063] [id = 931] 17:05:31 INFO - --DOCSHELL 0x129ea7700 == 23 [pid = 1063] [id = 914] 17:05:31 INFO - --DOCSHELL 0x12e039600 == 22 [pid = 1063] [id = 926] 17:05:31 INFO - --DOCSHELL 0x12c6db000 == 21 [pid = 1063] [id = 927] 17:05:31 INFO - --DOCSHELL 0x131a44100 == 20 [pid = 1063] [id = 928] 17:05:31 INFO - --DOCSHELL 0x134f99e00 == 19 [pid = 1063] [id = 936] 17:05:31 INFO - --DOCSHELL 0x13542c300 == 18 [pid = 1063] [id = 937] 17:05:31 INFO - --DOCSHELL 0x13542e600 == 17 [pid = 1063] [id = 938] 17:05:31 INFO - --DOCSHELL 0x1334e0800 == 16 [pid = 1063] [id = 930] 17:05:31 INFO - --DOCSHELL 0x11fbe2200 == 15 [pid = 1063] [id = 939] 17:05:31 INFO - --DOCSHELL 0x12c6ddd00 == 14 [pid = 1063] [id = 940] 17:05:31 INFO - --DOCSHELL 0x12e035a00 == 13 [pid = 1063] [id = 941] 17:05:31 INFO - --DOMWINDOW == 77 (0x128c2ac00) [pid = 1063] [serial = 2207] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:31 INFO - --DOMWINDOW == 76 (0x12f029400) [pid = 1063] [serial = 2209] [outer = 0x0] [url = about:blank] 17:05:31 INFO - --DOMWINDOW == 75 (0x134882c00) [pid = 1063] [serial = 2225] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:31 INFO - --DOMWINDOW == 74 (0x136b61000) [pid = 1063] [serial = 2231] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:31 INFO - --DOMWINDOW == 73 (0x1355bc800) [pid = 1063] [serial = 2227] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:31 INFO - --DOMWINDOW == 72 (0x1370a1800) [pid = 1063] [serial = 2233] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:31 INFO - --DOMWINDOW == 71 (0x133480800) [pid = 1063] [serial = 2223] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:31 INFO - --DOMWINDOW == 70 (0x1366cd400) [pid = 1063] [serial = 2229] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 69 (0x1538a7800) [pid = 1063] [serial = 2250] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 68 (0x137165800) [pid = 1063] [serial = 2248] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 67 (0x1367eac00) [pid = 1063] [serial = 2246] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 66 (0x134876c00) [pid = 1063] [serial = 2244] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 65 (0x131a9e800) [pid = 1063] [serial = 2242] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 64 (0x130826000) [pid = 1063] [serial = 2240] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 63 (0x1377e8800) [pid = 1063] [serial = 2238] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 62 (0x128738000) [pid = 1063] [serial = 2236] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 61 (0x12031e800) [pid = 1063] [serial = 2234] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 60 (0x120065800) [pid = 1063] [serial = 2212] [outer = 0x0] [url = about:blank] 17:05:32 INFO - --DOMWINDOW == 59 (0x120538c00) [pid = 1063] [serial = 2214] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 17:05:32 INFO - --DOMWINDOW == 58 (0x133eb7800) [pid = 1063] [serial = 2270] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 57 (0x13679fc00) [pid = 1063] [serial = 2264] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 56 (0x136ba7000) [pid = 1063] [serial = 2266] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 55 (0x13628c800) [pid = 1063] [serial = 2262] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:32 INFO - --DOMWINDOW == 54 (0x12d5a6800) [pid = 1063] [serial = 2220] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:32 INFO - --DOMWINDOW == 53 (0x1216c6c00) [pid = 1063] [serial = 2217] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:32 INFO - --DOMWINDOW == 52 (0x120343c00) [pid = 1063] [serial = 2213] [outer = 0x0] [url = about:blank] 17:05:32 INFO - --DOMWINDOW == 51 (0x1276eb400) [pid = 1063] [serial = 2255] [outer = 0x0] [url = about:blank] 17:05:32 INFO - --DOMWINDOW == 50 (0x128e94000) [pid = 1063] [serial = 2258] [outer = 0x0] [url = about:blank] 17:05:32 INFO - --DOMWINDOW == 49 (0x12c8e8800) [pid = 1063] [serial = 2216] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 17:05:32 INFO - MEMORY STAT | vsize 3792MB | residentFast 420MB | heapAllocated 133MB 17:05:32 INFO - 425 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_03.js | took 8136ms 17:05:32 INFO - ++DOCSHELL 0x11fbe2c00 == 14 [pid = 1063] [id = 945] 17:05:32 INFO - ++DOMWINDOW == 50 (0x12031e800) [pid = 1063] [serial = 2280] [outer = 0x0] 17:05:32 INFO - ++DOMWINDOW == 51 (0x120538c00) [pid = 1063] [serial = 2281] [outer = 0x12031e800] 17:05:32 INFO - 426 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_04.js 17:05:32 INFO - ++DOCSHELL 0x128ead000 == 15 [pid = 1063] [id = 946] 17:05:32 INFO - ++DOMWINDOW == 52 (0x1216a2800) [pid = 1063] [serial = 2282] [outer = 0x0] 17:05:32 INFO - ++DOMWINDOW == 53 (0x127b00800) [pid = 1063] [serial = 2283] [outer = 0x1216a2800] 17:05:32 INFO - ++DOMWINDOW == 54 (0x128c2ac00) [pid = 1063] [serial = 2284] [outer = 0x1216a2800] 17:05:32 INFO - ++DOCSHELL 0x12c6dd800 == 16 [pid = 1063] [id = 947] 17:05:32 INFO - ++DOMWINDOW == 55 (0x1276eb400) [pid = 1063] [serial = 2285] [outer = 0x0] 17:05:32 INFO - ++DOMWINDOW == 56 (0x127bea800) [pid = 1063] [serial = 2286] [outer = 0x1276eb400] 17:05:32 INFO - ++DOMWINDOW == 57 (0x1299ea000) [pid = 1063] [serial = 2287] [outer = 0x1276eb400] 17:05:32 INFO - ++DOCSHELL 0x12cb89100 == 17 [pid = 1063] [id = 948] 17:05:32 INFO - ++DOMWINDOW == 58 (0x12df59800) [pid = 1063] [serial = 2288] [outer = 0x0] 17:05:32 INFO - ++DOMWINDOW == 59 (0x12df86000) [pid = 1063] [serial = 2289] [outer = 0x12df59800] 17:05:34 INFO - ++DOCSHELL 0x1334e0800 == 18 [pid = 1063] [id = 949] 17:05:34 INFO - ++DOMWINDOW == 60 (0x136385800) [pid = 1063] [serial = 2290] [outer = 0x0] 17:05:34 INFO - ++DOMWINDOW == 61 (0x136423400) [pid = 1063] [serial = 2291] [outer = 0x136385800] 17:05:34 INFO - ++DOCSHELL 0x13542eb00 == 19 [pid = 1063] [id = 950] 17:05:34 INFO - ++DOMWINDOW == 62 (0x1367d3000) [pid = 1063] [serial = 2292] [outer = 0x0] 17:05:34 INFO - ++DOMWINDOW == 63 (0x1367ed800) [pid = 1063] [serial = 2293] [outer = 0x1367d3000] 17:05:35 INFO - ++DOCSHELL 0x1355f2400 == 20 [pid = 1063] [id = 951] 17:05:35 INFO - ++DOMWINDOW == 64 (0x137063000) [pid = 1063] [serial = 2294] [outer = 0x0] 17:05:35 INFO - ++DOMWINDOW == 65 (0x137063400) [pid = 1063] [serial = 2295] [outer = 0x137063000] 17:05:35 INFO - ++DOCSHELL 0x11fbe2200 == 21 [pid = 1063] [id = 952] 17:05:35 INFO - ++DOMWINDOW == 66 (0x12965a000) [pid = 1063] [serial = 2296] [outer = 0x0] 17:05:35 INFO - ++DOMWINDOW == 67 (0x12963d400) [pid = 1063] [serial = 2297] [outer = 0x12965a000] 17:05:36 INFO - ++DOCSHELL 0x12ca29000 == 22 [pid = 1063] [id = 953] 17:05:36 INFO - ++DOMWINDOW == 68 (0x13522f000) [pid = 1063] [serial = 2298] [outer = 0x0] 17:05:36 INFO - ++DOMWINDOW == 69 (0x1355a2000) [pid = 1063] [serial = 2299] [outer = 0x13522f000] 17:05:36 INFO - ++DOCSHELL 0x12de60700 == 23 [pid = 1063] [id = 954] 17:05:36 INFO - ++DOMWINDOW == 70 (0x1538d8800) [pid = 1063] [serial = 2300] [outer = 0x0] 17:05:37 INFO - ++DOMWINDOW == 71 (0x1538d8c00) [pid = 1063] [serial = 2301] [outer = 0x1538d8800] 17:05:37 INFO - ++DOCSHELL 0x12ea32700 == 24 [pid = 1063] [id = 955] 17:05:37 INFO - ++DOMWINDOW == 72 (0x15bf80800) [pid = 1063] [serial = 2302] [outer = 0x0] 17:05:37 INFO - ++DOMWINDOW == 73 (0x15bdc6400) [pid = 1063] [serial = 2303] [outer = 0x15bf80800] 17:05:37 INFO - ++DOCSHELL 0x131a42d00 == 25 [pid = 1063] [id = 956] 17:05:37 INFO - ++DOMWINDOW == 74 (0x134f79c00) [pid = 1063] [serial = 2304] [outer = 0x0] 17:05:37 INFO - ++DOMWINDOW == 75 (0x134f95000) [pid = 1063] [serial = 2305] [outer = 0x134f79c00] 17:05:39 INFO - --DOCSHELL 0x1201fb300 == 24 [pid = 1063] [id = 932] 17:05:39 INFO - --DOCSHELL 0x129ea8100 == 23 [pid = 1063] [id = 933] 17:05:39 INFO - --DOCSHELL 0x12c6dd800 == 22 [pid = 1063] [id = 947] 17:05:39 INFO - --DOCSHELL 0x12cb89100 == 21 [pid = 1063] [id = 948] 17:05:39 INFO - --DOCSHELL 0x131a42800 == 20 [pid = 1063] [id = 942] 17:05:39 INFO - --DOCSHELL 0x1334e0800 == 19 [pid = 1063] [id = 949] 17:05:39 INFO - --DOCSHELL 0x1332c1600 == 18 [pid = 1063] [id = 944] 17:05:39 INFO - --DOCSHELL 0x13542eb00 == 17 [pid = 1063] [id = 950] 17:05:39 INFO - --DOCSHELL 0x1355f2400 == 16 [pid = 1063] [id = 951] 17:05:39 INFO - --DOCSHELL 0x11fbe2200 == 15 [pid = 1063] [id = 952] 17:05:39 INFO - --DOCSHELL 0x1332be900 == 14 [pid = 1063] [id = 943] 17:05:39 INFO - --DOCSHELL 0x12ca29000 == 13 [pid = 1063] [id = 953] 17:05:39 INFO - --DOCSHELL 0x12de60700 == 12 [pid = 1063] [id = 954] 17:05:39 INFO - --DOMWINDOW == 74 (0x129900400) [pid = 1063] [serial = 2219] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:39 INFO - --DOMWINDOW == 73 (0x12d5a6c00) [pid = 1063] [serial = 2221] [outer = 0x0] [url = about:blank] 17:05:39 INFO - --DOMWINDOW == 72 (0x1367bb400) [pid = 1063] [serial = 2265] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 71 (0x136ba7400) [pid = 1063] [serial = 2267] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 70 (0x1362d4c00) [pid = 1063] [serial = 2263] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 69 (0x133553400) [pid = 1063] [serial = 2271] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 68 (0x1559e9800) [pid = 1063] [serial = 2251] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 67 (0x137165400) [pid = 1063] [serial = 2249] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 66 (0x136a37800) [pid = 1063] [serial = 2247] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 65 (0x134876000) [pid = 1063] [serial = 2245] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 64 (0x131a9ec00) [pid = 1063] [serial = 2243] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 63 (0x130826c00) [pid = 1063] [serial = 2241] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 62 (0x13710c400) [pid = 1063] [serial = 2239] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 61 (0x1333b6c00) [pid = 1063] [serial = 2237] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 60 (0x12666b000) [pid = 1063] [serial = 2235] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 59 (0x1367d3800) [pid = 1063] [serial = 2278] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 58 (0x158939c00) [pid = 1063] [serial = 2276] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 57 (0x13710d400) [pid = 1063] [serial = 2274] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 56 (0x1538a7000) [pid = 1063] [serial = 2272] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 55 (0x129932400) [pid = 1063] [serial = 2268] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 54 (0x12df86800) [pid = 1063] [serial = 2260] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:39 INFO - --DOMWINDOW == 53 (0x12054bc00) [pid = 1063] [serial = 2252] [outer = 0x0] [url = about:blank] 17:05:39 INFO - --DOMWINDOW == 52 (0x1209c4c00) [pid = 1063] [serial = 2254] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 17:05:39 INFO - --DOMWINDOW == 51 (0x1216bac00) [pid = 1063] [serial = 2253] [outer = 0x0] [url = about:blank] 17:05:39 INFO - --DOMWINDOW == 50 (0x127b00800) [pid = 1063] [serial = 2283] [outer = 0x0] [url = about:blank] 17:05:39 INFO - --DOMWINDOW == 49 (0x127bea800) [pid = 1063] [serial = 2286] [outer = 0x0] [url = about:blank] 17:05:39 INFO - --DOMWINDOW == 48 (0x137063000) [pid = 1063] [serial = 2294] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 47 (0x127274800) [pid = 1063] [serial = 2257] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:39 INFO - --DOMWINDOW == 46 (0x136385800) [pid = 1063] [serial = 2290] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 45 (0x1367d3000) [pid = 1063] [serial = 2292] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:39 INFO - --DOMWINDOW == 44 (0x1284e0400) [pid = 1063] [serial = 2256] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 17:05:39 INFO - MEMORY STAT | vsize 3792MB | residentFast 421MB | heapAllocated 132MB 17:05:39 INFO - 427 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_04.js | took 6987ms 17:05:39 INFO - ++DOCSHELL 0x1201b0200 == 13 [pid = 1063] [id = 957] 17:05:39 INFO - ++DOMWINDOW == 45 (0x1205f8400) [pid = 1063] [serial = 2306] [outer = 0x0] 17:05:39 INFO - ++DOMWINDOW == 46 (0x1216bac00) [pid = 1063] [serial = 2307] [outer = 0x1205f8400] 17:05:39 INFO - 428 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_05.js 17:05:39 INFO - ++DOCSHELL 0x1285b2500 == 14 [pid = 1063] [id = 958] 17:05:39 INFO - ++DOMWINDOW == 47 (0x1209c4c00) [pid = 1063] [serial = 2308] [outer = 0x0] 17:05:39 INFO - ++DOMWINDOW == 48 (0x127b00800) [pid = 1063] [serial = 2309] [outer = 0x1209c4c00] 17:05:39 INFO - ++DOCSHELL 0x12bf3f600 == 15 [pid = 1063] [id = 959] 17:05:39 INFO - ++DOMWINDOW == 49 (0x127274800) [pid = 1063] [serial = 2310] [outer = 0x0] 17:05:39 INFO - ++DOMWINDOW == 50 (0x128696c00) [pid = 1063] [serial = 2311] [outer = 0x127274800] 17:05:39 INFO - ++DOMWINDOW == 51 (0x12963d000) [pid = 1063] [serial = 2312] [outer = 0x127274800] 17:05:39 INFO - ++DOCSHELL 0x12c6df600 == 16 [pid = 1063] [id = 960] 17:05:39 INFO - ++DOMWINDOW == 52 (0x12d5a6800) [pid = 1063] [serial = 2313] [outer = 0x0] 17:05:39 INFO - ++DOMWINDOW == 53 (0x12d5a6c00) [pid = 1063] [serial = 2314] [outer = 0x12d5a6800] 17:05:41 INFO - ++DOCSHELL 0x12e036400 == 17 [pid = 1063] [id = 961] 17:05:41 INFO - ++DOMWINDOW == 54 (0x12a12cc00) [pid = 1063] [serial = 2315] [outer = 0x0] 17:05:41 INFO - ++DOMWINDOW == 55 (0x12a178c00) [pid = 1063] [serial = 2316] [outer = 0x12a12cc00] 17:05:41 INFO - ++DOCSHELL 0x12de60700 == 18 [pid = 1063] [id = 962] 17:05:41 INFO - ++DOMWINDOW == 56 (0x136b4ec00) [pid = 1063] [serial = 2317] [outer = 0x0] 17:05:42 INFO - ++DOMWINDOW == 57 (0x136b61000) [pid = 1063] [serial = 2318] [outer = 0x136b4ec00] 17:05:42 INFO - ++DOCSHELL 0x12d52de00 == 19 [pid = 1063] [id = 963] 17:05:42 INFO - ++DOMWINDOW == 58 (0x137062c00) [pid = 1063] [serial = 2319] [outer = 0x0] 17:05:42 INFO - ++DOMWINDOW == 59 (0x137063000) [pid = 1063] [serial = 2320] [outer = 0x137062c00] 17:05:42 INFO - ++DOCSHELL 0x13542b400 == 20 [pid = 1063] [id = 964] 17:05:42 INFO - ++DOMWINDOW == 60 (0x1538a5400) [pid = 1063] [serial = 2321] [outer = 0x0] 17:05:42 INFO - ++DOMWINDOW == 61 (0x13710d400) [pid = 1063] [serial = 2322] [outer = 0x1538a5400] 17:05:42 INFO - ++DOCSHELL 0x13542c300 == 21 [pid = 1063] [id = 965] 17:05:42 INFO - ++DOMWINDOW == 62 (0x13779e800) [pid = 1063] [serial = 2323] [outer = 0x0] 17:05:42 INFO - ++DOMWINDOW == 63 (0x1377e8800) [pid = 1063] [serial = 2324] [outer = 0x13779e800] 17:05:43 INFO - ++DOCSHELL 0x12c6dec00 == 22 [pid = 1063] [id = 966] 17:05:43 INFO - ++DOMWINDOW == 64 (0x1355b4800) [pid = 1063] [serial = 2325] [outer = 0x0] 17:05:43 INFO - ++DOMWINDOW == 65 (0x13555e000) [pid = 1063] [serial = 2326] [outer = 0x1355b4800] 17:05:44 INFO - ++DOCSHELL 0x12de5e900 == 23 [pid = 1063] [id = 967] 17:05:44 INFO - ++DOMWINDOW == 66 (0x137302c00) [pid = 1063] [serial = 2327] [outer = 0x0] 17:05:44 INFO - ++DOMWINDOW == 67 (0x158981c00) [pid = 1063] [serial = 2328] [outer = 0x137302c00] 17:05:44 INFO - ++DOCSHELL 0x130927000 == 24 [pid = 1063] [id = 968] 17:05:44 INFO - ++DOMWINDOW == 68 (0x1316c7c00) [pid = 1063] [serial = 2329] [outer = 0x0] 17:05:44 INFO - ++DOMWINDOW == 69 (0x1316c7400) [pid = 1063] [serial = 2330] [outer = 0x1316c7c00] 17:05:44 INFO - ++DOCSHELL 0x131a41e00 == 25 [pid = 1063] [id = 969] 17:05:44 INFO - ++DOMWINDOW == 70 (0x133eac000) [pid = 1063] [serial = 2331] [outer = 0x0] 17:05:44 INFO - ++DOMWINDOW == 71 (0x1332e9800) [pid = 1063] [serial = 2332] [outer = 0x133eac000] 17:05:45 INFO - ++DOCSHELL 0x131a43700 == 26 [pid = 1063] [id = 970] 17:05:45 INFO - ++DOMWINDOW == 72 (0x1351d8c00) [pid = 1063] [serial = 2333] [outer = 0x0] 17:05:45 INFO - --DOCSHELL 0x131a43700 == 25 [pid = 1063] [id = 970] 17:05:45 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:05:45 INFO - --DOMWINDOW == 71 (0x1351d8c00) [pid = 1063] [serial = 2333] [outer = 0x0] [url = ] 17:05:46 INFO - --DOCSHELL 0x12bf3f600 == 24 [pid = 1063] [id = 959] 17:05:46 INFO - --DOCSHELL 0x12c6df600 == 23 [pid = 1063] [id = 960] 17:05:46 INFO - --DOCSHELL 0x131a42d00 == 22 [pid = 1063] [id = 956] 17:05:46 INFO - --DOCSHELL 0x12e036400 == 21 [pid = 1063] [id = 961] 17:05:46 INFO - --DOCSHELL 0x11fbe2c00 == 20 [pid = 1063] [id = 945] 17:05:46 INFO - --DOCSHELL 0x12de60700 == 19 [pid = 1063] [id = 962] 17:05:46 INFO - --DOCSHELL 0x12d52de00 == 18 [pid = 1063] [id = 963] 17:05:46 INFO - --DOCSHELL 0x12ea32700 == 17 [pid = 1063] [id = 955] 17:05:46 INFO - --DOCSHELL 0x13542b400 == 16 [pid = 1063] [id = 964] 17:05:46 INFO - --DOCSHELL 0x13542c300 == 15 [pid = 1063] [id = 965] 17:05:46 INFO - --DOCSHELL 0x128ead000 == 14 [pid = 1063] [id = 946] 17:05:46 INFO - --DOCSHELL 0x12c6dec00 == 13 [pid = 1063] [id = 966] 17:05:46 INFO - --DOCSHELL 0x12de5e900 == 12 [pid = 1063] [id = 967] 17:05:46 INFO - --DOMWINDOW == 70 (0x1299ea800) [pid = 1063] [serial = 2259] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:46 INFO - --DOMWINDOW == 69 (0x12e21f800) [pid = 1063] [serial = 2261] [outer = 0x0] [url = about:blank] 17:05:46 INFO - --DOMWINDOW == 68 (0x137063400) [pid = 1063] [serial = 2295] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 67 (0x136423400) [pid = 1063] [serial = 2291] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 66 (0x1367ed800) [pid = 1063] [serial = 2293] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 65 (0x1367d3c00) [pid = 1063] [serial = 2279] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 64 (0x158939400) [pid = 1063] [serial = 2277] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 63 (0x137063c00) [pid = 1063] [serial = 2275] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 62 (0x155961c00) [pid = 1063] [serial = 2273] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 61 (0x129932000) [pid = 1063] [serial = 2269] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 60 (0x1216a2800) [pid = 1063] [serial = 2282] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 17:05:46 INFO - --DOMWINDOW == 59 (0x134f79c00) [pid = 1063] [serial = 2304] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 58 (0x15bf80800) [pid = 1063] [serial = 2302] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 57 (0x1538d8800) [pid = 1063] [serial = 2300] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 56 (0x13522f000) [pid = 1063] [serial = 2298] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 55 (0x12965a000) [pid = 1063] [serial = 2296] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 54 (0x137062c00) [pid = 1063] [serial = 2319] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 53 (0x12a12cc00) [pid = 1063] [serial = 2315] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 52 (0x1538a5400) [pid = 1063] [serial = 2321] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 51 (0x136b4ec00) [pid = 1063] [serial = 2317] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:46 INFO - --DOMWINDOW == 50 (0x12df59800) [pid = 1063] [serial = 2288] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:46 INFO - --DOMWINDOW == 49 (0x1276eb400) [pid = 1063] [serial = 2285] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:46 INFO - --DOMWINDOW == 48 (0x12031e800) [pid = 1063] [serial = 2280] [outer = 0x0] [url = about:blank] 17:05:46 INFO - --DOMWINDOW == 47 (0x120538c00) [pid = 1063] [serial = 2281] [outer = 0x0] [url = about:blank] 17:05:46 INFO - --DOMWINDOW == 46 (0x128696c00) [pid = 1063] [serial = 2311] [outer = 0x0] [url = about:blank] 17:05:46 INFO - MEMORY STAT | vsize 3793MB | residentFast 420MB | heapAllocated 131MB 17:05:46 INFO - 429 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_05.js | took 6965ms 17:05:46 INFO - ++DOCSHELL 0x1201fcc00 == 13 [pid = 1063] [id = 971] 17:05:46 INFO - ++DOMWINDOW == 47 (0x12054bc00) [pid = 1063] [serial = 2334] [outer = 0x0] 17:05:46 INFO - ++DOMWINDOW == 48 (0x121763000) [pid = 1063] [serial = 2335] [outer = 0x12054bc00] 17:05:46 INFO - 430 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_06.js 17:05:46 INFO - ++DOCSHELL 0x12bb2f300 == 14 [pid = 1063] [id = 972] 17:05:46 INFO - ++DOMWINDOW == 49 (0x1216c6c00) [pid = 1063] [serial = 2336] [outer = 0x0] 17:05:46 INFO - ++DOMWINDOW == 50 (0x127f0bc00) [pid = 1063] [serial = 2337] [outer = 0x1216c6c00] 17:05:46 INFO - ++DOCSHELL 0x11fbdf000 == 15 [pid = 1063] [id = 973] 17:05:46 INFO - ++DOMWINDOW == 51 (0x127bea800) [pid = 1063] [serial = 2338] [outer = 0x0] 17:05:46 INFO - ++DOMWINDOW == 52 (0x128c2a000) [pid = 1063] [serial = 2339] [outer = 0x127bea800] 17:05:46 INFO - ++DOMWINDOW == 53 (0x128738000) [pid = 1063] [serial = 2340] [outer = 0x127bea800] 17:05:47 INFO - ++DOCSHELL 0x12c825600 == 16 [pid = 1063] [id = 974] 17:05:47 INFO - ++DOMWINDOW == 54 (0x12df19c00) [pid = 1063] [serial = 2341] [outer = 0x0] 17:05:47 INFO - ++DOMWINDOW == 55 (0x12df27000) [pid = 1063] [serial = 2342] [outer = 0x12df19c00] 17:05:48 INFO - ++DOCSHELL 0x131a40f00 == 17 [pid = 1063] [id = 975] 17:05:48 INFO - ++DOMWINDOW == 56 (0x12a1d4800) [pid = 1063] [serial = 2343] [outer = 0x0] 17:05:48 INFO - ++DOMWINDOW == 57 (0x12ae21400) [pid = 1063] [serial = 2344] [outer = 0x12a1d4800] 17:05:48 INFO - ++DOCSHELL 0x12de5e400 == 18 [pid = 1063] [id = 976] 17:05:48 INFO - ++DOMWINDOW == 58 (0x130ad1400) [pid = 1063] [serial = 2345] [outer = 0x0] 17:05:48 INFO - ++DOMWINDOW == 59 (0x130ad1800) [pid = 1063] [serial = 2346] [outer = 0x130ad1400] 17:05:48 INFO - ++DOCSHELL 0x1334e0800 == 19 [pid = 1063] [id = 977] 17:05:48 INFO - ++DOMWINDOW == 60 (0x134882400) [pid = 1063] [serial = 2347] [outer = 0x0] 17:05:48 INFO - ++DOMWINDOW == 61 (0x134882c00) [pid = 1063] [serial = 2348] [outer = 0x134882400] 17:05:49 INFO - ++DOCSHELL 0x13542b900 == 20 [pid = 1063] [id = 978] 17:05:49 INFO - ++DOMWINDOW == 62 (0x1367ec000) [pid = 1063] [serial = 2349] [outer = 0x0] 17:05:49 INFO - ++DOMWINDOW == 63 (0x1367ed400) [pid = 1063] [serial = 2350] [outer = 0x1367ec000] 17:05:49 INFO - ++DOCSHELL 0x12d25b000 == 21 [pid = 1063] [id = 979] 17:05:49 INFO - ++DOMWINDOW == 64 (0x137031400) [pid = 1063] [serial = 2351] [outer = 0x0] 17:05:49 INFO - ++DOMWINDOW == 65 (0x137031800) [pid = 1063] [serial = 2352] [outer = 0x137031400] 17:05:49 INFO - ++DOCSHELL 0x13542dc00 == 22 [pid = 1063] [id = 980] 17:05:49 INFO - ++DOMWINDOW == 66 (0x137063800) [pid = 1063] [serial = 2353] [outer = 0x0] 17:05:49 INFO - ++DOMWINDOW == 67 (0x137063c00) [pid = 1063] [serial = 2354] [outer = 0x137063800] 17:05:50 INFO - ++DOCSHELL 0x11fbe2c00 == 23 [pid = 1063] [id = 981] 17:05:50 INFO - ++DOMWINDOW == 68 (0x1299ab800) [pid = 1063] [serial = 2355] [outer = 0x0] 17:05:50 INFO - ++DOMWINDOW == 69 (0x128ffb000) [pid = 1063] [serial = 2356] [outer = 0x1299ab800] 17:05:50 INFO - ++DOCSHELL 0x12cb85000 == 24 [pid = 1063] [id = 982] 17:05:50 INFO - ++DOMWINDOW == 70 (0x133ebc400) [pid = 1063] [serial = 2357] [outer = 0x0] 17:05:50 INFO - ++DOMWINDOW == 71 (0x13666cc00) [pid = 1063] [serial = 2358] [outer = 0x133ebc400] 17:05:51 INFO - ++DOCSHELL 0x12e035000 == 25 [pid = 1063] [id = 983] 17:05:51 INFO - ++DOMWINDOW == 72 (0x153814400) [pid = 1063] [serial = 2359] [outer = 0x0] 17:05:51 INFO - ++DOMWINDOW == 73 (0x12965a000) [pid = 1063] [serial = 2360] [outer = 0x153814400] 17:05:51 INFO - ++DOCSHELL 0x12ea31300 == 26 [pid = 1063] [id = 984] 17:05:51 INFO - ++DOMWINDOW == 74 (0x131bc7c00) [pid = 1063] [serial = 2361] [outer = 0x0] 17:05:51 INFO - ++DOMWINDOW == 75 (0x1538c8000) [pid = 1063] [serial = 2362] [outer = 0x131bc7c00] 17:05:51 INFO - ++DOCSHELL 0x131a42d00 == 27 [pid = 1063] [id = 985] 17:05:51 INFO - ++DOMWINDOW == 76 (0x1355ae800) [pid = 1063] [serial = 2363] [outer = 0x0] 17:05:52 INFO - ++DOMWINDOW == 77 (0x1355aec00) [pid = 1063] [serial = 2364] [outer = 0x1355ae800] 17:05:52 INFO - ++DOCSHELL 0x131a9cb00 == 28 [pid = 1063] [id = 986] 17:05:52 INFO - ++DOMWINDOW == 78 (0x1373a4c00) [pid = 1063] [serial = 2365] [outer = 0x0] 17:05:52 INFO - --DOCSHELL 0x131a9cb00 == 27 [pid = 1063] [id = 986] 17:05:52 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:05:52 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 17:05:52 INFO - --DOMWINDOW == 77 (0x1373a4c00) [pid = 1063] [serial = 2365] [outer = 0x0] [url = ] 17:05:52 INFO - ++DOCSHELL 0x131b2a200 == 28 [pid = 1063] [id = 987] 17:05:52 INFO - ++DOMWINDOW == 78 (0x13770b800) [pid = 1063] [serial = 2366] [outer = 0x0] 17:05:52 INFO - --DOCSHELL 0x131b2a200 == 27 [pid = 1063] [id = 987] 17:05:52 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:05:52 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 17:05:52 INFO - --DOMWINDOW == 77 (0x13770b800) [pid = 1063] [serial = 2366] [outer = 0x0] [url = ] 17:05:53 INFO - ++DOCSHELL 0x1332be900 == 28 [pid = 1063] [id = 988] 17:05:53 INFO - ++DOMWINDOW == 78 (0x1372c9800) [pid = 1063] [serial = 2367] [outer = 0x0] 17:05:53 INFO - --DOCSHELL 0x1332be900 == 27 [pid = 1063] [id = 988] 17:05:53 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:05:53 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 17:05:53 INFO - --DOMWINDOW == 77 (0x1372c9800) [pid = 1063] [serial = 2367] [outer = 0x0] [url = ] 17:05:53 INFO - ++DOCSHELL 0x1332be900 == 28 [pid = 1063] [id = 989] 17:05:53 INFO - ++DOMWINDOW == 78 (0x137f5fc00) [pid = 1063] [serial = 2368] [outer = 0x0] 17:05:53 INFO - ++DOMWINDOW == 79 (0x136a8ec00) [pid = 1063] [serial = 2369] [outer = 0x137f5fc00] 17:05:53 INFO - ++DOCSHELL 0x134f99e00 == 29 [pid = 1063] [id = 990] 17:05:53 INFO - ++DOMWINDOW == 80 (0x15bb6b800) [pid = 1063] [serial = 2370] [outer = 0x0] 17:05:53 INFO - ++DOMWINDOW == 81 (0x12df7b000) [pid = 1063] [serial = 2371] [outer = 0x15bb6b800] 17:05:54 INFO - --DOCSHELL 0x1201b0200 == 28 [pid = 1063] [id = 957] 17:05:54 INFO - --DOCSHELL 0x11fbdf000 == 27 [pid = 1063] [id = 973] 17:05:54 INFO - --DOCSHELL 0x1285b2500 == 26 [pid = 1063] [id = 958] 17:05:54 INFO - --DOCSHELL 0x12c825600 == 25 [pid = 1063] [id = 974] 17:05:54 INFO - --DOCSHELL 0x130927000 == 24 [pid = 1063] [id = 968] 17:05:54 INFO - --DOCSHELL 0x131a40f00 == 23 [pid = 1063] [id = 975] 17:05:54 INFO - --DOCSHELL 0x12de5e400 == 22 [pid = 1063] [id = 976] 17:05:54 INFO - --DOCSHELL 0x131a41e00 == 21 [pid = 1063] [id = 969] 17:05:54 INFO - --DOCSHELL 0x1334e0800 == 20 [pid = 1063] [id = 977] 17:05:54 INFO - --DOCSHELL 0x13542b900 == 19 [pid = 1063] [id = 978] 17:05:54 INFO - --DOCSHELL 0x12d25b000 == 18 [pid = 1063] [id = 979] 17:05:54 INFO - --DOCSHELL 0x13542dc00 == 17 [pid = 1063] [id = 980] 17:05:54 INFO - --DOCSHELL 0x11fbe2c00 == 16 [pid = 1063] [id = 981] 17:05:54 INFO - --DOCSHELL 0x12cb85000 == 15 [pid = 1063] [id = 982] 17:05:54 INFO - --DOCSHELL 0x12e035000 == 14 [pid = 1063] [id = 983] 17:05:54 INFO - --DOMWINDOW == 80 (0x1299ea000) [pid = 1063] [serial = 2287] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:54 INFO - --DOMWINDOW == 79 (0x12df86000) [pid = 1063] [serial = 2289] [outer = 0x0] [url = about:blank] 17:05:54 INFO - --DOMWINDOW == 78 (0x128c2ac00) [pid = 1063] [serial = 2284] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 17:05:54 INFO - --DOMWINDOW == 77 (0x12a178c00) [pid = 1063] [serial = 2316] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 76 (0x13710d400) [pid = 1063] [serial = 2322] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 75 (0x136b61000) [pid = 1063] [serial = 2318] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 74 (0x137063000) [pid = 1063] [serial = 2320] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 73 (0x134f95000) [pid = 1063] [serial = 2305] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 72 (0x15bdc6400) [pid = 1063] [serial = 2303] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 71 (0x1538d8c00) [pid = 1063] [serial = 2301] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 70 (0x1355a2000) [pid = 1063] [serial = 2299] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:54 INFO - --DOMWINDOW == 69 (0x12963d400) [pid = 1063] [serial = 2297] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 68 (0x133eac000) [pid = 1063] [serial = 2331] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 67 (0x1316c7c00) [pid = 1063] [serial = 2329] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 66 (0x137302c00) [pid = 1063] [serial = 2327] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 65 (0x1355b4800) [pid = 1063] [serial = 2325] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 64 (0x13779e800) [pid = 1063] [serial = 2323] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 63 (0x12d5a6800) [pid = 1063] [serial = 2313] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:55 INFO - --DOMWINDOW == 62 (0x127274800) [pid = 1063] [serial = 2310] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:55 INFO - --DOMWINDOW == 61 (0x1205f8400) [pid = 1063] [serial = 2306] [outer = 0x0] [url = about:blank] 17:05:55 INFO - --DOMWINDOW == 60 (0x1209c4c00) [pid = 1063] [serial = 2308] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2005] 17:05:55 INFO - --DOMWINDOW == 59 (0x128c2a000) [pid = 1063] [serial = 2339] [outer = 0x0] [url = about:blank] 17:05:55 INFO - --DOMWINDOW == 58 (0x137031400) [pid = 1063] [serial = 2351] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 57 (0x130ad1400) [pid = 1063] [serial = 2345] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 56 (0x12a1d4800) [pid = 1063] [serial = 2343] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 55 (0x1367ec000) [pid = 1063] [serial = 2349] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 54 (0x137063800) [pid = 1063] [serial = 2353] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 53 (0x134882400) [pid = 1063] [serial = 2347] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:55 INFO - --DOMWINDOW == 52 (0x1216bac00) [pid = 1063] [serial = 2307] [outer = 0x0] [url = about:blank] 17:05:55 INFO - MEMORY STAT | vsize 3790MB | residentFast 419MB | heapAllocated 132MB 17:05:55 INFO - 431 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_06.js | took 8610ms 17:05:55 INFO - ++DOCSHELL 0x11fbe3600 == 15 [pid = 1063] [id = 991] 17:05:55 INFO - ++DOMWINDOW == 53 (0x1205f8400) [pid = 1063] [serial = 2372] [outer = 0x0] 17:05:55 INFO - ++DOMWINDOW == 54 (0x121747c00) [pid = 1063] [serial = 2373] [outer = 0x1205f8400] 17:05:55 INFO - 432 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js 17:05:55 INFO - ++DOCSHELL 0x129f9b200 == 16 [pid = 1063] [id = 992] 17:05:55 INFO - ++DOMWINDOW == 55 (0x1216bac00) [pid = 1063] [serial = 2374] [outer = 0x0] 17:05:55 INFO - ++DOMWINDOW == 56 (0x127f4e800) [pid = 1063] [serial = 2375] [outer = 0x1216bac00] 17:05:55 INFO - ++DOCSHELL 0x121c23e00 == 17 [pid = 1063] [id = 993] 17:05:55 INFO - ++DOMWINDOW == 57 (0x127b8b000) [pid = 1063] [serial = 2376] [outer = 0x0] 17:05:55 INFO - ++DOMWINDOW == 58 (0x128e94000) [pid = 1063] [serial = 2377] [outer = 0x127b8b000] 17:05:55 INFO - ++DOMWINDOW == 59 (0x128c2ac00) [pid = 1063] [serial = 2378] [outer = 0x127b8b000] 17:05:55 INFO - ++DOCSHELL 0x12c825600 == 18 [pid = 1063] [id = 994] 17:05:55 INFO - ++DOMWINDOW == 60 (0x12df27800) [pid = 1063] [serial = 2379] [outer = 0x0] 17:05:55 INFO - ++DOMWINDOW == 61 (0x12df27c00) [pid = 1063] [serial = 2380] [outer = 0x12df27800] 17:05:57 INFO - --DOCSHELL 0x12bb2f300 == 17 [pid = 1063] [id = 972] 17:05:57 INFO - --DOCSHELL 0x1332be900 == 16 [pid = 1063] [id = 989] 17:05:57 INFO - --DOCSHELL 0x12c825600 == 15 [pid = 1063] [id = 994] 17:05:57 INFO - --DOCSHELL 0x12ea31300 == 14 [pid = 1063] [id = 984] 17:05:57 INFO - --DOCSHELL 0x134f99e00 == 13 [pid = 1063] [id = 990] 17:05:57 INFO - --DOCSHELL 0x131a42d00 == 12 [pid = 1063] [id = 985] 17:05:57 INFO - --DOCSHELL 0x1201fcc00 == 11 [pid = 1063] [id = 971] 17:05:57 INFO - --DOMWINDOW == 60 (0x12d5a6c00) [pid = 1063] [serial = 2314] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 59 (0x12963d000) [pid = 1063] [serial = 2312] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:57 INFO - --DOMWINDOW == 58 (0x1332e9800) [pid = 1063] [serial = 2332] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 57 (0x1316c7400) [pid = 1063] [serial = 2330] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 56 (0x158981c00) [pid = 1063] [serial = 2328] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 55 (0x13555e000) [pid = 1063] [serial = 2326] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 54 (0x1377e8800) [pid = 1063] [serial = 2324] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 53 (0x137031800) [pid = 1063] [serial = 2352] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 52 (0x127b00800) [pid = 1063] [serial = 2309] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 51 (0x130ad1800) [pid = 1063] [serial = 2346] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 50 (0x12ae21400) [pid = 1063] [serial = 2344] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 49 (0x1367ed400) [pid = 1063] [serial = 2350] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 48 (0x137063c00) [pid = 1063] [serial = 2354] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 47 (0x134882c00) [pid = 1063] [serial = 2348] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 46 (0x15bb6b800) [pid = 1063] [serial = 2370] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 45 (0x137f5fc00) [pid = 1063] [serial = 2368] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 44 (0x1355ae800) [pid = 1063] [serial = 2363] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 43 (0x131bc7c00) [pid = 1063] [serial = 2361] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 42 (0x153814400) [pid = 1063] [serial = 2359] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 41 (0x133ebc400) [pid = 1063] [serial = 2357] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 40 (0x1299ab800) [pid = 1063] [serial = 2355] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:05:57 INFO - --DOMWINDOW == 39 (0x12df19c00) [pid = 1063] [serial = 2341] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:05:57 INFO - --DOMWINDOW == 38 (0x1216c6c00) [pid = 1063] [serial = 2336] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2006] 17:05:57 INFO - --DOMWINDOW == 37 (0x12054bc00) [pid = 1063] [serial = 2334] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 36 (0x127f0bc00) [pid = 1063] [serial = 2337] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 35 (0x121763000) [pid = 1063] [serial = 2335] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 34 (0x128e94000) [pid = 1063] [serial = 2377] [outer = 0x0] [url = about:blank] 17:05:57 INFO - --DOMWINDOW == 33 (0x127bea800) [pid = 1063] [serial = 2338] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:05:57 INFO - MEMORY STAT | vsize 3788MB | residentFast 413MB | heapAllocated 129MB 17:05:57 INFO - 433 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js | took 2447ms 17:05:57 INFO - ++DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 995] 17:05:57 INFO - ++DOMWINDOW == 34 (0x1216a2800) [pid = 1063] [serial = 2381] [outer = 0x0] 17:05:57 INFO - ++DOMWINDOW == 35 (0x121cbac00) [pid = 1063] [serial = 2382] [outer = 0x1216a2800] 17:05:57 INFO - 434 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js 17:05:57 INFO - ++DOCSHELL 0x12c6db500 == 13 [pid = 1063] [id = 996] 17:05:57 INFO - ++DOMWINDOW == 36 (0x121ddb400) [pid = 1063] [serial = 2383] [outer = 0x0] 17:05:57 INFO - ++DOMWINDOW == 37 (0x127f0bc00) [pid = 1063] [serial = 2384] [outer = 0x121ddb400] 17:05:58 INFO - ++DOMWINDOW == 38 (0x129900400) [pid = 1063] [serial = 2385] [outer = 0x121ddb400] 17:05:58 INFO - ++DOCSHELL 0x1201b0200 == 14 [pid = 1063] [id = 997] 17:05:58 INFO - ++DOMWINDOW == 39 (0x11fadc400) [pid = 1063] [serial = 2386] [outer = 0x0] 17:05:58 INFO - ++DOMWINDOW == 40 (0x129a2a800) [pid = 1063] [serial = 2387] [outer = 0x11fadc400] 17:05:58 INFO - ++DOCSHELL 0x12d25b000 == 15 [pid = 1063] [id = 998] 17:05:58 INFO - ++DOMWINDOW == 41 (0x127f0b400) [pid = 1063] [serial = 2388] [outer = 0x0] 17:05:58 INFO - ++DOMWINDOW == 42 (0x12a117400) [pid = 1063] [serial = 2389] [outer = 0x127f0b400] 17:05:58 INFO - ++DOMWINDOW == 43 (0x12a03b400) [pid = 1063] [serial = 2390] [outer = 0x127f0b400] 17:05:58 INFO - ++DOCSHELL 0x12de5e900 == 16 [pid = 1063] [id = 999] 17:05:58 INFO - ++DOMWINDOW == 44 (0x130978800) [pid = 1063] [serial = 2391] [outer = 0x0] 17:05:58 INFO - ++DOMWINDOW == 45 (0x130995000) [pid = 1063] [serial = 2392] [outer = 0x130978800] 17:06:03 INFO - --DOCSHELL 0x11fbe3600 == 15 [pid = 1063] [id = 991] 17:06:03 INFO - --DOCSHELL 0x12d25b000 == 14 [pid = 1063] [id = 998] 17:06:03 INFO - --DOCSHELL 0x12de5e900 == 13 [pid = 1063] [id = 999] 17:06:03 INFO - --DOCSHELL 0x121c23e00 == 12 [pid = 1063] [id = 993] 17:06:03 INFO - --DOCSHELL 0x129f9b200 == 11 [pid = 1063] [id = 992] 17:06:03 INFO - --DOMWINDOW == 44 (0x128738000) [pid = 1063] [serial = 2340] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:03 INFO - --DOMWINDOW == 43 (0x12df27000) [pid = 1063] [serial = 2342] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOMWINDOW == 42 (0x12df7b000) [pid = 1063] [serial = 2371] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 41 (0x136a8ec00) [pid = 1063] [serial = 2369] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 40 (0x1355aec00) [pid = 1063] [serial = 2364] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 39 (0x1538c8000) [pid = 1063] [serial = 2362] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 38 (0x12965a000) [pid = 1063] [serial = 2360] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 37 (0x13666cc00) [pid = 1063] [serial = 2358] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 36 (0x128ffb000) [pid = 1063] [serial = 2356] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:03 INFO - --DOMWINDOW == 35 (0x127b8b000) [pid = 1063] [serial = 2376] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:03 INFO - --DOMWINDOW == 34 (0x12df27800) [pid = 1063] [serial = 2379] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:03 INFO - --DOMWINDOW == 33 (0x1205f8400) [pid = 1063] [serial = 2372] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOMWINDOW == 32 (0x1216bac00) [pid = 1063] [serial = 2374] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello%20world,%20bug%20916997] 17:06:03 INFO - --DOMWINDOW == 31 (0x121747c00) [pid = 1063] [serial = 2373] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOMWINDOW == 30 (0x127f4e800) [pid = 1063] [serial = 2375] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOMWINDOW == 29 (0x127f0bc00) [pid = 1063] [serial = 2384] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOMWINDOW == 28 (0x12a117400) [pid = 1063] [serial = 2389] [outer = 0x0] [url = about:blank] 17:06:03 INFO - --DOCSHELL 0x1201b0200 == 10 [pid = 1063] [id = 997] 17:06:03 INFO - MEMORY STAT | vsize 3791MB | residentFast 416MB | heapAllocated 128MB 17:06:03 INFO - 435 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js | took 5930ms 17:06:03 INFO - ++DOCSHELL 0x11fbe3600 == 11 [pid = 1063] [id = 1000] 17:06:03 INFO - ++DOMWINDOW == 29 (0x120538c00) [pid = 1063] [serial = 2393] [outer = 0x0] 17:06:03 INFO - ++DOMWINDOW == 30 (0x1205f8400) [pid = 1063] [serial = 2394] [outer = 0x120538c00] 17:06:04 INFO - 436 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js 17:06:04 INFO - ++DOCSHELL 0x129ea7700 == 12 [pid = 1063] [id = 1001] 17:06:04 INFO - ++DOMWINDOW == 31 (0x12082f800) [pid = 1063] [serial = 2395] [outer = 0x0] 17:06:04 INFO - ++DOMWINDOW == 32 (0x1276eb400) [pid = 1063] [serial = 2396] [outer = 0x12082f800] 17:06:04 INFO - ++DOMWINDOW == 33 (0x130b52000) [pid = 1063] [serial = 2397] [outer = 0x12082f800] 17:06:04 INFO - ++DOCSHELL 0x12bb31600 == 13 [pid = 1063] [id = 1002] 17:06:04 INFO - ++DOMWINDOW == 34 (0x128696c00) [pid = 1063] [serial = 2398] [outer = 0x0] 17:06:04 INFO - ++DOMWINDOW == 35 (0x1285cb800) [pid = 1063] [serial = 2399] [outer = 0x128696c00] 17:06:04 INFO - ++DOCSHELL 0x12c6dd800 == 14 [pid = 1063] [id = 1003] 17:06:04 INFO - ++DOMWINDOW == 36 (0x121747c00) [pid = 1063] [serial = 2400] [outer = 0x0] 17:06:04 INFO - ++DOMWINDOW == 37 (0x129932000) [pid = 1063] [serial = 2401] [outer = 0x121747c00] 17:06:04 INFO - ++DOMWINDOW == 38 (0x12019e400) [pid = 1063] [serial = 2402] [outer = 0x121747c00] 17:06:04 INFO - ++DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 1004] 17:06:04 INFO - ++DOMWINDOW == 39 (0x12df19c00) [pid = 1063] [serial = 2403] [outer = 0x0] 17:06:04 INFO - ++DOMWINDOW == 40 (0x12df27000) [pid = 1063] [serial = 2404] [outer = 0x12df19c00] 17:06:05 INFO - ++DOCSHELL 0x131a42800 == 16 [pid = 1063] [id = 1005] 17:06:05 INFO - ++DOMWINDOW == 41 (0x131b8dc00) [pid = 1063] [serial = 2405] [outer = 0x0] 17:06:05 INFO - ++DOMWINDOW == 42 (0x131bc1400) [pid = 1063] [serial = 2406] [outer = 0x131b8dc00] 17:06:05 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:05 INFO - ++DOCSHELL 0x131b2a200 == 17 [pid = 1063] [id = 1006] 17:06:05 INFO - ++DOMWINDOW == 43 (0x1373a4c00) [pid = 1063] [serial = 2407] [outer = 0x0] 17:06:05 INFO - ++DOMWINDOW == 44 (0x137e5b800) [pid = 1063] [serial = 2408] [outer = 0x1373a4c00] 17:06:05 INFO - ++DOCSHELL 0x1332bf300 == 18 [pid = 1063] [id = 1007] 17:06:05 INFO - ++DOMWINDOW == 45 (0x137e5dc00) [pid = 1063] [serial = 2409] [outer = 0x0] 17:06:05 INFO - ++DOCSHELL 0x1332c1600 == 19 [pid = 1063] [id = 1008] 17:06:05 INFO - ++DOMWINDOW == 46 (0x137e68400) [pid = 1063] [serial = 2410] [outer = 0x0] 17:06:05 INFO - ++DOCSHELL 0x1334dea00 == 20 [pid = 1063] [id = 1009] 17:06:05 INFO - ++DOMWINDOW == 47 (0x137e68800) [pid = 1063] [serial = 2411] [outer = 0x0] 17:06:05 INFO - ++DOCSHELL 0x1334def00 == 21 [pid = 1063] [id = 1010] 17:06:05 INFO - ++DOMWINDOW == 48 (0x137ef0000) [pid = 1063] [serial = 2412] [outer = 0x0] 17:06:05 INFO - ++DOCSHELL 0x1334df900 == 22 [pid = 1063] [id = 1011] 17:06:05 INFO - ++DOMWINDOW == 49 (0x137f6d000) [pid = 1063] [serial = 2413] [outer = 0x0] 17:06:05 INFO - ++DOMWINDOW == 50 (0x1334d7c00) [pid = 1063] [serial = 2414] [outer = 0x137e5dc00] 17:06:05 INFO - ++DOMWINDOW == 51 (0x134862000) [pid = 1063] [serial = 2415] [outer = 0x137e68400] 17:06:05 INFO - ++DOMWINDOW == 52 (0x134882c00) [pid = 1063] [serial = 2416] [outer = 0x137e68800] 17:06:05 INFO - ++DOMWINDOW == 53 (0x135172c00) [pid = 1063] [serial = 2417] [outer = 0x137ef0000] 17:06:05 INFO - ++DOMWINDOW == 54 (0x1351b2400) [pid = 1063] [serial = 2418] [outer = 0x137f6d000] 17:06:05 INFO - ++DOCSHELL 0x13542c300 == 23 [pid = 1063] [id = 1012] 17:06:05 INFO - ++DOMWINDOW == 55 (0x136a37000) [pid = 1063] [serial = 2419] [outer = 0x0] 17:06:05 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:05 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:06 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:06 INFO - ++DOCSHELL 0x13542e600 == 24 [pid = 1063] [id = 1013] 17:06:06 INFO - ++DOMWINDOW == 56 (0x136b7d800) [pid = 1063] [serial = 2420] [outer = 0x0] 17:06:06 INFO - ++DOCSHELL 0x13542eb00 == 25 [pid = 1063] [id = 1014] 17:06:06 INFO - ++DOMWINDOW == 57 (0x137063400) [pid = 1063] [serial = 2421] [outer = 0x0] 17:06:06 INFO - ++DOCSHELL 0x135547200 == 26 [pid = 1063] [id = 1015] 17:06:06 INFO - ++DOMWINDOW == 58 (0x137063800) [pid = 1063] [serial = 2422] [outer = 0x0] 17:06:06 INFO - ++DOCSHELL 0x135548600 == 27 [pid = 1063] [id = 1016] 17:06:06 INFO - ++DOMWINDOW == 59 (0x137154000) [pid = 1063] [serial = 2423] [outer = 0x0] 17:06:06 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:06 INFO - ++DOCSHELL 0x1355f1a00 == 28 [pid = 1063] [id = 1017] 17:06:06 INFO - ++DOMWINDOW == 60 (0x137154800) [pid = 1063] [serial = 2424] [outer = 0x0] 17:06:06 INFO - ++DOMWINDOW == 61 (0x137154c00) [pid = 1063] [serial = 2425] [outer = 0x137154800] 17:06:06 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:06 INFO - ++DOCSHELL 0x136a6ec00 == 29 [pid = 1063] [id = 1018] 17:06:06 INFO - ++DOMWINDOW == 62 (0x1538ea800) [pid = 1063] [serial = 2426] [outer = 0x0] 17:06:06 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:06 INFO - ++DOMWINDOW == 63 (0x15bdc1000) [pid = 1063] [serial = 2427] [outer = 0x136a37000] 17:06:06 INFO - ++DOMWINDOW == 64 (0x13724c800) [pid = 1063] [serial = 2428] [outer = 0x136b7d800] 17:06:06 INFO - ++DOMWINDOW == 65 (0x15bdc1c00) [pid = 1063] [serial = 2429] [outer = 0x137063400] 17:06:06 INFO - ++DOMWINDOW == 66 (0x137e24400) [pid = 1063] [serial = 2430] [outer = 0x137063800] 17:06:06 INFO - ++DOMWINDOW == 67 (0x137e24c00) [pid = 1063] [serial = 2431] [outer = 0x137154000] 17:06:06 INFO - ++DOMWINDOW == 68 (0x1371a4400) [pid = 1063] [serial = 2432] [outer = 0x137154800] 17:06:06 INFO - ++DOMWINDOW == 69 (0x15388b400) [pid = 1063] [serial = 2433] [outer = 0x1538ea800] 17:06:12 INFO - --DOCSHELL 0x13542eb00 == 28 [pid = 1063] [id = 1014] 17:06:12 INFO - --DOCSHELL 0x135547200 == 27 [pid = 1063] [id = 1015] 17:06:12 INFO - --DOCSHELL 0x13542e600 == 26 [pid = 1063] [id = 1013] 17:06:12 INFO - --DOCSHELL 0x135548600 == 25 [pid = 1063] [id = 1016] 17:06:12 INFO - --DOCSHELL 0x136a6ec00 == 24 [pid = 1063] [id = 1018] 17:06:12 INFO - --DOCSHELL 0x13542c300 == 23 [pid = 1063] [id = 1012] 17:06:12 INFO - --DOCSHELL 0x1355f1a00 == 22 [pid = 1063] [id = 1017] 17:06:12 INFO - --DOCSHELL 0x11fbe3100 == 21 [pid = 1063] [id = 995] 17:06:12 INFO - --DOCSHELL 0x12cb89600 == 20 [pid = 1063] [id = 1004] 17:06:12 INFO - --DOCSHELL 0x131a42800 == 19 [pid = 1063] [id = 1005] 17:06:13 INFO - --DOCSHELL 0x12c6db500 == 18 [pid = 1063] [id = 996] 17:06:13 INFO - --DOMWINDOW == 68 (0x128c2ac00) [pid = 1063] [serial = 2378] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:13 INFO - --DOMWINDOW == 67 (0x12df27c00) [pid = 1063] [serial = 2380] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOMWINDOW == 66 (0x137e5dc00) [pid = 1063] [serial = 2409] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:13 INFO - --DOMWINDOW == 65 (0x137ef0000) [pid = 1063] [serial = 2412] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:13 INFO - --DOMWINDOW == 64 (0x137e68800) [pid = 1063] [serial = 2411] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:13 INFO - --DOMWINDOW == 63 (0x137e68400) [pid = 1063] [serial = 2410] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:13 INFO - --DOMWINDOW == 62 (0x137f6d000) [pid = 1063] [serial = 2413] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:13 INFO - --DOMWINDOW == 61 (0x131b8dc00) [pid = 1063] [serial = 2405] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:06:13 INFO - --DOMWINDOW == 60 (0x1373a4c00) [pid = 1063] [serial = 2407] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:06:13 INFO - --DOMWINDOW == 59 (0x121ddb400) [pid = 1063] [serial = 2383] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:13 INFO - --DOMWINDOW == 58 (0x136a37000) [pid = 1063] [serial = 2419] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:13 INFO - --DOMWINDOW == 57 (0x137154800) [pid = 1063] [serial = 2424] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:13 INFO - --DOMWINDOW == 56 (0x127f0b400) [pid = 1063] [serial = 2388] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:13 INFO - --DOMWINDOW == 55 (0x1216a2800) [pid = 1063] [serial = 2381] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOMWINDOW == 54 (0x137063400) [pid = 1063] [serial = 2421] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:13 INFO - --DOMWINDOW == 53 (0x11fadc400) [pid = 1063] [serial = 2386] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:13 INFO - --DOMWINDOW == 52 (0x130978800) [pid = 1063] [serial = 2391] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:13 INFO - --DOMWINDOW == 51 (0x1538ea800) [pid = 1063] [serial = 2426] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:13 INFO - --DOMWINDOW == 50 (0x137154000) [pid = 1063] [serial = 2423] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:13 INFO - --DOMWINDOW == 49 (0x136b7d800) [pid = 1063] [serial = 2420] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:13 INFO - --DOMWINDOW == 48 (0x1276eb400) [pid = 1063] [serial = 2396] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOMWINDOW == 47 (0x137063800) [pid = 1063] [serial = 2422] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:13 INFO - --DOMWINDOW == 46 (0x129932000) [pid = 1063] [serial = 2401] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOMWINDOW == 45 (0x129a2a800) [pid = 1063] [serial = 2387] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:13 INFO - --DOMWINDOW == 44 (0x137154c00) [pid = 1063] [serial = 2425] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOMWINDOW == 43 (0x1371a4400) [pid = 1063] [serial = 2432] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:13 INFO - --DOMWINDOW == 42 (0x121cbac00) [pid = 1063] [serial = 2382] [outer = 0x0] [url = about:blank] 17:06:13 INFO - --DOCSHELL 0x12bb31600 == 17 [pid = 1063] [id = 1002] 17:06:13 INFO - --DOMWINDOW == 41 (0x1351b2400) [pid = 1063] [serial = 2418] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:13 INFO - --DOMWINDOW == 40 (0x134882c00) [pid = 1063] [serial = 2416] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:13 INFO - --DOMWINDOW == 39 (0x129900400) [pid = 1063] [serial = 2385] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:13 INFO - MEMORY STAT | vsize 3790MB | residentFast 418MB | heapAllocated 130MB 17:06:13 INFO - 437 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js | took 9824ms 17:06:13 INFO - ++DOCSHELL 0x120929200 == 18 [pid = 1063] [id = 1019] 17:06:13 INFO - ++DOMWINDOW == 40 (0x1216a2800) [pid = 1063] [serial = 2434] [outer = 0x0] 17:06:13 INFO - ++DOMWINDOW == 41 (0x121ddb400) [pid = 1063] [serial = 2435] [outer = 0x1216a2800] 17:06:14 INFO - 438 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js 17:06:14 INFO - ++DOCSHELL 0x12c6db000 == 19 [pid = 1063] [id = 1020] 17:06:14 INFO - ++DOMWINDOW == 42 (0x121763000) [pid = 1063] [serial = 2436] [outer = 0x0] 17:06:14 INFO - ++DOMWINDOW == 43 (0x1284e0400) [pid = 1063] [serial = 2437] [outer = 0x121763000] 17:06:14 INFO - ++DOMWINDOW == 44 (0x1297a0800) [pid = 1063] [serial = 2438] [outer = 0x121763000] 17:06:14 INFO - ++DOCSHELL 0x12c6ddd00 == 20 [pid = 1063] [id = 1021] 17:06:14 INFO - ++DOMWINDOW == 45 (0x129900400) [pid = 1063] [serial = 2439] [outer = 0x0] 17:06:14 INFO - ++DOMWINDOW == 46 (0x129932000) [pid = 1063] [serial = 2440] [outer = 0x129900400] 17:06:14 INFO - ++DOCSHELL 0x12ca29000 == 21 [pid = 1063] [id = 1022] 17:06:14 INFO - ++DOMWINDOW == 47 (0x127f0b400) [pid = 1063] [serial = 2441] [outer = 0x0] 17:06:14 INFO - ++DOMWINDOW == 48 (0x1299fe000) [pid = 1063] [serial = 2442] [outer = 0x127f0b400] 17:06:14 INFO - ++DOMWINDOW == 49 (0x1296a6000) [pid = 1063] [serial = 2443] [outer = 0x127f0b400] 17:06:14 INFO - ++DOCSHELL 0x12d4c0200 == 22 [pid = 1063] [id = 1023] 17:06:14 INFO - ++DOMWINDOW == 50 (0x12df86000) [pid = 1063] [serial = 2444] [outer = 0x0] 17:06:14 INFO - ++DOMWINDOW == 51 (0x12df86800) [pid = 1063] [serial = 2445] [outer = 0x12df86000] 17:06:15 INFO - ++DOCSHELL 0x13542dc00 == 23 [pid = 1063] [id = 1024] 17:06:15 INFO - ++DOMWINDOW == 52 (0x1367edc00) [pid = 1063] [serial = 2446] [outer = 0x0] 17:06:15 INFO - ++DOMWINDOW == 53 (0x1367f0000) [pid = 1063] [serial = 2447] [outer = 0x1367edc00] 17:06:15 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:15 INFO - ++DOCSHELL 0x13542eb00 == 24 [pid = 1063] [id = 1025] 17:06:15 INFO - ++DOMWINDOW == 54 (0x153814800) [pid = 1063] [serial = 2448] [outer = 0x0] 17:06:15 INFO - ++DOMWINDOW == 55 (0x137ef0000) [pid = 1063] [serial = 2449] [outer = 0x153814800] 17:06:15 INFO - ++DOCSHELL 0x135548600 == 25 [pid = 1063] [id = 1026] 17:06:15 INFO - ++DOMWINDOW == 56 (0x1538a5000) [pid = 1063] [serial = 2450] [outer = 0x0] 17:06:15 INFO - ++DOCSHELL 0x1355f1a00 == 26 [pid = 1063] [id = 1027] 17:06:15 INFO - ++DOMWINDOW == 57 (0x1538a5400) [pid = 1063] [serial = 2451] [outer = 0x0] 17:06:15 INFO - ++DOCSHELL 0x1355f2400 == 27 [pid = 1063] [id = 1028] 17:06:15 INFO - ++DOMWINDOW == 58 (0x1538c8000) [pid = 1063] [serial = 2452] [outer = 0x0] 17:06:15 INFO - ++DOCSHELL 0x13674c800 == 28 [pid = 1063] [id = 1029] 17:06:15 INFO - ++DOMWINDOW == 59 (0x1538d8800) [pid = 1063] [serial = 2453] [outer = 0x0] 17:06:15 INFO - ++DOCSHELL 0x136a6d800 == 29 [pid = 1063] [id = 1030] 17:06:15 INFO - ++DOMWINDOW == 60 (0x1538ea400) [pid = 1063] [serial = 2454] [outer = 0x0] 17:06:15 INFO - ++DOMWINDOW == 61 (0x1538ea800) [pid = 1063] [serial = 2455] [outer = 0x1538a5000] 17:06:15 INFO - ++DOMWINDOW == 62 (0x1539fd000) [pid = 1063] [serial = 2456] [outer = 0x1538a5400] 17:06:15 INFO - ++DOMWINDOW == 63 (0x15576c000) [pid = 1063] [serial = 2457] [outer = 0x1538c8000] 17:06:15 INFO - ++DOMWINDOW == 64 (0x155fe7000) [pid = 1063] [serial = 2458] [outer = 0x1538d8800] 17:06:15 INFO - ++DOMWINDOW == 65 (0x155fe7c00) [pid = 1063] [serial = 2459] [outer = 0x1538ea400] 17:06:15 INFO - ++DOCSHELL 0x1201b0200 == 30 [pid = 1063] [id = 1031] 17:06:15 INFO - ++DOMWINDOW == 66 (0x130978800) [pid = 1063] [serial = 2460] [outer = 0x0] 17:06:15 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:15 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:15 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:15 INFO - ++DOCSHELL 0x12de61b00 == 31 [pid = 1063] [id = 1032] 17:06:15 INFO - ++DOMWINDOW == 67 (0x1351cc800) [pid = 1063] [serial = 2461] [outer = 0x0] 17:06:15 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:15 INFO - ++DOMWINDOW == 68 (0x136ba7800) [pid = 1063] [serial = 2462] [outer = 0x130978800] 17:06:16 INFO - ++DOMWINDOW == 69 (0x137e84c00) [pid = 1063] [serial = 2463] [outer = 0x1351cc800] 17:06:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:16 INFO - ++DOCSHELL 0x135547200 == 32 [pid = 1063] [id = 1033] 17:06:16 INFO - ++DOMWINDOW == 70 (0x1376ba400) [pid = 1063] [serial = 2464] [outer = 0x0] 17:06:16 INFO - ++DOCSHELL 0x13707f900 == 33 [pid = 1063] [id = 1034] 17:06:16 INFO - ++DOMWINDOW == 71 (0x1376ba800) [pid = 1063] [serial = 2465] [outer = 0x0] 17:06:16 INFO - ++DOCSHELL 0x137080300 == 34 [pid = 1063] [id = 1035] 17:06:16 INFO - ++DOMWINDOW == 72 (0x1376bac00) [pid = 1063] [serial = 2466] [outer = 0x0] 17:06:16 INFO - ++DOCSHELL 0x137080800 == 35 [pid = 1063] [id = 1036] 17:06:16 INFO - ++DOMWINDOW == 73 (0x15bf50400) [pid = 1063] [serial = 2467] [outer = 0x0] 17:06:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:16 INFO - ++DOCSHELL 0x137080d00 == 36 [pid = 1063] [id = 1037] 17:06:16 INFO - ++DOMWINDOW == 74 (0x1377c6400) [pid = 1063] [serial = 2468] [outer = 0x0] 17:06:16 INFO - ++DOMWINDOW == 75 (0x1377c6800) [pid = 1063] [serial = 2469] [outer = 0x1377c6400] 17:06:16 INFO - ++DOMWINDOW == 76 (0x1589db400) [pid = 1063] [serial = 2470] [outer = 0x1376ba400] 17:06:16 INFO - ++DOMWINDOW == 77 (0x1589dbc00) [pid = 1063] [serial = 2471] [outer = 0x1376ba800] 17:06:16 INFO - ++DOMWINDOW == 78 (0x15bfc9400) [pid = 1063] [serial = 2472] [outer = 0x1376bac00] 17:06:16 INFO - ++DOMWINDOW == 79 (0x15bfc9c00) [pid = 1063] [serial = 2473] [outer = 0x15bf50400] 17:06:16 INFO - ++DOMWINDOW == 80 (0x130992400) [pid = 1063] [serial = 2474] [outer = 0x1377c6400] 17:06:17 INFO - --DOCSHELL 0x13707f900 == 35 [pid = 1063] [id = 1034] 17:06:17 INFO - --DOCSHELL 0x137080300 == 34 [pid = 1063] [id = 1035] 17:06:17 INFO - --DOCSHELL 0x135547200 == 33 [pid = 1063] [id = 1033] 17:06:17 INFO - --DOCSHELL 0x137080800 == 32 [pid = 1063] [id = 1036] 17:06:17 INFO - --DOCSHELL 0x12de61b00 == 31 [pid = 1063] [id = 1032] 17:06:17 INFO - --DOCSHELL 0x1201b0200 == 30 [pid = 1063] [id = 1031] 17:06:18 INFO - --DOCSHELL 0x137080d00 == 29 [pid = 1063] [id = 1037] 17:06:18 INFO - --DOCSHELL 0x11fbe3600 == 28 [pid = 1063] [id = 1000] 17:06:18 INFO - --DOCSHELL 0x129ea7700 == 27 [pid = 1063] [id = 1001] 17:06:18 INFO - --DOCSHELL 0x131b2a200 == 26 [pid = 1063] [id = 1006] 17:06:18 INFO - --DOCSHELL 0x12c6dd800 == 25 [pid = 1063] [id = 1003] 17:06:18 INFO - --DOCSHELL 0x12d4c0200 == 24 [pid = 1063] [id = 1023] 17:06:18 INFO - --DOCSHELL 0x13542dc00 == 23 [pid = 1063] [id = 1024] 17:06:18 INFO - --DOCSHELL 0x13542eb00 == 22 [pid = 1063] [id = 1025] 17:06:18 INFO - --DOCSHELL 0x1332bf300 == 21 [pid = 1063] [id = 1007] 17:06:18 INFO - --DOCSHELL 0x1332c1600 == 20 [pid = 1063] [id = 1008] 17:06:18 INFO - --DOCSHELL 0x1334dea00 == 19 [pid = 1063] [id = 1009] 17:06:18 INFO - --DOCSHELL 0x1334def00 == 18 [pid = 1063] [id = 1010] 17:06:18 INFO - --DOCSHELL 0x1334df900 == 17 [pid = 1063] [id = 1011] 17:06:18 INFO - --DOMWINDOW == 79 (0x12a03b400) [pid = 1063] [serial = 2390] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:18 INFO - --DOMWINDOW == 78 (0x130995000) [pid = 1063] [serial = 2392] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 77 (0x131bc1400) [pid = 1063] [serial = 2406] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 76 (0x137e5b800) [pid = 1063] [serial = 2408] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 75 (0x1334d7c00) [pid = 1063] [serial = 2414] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:18 INFO - --DOMWINDOW == 74 (0x134862000) [pid = 1063] [serial = 2415] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:18 INFO - --DOMWINDOW == 73 (0x135172c00) [pid = 1063] [serial = 2417] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:18 INFO - --DOMWINDOW == 72 (0x15bdc1000) [pid = 1063] [serial = 2427] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:18 INFO - --DOMWINDOW == 71 (0x13724c800) [pid = 1063] [serial = 2428] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 70 (0x15bdc1c00) [pid = 1063] [serial = 2429] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 69 (0x137e24400) [pid = 1063] [serial = 2430] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 68 (0x137e24c00) [pid = 1063] [serial = 2431] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 67 (0x15388b400) [pid = 1063] [serial = 2433] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 66 (0x12df19c00) [pid = 1063] [serial = 2403] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:18 INFO - --DOMWINDOW == 65 (0x121747c00) [pid = 1063] [serial = 2400] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:18 INFO - --DOMWINDOW == 64 (0x120538c00) [pid = 1063] [serial = 2393] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 63 (0x12082f800) [pid = 1063] [serial = 2395] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:18 INFO - --DOMWINDOW == 62 (0x128696c00) [pid = 1063] [serial = 2398] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:18 INFO - --DOMWINDOW == 61 (0x1538a5400) [pid = 1063] [serial = 2451] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:18 INFO - --DOMWINDOW == 60 (0x1538a5000) [pid = 1063] [serial = 2450] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:18 INFO - --DOMWINDOW == 59 (0x1538d8800) [pid = 1063] [serial = 2453] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:18 INFO - --DOMWINDOW == 58 (0x1538c8000) [pid = 1063] [serial = 2452] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:18 INFO - --DOMWINDOW == 57 (0x130978800) [pid = 1063] [serial = 2460] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:18 INFO - --DOMWINDOW == 56 (0x1376ba400) [pid = 1063] [serial = 2464] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 55 (0x1376ba800) [pid = 1063] [serial = 2465] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 54 (0x15bf50400) [pid = 1063] [serial = 2467] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 53 (0x1377c6800) [pid = 1063] [serial = 2469] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 52 (0x1351cc800) [pid = 1063] [serial = 2461] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:18 INFO - --DOMWINDOW == 51 (0x130992400) [pid = 1063] [serial = 2474] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:18 INFO - --DOMWINDOW == 50 (0x1377c6400) [pid = 1063] [serial = 2468] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:18 INFO - --DOMWINDOW == 49 (0x1205f8400) [pid = 1063] [serial = 2394] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 48 (0x1285cb800) [pid = 1063] [serial = 2399] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:18 INFO - --DOMWINDOW == 47 (0x1284e0400) [pid = 1063] [serial = 2437] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 46 (0x1299fe000) [pid = 1063] [serial = 2442] [outer = 0x0] [url = about:blank] 17:06:18 INFO - --DOMWINDOW == 45 (0x15576c000) [pid = 1063] [serial = 2457] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:18 INFO - --DOMWINDOW == 44 (0x130b52000) [pid = 1063] [serial = 2397] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:18 INFO - MEMORY STAT | vsize 3788MB | residentFast 414MB | heapAllocated 132MB 17:06:18 INFO - 439 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js | took 4412ms 17:06:18 INFO - ++DOCSHELL 0x11fbe3600 == 18 [pid = 1063] [id = 1038] 17:06:18 INFO - ++DOMWINDOW == 45 (0x120538c00) [pid = 1063] [serial = 2475] [outer = 0x0] 17:06:18 INFO - ++DOMWINDOW == 46 (0x12082f800) [pid = 1063] [serial = 2476] [outer = 0x120538c00] 17:06:18 INFO - 440 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js 17:06:18 INFO - ++DOCSHELL 0x12bb2f800 == 19 [pid = 1063] [id = 1039] 17:06:18 INFO - ++DOMWINDOW == 47 (0x126671000) [pid = 1063] [serial = 2477] [outer = 0x0] 17:06:18 INFO - ++DOMWINDOW == 48 (0x1284e0400) [pid = 1063] [serial = 2478] [outer = 0x126671000] 17:06:18 INFO - ++DOMWINDOW == 49 (0x128e94000) [pid = 1063] [serial = 2479] [outer = 0x126671000] 17:06:18 INFO - ++DOCSHELL 0x12c6df600 == 20 [pid = 1063] [id = 1040] 17:06:18 INFO - ++DOMWINDOW == 50 (0x128c2ac00) [pid = 1063] [serial = 2480] [outer = 0x0] 17:06:18 INFO - ++DOMWINDOW == 51 (0x1299ab000) [pid = 1063] [serial = 2481] [outer = 0x128c2ac00] 17:06:18 INFO - ++DOCSHELL 0x12cb89100 == 21 [pid = 1063] [id = 1041] 17:06:18 INFO - ++DOMWINDOW == 52 (0x127ed2800) [pid = 1063] [serial = 2482] [outer = 0x0] 17:06:18 INFO - ++DOMWINDOW == 53 (0x129aa6c00) [pid = 1063] [serial = 2483] [outer = 0x127ed2800] 17:06:18 INFO - ++DOMWINDOW == 54 (0x1299fe000) [pid = 1063] [serial = 2484] [outer = 0x127ed2800] 17:06:19 INFO - ++DOCSHELL 0x12d530100 == 22 [pid = 1063] [id = 1042] 17:06:19 INFO - ++DOMWINDOW == 55 (0x12df27800) [pid = 1063] [serial = 2485] [outer = 0x0] 17:06:19 INFO - ++DOMWINDOW == 56 (0x12e1ec800) [pid = 1063] [serial = 2486] [outer = 0x12df27800] 17:06:20 INFO - ++DOMWINDOW == 57 (0x137049400) [pid = 1063] [serial = 2487] [outer = 0x126671000] 17:06:20 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:06:20 INFO - ++DOCSHELL 0x135547200 == 23 [pid = 1063] [id = 1043] 17:06:20 INFO - ++DOMWINDOW == 58 (0x1285cb800) [pid = 1063] [serial = 2488] [outer = 0x0] 17:06:20 INFO - ++DOMWINDOW == 59 (0x1370b7c00) [pid = 1063] [serial = 2489] [outer = 0x1285cb800] 17:06:20 INFO - ++DOCSHELL 0x137080d00 == 24 [pid = 1063] [id = 1044] 17:06:20 INFO - ++DOMWINDOW == 60 (0x1373a4400) [pid = 1063] [serial = 2490] [outer = 0x0] 17:06:20 INFO - ++DOMWINDOW == 61 (0x1373a4c00) [pid = 1063] [serial = 2491] [outer = 0x1373a4400] 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - ++DOCSHELL 0x13707ea00 == 25 [pid = 1063] [id = 1045] 17:06:21 INFO - ++DOMWINDOW == 62 (0x134876000) [pid = 1063] [serial = 2492] [outer = 0x0] 17:06:21 INFO - ++DOMWINDOW == 63 (0x13675c800) [pid = 1063] [serial = 2493] [outer = 0x134876000] 17:06:21 INFO - ++DOCSHELL 0x137081700 == 26 [pid = 1063] [id = 1046] 17:06:21 INFO - ++DOMWINDOW == 64 (0x137e68800) [pid = 1063] [serial = 2494] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x13715d000 == 27 [pid = 1063] [id = 1047] 17:06:21 INFO - ++DOMWINDOW == 65 (0x153814400) [pid = 1063] [serial = 2495] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x13715da00 == 28 [pid = 1063] [id = 1048] 17:06:21 INFO - ++DOMWINDOW == 66 (0x153816400) [pid = 1063] [serial = 2496] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x13715f300 == 29 [pid = 1063] [id = 1049] 17:06:21 INFO - ++DOMWINDOW == 67 (0x15387b000) [pid = 1063] [serial = 2497] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x13715f800 == 30 [pid = 1063] [id = 1050] 17:06:21 INFO - ++DOMWINDOW == 68 (0x15387b400) [pid = 1063] [serial = 2498] [outer = 0x0] 17:06:21 INFO - ++DOMWINDOW == 69 (0x15387b800) [pid = 1063] [serial = 2499] [outer = 0x137e68800] 17:06:21 INFO - ++DOMWINDOW == 70 (0x1538a5400) [pid = 1063] [serial = 2500] [outer = 0x153814400] 17:06:21 INFO - ++DOMWINDOW == 71 (0x1538d8800) [pid = 1063] [serial = 2501] [outer = 0x153816400] 17:06:21 INFO - ++DOMWINDOW == 72 (0x1539fd400) [pid = 1063] [serial = 2502] [outer = 0x15387b000] 17:06:21 INFO - ++DOMWINDOW == 73 (0x1539fdc00) [pid = 1063] [serial = 2503] [outer = 0x15387b400] 17:06:21 INFO - ++DOCSHELL 0x137081200 == 31 [pid = 1063] [id = 1051] 17:06:21 INFO - ++DOMWINDOW == 74 (0x15bbed000) [pid = 1063] [serial = 2504] [outer = 0x0] 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - ++DOCSHELL 0x15899bb00 == 32 [pid = 1063] [id = 1052] 17:06:21 INFO - ++DOMWINDOW == 75 (0x137136000) [pid = 1063] [serial = 2505] [outer = 0x0] 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - ++DOMWINDOW == 76 (0x1334a4c00) [pid = 1063] [serial = 2506] [outer = 0x15bbed000] 17:06:21 INFO - ++DOMWINDOW == 77 (0x1538a5000) [pid = 1063] [serial = 2507] [outer = 0x137136000] 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - ++DOCSHELL 0x158762f00 == 33 [pid = 1063] [id = 1053] 17:06:21 INFO - ++DOMWINDOW == 78 (0x15bfd0000) [pid = 1063] [serial = 2508] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x158763400 == 34 [pid = 1063] [id = 1054] 17:06:21 INFO - ++DOMWINDOW == 79 (0x1351ee000) [pid = 1063] [serial = 2509] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x158763900 == 35 [pid = 1063] [id = 1055] 17:06:21 INFO - ++DOMWINDOW == 80 (0x1351ee400) [pid = 1063] [serial = 2510] [outer = 0x0] 17:06:21 INFO - ++DOCSHELL 0x158763e00 == 36 [pid = 1063] [id = 1056] 17:06:21 INFO - ++DOMWINDOW == 81 (0x1351ee800) [pid = 1063] [serial = 2511] [outer = 0x0] 17:06:21 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:21 INFO - ++DOCSHELL 0x158764300 == 37 [pid = 1063] [id = 1057] 17:06:21 INFO - ++DOMWINDOW == 82 (0x15bbaa000) [pid = 1063] [serial = 2512] [outer = 0x0] 17:06:21 INFO - ++DOMWINDOW == 83 (0x15bbaa400) [pid = 1063] [serial = 2513] [outer = 0x15bbaa000] 17:06:22 INFO - ++DOMWINDOW == 84 (0x133ecbc00) [pid = 1063] [serial = 2514] [outer = 0x15bfd0000] 17:06:22 INFO - ++DOMWINDOW == 85 (0x15891e000) [pid = 1063] [serial = 2515] [outer = 0x1351ee000] 17:06:22 INFO - ++DOMWINDOW == 86 (0x15891e800) [pid = 1063] [serial = 2516] [outer = 0x1351ee400] 17:06:22 INFO - ++DOMWINDOW == 87 (0x157eaf000) [pid = 1063] [serial = 2517] [outer = 0x1351ee800] 17:06:22 INFO - ++DOMWINDOW == 88 (0x157eaf800) [pid = 1063] [serial = 2518] [outer = 0x15bbaa000] 17:06:22 INFO - --DOCSHELL 0x12c6ddd00 == 36 [pid = 1063] [id = 1021] 17:06:23 INFO - --DOCSHELL 0x12c6df600 == 35 [pid = 1063] [id = 1040] 17:06:23 INFO - --DOMWINDOW == 87 (0x12019e400) [pid = 1063] [serial = 2402] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:23 INFO - --DOMWINDOW == 86 (0x12df27000) [pid = 1063] [serial = 2404] [outer = 0x0] [url = about:blank] 17:06:23 INFO - --DOMWINDOW == 85 (0x1538ea800) [pid = 1063] [serial = 2455] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:23 INFO - --DOMWINDOW == 84 (0x1539fd000) [pid = 1063] [serial = 2456] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:23 INFO - --DOMWINDOW == 83 (0x136ba7800) [pid = 1063] [serial = 2462] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:23 INFO - --DOMWINDOW == 82 (0x137e84c00) [pid = 1063] [serial = 2463] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:23 INFO - --DOMWINDOW == 81 (0x1589db400) [pid = 1063] [serial = 2470] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:23 INFO - --DOMWINDOW == 80 (0x155fe7000) [pid = 1063] [serial = 2458] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:23 INFO - --DOMWINDOW == 79 (0x1589dbc00) [pid = 1063] [serial = 2471] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:23 INFO - --DOMWINDOW == 78 (0x15bfc9c00) [pid = 1063] [serial = 2473] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:24 INFO - --DOCSHELL 0x158764300 == 34 [pid = 1063] [id = 1057] 17:06:24 INFO - --DOCSHELL 0x158763400 == 33 [pid = 1063] [id = 1054] 17:06:24 INFO - --DOCSHELL 0x158763900 == 32 [pid = 1063] [id = 1055] 17:06:24 INFO - --DOCSHELL 0x158762f00 == 31 [pid = 1063] [id = 1053] 17:06:24 INFO - --DOCSHELL 0x158763e00 == 30 [pid = 1063] [id = 1056] 17:06:24 INFO - --DOCSHELL 0x15899bb00 == 29 [pid = 1063] [id = 1052] 17:06:24 INFO - --DOCSHELL 0x137081200 == 28 [pid = 1063] [id = 1051] 17:06:24 INFO - --DOCSHELL 0x13707ea00 == 27 [pid = 1063] [id = 1045] 17:06:24 INFO - --DOCSHELL 0x137080d00 == 26 [pid = 1063] [id = 1044] 17:06:24 INFO - --DOCSHELL 0x12d530100 == 25 [pid = 1063] [id = 1042] 17:06:25 INFO - --DOCSHELL 0x12ca29000 == 24 [pid = 1063] [id = 1022] 17:06:25 INFO - --DOCSHELL 0x137081700 == 23 [pid = 1063] [id = 1046] 17:06:25 INFO - --DOCSHELL 0x13715d000 == 22 [pid = 1063] [id = 1047] 17:06:25 INFO - --DOCSHELL 0x13715da00 == 21 [pid = 1063] [id = 1048] 17:06:25 INFO - --DOCSHELL 0x13715f300 == 20 [pid = 1063] [id = 1049] 17:06:25 INFO - --DOCSHELL 0x13715f800 == 19 [pid = 1063] [id = 1050] 17:06:25 INFO - --DOCSHELL 0x135548600 == 18 [pid = 1063] [id = 1026] 17:06:25 INFO - --DOCSHELL 0x1355f1a00 == 17 [pid = 1063] [id = 1027] 17:06:25 INFO - --DOCSHELL 0x1355f2400 == 16 [pid = 1063] [id = 1028] 17:06:25 INFO - --DOCSHELL 0x13674c800 == 15 [pid = 1063] [id = 1029] 17:06:25 INFO - --DOCSHELL 0x136a6d800 == 14 [pid = 1063] [id = 1030] 17:06:25 INFO - --DOCSHELL 0x12c6db000 == 13 [pid = 1063] [id = 1020] 17:06:25 INFO - --DOCSHELL 0x120929200 == 12 [pid = 1063] [id = 1019] 17:06:25 INFO - --DOMWINDOW == 77 (0x1376bac00) [pid = 1063] [serial = 2466] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:25 INFO - --DOMWINDOW == 76 (0x153814800) [pid = 1063] [serial = 2448] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:06:25 INFO - --DOMWINDOW == 75 (0x137e68800) [pid = 1063] [serial = 2494] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:25 INFO - --DOMWINDOW == 74 (0x15bbaa000) [pid = 1063] [serial = 2512] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:25 INFO - --DOMWINDOW == 73 (0x153814400) [pid = 1063] [serial = 2495] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:25 INFO - --DOMWINDOW == 72 (0x153816400) [pid = 1063] [serial = 2496] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:25 INFO - --DOMWINDOW == 71 (0x15387b000) [pid = 1063] [serial = 2497] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:25 INFO - --DOMWINDOW == 70 (0x15bbed000) [pid = 1063] [serial = 2504] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:25 INFO - --DOMWINDOW == 69 (0x1351ee000) [pid = 1063] [serial = 2509] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:25 INFO - --DOMWINDOW == 68 (0x15bfd0000) [pid = 1063] [serial = 2508] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:25 INFO - --DOMWINDOW == 67 (0x1351ee800) [pid = 1063] [serial = 2511] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:25 INFO - --DOMWINDOW == 66 (0x137136000) [pid = 1063] [serial = 2505] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:25 INFO - --DOMWINDOW == 65 (0x157eaf800) [pid = 1063] [serial = 2518] [outer = 0x0] [url = data:text/html,<html></html>] 17:06:25 INFO - --DOMWINDOW == 64 (0x15bbaa400) [pid = 1063] [serial = 2513] [outer = 0x0] [url = about:blank] 17:06:25 INFO - --DOMWINDOW == 63 (0x1367edc00) [pid = 1063] [serial = 2446] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:06:25 INFO - --DOMWINDOW == 62 (0x12df86000) [pid = 1063] [serial = 2444] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:25 INFO - --DOMWINDOW == 61 (0x127f0b400) [pid = 1063] [serial = 2441] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:25 INFO - --DOMWINDOW == 60 (0x1538ea400) [pid = 1063] [serial = 2454] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:25 INFO - --DOMWINDOW == 59 (0x1216a2800) [pid = 1063] [serial = 2434] [outer = 0x0] [url = about:blank] 17:06:25 INFO - --DOMWINDOW == 58 (0x121763000) [pid = 1063] [serial = 2436] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:25 INFO - --DOMWINDOW == 57 (0x129900400) [pid = 1063] [serial = 2439] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:25 INFO - --DOMWINDOW == 56 (0x129aa6c00) [pid = 1063] [serial = 2483] [outer = 0x0] [url = about:blank] 17:06:25 INFO - --DOMWINDOW == 55 (0x121ddb400) [pid = 1063] [serial = 2435] [outer = 0x0] [url = about:blank] 17:06:25 INFO - --DOMWINDOW == 54 (0x129932000) [pid = 1063] [serial = 2440] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:25 INFO - --DOMWINDOW == 53 (0x1284e0400) [pid = 1063] [serial = 2478] [outer = 0x0] [url = about:blank] 17:06:25 INFO - --DOCSHELL 0x135547200 == 11 [pid = 1063] [id = 1043] 17:06:25 INFO - --DOMWINDOW == 52 (0x1538d8800) [pid = 1063] [serial = 2501] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:06:25 INFO - --DOMWINDOW == 51 (0x155fe7c00) [pid = 1063] [serial = 2459] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:25 INFO - --DOMWINDOW == 50 (0x1297a0800) [pid = 1063] [serial = 2438] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:25 INFO - MEMORY STAT | vsize 3786MB | residentFast 415MB | heapAllocated 130MB 17:06:25 INFO - 441 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js | took 7227ms 17:06:25 INFO - ++DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 1058] 17:06:25 INFO - ++DOMWINDOW == 51 (0x121c1cc00) [pid = 1063] [serial = 2519] [outer = 0x0] 17:06:25 INFO - ++DOMWINDOW == 52 (0x127ed2000) [pid = 1063] [serial = 2520] [outer = 0x121c1cc00] 17:06:25 INFO - 442 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_events.js 17:06:25 INFO - ++DOCSHELL 0x129fc3000 == 13 [pid = 1063] [id = 1059] 17:06:25 INFO - ++DOMWINDOW == 53 (0x1284e0400) [pid = 1063] [serial = 2521] [outer = 0x0] 17:06:25 INFO - ++DOMWINDOW == 54 (0x129932000) [pid = 1063] [serial = 2522] [outer = 0x1284e0400] 17:06:26 INFO - ++DOMWINDOW == 55 (0x12fd7a000) [pid = 1063] [serial = 2523] [outer = 0x1284e0400] 17:06:26 INFO - ++DOCSHELL 0x12c825600 == 14 [pid = 1063] [id = 1060] 17:06:26 INFO - ++DOMWINDOW == 56 (0x128c4ec00) [pid = 1063] [serial = 2524] [outer = 0x0] 17:06:26 INFO - ++DOMWINDOW == 57 (0x129900c00) [pid = 1063] [serial = 2525] [outer = 0x128c4ec00] 17:06:26 INFO - ++DOMWINDOW == 58 (0x12a1d4800) [pid = 1063] [serial = 2526] [outer = 0x128c4ec00] 17:06:26 INFO - ++DOCSHELL 0x12d4c0200 == 15 [pid = 1063] [id = 1061] 17:06:26 INFO - ++DOMWINDOW == 59 (0x12e8fd000) [pid = 1063] [serial = 2527] [outer = 0x0] 17:06:26 INFO - ++DOMWINDOW == 60 (0x12e902c00) [pid = 1063] [serial = 2528] [outer = 0x12e8fd000] 17:06:28 INFO - --DOCSHELL 0x12bb2f800 == 14 [pid = 1063] [id = 1039] 17:06:28 INFO - --DOCSHELL 0x11fbe3600 == 13 [pid = 1063] [id = 1038] 17:06:28 INFO - --DOCSHELL 0x12cb89100 == 12 [pid = 1063] [id = 1041] 17:06:28 INFO - --DOCSHELL 0x12d4c0200 == 11 [pid = 1063] [id = 1061] 17:06:28 INFO - --DOMWINDOW == 59 (0x1367f0000) [pid = 1063] [serial = 2447] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 58 (0x15bfc9400) [pid = 1063] [serial = 2472] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 57 (0x137ef0000) [pid = 1063] [serial = 2449] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 56 (0x12df86800) [pid = 1063] [serial = 2445] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 55 (0x1296a6000) [pid = 1063] [serial = 2443] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:28 INFO - --DOMWINDOW == 54 (0x15387b800) [pid = 1063] [serial = 2499] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:06:28 INFO - --DOMWINDOW == 53 (0x1538a5400) [pid = 1063] [serial = 2500] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:06:28 INFO - --DOMWINDOW == 52 (0x1539fd400) [pid = 1063] [serial = 2502] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:06:28 INFO - --DOMWINDOW == 51 (0x1334a4c00) [pid = 1063] [serial = 2506] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:28 INFO - --DOMWINDOW == 50 (0x15891e000) [pid = 1063] [serial = 2515] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 49 (0x133ecbc00) [pid = 1063] [serial = 2514] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 48 (0x157eaf000) [pid = 1063] [serial = 2517] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 47 (0x1538a5000) [pid = 1063] [serial = 2507] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 46 (0x1351ee400) [pid = 1063] [serial = 2510] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:28 INFO - --DOMWINDOW == 45 (0x134876000) [pid = 1063] [serial = 2492] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:06:28 INFO - --DOMWINDOW == 44 (0x129932000) [pid = 1063] [serial = 2522] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 43 (0x1370b7c00) [pid = 1063] [serial = 2489] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 42 (0x1299ab000) [pid = 1063] [serial = 2481] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:28 INFO - --DOMWINDOW == 41 (0x12082f800) [pid = 1063] [serial = 2476] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 40 (0x129900c00) [pid = 1063] [serial = 2525] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 39 (0x1373a4400) [pid = 1063] [serial = 2490] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:06:28 INFO - --DOMWINDOW == 38 (0x12df27800) [pid = 1063] [serial = 2485] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:28 INFO - --DOMWINDOW == 37 (0x127ed2800) [pid = 1063] [serial = 2482] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:28 INFO - --DOMWINDOW == 36 (0x1285cb800) [pid = 1063] [serial = 2488] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:28 INFO - --DOMWINDOW == 35 (0x126671000) [pid = 1063] [serial = 2477] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:28 INFO - --DOMWINDOW == 34 (0x128c2ac00) [pid = 1063] [serial = 2480] [outer = 0x0] [url = data:text/html,<p>hello%20from%20iframe</p>] 17:06:28 INFO - --DOMWINDOW == 33 (0x120538c00) [pid = 1063] [serial = 2475] [outer = 0x0] [url = about:blank] 17:06:28 INFO - --DOMWINDOW == 32 (0x15387b400) [pid = 1063] [serial = 2498] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:28 INFO - --DOMWINDOW == 31 (0x137049400) [pid = 1063] [serial = 2487] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:28 INFO - --DOMWINDOW == 30 (0x128e94000) [pid = 1063] [serial = 2479] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 17:06:28 INFO - --DOMWINDOW == 29 (0x1539fdc00) [pid = 1063] [serial = 2503] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:06:28 INFO - MEMORY STAT | vsize 3784MB | residentFast 410MB | heapAllocated 127MB 17:06:28 INFO - 443 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_events.js | took 2618ms 17:06:28 INFO - ++DOCSHELL 0x11fbdff00 == 12 [pid = 1063] [id = 1062] 17:06:28 INFO - ++DOMWINDOW == 30 (0x1200e3000) [pid = 1063] [serial = 2529] [outer = 0x0] 17:06:28 INFO - ++DOMWINDOW == 31 (0x120538c00) [pid = 1063] [serial = 2530] [outer = 0x1200e3000] 17:06:28 INFO - 444 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_order.js 17:06:28 INFO - ++DOCSHELL 0x12092a600 == 13 [pid = 1063] [id = 1063] 17:06:28 INFO - ++DOMWINDOW == 32 (0x120541800) [pid = 1063] [serial = 2531] [outer = 0x0] 17:06:28 INFO - ++DOMWINDOW == 33 (0x120984800) [pid = 1063] [serial = 2532] [outer = 0x120541800] 17:06:28 INFO - ++DOMWINDOW == 34 (0x131bc1c00) [pid = 1063] [serial = 2533] [outer = 0x120541800] 17:06:28 INFO - ++DOCSHELL 0x127aa0100 == 14 [pid = 1063] [id = 1064] 17:06:28 INFO - ++DOMWINDOW == 35 (0x121ddb400) [pid = 1063] [serial = 2534] [outer = 0x0] 17:06:28 INFO - ++DOMWINDOW == 36 (0x126671000) [pid = 1063] [serial = 2535] [outer = 0x121ddb400] 17:06:29 INFO - ++DOMWINDOW == 37 (0x120961000) [pid = 1063] [serial = 2536] [outer = 0x121ddb400] 17:06:29 INFO - ++DOCSHELL 0x1285b3400 == 15 [pid = 1063] [id = 1065] 17:06:29 INFO - ++DOMWINDOW == 38 (0x12c48ec00) [pid = 1063] [serial = 2537] [outer = 0x0] 17:06:29 INFO - ++DOMWINDOW == 39 (0x12c50f000) [pid = 1063] [serial = 2538] [outer = 0x12c48ec00] 17:06:30 INFO - --DOCSHELL 0x1201b0200 == 14 [pid = 1063] [id = 1058] 17:06:30 INFO - --DOCSHELL 0x129fc3000 == 13 [pid = 1063] [id = 1059] 17:06:30 INFO - --DOCSHELL 0x1285b3400 == 12 [pid = 1063] [id = 1065] 17:06:30 INFO - --DOCSHELL 0x12c825600 == 11 [pid = 1063] [id = 1060] 17:06:30 INFO - --DOMWINDOW == 38 (0x1373a4c00) [pid = 1063] [serial = 2491] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 37 (0x12e1ec800) [pid = 1063] [serial = 2486] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 36 (0x1299fe000) [pid = 1063] [serial = 2484] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:30 INFO - --DOMWINDOW == 35 (0x15891e800) [pid = 1063] [serial = 2516] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:06:30 INFO - --DOMWINDOW == 34 (0x13675c800) [pid = 1063] [serial = 2493] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 33 (0x126671000) [pid = 1063] [serial = 2535] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 32 (0x120984800) [pid = 1063] [serial = 2532] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 31 (0x127ed2000) [pid = 1063] [serial = 2520] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 30 (0x12e8fd000) [pid = 1063] [serial = 2527] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:30 INFO - --DOMWINDOW == 29 (0x128c4ec00) [pid = 1063] [serial = 2524] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:30 INFO - --DOMWINDOW == 28 (0x121c1cc00) [pid = 1063] [serial = 2519] [outer = 0x0] [url = about:blank] 17:06:30 INFO - --DOMWINDOW == 27 (0x1284e0400) [pid = 1063] [serial = 2521] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 17:06:31 INFO - MEMORY STAT | vsize 3789MB | residentFast 414MB | heapAllocated 126MB 17:06:31 INFO - 445 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_order.js | took 2421ms 17:06:31 INFO - ++DOCSHELL 0x11fbdfa00 == 12 [pid = 1063] [id = 1066] 17:06:31 INFO - ++DOMWINDOW == 28 (0x12031e800) [pid = 1063] [serial = 2539] [outer = 0x0] 17:06:31 INFO - ++DOMWINDOW == 29 (0x120541c00) [pid = 1063] [serial = 2540] [outer = 0x12031e800] 17:06:31 INFO - 446 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_regexp.js 17:06:31 INFO - ++DOCSHELL 0x121c22000 == 13 [pid = 1063] [id = 1067] 17:06:31 INFO - ++DOMWINDOW == 30 (0x120547800) [pid = 1063] [serial = 2541] [outer = 0x0] 17:06:31 INFO - ++DOMWINDOW == 31 (0x1216bac00) [pid = 1063] [serial = 2542] [outer = 0x120547800] 17:06:31 INFO - ++DOMWINDOW == 32 (0x1272ba400) [pid = 1063] [serial = 2543] [outer = 0x120547800] 17:06:31 INFO - ++DOCSHELL 0x127e64300 == 14 [pid = 1063] [id = 1068] 17:06:31 INFO - ++DOMWINDOW == 33 (0x1209c4c00) [pid = 1063] [serial = 2544] [outer = 0x0] 17:06:31 INFO - ++DOMWINDOW == 34 (0x127371c00) [pid = 1063] [serial = 2545] [outer = 0x1209c4c00] 17:06:31 INFO - ++DOMWINDOW == 35 (0x1272a0800) [pid = 1063] [serial = 2546] [outer = 0x1209c4c00] 17:06:31 INFO - ++DOCSHELL 0x129bde300 == 15 [pid = 1063] [id = 1069] 17:06:31 INFO - ++DOMWINDOW == 36 (0x12c9b4800) [pid = 1063] [serial = 2547] [outer = 0x0] 17:06:31 INFO - ++DOMWINDOW == 37 (0x12c9b4c00) [pid = 1063] [serial = 2548] [outer = 0x12c9b4800] 17:06:32 INFO - ++DOCSHELL 0x12de5f800 == 16 [pid = 1063] [id = 1070] 17:06:32 INFO - ++DOMWINDOW == 38 (0x12f108c00) [pid = 1063] [serial = 2549] [outer = 0x0] 17:06:32 INFO - ++DOMWINDOW == 39 (0x13094b000) [pid = 1063] [serial = 2550] [outer = 0x12f108c00] 17:06:33 INFO - --DOCSHELL 0x127aa0100 == 15 [pid = 1063] [id = 1064] 17:06:33 INFO - --DOCSHELL 0x11fbdff00 == 14 [pid = 1063] [id = 1062] 17:06:33 INFO - --DOCSHELL 0x129bde300 == 13 [pid = 1063] [id = 1069] 17:06:33 INFO - --DOCSHELL 0x12092a600 == 12 [pid = 1063] [id = 1063] 17:06:33 INFO - --DOCSHELL 0x12de5f800 == 11 [pid = 1063] [id = 1070] 17:06:33 INFO - --DOMWINDOW == 38 (0x12a1d4800) [pid = 1063] [serial = 2526] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:33 INFO - --DOMWINDOW == 37 (0x12e902c00) [pid = 1063] [serial = 2528] [outer = 0x0] [url = about:blank] 17:06:33 INFO - --DOMWINDOW == 36 (0x12fd7a000) [pid = 1063] [serial = 2523] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 17:06:33 INFO - --DOMWINDOW == 35 (0x127371c00) [pid = 1063] [serial = 2545] [outer = 0x0] [url = about:blank] 17:06:33 INFO - --DOMWINDOW == 34 (0x120538c00) [pid = 1063] [serial = 2530] [outer = 0x0] [url = about:blank] 17:06:33 INFO - --DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 2542] [outer = 0x0] [url = about:blank] 17:06:33 INFO - --DOMWINDOW == 32 (0x12f108c00) [pid = 1063] [serial = 2549] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:33 INFO - --DOMWINDOW == 31 (0x12c48ec00) [pid = 1063] [serial = 2537] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:33 INFO - --DOMWINDOW == 30 (0x121ddb400) [pid = 1063] [serial = 2534] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:33 INFO - --DOMWINDOW == 29 (0x1200e3000) [pid = 1063] [serial = 2529] [outer = 0x0] [url = about:blank] 17:06:33 INFO - --DOMWINDOW == 28 (0x120541800) [pid = 1063] [serial = 2531] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:06:33 INFO - --DOMWINDOW == 27 (0x131bc1c00) [pid = 1063] [serial = 2533] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 17:06:33 INFO - MEMORY STAT | vsize 3790MB | residentFast 414MB | heapAllocated 126MB 17:06:33 INFO - 447 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_regexp.js | took 2713ms 17:06:33 INFO - ++DOCSHELL 0x1201b0200 == 12 [pid = 1063] [id = 1071] 17:06:33 INFO - ++DOMWINDOW == 28 (0x1200e3000) [pid = 1063] [serial = 2551] [outer = 0x0] 17:06:33 INFO - ++DOMWINDOW == 29 (0x120343c00) [pid = 1063] [serial = 2552] [outer = 0x1200e3000] 17:06:34 INFO - 448 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_table.js 17:06:34 INFO - ++DOCSHELL 0x121730200 == 13 [pid = 1063] [id = 1072] 17:06:34 INFO - ++DOMWINDOW == 30 (0x120984800) [pid = 1063] [serial = 2553] [outer = 0x0] 17:06:34 INFO - ++DOMWINDOW == 31 (0x121747c00) [pid = 1063] [serial = 2554] [outer = 0x120984800] 17:06:34 INFO - ++DOMWINDOW == 32 (0x127274800) [pid = 1063] [serial = 2555] [outer = 0x120984800] 17:06:34 INFO - ++DOCSHELL 0x1285b4300 == 14 [pid = 1063] [id = 1073] 17:06:34 INFO - ++DOMWINDOW == 33 (0x1216c6c00) [pid = 1063] [serial = 2556] [outer = 0x0] 17:06:34 INFO - ++DOMWINDOW == 34 (0x121cbac00) [pid = 1063] [serial = 2557] [outer = 0x1216c6c00] 17:06:34 INFO - ++DOMWINDOW == 35 (0x11fb7a400) [pid = 1063] [serial = 2558] [outer = 0x1216c6c00] 17:06:34 INFO - ++DOCSHELL 0x129fc4e00 == 15 [pid = 1063] [id = 1074] 17:06:34 INFO - ++DOMWINDOW == 36 (0x12c76f800) [pid = 1063] [serial = 2559] [outer = 0x0] 17:06:34 INFO - ++DOMWINDOW == 37 (0x12c777800) [pid = 1063] [serial = 2560] [outer = 0x12c76f800] 17:06:37 INFO - MEMORY STAT | vsize 3793MB | residentFast 420MB | heapAllocated 137MB 17:06:37 INFO - 449 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_table.js | took 3281ms 17:06:37 INFO - ++DOCSHELL 0x121c8e900 == 16 [pid = 1063] [id = 1075] 17:06:37 INFO - ++DOMWINDOW == 38 (0x128c2a000) [pid = 1063] [serial = 2561] [outer = 0x0] 17:06:37 INFO - ++DOMWINDOW == 39 (0x128e94000) [pid = 1063] [serial = 2562] [outer = 0x128c2a000] 17:06:37 INFO - 450 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_promise.js 17:06:37 INFO - ++DOCSHELL 0x12cb89100 == 17 [pid = 1063] [id = 1076] 17:06:37 INFO - ++DOMWINDOW == 40 (0x1297a0800) [pid = 1063] [serial = 2563] [outer = 0x0] 17:06:37 INFO - ++DOMWINDOW == 41 (0x129900c00) [pid = 1063] [serial = 2564] [outer = 0x1297a0800] 17:06:37 INFO - ++DOCSHELL 0x11fbdf000 == 18 [pid = 1063] [id = 1077] 17:06:37 INFO - ++DOMWINDOW == 42 (0x12019e400) [pid = 1063] [serial = 2565] [outer = 0x0] 17:06:37 INFO - ++DOMWINDOW == 43 (0x120996c00) [pid = 1063] [serial = 2566] [outer = 0x12019e400] 17:06:37 INFO - ++DOMWINDOW == 44 (0x12666b000) [pid = 1063] [serial = 2567] [outer = 0x12019e400] 17:06:38 INFO - ++DOCSHELL 0x127b2e500 == 19 [pid = 1063] [id = 1078] 17:06:38 INFO - ++DOMWINDOW == 45 (0x1355a1c00) [pid = 1063] [serial = 2568] [outer = 0x0] 17:06:38 INFO - ++DOMWINDOW == 46 (0x1355a2000) [pid = 1063] [serial = 2569] [outer = 0x1355a1c00] 17:06:39 INFO - ++DOCSHELL 0x12d52ed00 == 20 [pid = 1063] [id = 1079] 17:06:39 INFO - ++DOMWINDOW == 47 (0x134f78800) [pid = 1063] [serial = 2570] [outer = 0x0] 17:06:39 INFO - ++DOMWINDOW == 48 (0x134f78c00) [pid = 1063] [serial = 2571] [outer = 0x134f78800] 17:06:40 INFO - --DOCSHELL 0x121c22000 == 19 [pid = 1063] [id = 1067] 17:06:40 INFO - --DOCSHELL 0x127e64300 == 18 [pid = 1063] [id = 1068] 17:06:40 INFO - --DOCSHELL 0x129fc4e00 == 17 [pid = 1063] [id = 1074] 17:06:40 INFO - --DOCSHELL 0x11fbdfa00 == 16 [pid = 1063] [id = 1066] 17:06:40 INFO - --DOCSHELL 0x127b2e500 == 15 [pid = 1063] [id = 1078] 17:06:40 INFO - --DOCSHELL 0x12d52ed00 == 14 [pid = 1063] [id = 1079] 17:06:40 INFO - --DOMWINDOW == 47 (0x120961000) [pid = 1063] [serial = 2536] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:40 INFO - --DOMWINDOW == 46 (0x12c50f000) [pid = 1063] [serial = 2538] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 45 (0x13094b000) [pid = 1063] [serial = 2550] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:40 INFO - --DOMWINDOW == 44 (0x1200e3000) [pid = 1063] [serial = 2551] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 43 (0x120996c00) [pid = 1063] [serial = 2566] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 42 (0x120984800) [pid = 1063] [serial = 2553] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 17:06:40 INFO - --DOMWINDOW == 41 (0x1209c4c00) [pid = 1063] [serial = 2544] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:40 INFO - --DOMWINDOW == 40 (0x12c9b4800) [pid = 1063] [serial = 2547] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:40 INFO - --DOMWINDOW == 39 (0x12031e800) [pid = 1063] [serial = 2539] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 38 (0x120547800) [pid = 1063] [serial = 2541] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 17:06:40 INFO - --DOMWINDOW == 37 (0x134f78800) [pid = 1063] [serial = 2570] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:40 INFO - --DOMWINDOW == 36 (0x121cbac00) [pid = 1063] [serial = 2557] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 35 (0x120541c00) [pid = 1063] [serial = 2540] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 34 (0x120343c00) [pid = 1063] [serial = 2552] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 33 (0x121747c00) [pid = 1063] [serial = 2554] [outer = 0x0] [url = about:blank] 17:06:40 INFO - --DOMWINDOW == 32 (0x1272ba400) [pid = 1063] [serial = 2543] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 17:06:40 INFO - --DOMWINDOW == 31 (0x127274800) [pid = 1063] [serial = 2555] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 17:06:40 INFO - MEMORY STAT | vsize 3792MB | residentFast 416MB | heapAllocated 129MB 17:06:40 INFO - 451 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_promise.js | took 3155ms 17:06:40 INFO - ++DOCSHELL 0x11fbe2700 == 15 [pid = 1063] [id = 1080] 17:06:40 INFO - ++DOMWINDOW == 32 (0x11fe61400) [pid = 1063] [serial = 2572] [outer = 0x0] 17:06:40 INFO - ++DOMWINDOW == 33 (0x120343c00) [pid = 1063] [serial = 2573] [outer = 0x11fe61400] 17:06:40 INFO - 452 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_property_provider.js 17:06:40 INFO - ++DOCSHELL 0x12092a600 == 16 [pid = 1063] [id = 1081] 17:06:40 INFO - ++DOMWINDOW == 34 (0x10a467400) [pid = 1063] [serial = 2574] [outer = 0x0] 17:06:40 INFO - ++DOMWINDOW == 35 (0x12054bc00) [pid = 1063] [serial = 2575] [outer = 0x10a467400] 17:06:41 INFO - [1063] WARNING: Too large an index passed to GetChildAt: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4055 17:06:41 INFO - [1063] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4060 17:06:41 INFO - MEMORY STAT | vsize 3792MB | residentFast 417MB | heapAllocated 131MB 17:06:41 INFO - 453 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_property_provider.js | took 481ms 17:06:41 INFO - ++DOCSHELL 0x127e64300 == 17 [pid = 1063] [id = 1082] 17:06:41 INFO - ++DOMWINDOW == 36 (0x1285cb800) [pid = 1063] [serial = 2576] [outer = 0x0] 17:06:41 INFO - ++DOMWINDOW == 37 (0x12963d000) [pid = 1063] [serial = 2577] [outer = 0x1285cb800] 17:06:41 INFO - 454 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_reflow.js 17:06:41 INFO - ++DOCSHELL 0x129fc3000 == 18 [pid = 1063] [id = 1083] 17:06:41 INFO - ++DOMWINDOW == 38 (0x1299ea800) [pid = 1063] [serial = 2578] [outer = 0x0] 17:06:41 INFO - ++DOMWINDOW == 39 (0x129f83800) [pid = 1063] [serial = 2579] [outer = 0x1299ea800] 17:06:41 INFO - ++DOCSHELL 0x12c6dbf00 == 19 [pid = 1063] [id = 1084] 17:06:41 INFO - ++DOMWINDOW == 40 (0x11fa56000) [pid = 1063] [serial = 2580] [outer = 0x0] 17:06:41 INFO - ++DOMWINDOW == 41 (0x129aa6c00) [pid = 1063] [serial = 2581] [outer = 0x11fa56000] 17:06:41 INFO - ++DOMWINDOW == 42 (0x12a1d4800) [pid = 1063] [serial = 2582] [outer = 0x11fa56000] 17:06:41 INFO - ++DOCSHELL 0x12cb89600 == 20 [pid = 1063] [id = 1085] 17:06:41 INFO - ++DOMWINDOW == 43 (0x130995400) [pid = 1063] [serial = 2583] [outer = 0x0] 17:06:41 INFO - ++DOMWINDOW == 44 (0x130995c00) [pid = 1063] [serial = 2584] [outer = 0x130995400] 17:06:43 INFO - --DOCSHELL 0x1285b4300 == 19 [pid = 1063] [id = 1073] 17:06:43 INFO - --DOCSHELL 0x12cb89600 == 18 [pid = 1063] [id = 1085] 17:06:43 INFO - --DOCSHELL 0x11fbdf000 == 17 [pid = 1063] [id = 1077] 17:06:43 INFO - --DOCSHELL 0x121730200 == 16 [pid = 1063] [id = 1072] 17:06:43 INFO - --DOCSHELL 0x12cb89100 == 15 [pid = 1063] [id = 1076] 17:06:43 INFO - --DOCSHELL 0x121c8e900 == 14 [pid = 1063] [id = 1075] 17:06:43 INFO - --DOCSHELL 0x1201b0200 == 13 [pid = 1063] [id = 1071] 17:06:43 INFO - --DOMWINDOW == 43 (0x134f78c00) [pid = 1063] [serial = 2571] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:06:43 INFO - --DOMWINDOW == 42 (0x12c9b4c00) [pid = 1063] [serial = 2548] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 41 (0x1272a0800) [pid = 1063] [serial = 2546] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:43 INFO - --DOMWINDOW == 40 (0x12054bc00) [pid = 1063] [serial = 2575] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 39 (0x120343c00) [pid = 1063] [serial = 2573] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 38 (0x128e94000) [pid = 1063] [serial = 2562] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 37 (0x1297a0800) [pid = 1063] [serial = 2563] [outer = 0x0] [url = data:text/html;charset=utf8,test%20for%20console%20and%20promises] 17:06:43 INFO - --DOMWINDOW == 36 (0x129aa6c00) [pid = 1063] [serial = 2581] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 35 (0x1216c6c00) [pid = 1063] [serial = 2556] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:43 INFO - --DOMWINDOW == 34 (0x12019e400) [pid = 1063] [serial = 2565] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:43 INFO - --DOMWINDOW == 33 (0x1355a1c00) [pid = 1063] [serial = 2568] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:43 INFO - --DOMWINDOW == 32 (0x12c76f800) [pid = 1063] [serial = 2559] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:43 INFO - --DOMWINDOW == 31 (0x10a467400) [pid = 1063] [serial = 2574] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20the%20JS%20property%20provider] 17:06:43 INFO - --DOMWINDOW == 30 (0x11fe61400) [pid = 1063] [serial = 2572] [outer = 0x0] [url = about:blank] 17:06:43 INFO - --DOMWINDOW == 29 (0x128c2a000) [pid = 1063] [serial = 2561] [outer = 0x0] [url = about:blank] 17:06:43 INFO - MEMORY STAT | vsize 3791MB | residentFast 416MB | heapAllocated 128MB 17:06:43 INFO - 455 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_reflow.js | took 2335ms 17:06:43 INFO - ++DOCSHELL 0x11fbdff00 == 14 [pid = 1063] [id = 1086] 17:06:43 INFO - ++DOMWINDOW == 30 (0x12031e800) [pid = 1063] [serial = 2585] [outer = 0x0] 17:06:43 INFO - ++DOMWINDOW == 31 (0x120538c00) [pid = 1063] [serial = 2586] [outer = 0x12031e800] 17:06:43 INFO - 456 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js 17:06:43 INFO - ++DOCSHELL 0x1201fd600 == 15 [pid = 1063] [id = 1087] 17:06:43 INFO - ++DOMWINDOW == 32 (0x120984800) [pid = 1063] [serial = 2587] [outer = 0x0] 17:06:43 INFO - ++DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 2588] [outer = 0x120984800] 17:06:44 INFO - ++DOCSHELL 0x12737ba00 == 16 [pid = 1063] [id = 1088] 17:06:44 INFO - ++DOMWINDOW == 34 (0x1216a2800) [pid = 1063] [serial = 2589] [outer = 0x0] 17:06:44 INFO - ++DOMWINDOW == 35 (0x127274800) [pid = 1063] [serial = 2590] [outer = 0x1216a2800] 17:06:44 INFO - ++DOCSHELL 0x127768800 == 17 [pid = 1063] [id = 1089] 17:06:44 INFO - ++DOMWINDOW == 36 (0x1276eb400) [pid = 1063] [serial = 2591] [outer = 0x0] 17:06:44 INFO - ++DOMWINDOW == 37 (0x1299ea000) [pid = 1063] [serial = 2592] [outer = 0x1276eb400] 17:06:44 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:06:44 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:06:44 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 17:06:44 INFO - ++DOMWINDOW == 38 (0x1272a0800) [pid = 1063] [serial = 2593] [outer = 0x1276eb400] 17:06:44 INFO - ++DOCSHELL 0x130927500 == 18 [pid = 1063] [id = 1090] 17:06:44 INFO - ++DOMWINDOW == 39 (0x134f93400) [pid = 1063] [serial = 2594] [outer = 0x0] 17:06:44 INFO - ++DOMWINDOW == 40 (0x134f93800) [pid = 1063] [serial = 2595] [outer = 0x134f93400] 17:06:45 INFO - ++DOCSHELL 0x1334def00 == 19 [pid = 1063] [id = 1091] 17:06:45 INFO - ++DOMWINDOW == 41 (0x1308a7400) [pid = 1063] [serial = 2596] [outer = 0x0] 17:06:45 INFO - ++DOMWINDOW == 42 (0x1308a7800) [pid = 1063] [serial = 2597] [outer = 0x1308a7400] 17:06:46 INFO - ++DOCSHELL 0x137081700 == 20 [pid = 1063] [id = 1092] 17:06:46 INFO - ++DOMWINDOW == 43 (0x1538eac00) [pid = 1063] [serial = 2598] [outer = 0x0] 17:06:46 INFO - ++DOMWINDOW == 44 (0x158995800) [pid = 1063] [serial = 2599] [outer = 0x1538eac00] 17:06:47 INFO - MEMORY STAT | vsize 3835MB | residentFast 468MB | heapAllocated 187MB 17:06:47 INFO - 457 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js | took 3298ms 17:06:47 INFO - ++DOCSHELL 0x137ee1f00 == 21 [pid = 1063] [id = 1093] 17:06:47 INFO - ++DOMWINDOW == 45 (0x127e67c00) [pid = 1063] [serial = 2600] [outer = 0x0] 17:06:47 INFO - ++DOMWINDOW == 46 (0x127ed2c00) [pid = 1063] [serial = 2601] [outer = 0x127e67c00] 17:06:47 INFO - 458 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js 17:06:47 INFO - ++DOCSHELL 0x1332bdf00 == 22 [pid = 1063] [id = 1094] 17:06:47 INFO - ++DOMWINDOW == 47 (0x128c2a000) [pid = 1063] [serial = 2602] [outer = 0x0] 17:06:47 INFO - ++DOMWINDOW == 48 (0x128ffb000) [pid = 1063] [serial = 2603] [outer = 0x128c2a000] 17:06:47 INFO - ++DOCSHELL 0x1201f9a00 == 23 [pid = 1063] [id = 1095] 17:06:47 INFO - ++DOMWINDOW == 49 (0x127ed2000) [pid = 1063] [serial = 2604] [outer = 0x0] 17:06:47 INFO - ++DOMWINDOW == 50 (0x1284e0400) [pid = 1063] [serial = 2605] [outer = 0x127ed2000] 17:06:47 INFO - ++DOMWINDOW == 51 (0x128738000) [pid = 1063] [serial = 2606] [outer = 0x127ed2000] 17:06:48 INFO - ++DOCSHELL 0x12de5e900 == 24 [pid = 1063] [id = 1096] 17:06:48 INFO - ++DOMWINDOW == 52 (0x1367ed800) [pid = 1063] [serial = 2607] [outer = 0x0] 17:06:48 INFO - ++DOMWINDOW == 53 (0x136a4bc00) [pid = 1063] [serial = 2608] [outer = 0x1367ed800] 17:06:49 INFO - ++DOMWINDOW == 54 (0x1589e3400) [pid = 1063] [serial = 2609] [outer = 0x128c2a000] 17:06:49 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:06:50 INFO - --DOCSHELL 0x11fbe2700 == 23 [pid = 1063] [id = 1080] 17:06:50 INFO - --DOCSHELL 0x12092a600 == 22 [pid = 1063] [id = 1081] 17:06:50 INFO - --DOCSHELL 0x12c6dbf00 == 21 [pid = 1063] [id = 1084] 17:06:50 INFO - --DOCSHELL 0x129fc3000 == 20 [pid = 1063] [id = 1083] 17:06:50 INFO - --DOCSHELL 0x12de5e900 == 19 [pid = 1063] [id = 1096] 17:06:50 INFO - --DOCSHELL 0x127e64300 == 18 [pid = 1063] [id = 1082] 17:06:50 INFO - --DOCSHELL 0x130927500 == 17 [pid = 1063] [id = 1090] 17:06:50 INFO - --DOCSHELL 0x1334def00 == 16 [pid = 1063] [id = 1091] 17:06:50 INFO - --DOCSHELL 0x137081700 == 15 [pid = 1063] [id = 1092] 17:06:50 INFO - --DOCSHELL 0x127768800 == 14 [pid = 1063] [id = 1089] 17:06:50 INFO - --DOCSHELL 0x12737ba00 == 13 [pid = 1063] [id = 1088] 17:06:50 INFO - --DOMWINDOW == 53 (0x11fb7a400) [pid = 1063] [serial = 2558] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:50 INFO - --DOMWINDOW == 52 (0x12c777800) [pid = 1063] [serial = 2560] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 51 (0x12666b000) [pid = 1063] [serial = 2567] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:50 INFO - --DOMWINDOW == 50 (0x1355a2000) [pid = 1063] [serial = 2569] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 49 (0x129900c00) [pid = 1063] [serial = 2564] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 48 (0x1284e0400) [pid = 1063] [serial = 2605] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 47 (0x130995400) [pid = 1063] [serial = 2583] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:50 INFO - --DOMWINDOW == 46 (0x11fa56000) [pid = 1063] [serial = 2580] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:50 INFO - --DOMWINDOW == 45 (0x1285cb800) [pid = 1063] [serial = 2576] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 44 (0x1299ea800) [pid = 1063] [serial = 2578] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20reflow%20activity] 17:06:50 INFO - --DOMWINDOW == 43 (0x12963d000) [pid = 1063] [serial = 2577] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 42 (0x129f83800) [pid = 1063] [serial = 2579] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 41 (0x12031e800) [pid = 1063] [serial = 2585] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 40 (0x1299ea000) [pid = 1063] [serial = 2592] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 39 (0x1216a2800) [pid = 1063] [serial = 2589] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-window.xul] 17:06:50 INFO - --DOMWINDOW == 38 (0x1308a7400) [pid = 1063] [serial = 2596] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:50 INFO - --DOMWINDOW == 37 (0x134f93400) [pid = 1063] [serial = 2594] [outer = 0x0] [url = chrome://devtools/content/scratchpad/scratchpad.xul] 17:06:50 INFO - --DOMWINDOW == 36 (0x1276eb400) [pid = 1063] [serial = 2591] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:50 INFO - --DOMWINDOW == 35 (0x1538eac00) [pid = 1063] [serial = 2598] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:06:50 INFO - --DOMWINDOW == 34 (0x120984800) [pid = 1063] [serial = 2587] [outer = 0x0] [url = data:text/html;charset=utf8,<p>test%20Scratchpad%20panel%20linking</p>] 17:06:50 INFO - --DOMWINDOW == 33 (0x1216bac00) [pid = 1063] [serial = 2588] [outer = 0x0] [url = about:blank] 17:06:50 INFO - --DOMWINDOW == 32 (0x120538c00) [pid = 1063] [serial = 2586] [outer = 0x0] [url = about:blank] 17:06:51 INFO - MEMORY STAT | vsize 3791MB | residentFast 391MB | heapAllocated 128MB 17:06:51 INFO - 459 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js | took 3745ms 17:06:51 INFO - ++DOCSHELL 0x121730200 == 14 [pid = 1063] [id = 1097] 17:06:51 INFO - ++DOMWINDOW == 33 (0x120594400) [pid = 1063] [serial = 2610] [outer = 0x0] 17:06:51 INFO - ++DOMWINDOW == 34 (0x120961000) [pid = 1063] [serial = 2611] [outer = 0x120594400] 17:06:51 INFO - 460 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js 17:06:51 INFO - ++DOCSHELL 0x127e63400 == 15 [pid = 1063] [id = 1098] 17:06:51 INFO - ++DOMWINDOW == 35 (0x121747c00) [pid = 1063] [serial = 2612] [outer = 0x0] 17:06:51 INFO - ++DOMWINDOW == 36 (0x12666b000) [pid = 1063] [serial = 2613] [outer = 0x121747c00] 17:06:51 INFO - ++DOCSHELL 0x1285b4300 == 16 [pid = 1063] [id = 1099] 17:06:51 INFO - ++DOMWINDOW == 37 (0x10a467400) [pid = 1063] [serial = 2614] [outer = 0x0] 17:06:51 INFO - ++DOMWINDOW == 38 (0x121ddb400) [pid = 1063] [serial = 2615] [outer = 0x10a467400] 17:06:51 INFO - ++DOMWINDOW == 39 (0x127e48800) [pid = 1063] [serial = 2616] [outer = 0x10a467400] 17:06:51 INFO - ++DOCSHELL 0x12a059f00 == 17 [pid = 1063] [id = 1100] 17:06:51 INFO - ++DOMWINDOW == 40 (0x12c989000) [pid = 1063] [serial = 2617] [outer = 0x0] 17:06:51 INFO - ++DOMWINDOW == 41 (0x12c9b4000) [pid = 1063] [serial = 2618] [outer = 0x12c989000] 17:06:51 INFO - ++DOCSHELL 0x12d4c0200 == 18 [pid = 1063] [id = 1101] 17:06:51 INFO - ++DOMWINDOW == 42 (0x13539a400) [pid = 1063] [serial = 2619] [outer = 0x0] 17:06:52 INFO - ++DOMWINDOW == 43 (0x1367edc00) [pid = 1063] [serial = 2620] [outer = 0x13539a400] 17:06:52 INFO - ++DOMWINDOW == 44 (0x1333bb400) [pid = 1063] [serial = 2621] [outer = 0x121747c00] 17:06:52 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:06:52 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:52 INFO - ++DOCSHELL 0x13092a700 == 19 [pid = 1063] [id = 1102] 17:06:52 INFO - ++DOMWINDOW == 45 (0x12d4ef800) [pid = 1063] [serial = 2622] [outer = 0x0] 17:06:52 INFO - ++DOMWINDOW == 46 (0x12df27000) [pid = 1063] [serial = 2623] [outer = 0x12d4ef800] 17:06:53 INFO - --DOCSHELL 0x12d4c0200 == 18 [pid = 1063] [id = 1101] 17:06:53 INFO - MEMORY STAT | vsize 3808MB | residentFast 420MB | heapAllocated 137MB 17:06:53 INFO - 461 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js | took 2386ms 17:06:53 INFO - ++DOCSHELL 0x131a98000 == 19 [pid = 1063] [id = 1103] 17:06:53 INFO - ++DOMWINDOW == 47 (0x12b050c00) [pid = 1063] [serial = 2624] [outer = 0x0] 17:06:53 INFO - ++DOMWINDOW == 48 (0x12bba2c00) [pid = 1063] [serial = 2625] [outer = 0x12b050c00] 17:06:53 INFO - 462 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split.js 17:06:53 INFO - ++DOCSHELL 0x12de5e400 == 20 [pid = 1063] [id = 1104] 17:06:53 INFO - ++DOMWINDOW == 49 (0x12c26c400) [pid = 1063] [serial = 2626] [outer = 0x0] 17:06:53 INFO - ++DOMWINDOW == 50 (0x12c3ea400) [pid = 1063] [serial = 2627] [outer = 0x12c26c400] 17:06:54 INFO - ++DOCSHELL 0x1334dea00 == 21 [pid = 1063] [id = 1105] 17:06:54 INFO - ++DOMWINDOW == 51 (0x12c3ea000) [pid = 1063] [serial = 2628] [outer = 0x0] 17:06:54 INFO - ++DOMWINDOW == 52 (0x12c41a800) [pid = 1063] [serial = 2629] [outer = 0x12c3ea000] 17:06:54 INFO - ++DOMWINDOW == 53 (0x11f4c0800) [pid = 1063] [serial = 2630] [outer = 0x12c3ea000] 17:06:54 INFO - ++DOCSHELL 0x11f881400 == 22 [pid = 1063] [id = 1106] 17:06:54 INFO - ++DOMWINDOW == 54 (0x11f9a5c00) [pid = 1063] [serial = 2631] [outer = 0x0] 17:06:54 INFO - ++DOMWINDOW == 55 (0x11fadc400) [pid = 1063] [serial = 2632] [outer = 0x11f9a5c00] 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - ++DOCSHELL 0x127a9ca00 == 23 [pid = 1063] [id = 1107] 17:06:55 INFO - ++DOMWINDOW == 56 (0x127f0bc00) [pid = 1063] [serial = 2633] [outer = 0x0] 17:06:55 INFO - ++DOMWINDOW == 57 (0x128e94000) [pid = 1063] [serial = 2634] [outer = 0x127f0bc00] 17:06:55 INFO - ++DOCSHELL 0x127b2ea00 == 24 [pid = 1063] [id = 1108] 17:06:55 INFO - ++DOMWINDOW == 58 (0x1284e0400) [pid = 1063] [serial = 2635] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x127b2ef00 == 25 [pid = 1063] [id = 1109] 17:06:55 INFO - ++DOMWINDOW == 59 (0x1299ac000) [pid = 1063] [serial = 2636] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x127b32100 == 26 [pid = 1063] [id = 1110] 17:06:55 INFO - ++DOMWINDOW == 60 (0x1299ea400) [pid = 1063] [serial = 2637] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x1285b3400 == 27 [pid = 1063] [id = 1111] 17:06:55 INFO - ++DOMWINDOW == 61 (0x12a01e400) [pid = 1063] [serial = 2638] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x1285b6100 == 28 [pid = 1063] [id = 1112] 17:06:55 INFO - ++DOMWINDOW == 62 (0x12bf6e800) [pid = 1063] [serial = 2639] [outer = 0x0] 17:06:55 INFO - ++DOMWINDOW == 63 (0x12ae6a000) [pid = 1063] [serial = 2640] [outer = 0x1284e0400] 17:06:55 INFO - ++DOMWINDOW == 64 (0x12c345400) [pid = 1063] [serial = 2641] [outer = 0x1299ac000] 17:06:55 INFO - ++DOMWINDOW == 65 (0x12c777400) [pid = 1063] [serial = 2642] [outer = 0x1299ea400] 17:06:55 INFO - ++DOMWINDOW == 66 (0x12c78f800) [pid = 1063] [serial = 2643] [outer = 0x12a01e400] 17:06:55 INFO - ++DOMWINDOW == 67 (0x12c9f5800) [pid = 1063] [serial = 2644] [outer = 0x12bf6e800] 17:06:55 INFO - ++DOCSHELL 0x12c6db000 == 29 [pid = 1063] [id = 1113] 17:06:55 INFO - ++DOMWINDOW == 68 (0x1353e2c00) [pid = 1063] [serial = 2645] [outer = 0x0] 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - ++DOCSHELL 0x12c6dd300 == 30 [pid = 1063] [id = 1114] 17:06:55 INFO - ++DOMWINDOW == 69 (0x1353e2000) [pid = 1063] [serial = 2646] [outer = 0x0] 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - ++DOMWINDOW == 70 (0x13732fc00) [pid = 1063] [serial = 2647] [outer = 0x1353e2c00] 17:06:55 INFO - ++DOMWINDOW == 71 (0x12c50f000) [pid = 1063] [serial = 2648] [outer = 0x1353e2000] 17:06:55 INFO - ++DOCSHELL 0x12d52de00 == 31 [pid = 1063] [id = 1115] 17:06:55 INFO - ++DOMWINDOW == 72 (0x15899b800) [pid = 1063] [serial = 2649] [outer = 0x0] 17:06:55 INFO - ++DOMWINDOW == 73 (0x13643f000) [pid = 1063] [serial = 2650] [outer = 0x15899b800] 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - ++DOCSHELL 0x12bb2f800 == 32 [pid = 1063] [id = 1116] 17:06:55 INFO - ++DOMWINDOW == 74 (0x13480fc00) [pid = 1063] [serial = 2651] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x12de5d000 == 33 [pid = 1063] [id = 1117] 17:06:55 INFO - ++DOMWINDOW == 75 (0x136531000) [pid = 1063] [serial = 2652] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x12de5da00 == 34 [pid = 1063] [id = 1118] 17:06:55 INFO - ++DOMWINDOW == 76 (0x13643fc00) [pid = 1063] [serial = 2653] [outer = 0x0] 17:06:55 INFO - ++DOCSHELL 0x12de5f800 == 35 [pid = 1063] [id = 1119] 17:06:55 INFO - ++DOMWINDOW == 77 (0x136531400) [pid = 1063] [serial = 2654] [outer = 0x0] 17:06:55 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:06:55 INFO - ++DOCSHELL 0x12de60200 == 36 [pid = 1063] [id = 1120] 17:06:55 INFO - ++DOMWINDOW == 78 (0x155961800) [pid = 1063] [serial = 2655] [outer = 0x0] 17:06:55 INFO - ++DOMWINDOW == 79 (0x136b0a000) [pid = 1063] [serial = 2656] [outer = 0x155961800] 17:06:56 INFO - ++DOMWINDOW == 80 (0x121cbac00) [pid = 1063] [serial = 2657] [outer = 0x13480fc00] 17:06:56 INFO - ++DOMWINDOW == 81 (0x12c777800) [pid = 1063] [serial = 2658] [outer = 0x136531000] 17:06:56 INFO - ++DOMWINDOW == 82 (0x136b21400) [pid = 1063] [serial = 2659] [outer = 0x13643fc00] 17:06:56 INFO - ++DOMWINDOW == 83 (0x136b21c00) [pid = 1063] [serial = 2660] [outer = 0x136531400] 17:06:56 INFO - ++DOMWINDOW == 84 (0x13722c400) [pid = 1063] [serial = 2661] [outer = 0x155961800] 17:06:56 INFO - ++DOCSHELL 0x12de60700 == 37 [pid = 1063] [id = 1121] 17:06:56 INFO - ++DOMWINDOW == 85 (0x1563cd000) [pid = 1063] [serial = 2662] [outer = 0x0] 17:06:56 INFO - ++DOMWINDOW == 86 (0x1563cd400) [pid = 1063] [serial = 2663] [outer = 0x1563cd000] 17:06:57 INFO - ++DOCSHELL 0x137ee5b00 == 38 [pid = 1063] [id = 1122] 17:06:57 INFO - ++DOMWINDOW == 87 (0x15bf96000) [pid = 1063] [serial = 2664] [outer = 0x0] 17:06:57 INFO - ++DOMWINDOW == 88 (0x15bf96400) [pid = 1063] [serial = 2665] [outer = 0x15bf96000] 17:06:57 INFO - ++DOCSHELL 0x1332bfd00 == 39 [pid = 1063] [id = 1123] 17:06:57 INFO - ++DOMWINDOW == 89 (0x12f1d6c00) [pid = 1063] [serial = 2666] [outer = 0x0] 17:06:57 INFO - ++DOMWINDOW == 90 (0x12f1df000) [pid = 1063] [serial = 2667] [outer = 0x12f1d6c00] 17:06:58 INFO - --DOCSHELL 0x11fbdff00 == 38 [pid = 1063] [id = 1086] 17:06:58 INFO - --DOCSHELL 0x1201f9a00 == 37 [pid = 1063] [id = 1095] 17:06:58 INFO - --DOCSHELL 0x1201fd600 == 36 [pid = 1063] [id = 1087] 17:06:58 INFO - --DOCSHELL 0x12a059f00 == 35 [pid = 1063] [id = 1100] 17:06:58 INFO - --DOCSHELL 0x1332bdf00 == 34 [pid = 1063] [id = 1094] 17:06:58 INFO - --DOCSHELL 0x13092a700 == 33 [pid = 1063] [id = 1102] 17:06:59 INFO - --DOCSHELL 0x12de60200 == 32 [pid = 1063] [id = 1120] 17:06:59 INFO - --DOMWINDOW == 89 (0x12a1d4800) [pid = 1063] [serial = 2582] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:59 INFO - --DOMWINDOW == 88 (0x158995800) [pid = 1063] [serial = 2599] [outer = 0x0] [url = about:blank] 17:06:59 INFO - --DOMWINDOW == 87 (0x130995c00) [pid = 1063] [serial = 2584] [outer = 0x0] [url = about:blank] 17:06:59 INFO - --DOMWINDOW == 86 (0x1272a0800) [pid = 1063] [serial = 2593] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:06:59 INFO - --DOMWINDOW == 85 (0x1308a7800) [pid = 1063] [serial = 2597] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:06:59 INFO - --DOMWINDOW == 84 (0x134f93800) [pid = 1063] [serial = 2595] [outer = 0x0] [url = about:blank] 17:06:59 INFO - --DOMWINDOW == 83 (0x127274800) [pid = 1063] [serial = 2590] [outer = 0x0] [url = about:blank] 17:06:59 INFO - ++DOCSHELL 0x121646100 == 33 [pid = 1063] [id = 1124] 17:06:59 INFO - ++DOMWINDOW == 84 (0x12a06c000) [pid = 1063] [serial = 2668] [outer = 0x0] 17:06:59 INFO - ++DOMWINDOW == 85 (0x12a06cc00) [pid = 1063] [serial = 2669] [outer = 0x12a06c000] 17:06:59 INFO - ++DOCSHELL 0x12d25b500 == 34 [pid = 1063] [id = 1125] 17:06:59 INFO - ++DOMWINDOW == 86 (0x131a86000) [pid = 1063] [serial = 2670] [outer = 0x0] 17:06:59 INFO - ++DOMWINDOW == 87 (0x131b3ec00) [pid = 1063] [serial = 2671] [outer = 0x131a86000] 17:07:00 INFO - ++DOCSHELL 0x12d4c1100 == 35 [pid = 1063] [id = 1126] 17:07:00 INFO - ++DOMWINDOW == 88 (0x1367ed400) [pid = 1063] [serial = 2672] [outer = 0x0] 17:07:00 INFO - ++DOMWINDOW == 89 (0x12f10ac00) [pid = 1063] [serial = 2673] [outer = 0x1367ed400] 17:07:00 INFO - ++DOCSHELL 0x12cb89600 == 36 [pid = 1063] [id = 1127] 17:07:00 INFO - ++DOMWINDOW == 90 (0x130938400) [pid = 1063] [serial = 2674] [outer = 0x0] 17:07:00 INFO - ++DOMWINDOW == 91 (0x130938800) [pid = 1063] [serial = 2675] [outer = 0x130938400] 17:07:00 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:00 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:00 INFO - ++DOCSHELL 0x12d25ba00 == 37 [pid = 1063] [id = 1128] 17:07:00 INFO - ++DOMWINDOW == 92 (0x134fb9000) [pid = 1063] [serial = 2676] [outer = 0x0] 17:07:00 INFO - ++DOMWINDOW == 93 (0x134fb9400) [pid = 1063] [serial = 2677] [outer = 0x134fb9000] 17:07:00 INFO - ++DOCSHELL 0x12e039100 == 38 [pid = 1063] [id = 1129] 17:07:00 INFO - ++DOMWINDOW == 94 (0x13760f000) [pid = 1063] [serial = 2678] [outer = 0x0] 17:07:01 INFO - ++DOMWINDOW == 95 (0x120343c00) [pid = 1063] [serial = 2679] [outer = 0x13760f000] 17:07:01 INFO - [1063] WARNING: sRGB_framebuffer marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:07:01 INFO - [1063] WARNING: depth_texture marked as unsupported: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/gfx/gl/GLContextFeatures.cpp, line 869 17:07:01 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:01 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:01 INFO - ++DOCSHELL 0x1581da500 == 39 [pid = 1063] [id = 1130] 17:07:01 INFO - ++DOMWINDOW == 96 (0x15575a400) [pid = 1063] [serial = 2680] [outer = 0x0] 17:07:01 INFO - ++DOMWINDOW == 97 (0x15575a800) [pid = 1063] [serial = 2681] [outer = 0x15575a400] 17:07:01 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 17:07:01 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:01 INFO - [1063] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3155 17:07:01 INFO - --DOCSHELL 0x12de5d000 == 38 [pid = 1063] [id = 1117] 17:07:01 INFO - --DOCSHELL 0x12de5da00 == 37 [pid = 1063] [id = 1118] 17:07:01 INFO - --DOCSHELL 0x12bb2f800 == 36 [pid = 1063] [id = 1116] 17:07:01 INFO - --DOCSHELL 0x12de5f800 == 35 [pid = 1063] [id = 1119] 17:07:01 INFO - --DOCSHELL 0x12c6dd300 == 34 [pid = 1063] [id = 1114] 17:07:01 INFO - --DOCSHELL 0x12c6db000 == 33 [pid = 1063] [id = 1113] 17:07:01 INFO - --DOCSHELL 0x127a9ca00 == 32 [pid = 1063] [id = 1107] 17:07:01 INFO - --DOCSHELL 0x137ee5b00 == 31 [pid = 1063] [id = 1122] 17:07:01 INFO - --DOCSHELL 0x12d4c1100 == 30 [pid = 1063] [id = 1126] 17:07:01 INFO - --DOCSHELL 0x12d25ba00 == 29 [pid = 1063] [id = 1128] 17:07:01 INFO - --DOCSHELL 0x11f881400 == 28 [pid = 1063] [id = 1106] 17:07:02 INFO - --DOCSHELL 0x12d52de00 == 27 [pid = 1063] [id = 1115] 17:07:02 INFO - --DOCSHELL 0x137ee1f00 == 26 [pid = 1063] [id = 1093] 17:07:02 INFO - --DOCSHELL 0x121730200 == 25 [pid = 1063] [id = 1097] 17:07:02 INFO - --DOCSHELL 0x121646100 == 24 [pid = 1063] [id = 1124] 17:07:02 INFO - --DOCSHELL 0x1332bfd00 == 23 [pid = 1063] [id = 1123] 17:07:02 INFO - --DOCSHELL 0x127e63400 == 22 [pid = 1063] [id = 1098] 17:07:02 INFO - --DOCSHELL 0x12d25b500 == 21 [pid = 1063] [id = 1125] 17:07:02 INFO - --DOCSHELL 0x12de60700 == 20 [pid = 1063] [id = 1121] 17:07:02 INFO - --DOCSHELL 0x1285b4300 == 19 [pid = 1063] [id = 1099] 17:07:02 INFO - --DOCSHELL 0x127b2ea00 == 18 [pid = 1063] [id = 1108] 17:07:02 INFO - --DOCSHELL 0x127b2ef00 == 17 [pid = 1063] [id = 1109] 17:07:02 INFO - --DOCSHELL 0x127b32100 == 16 [pid = 1063] [id = 1110] 17:07:02 INFO - --DOCSHELL 0x1285b3400 == 15 [pid = 1063] [id = 1111] 17:07:02 INFO - --DOCSHELL 0x1285b6100 == 14 [pid = 1063] [id = 1112] 17:07:03 INFO - ++DOCSHELL 0x11f52ad00 == 15 [pid = 1063] [id = 1131] 17:07:03 INFO - ++DOMWINDOW == 98 (0x11f80f000) [pid = 1063] [serial = 2682] [outer = 0x0] 17:07:03 INFO - ++DOMWINDOW == 99 (0x11f8a9800) [pid = 1063] [serial = 2683] [outer = 0x11f80f000] 17:07:03 INFO - --DOMWINDOW == 98 (0x121747c00) [pid = 1063] [serial = 2612] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:07:03 INFO - --DOMWINDOW == 97 (0x127e67c00) [pid = 1063] [serial = 2600] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 96 (0x120594400) [pid = 1063] [serial = 2610] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 95 (0x13539a400) [pid = 1063] [serial = 2619] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 94 (0x128c2a000) [pid = 1063] [serial = 2602] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 17:07:03 INFO - --DOMWINDOW == 93 (0x12c989000) [pid = 1063] [serial = 2617] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 17:07:03 INFO - --DOMWINDOW == 92 (0x1367ed800) [pid = 1063] [serial = 2607] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:03 INFO - --DOMWINDOW == 91 (0x155961800) [pid = 1063] [serial = 2655] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:03 INFO - --DOMWINDOW == 90 (0x13760f000) [pid = 1063] [serial = 2678] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 89 (0x130938400) [pid = 1063] [serial = 2674] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 88 (0x12bf6e800) [pid = 1063] [serial = 2639] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:03 INFO - --DOMWINDOW == 87 (0x1284e0400) [pid = 1063] [serial = 2635] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:03 INFO - --DOMWINDOW == 86 (0x1299ac000) [pid = 1063] [serial = 2636] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:03 INFO - --DOMWINDOW == 85 (0x1299ea400) [pid = 1063] [serial = 2637] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:03 INFO - --DOMWINDOW == 84 (0x12a01e400) [pid = 1063] [serial = 2638] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:03 INFO - --DOMWINDOW == 83 (0x1353e2c00) [pid = 1063] [serial = 2645] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:03 INFO - --DOMWINDOW == 82 (0x1367ed400) [pid = 1063] [serial = 2672] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 81 (0x136531400) [pid = 1063] [serial = 2654] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:03 INFO - --DOMWINDOW == 80 (0x13643fc00) [pid = 1063] [serial = 2653] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:03 INFO - --DOMWINDOW == 79 (0x136531000) [pid = 1063] [serial = 2652] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:03 INFO - --DOMWINDOW == 78 (0x13480fc00) [pid = 1063] [serial = 2651] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:03 INFO - --DOMWINDOW == 77 (0x1353e2000) [pid = 1063] [serial = 2646] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:03 INFO - --DOMWINDOW == 76 (0x12f10ac00) [pid = 1063] [serial = 2673] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 75 (0x134fb9000) [pid = 1063] [serial = 2676] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox-window.xul] 17:07:03 INFO - --DOMWINDOW == 74 (0x15575a800) [pid = 1063] [serial = 2681] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 73 (0x15bf96000) [pid = 1063] [serial = 2664] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:03 INFO - --DOMWINDOW == 72 (0x15575a400) [pid = 1063] [serial = 2680] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 71 (0x10a467400) [pid = 1063] [serial = 2614] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:03 INFO - --DOMWINDOW == 70 (0x127ed2000) [pid = 1063] [serial = 2604] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:03 INFO - --DOMWINDOW == 69 (0x12d4ef800) [pid = 1063] [serial = 2622] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:03 INFO - --DOMWINDOW == 68 (0x13722c400) [pid = 1063] [serial = 2661] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:03 INFO - --DOMWINDOW == 67 (0x120343c00) [pid = 1063] [serial = 2679] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 66 (0x130938800) [pid = 1063] [serial = 2675] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 65 (0x136b0a000) [pid = 1063] [serial = 2656] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 64 (0x121ddb400) [pid = 1063] [serial = 2615] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 63 (0x12666b000) [pid = 1063] [serial = 2613] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 62 (0x127ed2c00) [pid = 1063] [serial = 2601] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 61 (0x120961000) [pid = 1063] [serial = 2611] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 60 (0x1367edc00) [pid = 1063] [serial = 2620] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 59 (0x128ffb000) [pid = 1063] [serial = 2603] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 58 (0x12c41a800) [pid = 1063] [serial = 2629] [outer = 0x0] [url = about:blank] 17:07:03 INFO - --DOMWINDOW == 57 (0x12c9f5800) [pid = 1063] [serial = 2644] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:03 INFO - --DOMWINDOW == 56 (0x12c777400) [pid = 1063] [serial = 2642] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:03 INFO - --DOMWINDOW == 55 (0x1589e3400) [pid = 1063] [serial = 2609] [outer = 0x0] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 17:07:03 INFO - --DOMWINDOW == 54 (0x1333bb400) [pid = 1063] [serial = 2621] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 17:07:03 INFO - ++DOMWINDOW == 55 (0x10a467400) [pid = 1063] [serial = 2684] [outer = 0x11f80f000] 17:07:03 INFO - ++DOCSHELL 0x127aa0100 == 16 [pid = 1063] [id = 1132] 17:07:03 INFO - ++DOMWINDOW == 56 (0x12e913400) [pid = 1063] [serial = 2685] [outer = 0x0] 17:07:03 INFO - ++DOMWINDOW == 57 (0x12ea94800) [pid = 1063] [serial = 2686] [outer = 0x12e913400] 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - ++DOCSHELL 0x1285b6100 == 17 [pid = 1063] [id = 1133] 17:07:04 INFO - ++DOMWINDOW == 58 (0x1351b2400) [pid = 1063] [serial = 2687] [outer = 0x0] 17:07:04 INFO - ++DOMWINDOW == 59 (0x13539ac00) [pid = 1063] [serial = 2688] [outer = 0x1351b2400] 17:07:04 INFO - ++DOCSHELL 0x12bb2da00 == 18 [pid = 1063] [id = 1134] 17:07:04 INFO - ++DOMWINDOW == 60 (0x1353c5400) [pid = 1063] [serial = 2689] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12bb2f300 == 19 [pid = 1063] [id = 1135] 17:07:04 INFO - ++DOMWINDOW == 61 (0x1353ce000) [pid = 1063] [serial = 2690] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12bb2f800 == 20 [pid = 1063] [id = 1136] 17:07:04 INFO - ++DOMWINDOW == 62 (0x1353e2000) [pid = 1063] [serial = 2691] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12c6db000 == 21 [pid = 1063] [id = 1137] 17:07:04 INFO - ++DOMWINDOW == 63 (0x1353e2c00) [pid = 1063] [serial = 2692] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12c6dce00 == 22 [pid = 1063] [id = 1138] 17:07:04 INFO - ++DOMWINDOW == 64 (0x135477000) [pid = 1063] [serial = 2693] [outer = 0x0] 17:07:04 INFO - ++DOMWINDOW == 65 (0x135477c00) [pid = 1063] [serial = 2694] [outer = 0x1353c5400] 17:07:04 INFO - ++DOMWINDOW == 66 (0x1355a1400) [pid = 1063] [serial = 2695] [outer = 0x1353ce000] 17:07:04 INFO - ++DOMWINDOW == 67 (0x1355a2000) [pid = 1063] [serial = 2696] [outer = 0x1353e2000] 17:07:04 INFO - ++DOMWINDOW == 68 (0x1355ae400) [pid = 1063] [serial = 2697] [outer = 0x1353e2c00] 17:07:04 INFO - ++DOMWINDOW == 69 (0x1355aec00) [pid = 1063] [serial = 2698] [outer = 0x135477000] 17:07:04 INFO - ++DOCSHELL 0x127b2ef00 == 23 [pid = 1063] [id = 1139] 17:07:04 INFO - ++DOMWINDOW == 70 (0x12b0f8c00) [pid = 1063] [serial = 2699] [outer = 0x0] 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - ++DOCSHELL 0x12de60200 == 24 [pid = 1063] [id = 1140] 17:07:04 INFO - ++DOMWINDOW == 71 (0x12e1ec800) [pid = 1063] [serial = 2700] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12de60700 == 25 [pid = 1063] [id = 1141] 17:07:04 INFO - ++DOMWINDOW == 72 (0x130fb9000) [pid = 1063] [serial = 2701] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12de60c00 == 26 [pid = 1063] [id = 1142] 17:07:04 INFO - ++DOMWINDOW == 73 (0x130fb9800) [pid = 1063] [serial = 2702] [outer = 0x0] 17:07:04 INFO - ++DOCSHELL 0x12de61100 == 27 [pid = 1063] [id = 1143] 17:07:04 INFO - ++DOMWINDOW == 74 (0x1355bc800) [pid = 1063] [serial = 2703] [outer = 0x0] 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - ++DOCSHELL 0x12de61600 == 28 [pid = 1063] [id = 1144] 17:07:04 INFO - ++DOMWINDOW == 75 (0x1355ea800) [pid = 1063] [serial = 2704] [outer = 0x0] 17:07:04 INFO - ++DOMWINDOW == 76 (0x136211800) [pid = 1063] [serial = 2705] [outer = 0x1355ea800] 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - ++DOCSHELL 0x12e035a00 == 29 [pid = 1063] [id = 1145] 17:07:04 INFO - ++DOMWINDOW == 77 (0x11f423800) [pid = 1063] [serial = 2706] [outer = 0x0] 17:07:04 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:04 INFO - ++DOMWINDOW == 78 (0x13628c000) [pid = 1063] [serial = 2707] [outer = 0x12b0f8c00] 17:07:04 INFO - ++DOMWINDOW == 79 (0x136423800) [pid = 1063] [serial = 2708] [outer = 0x12e1ec800] 17:07:04 INFO - ++DOMWINDOW == 80 (0x136531000) [pid = 1063] [serial = 2709] [outer = 0x130fb9000] 17:07:04 INFO - ++DOMWINDOW == 81 (0x136671800) [pid = 1063] [serial = 2710] [outer = 0x130fb9800] 17:07:04 INFO - ++DOMWINDOW == 82 (0x1351b2000) [pid = 1063] [serial = 2711] [outer = 0x1355bc800] 17:07:04 INFO - ++DOMWINDOW == 83 (0x1355a1c00) [pid = 1063] [serial = 2712] [outer = 0x1355ea800] 17:07:04 INFO - ++DOMWINDOW == 84 (0x1367a1800) [pid = 1063] [serial = 2713] [outer = 0x11f423800] 17:07:04 INFO - --DOCSHELL 0x12de60c00 == 28 [pid = 1063] [id = 1142] 17:07:04 INFO - --DOCSHELL 0x12de60700 == 27 [pid = 1063] [id = 1141] 17:07:04 INFO - --DOCSHELL 0x12de60200 == 26 [pid = 1063] [id = 1140] 17:07:04 INFO - --DOCSHELL 0x12e035a00 == 25 [pid = 1063] [id = 1145] 17:07:04 INFO - --DOCSHELL 0x12de61100 == 24 [pid = 1063] [id = 1143] 17:07:05 INFO - --DOCSHELL 0x127aa0100 == 23 [pid = 1063] [id = 1132] 17:07:05 INFO - --DOCSHELL 0x12e039100 == 22 [pid = 1063] [id = 1129] 17:07:05 INFO - --DOCSHELL 0x1285b6100 == 21 [pid = 1063] [id = 1133] 17:07:05 INFO - --DOCSHELL 0x12bb2da00 == 20 [pid = 1063] [id = 1134] 17:07:05 INFO - --DOCSHELL 0x12bb2f300 == 19 [pid = 1063] [id = 1135] 17:07:05 INFO - --DOCSHELL 0x12bb2f800 == 18 [pid = 1063] [id = 1136] 17:07:05 INFO - --DOCSHELL 0x12c6db000 == 17 [pid = 1063] [id = 1137] 17:07:05 INFO - --DOCSHELL 0x12c6dce00 == 16 [pid = 1063] [id = 1138] 17:07:05 INFO - --DOCSHELL 0x12cb89600 == 15 [pid = 1063] [id = 1127] 17:07:05 INFO - --DOCSHELL 0x1334dea00 == 14 [pid = 1063] [id = 1105] 17:07:05 INFO - --DOCSHELL 0x1581da500 == 13 [pid = 1063] [id = 1130] 17:07:05 INFO - --DOMWINDOW == 83 (0x127e48800) [pid = 1063] [serial = 2616] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:05 INFO - --DOCSHELL 0x127b2ef00 == 12 [pid = 1063] [id = 1139] 17:07:05 INFO - --DOMWINDOW == 82 (0x134fb9400) [pid = 1063] [serial = 2677] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOMWINDOW == 81 (0x136b21400) [pid = 1063] [serial = 2659] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 80 (0x136b21c00) [pid = 1063] [serial = 2660] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 79 (0x15bf96400) [pid = 1063] [serial = 2665] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:05 INFO - --DOMWINDOW == 78 (0x12c777800) [pid = 1063] [serial = 2658] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 77 (0x12c78f800) [pid = 1063] [serial = 2643] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:05 INFO - --DOMWINDOW == 76 (0x12c9b4000) [pid = 1063] [serial = 2618] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOMWINDOW == 75 (0x121cbac00) [pid = 1063] [serial = 2657] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 74 (0x12c50f000) [pid = 1063] [serial = 2648] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 73 (0x13732fc00) [pid = 1063] [serial = 2647] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:05 INFO - --DOMWINDOW == 72 (0x12c345400) [pid = 1063] [serial = 2641] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:05 INFO - --DOMWINDOW == 71 (0x12ae6a000) [pid = 1063] [serial = 2640] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:05 INFO - --DOMWINDOW == 70 (0x136a4bc00) [pid = 1063] [serial = 2608] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOMWINDOW == 69 (0x128738000) [pid = 1063] [serial = 2606] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:05 INFO - --DOMWINDOW == 68 (0x12df27000) [pid = 1063] [serial = 2623] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOCSHELL 0x12de61600 == 11 [pid = 1063] [id = 1144] 17:07:05 INFO - --DOMWINDOW == 67 (0x136531000) [pid = 1063] [serial = 2709] [outer = 0x130fb9000] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 66 (0x136671800) [pid = 1063] [serial = 2710] [outer = 0x130fb9800] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 65 (0x136423800) [pid = 1063] [serial = 2708] [outer = 0x12e1ec800] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 64 (0x1351b2000) [pid = 1063] [serial = 2711] [outer = 0x1355bc800] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 63 (0x1367a1800) [pid = 1063] [serial = 2713] [outer = 0x11f423800] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 62 (0x13628c000) [pid = 1063] [serial = 2707] [outer = 0x12b0f8c00] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:05 INFO - --DOMWINDOW == 61 (0x12b0f8c00) [pid = 1063] [serial = 2699] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:05 INFO - --DOMWINDOW == 60 (0x11f423800) [pid = 1063] [serial = 2706] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 59 (0x1355bc800) [pid = 1063] [serial = 2703] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 58 (0x12e1ec800) [pid = 1063] [serial = 2700] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 57 (0x130fb9800) [pid = 1063] [serial = 2702] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 56 (0x130fb9000) [pid = 1063] [serial = 2701] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:05 INFO - --DOMWINDOW == 55 (0x1353e2000) [pid = 1063] [serial = 2691] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:05 INFO - --DOMWINDOW == 54 (0x1353e2c00) [pid = 1063] [serial = 2692] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:05 INFO - --DOMWINDOW == 53 (0x1353c5400) [pid = 1063] [serial = 2689] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:05 INFO - --DOMWINDOW == 52 (0x1353ce000) [pid = 1063] [serial = 2690] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:05 INFO - --DOMWINDOW == 51 (0x12a06c000) [pid = 1063] [serial = 2668] [outer = 0x0] [url = chrome://devtools/content/performance/performance.xul] 17:07:05 INFO - --DOMWINDOW == 50 (0x1563cd000) [pid = 1063] [serial = 2662] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 17:07:05 INFO - --DOMWINDOW == 49 (0x12f1d6c00) [pid = 1063] [serial = 2666] [outer = 0x0] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 17:07:05 INFO - --DOMWINDOW == 48 (0x131a86000) [pid = 1063] [serial = 2670] [outer = 0x0] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 17:07:05 INFO - --DOMWINDOW == 47 (0x127f0bc00) [pid = 1063] [serial = 2633] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:05 INFO - --DOMWINDOW == 46 (0x11f8a9800) [pid = 1063] [serial = 2683] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOMWINDOW == 45 (0x136211800) [pid = 1063] [serial = 2705] [outer = 0x0] [url = about:blank] 17:07:05 INFO - --DOMWINDOW == 44 (0x1355ea800) [pid = 1063] [serial = 2704] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:05 INFO - --DOMWINDOW == 43 (0x1355ae400) [pid = 1063] [serial = 2697] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:05 INFO - --DOMWINDOW == 42 (0x135477c00) [pid = 1063] [serial = 2694] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:05 INFO - --DOMWINDOW == 41 (0x1355a1c00) [pid = 1063] [serial = 2712] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:05 INFO - --DOMWINDOW == 40 (0x11f9a5c00) [pid = 1063] [serial = 2631] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:05 INFO - --DOMWINDOW == 39 (0x12c3ea000) [pid = 1063] [serial = 2628] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:05 INFO - --DOMWINDOW == 38 (0x15899b800) [pid = 1063] [serial = 2649] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:05 INFO - --DOMWINDOW == 37 (0x1355a2000) [pid = 1063] [serial = 2696] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:06 INFO - MEMORY STAT | vsize 3784MB | residentFast 407MB | heapAllocated 128MB 17:07:06 INFO - 463 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split.js | took 12188ms 17:07:06 INFO - ++DOCSHELL 0x11fbe3100 == 12 [pid = 1063] [id = 1146] 17:07:06 INFO - ++DOMWINDOW == 38 (0x120541c00) [pid = 1063] [serial = 2714] [outer = 0x0] 17:07:06 INFO - ++DOMWINDOW == 39 (0x120594400) [pid = 1063] [serial = 2715] [outer = 0x120541c00] 17:07:06 INFO - 464 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js 17:07:06 INFO - ++DOCSHELL 0x121c23e00 == 13 [pid = 1063] [id = 1147] 17:07:06 INFO - ++DOMWINDOW == 40 (0x11f9bb000) [pid = 1063] [serial = 2716] [outer = 0x0] 17:07:06 INFO - ++DOMWINDOW == 41 (0x1209c4c00) [pid = 1063] [serial = 2717] [outer = 0x11f9bb000] 17:07:06 INFO - ++DOCSHELL 0x127aa0100 == 14 [pid = 1063] [id = 1148] 17:07:06 INFO - ++DOMWINDOW == 42 (0x120961000) [pid = 1063] [serial = 2718] [outer = 0x0] 17:07:06 INFO - ++DOMWINDOW == 43 (0x121cbac00) [pid = 1063] [serial = 2719] [outer = 0x120961000] 17:07:06 INFO - ++DOMWINDOW == 44 (0x12666b000) [pid = 1063] [serial = 2720] [outer = 0x120961000] 17:07:07 INFO - ++DOCSHELL 0x127766500 == 15 [pid = 1063] [id = 1149] 17:07:07 INFO - ++DOMWINDOW == 45 (0x1272a0800) [pid = 1063] [serial = 2721] [outer = 0x0] 17:07:07 INFO - ++DOMWINDOW == 46 (0x127371c00) [pid = 1063] [serial = 2722] [outer = 0x1272a0800] 17:07:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:07 INFO - ++DOCSHELL 0x12d52de00 == 16 [pid = 1063] [id = 1150] 17:07:07 INFO - ++DOMWINDOW == 47 (0x127e67c00) [pid = 1063] [serial = 2723] [outer = 0x0] 17:07:07 INFO - ++DOMWINDOW == 48 (0x127f0bc00) [pid = 1063] [serial = 2724] [outer = 0x127e67c00] 17:07:07 INFO - ++DOCSHELL 0x12de61b00 == 17 [pid = 1063] [id = 1151] 17:07:07 INFO - ++DOMWINDOW == 49 (0x127f4e800) [pid = 1063] [serial = 2725] [outer = 0x0] 17:07:07 INFO - ++DOCSHELL 0x12e035a00 == 18 [pid = 1063] [id = 1152] 17:07:07 INFO - ++DOMWINDOW == 50 (0x1284e0400) [pid = 1063] [serial = 2726] [outer = 0x0] 17:07:07 INFO - ++DOCSHELL 0x12e036e00 == 19 [pid = 1063] [id = 1153] 17:07:07 INFO - ++DOMWINDOW == 51 (0x128696c00) [pid = 1063] [serial = 2727] [outer = 0x0] 17:07:07 INFO - ++DOCSHELL 0x12e037800 == 20 [pid = 1063] [id = 1154] 17:07:07 INFO - ++DOMWINDOW == 52 (0x128738000) [pid = 1063] [serial = 2728] [outer = 0x0] 17:07:07 INFO - ++DOCSHELL 0x12e038700 == 21 [pid = 1063] [id = 1155] 17:07:07 INFO - ++DOMWINDOW == 53 (0x128c2a000) [pid = 1063] [serial = 2729] [outer = 0x0] 17:07:07 INFO - ++DOMWINDOW == 54 (0x12df19c00) [pid = 1063] [serial = 2730] [outer = 0x127f4e800] 17:07:07 INFO - ++DOMWINDOW == 55 (0x12df59000) [pid = 1063] [serial = 2731] [outer = 0x1284e0400] 17:07:07 INFO - ++DOMWINDOW == 56 (0x12e1ec000) [pid = 1063] [serial = 2732] [outer = 0x128696c00] 17:07:07 INFO - ++DOMWINDOW == 57 (0x12e2b9400) [pid = 1063] [serial = 2733] [outer = 0x128738000] 17:07:07 INFO - ++DOMWINDOW == 58 (0x13539a400) [pid = 1063] [serial = 2734] [outer = 0x128c2a000] 17:07:07 INFO - ++DOCSHELL 0x130ac8f00 == 22 [pid = 1063] [id = 1156] 17:07:07 INFO - ++DOMWINDOW == 59 (0x1538c8000) [pid = 1063] [serial = 2735] [outer = 0x0] 17:07:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:07 INFO - ++DOCSHELL 0x131a42d00 == 23 [pid = 1063] [id = 1157] 17:07:07 INFO - ++DOMWINDOW == 60 (0x1538d8c00) [pid = 1063] [serial = 2736] [outer = 0x0] 17:07:07 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:07 INFO - ++DOMWINDOW == 61 (0x1538eac00) [pid = 1063] [serial = 2737] [outer = 0x1538c8000] 17:07:07 INFO - ++DOMWINDOW == 62 (0x1587ff000) [pid = 1063] [serial = 2738] [outer = 0x1538d8c00] 17:07:07 INFO - ++DOCSHELL 0x1332be900 == 24 [pid = 1063] [id = 1158] 17:07:07 INFO - ++DOMWINDOW == 63 (0x136b07400) [pid = 1063] [serial = 2739] [outer = 0x0] 17:07:07 INFO - ++DOMWINDOW == 64 (0x1563cd800) [pid = 1063] [serial = 2740] [outer = 0x136b07400] 17:07:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:08 INFO - ++DOCSHELL 0x1332bfd00 == 25 [pid = 1063] [id = 1159] 17:07:08 INFO - ++DOMWINDOW == 65 (0x12df27000) [pid = 1063] [serial = 2741] [outer = 0x0] 17:07:08 INFO - ++DOCSHELL 0x1332c1600 == 26 [pid = 1063] [id = 1160] 17:07:08 INFO - ++DOMWINDOW == 66 (0x158846c00) [pid = 1063] [serial = 2742] [outer = 0x0] 17:07:08 INFO - ++DOCSHELL 0x1334de000 == 27 [pid = 1063] [id = 1161] 17:07:08 INFO - ++DOMWINDOW == 67 (0x158847800) [pid = 1063] [serial = 2743] [outer = 0x0] 17:07:08 INFO - ++DOCSHELL 0x1334dea00 == 28 [pid = 1063] [id = 1162] 17:07:08 INFO - ++DOMWINDOW == 68 (0x15899b400) [pid = 1063] [serial = 2744] [outer = 0x0] 17:07:08 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:08 INFO - ++DOCSHELL 0x1334def00 == 29 [pid = 1063] [id = 1163] 17:07:08 INFO - ++DOMWINDOW == 69 (0x15899bc00) [pid = 1063] [serial = 2745] [outer = 0x0] 17:07:08 INFO - ++DOMWINDOW == 70 (0x15bbed000) [pid = 1063] [serial = 2746] [outer = 0x15899bc00] 17:07:08 INFO - ++DOMWINDOW == 71 (0x15bffcc00) [pid = 1063] [serial = 2747] [outer = 0x12df27000] 17:07:08 INFO - ++DOMWINDOW == 72 (0x133349400) [pid = 1063] [serial = 2748] [outer = 0x158846c00] 17:07:08 INFO - ++DOMWINDOW == 73 (0x133349c00) [pid = 1063] [serial = 2749] [outer = 0x158847800] 17:07:08 INFO - ++DOMWINDOW == 74 (0x1335a0400) [pid = 1063] [serial = 2750] [outer = 0x15899b400] 17:07:08 INFO - ++DOMWINDOW == 75 (0x1335a0c00) [pid = 1063] [serial = 2751] [outer = 0x15899bc00] 17:07:09 INFO - ++DOCSHELL 0x1377af300 == 30 [pid = 1063] [id = 1164] 17:07:09 INFO - ++DOMWINDOW == 76 (0x1538eb400) [pid = 1063] [serial = 2752] [outer = 0x0] 17:07:09 INFO - ++DOMWINDOW == 77 (0x1538eb800) [pid = 1063] [serial = 2753] [outer = 0x1538eb400] 17:07:09 INFO - ++DOCSHELL 0x137ee2400 == 31 [pid = 1063] [id = 1165] 17:07:09 INFO - ++DOMWINDOW == 78 (0x137e24c00) [pid = 1063] [serial = 2754] [outer = 0x0] 17:07:09 INFO - ++DOMWINDOW == 79 (0x1585bf000) [pid = 1063] [serial = 2755] [outer = 0x137e24c00] 17:07:09 INFO - --DOCSHELL 0x1332c1600 == 30 [pid = 1063] [id = 1160] 17:07:09 INFO - --DOCSHELL 0x1334de000 == 29 [pid = 1063] [id = 1161] 17:07:09 INFO - --DOCSHELL 0x1332bfd00 == 28 [pid = 1063] [id = 1159] 17:07:09 INFO - --DOCSHELL 0x1334dea00 == 27 [pid = 1063] [id = 1162] 17:07:09 INFO - --DOCSHELL 0x131a42d00 == 26 [pid = 1063] [id = 1157] 17:07:09 INFO - --DOCSHELL 0x130ac8f00 == 25 [pid = 1063] [id = 1156] 17:07:10 INFO - --DOCSHELL 0x1334def00 == 24 [pid = 1063] [id = 1163] 17:07:10 INFO - --DOCSHELL 0x11f52ad00 == 23 [pid = 1063] [id = 1131] 17:07:10 INFO - --DOCSHELL 0x127aa0100 == 22 [pid = 1063] [id = 1148] 17:07:10 INFO - --DOCSHELL 0x131a98000 == 21 [pid = 1063] [id = 1103] 17:07:10 INFO - --DOCSHELL 0x127766500 == 20 [pid = 1063] [id = 1149] 17:07:10 INFO - --DOCSHELL 0x12d52de00 == 19 [pid = 1063] [id = 1150] 17:07:10 INFO - --DOCSHELL 0x1332be900 == 18 [pid = 1063] [id = 1158] 17:07:10 INFO - --DOCSHELL 0x12de5e400 == 17 [pid = 1063] [id = 1104] 17:07:10 INFO - --DOCSHELL 0x1377af300 == 16 [pid = 1063] [id = 1164] 17:07:10 INFO - --DOCSHELL 0x137ee2400 == 15 [pid = 1063] [id = 1165] 17:07:10 INFO - --DOCSHELL 0x12de61b00 == 14 [pid = 1063] [id = 1151] 17:07:10 INFO - --DOCSHELL 0x12e035a00 == 13 [pid = 1063] [id = 1152] 17:07:10 INFO - --DOCSHELL 0x12e036e00 == 12 [pid = 1063] [id = 1153] 17:07:10 INFO - --DOCSHELL 0x12e037800 == 11 [pid = 1063] [id = 1154] 17:07:10 INFO - --DOCSHELL 0x12e038700 == 10 [pid = 1063] [id = 1155] 17:07:10 INFO - --DOMWINDOW == 78 (0x11fadc400) [pid = 1063] [serial = 2632] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 77 (0x128e94000) [pid = 1063] [serial = 2634] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 76 (0x13643f000) [pid = 1063] [serial = 2650] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 75 (0x1563cd400) [pid = 1063] [serial = 2663] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 74 (0x12f1df000) [pid = 1063] [serial = 2667] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 73 (0x131b3ec00) [pid = 1063] [serial = 2671] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 72 (0x1355a1400) [pid = 1063] [serial = 2695] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:10 INFO - --DOMWINDOW == 71 (0x11f4c0800) [pid = 1063] [serial = 2630] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:10 INFO - --DOMWINDOW == 70 (0x12a06cc00) [pid = 1063] [serial = 2669] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 69 (0x1351b2400) [pid = 1063] [serial = 2687] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:10 INFO - --DOMWINDOW == 68 (0x11f80f000) [pid = 1063] [serial = 2682] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:10 INFO - --DOMWINDOW == 67 (0x135477000) [pid = 1063] [serial = 2693] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:10 INFO - --DOMWINDOW == 66 (0x12b050c00) [pid = 1063] [serial = 2624] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 65 (0x12c26c400) [pid = 1063] [serial = 2626] [outer = 0x0] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20splitting] 17:07:10 INFO - --DOMWINDOW == 64 (0x15899bc00) [pid = 1063] [serial = 2745] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:10 INFO - --DOMWINDOW == 63 (0x1272a0800) [pid = 1063] [serial = 2721] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:10 INFO - --DOMWINDOW == 62 (0x1538eb400) [pid = 1063] [serial = 2752] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:07:10 INFO - --DOMWINDOW == 61 (0x15899b400) [pid = 1063] [serial = 2744] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:10 INFO - --DOMWINDOW == 60 (0x12df27000) [pid = 1063] [serial = 2741] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:10 INFO - --DOMWINDOW == 59 (0x158847800) [pid = 1063] [serial = 2743] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:10 INFO - --DOMWINDOW == 58 (0x158846c00) [pid = 1063] [serial = 2742] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:10 INFO - --DOMWINDOW == 57 (0x128c2a000) [pid = 1063] [serial = 2729] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:10 INFO - --DOMWINDOW == 56 (0x127e67c00) [pid = 1063] [serial = 2723] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:10 INFO - --DOMWINDOW == 55 (0x1538c8000) [pid = 1063] [serial = 2735] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:10 INFO - --DOMWINDOW == 54 (0x128738000) [pid = 1063] [serial = 2728] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:10 INFO - --DOMWINDOW == 53 (0x128696c00) [pid = 1063] [serial = 2727] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:10 INFO - --DOMWINDOW == 52 (0x1538d8c00) [pid = 1063] [serial = 2736] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:10 INFO - --DOMWINDOW == 51 (0x1284e0400) [pid = 1063] [serial = 2726] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:10 INFO - --DOMWINDOW == 50 (0x127f4e800) [pid = 1063] [serial = 2725] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:10 INFO - --DOMWINDOW == 49 (0x12e913400) [pid = 1063] [serial = 2685] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:10 INFO - --DOMWINDOW == 48 (0x121cbac00) [pid = 1063] [serial = 2719] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 47 (0x12bba2c00) [pid = 1063] [serial = 2625] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 46 (0x12c3ea400) [pid = 1063] [serial = 2627] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 45 (0x15bbed000) [pid = 1063] [serial = 2746] [outer = 0x0] [url = about:blank] 17:07:10 INFO - --DOMWINDOW == 44 (0x1335a0c00) [pid = 1063] [serial = 2751] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:10 INFO - --DOMWINDOW == 43 (0x12e1ec000) [pid = 1063] [serial = 2732] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:10 INFO - --DOMWINDOW == 42 (0x13539a400) [pid = 1063] [serial = 2734] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:10 INFO - --DOMWINDOW == 41 (0x1355aec00) [pid = 1063] [serial = 2698] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:10 INFO - MEMORY STAT | vsize 3786MB | residentFast 411MB | heapAllocated 129MB 17:07:10 INFO - 465 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js | took 4728ms 17:07:10 INFO - ++DOCSHELL 0x121642f00 == 11 [pid = 1063] [id = 1166] 17:07:10 INFO - ++DOMWINDOW == 42 (0x12036d400) [pid = 1063] [serial = 2756] [outer = 0x0] 17:07:10 INFO - ++DOMWINDOW == 43 (0x120594800) [pid = 1063] [serial = 2757] [outer = 0x12036d400] 17:07:11 INFO - 466 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_focus.js 17:07:11 INFO - ++DOCSHELL 0x127b32100 == 12 [pid = 1063] [id = 1167] 17:07:11 INFO - ++DOMWINDOW == 44 (0x12054bc00) [pid = 1063] [serial = 2758] [outer = 0x0] 17:07:11 INFO - ++DOMWINDOW == 45 (0x121763000) [pid = 1063] [serial = 2759] [outer = 0x12054bc00] 17:07:11 INFO - ++DOCSHELL 0x1201f9f00 == 13 [pid = 1063] [id = 1168] 17:07:11 INFO - ++DOMWINDOW == 46 (0x1216c6c00) [pid = 1063] [serial = 2760] [outer = 0x0] 17:07:11 INFO - ++DOMWINDOW == 47 (0x1272a0800) [pid = 1063] [serial = 2761] [outer = 0x1216c6c00] 17:07:11 INFO - ++DOMWINDOW == 48 (0x127274800) [pid = 1063] [serial = 2762] [outer = 0x1216c6c00] 17:07:12 INFO - ++DOCSHELL 0x12c6dd300 == 14 [pid = 1063] [id = 1169] 17:07:12 INFO - ++DOMWINDOW == 49 (0x127e48000) [pid = 1063] [serial = 2763] [outer = 0x0] 17:07:12 INFO - ++DOMWINDOW == 50 (0x127e48c00) [pid = 1063] [serial = 2764] [outer = 0x127e48000] 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - ++DOCSHELL 0x12d4c1100 == 15 [pid = 1063] [id = 1170] 17:07:12 INFO - ++DOMWINDOW == 51 (0x128696c00) [pid = 1063] [serial = 2765] [outer = 0x0] 17:07:12 INFO - ++DOMWINDOW == 52 (0x128e94000) [pid = 1063] [serial = 2766] [outer = 0x128696c00] 17:07:12 INFO - ++DOCSHELL 0x12de61600 == 16 [pid = 1063] [id = 1171] 17:07:12 INFO - ++DOMWINDOW == 53 (0x128ffbc00) [pid = 1063] [serial = 2767] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x12e035a00 == 17 [pid = 1063] [id = 1172] 17:07:12 INFO - ++DOMWINDOW == 54 (0x12963d000) [pid = 1063] [serial = 2768] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x12e036e00 == 18 [pid = 1063] [id = 1173] 17:07:12 INFO - ++DOMWINDOW == 55 (0x12963d400) [pid = 1063] [serial = 2769] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x130927f00 == 19 [pid = 1063] [id = 1174] 17:07:12 INFO - ++DOMWINDOW == 56 (0x12965a000) [pid = 1063] [serial = 2770] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x130928400 == 20 [pid = 1063] [id = 1175] 17:07:12 INFO - ++DOMWINDOW == 57 (0x12965a800) [pid = 1063] [serial = 2771] [outer = 0x0] 17:07:12 INFO - ++DOMWINDOW == 58 (0x1297a0800) [pid = 1063] [serial = 2772] [outer = 0x128ffbc00] 17:07:12 INFO - ++DOMWINDOW == 59 (0x12987f800) [pid = 1063] [serial = 2773] [outer = 0x12963d000] 17:07:12 INFO - ++DOMWINDOW == 60 (0x12e3a4000) [pid = 1063] [serial = 2774] [outer = 0x12963d400] 17:07:12 INFO - ++DOMWINDOW == 61 (0x12e824400) [pid = 1063] [serial = 2775] [outer = 0x12965a000] 17:07:12 INFO - ++DOMWINDOW == 62 (0x12e902c00) [pid = 1063] [serial = 2776] [outer = 0x12965a800] 17:07:12 INFO - ++DOCSHELL 0x131a44600 == 21 [pid = 1063] [id = 1176] 17:07:12 INFO - ++DOMWINDOW == 63 (0x137094000) [pid = 1063] [serial = 2777] [outer = 0x0] 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - ++DOCSHELL 0x131a9cb00 == 22 [pid = 1063] [id = 1177] 17:07:12 INFO - ++DOMWINDOW == 64 (0x137094c00) [pid = 1063] [serial = 2778] [outer = 0x0] 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - ++DOMWINDOW == 65 (0x137629400) [pid = 1063] [serial = 2779] [outer = 0x137094000] 17:07:12 INFO - ++DOMWINDOW == 66 (0x120547800) [pid = 1063] [serial = 2780] [outer = 0x137094c00] 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - ++DOCSHELL 0x12d52ed00 == 23 [pid = 1063] [id = 1178] 17:07:12 INFO - ++DOMWINDOW == 67 (0x10a467000) [pid = 1063] [serial = 2781] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x1332bfd00 == 24 [pid = 1063] [id = 1179] 17:07:12 INFO - ++DOMWINDOW == 68 (0x137ef0000) [pid = 1063] [serial = 2782] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x1332c1600 == 25 [pid = 1063] [id = 1180] 17:07:12 INFO - ++DOMWINDOW == 69 (0x1538d8c00) [pid = 1063] [serial = 2783] [outer = 0x0] 17:07:12 INFO - ++DOCSHELL 0x1334de000 == 26 [pid = 1063] [id = 1181] 17:07:12 INFO - ++DOMWINDOW == 70 (0x1538ea400) [pid = 1063] [serial = 2784] [outer = 0x0] 17:07:12 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:12 INFO - ++DOCSHELL 0x1334dea00 == 27 [pid = 1063] [id = 1182] 17:07:12 INFO - ++DOMWINDOW == 71 (0x1538eb000) [pid = 1063] [serial = 2785] [outer = 0x0] 17:07:12 INFO - ++DOMWINDOW == 72 (0x1538eb400) [pid = 1063] [serial = 2786] [outer = 0x1538eb000] 17:07:12 INFO - ++DOCSHELL 0x134f99e00 == 28 [pid = 1063] [id = 1183] 17:07:12 INFO - ++DOMWINDOW == 73 (0x158527c00) [pid = 1063] [serial = 2787] [outer = 0x0] 17:07:12 INFO - ++DOMWINDOW == 74 (0x158531800) [pid = 1063] [serial = 2788] [outer = 0x158527c00] 17:07:12 INFO - ++DOMWINDOW == 75 (0x127f0b400) [pid = 1063] [serial = 2789] [outer = 0x10a467000] 17:07:12 INFO - ++DOMWINDOW == 76 (0x12e376c00) [pid = 1063] [serial = 2790] [outer = 0x137ef0000] 17:07:12 INFO - ++DOMWINDOW == 77 (0x1373a1800) [pid = 1063] [serial = 2791] [outer = 0x1538d8c00] 17:07:12 INFO - ++DOMWINDOW == 78 (0x1585bfc00) [pid = 1063] [serial = 2792] [outer = 0x1538ea400] 17:07:13 INFO - ++DOMWINDOW == 79 (0x1587ffc00) [pid = 1063] [serial = 2793] [outer = 0x1538eb000] 17:07:13 INFO - --DOCSHELL 0x1332bfd00 == 27 [pid = 1063] [id = 1179] 17:07:13 INFO - --DOCSHELL 0x1332c1600 == 26 [pid = 1063] [id = 1180] 17:07:13 INFO - --DOCSHELL 0x12d52ed00 == 25 [pid = 1063] [id = 1178] 17:07:13 INFO - --DOCSHELL 0x1334de000 == 24 [pid = 1063] [id = 1181] 17:07:13 INFO - --DOCSHELL 0x131a9cb00 == 23 [pid = 1063] [id = 1177] 17:07:13 INFO - --DOCSHELL 0x131a44600 == 22 [pid = 1063] [id = 1176] 17:07:14 INFO - --DOCSHELL 0x1334dea00 == 21 [pid = 1063] [id = 1182] 17:07:14 INFO - --DOCSHELL 0x121c23e00 == 20 [pid = 1063] [id = 1147] 17:07:14 INFO - --DOCSHELL 0x12c6dd300 == 19 [pid = 1063] [id = 1169] 17:07:14 INFO - --DOCSHELL 0x11fbe3100 == 18 [pid = 1063] [id = 1146] 17:07:14 INFO - --DOCSHELL 0x12d4c1100 == 17 [pid = 1063] [id = 1170] 17:07:14 INFO - --DOCSHELL 0x134f99e00 == 16 [pid = 1063] [id = 1183] 17:07:14 INFO - --DOCSHELL 0x12de61600 == 15 [pid = 1063] [id = 1171] 17:07:14 INFO - --DOCSHELL 0x12e035a00 == 14 [pid = 1063] [id = 1172] 17:07:14 INFO - --DOCSHELL 0x12e036e00 == 13 [pid = 1063] [id = 1173] 17:07:14 INFO - --DOCSHELL 0x130927f00 == 12 [pid = 1063] [id = 1174] 17:07:14 INFO - --DOMWINDOW == 78 (0x1335a0400) [pid = 1063] [serial = 2750] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 77 (0x133349c00) [pid = 1063] [serial = 2749] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 76 (0x133349400) [pid = 1063] [serial = 2748] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 75 (0x15bffcc00) [pid = 1063] [serial = 2747] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 74 (0x13539ac00) [pid = 1063] [serial = 2688] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 73 (0x12ea94800) [pid = 1063] [serial = 2686] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 72 (0x1587ff000) [pid = 1063] [serial = 2738] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 71 (0x1538eac00) [pid = 1063] [serial = 2737] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:14 INFO - --DOMWINDOW == 70 (0x12df59000) [pid = 1063] [serial = 2731] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:14 INFO - --DOMWINDOW == 69 (0x12df19c00) [pid = 1063] [serial = 2730] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:14 INFO - --DOMWINDOW == 68 (0x10a467400) [pid = 1063] [serial = 2684] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:14 INFO - --DOMWINDOW == 67 (0x127f0bc00) [pid = 1063] [serial = 2724] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 66 (0x127371c00) [pid = 1063] [serial = 2722] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 65 (0x12e2b9400) [pid = 1063] [serial = 2733] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:14 INFO - --DOMWINDOW == 64 (0x1538eb800) [pid = 1063] [serial = 2753] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:07:14 INFO - --DOMWINDOW == 63 (0x137ef0000) [pid = 1063] [serial = 2782] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 62 (0x1538ea400) [pid = 1063] [serial = 2784] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 61 (0x128ffbc00) [pid = 1063] [serial = 2767] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:14 INFO - --DOMWINDOW == 60 (0x12963d000) [pid = 1063] [serial = 2768] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:14 INFO - --DOMWINDOW == 59 (0x12963d400) [pid = 1063] [serial = 2769] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:14 INFO - --DOMWINDOW == 58 (0x12965a000) [pid = 1063] [serial = 2770] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:14 INFO - --DOMWINDOW == 57 (0x137094000) [pid = 1063] [serial = 2777] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:14 INFO - --DOMWINDOW == 56 (0x137094c00) [pid = 1063] [serial = 2778] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:14 INFO - --DOMWINDOW == 55 (0x120961000) [pid = 1063] [serial = 2718] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:14 INFO - --DOMWINDOW == 54 (0x136b07400) [pid = 1063] [serial = 2739] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:14 INFO - --DOMWINDOW == 53 (0x137e24c00) [pid = 1063] [serial = 2754] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:07:14 INFO - --DOMWINDOW == 52 (0x11f9bb000) [pid = 1063] [serial = 2716] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting] 17:07:14 INFO - --DOMWINDOW == 51 (0x120541c00) [pid = 1063] [serial = 2714] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 50 (0x1538eb000) [pid = 1063] [serial = 2785] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:14 INFO - --DOMWINDOW == 49 (0x1209c4c00) [pid = 1063] [serial = 2717] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 48 (0x120594400) [pid = 1063] [serial = 2715] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 47 (0x1272a0800) [pid = 1063] [serial = 2761] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 46 (0x1587ffc00) [pid = 1063] [serial = 2793] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:14 INFO - --DOMWINDOW == 45 (0x1538eb400) [pid = 1063] [serial = 2786] [outer = 0x0] [url = about:blank] 17:07:14 INFO - --DOMWINDOW == 44 (0x10a467000) [pid = 1063] [serial = 2781] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:15 INFO - --DOMWINDOW == 43 (0x12e3a4000) [pid = 1063] [serial = 2774] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:15 INFO - MEMORY STAT | vsize 3788MB | residentFast 413MB | heapAllocated 131MB 17:07:15 INFO - 467 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_focus.js | took 4123ms 17:07:15 INFO - ++DOCSHELL 0x120929200 == 13 [pid = 1063] [id = 1184] 17:07:15 INFO - ++DOMWINDOW == 44 (0x12019e400) [pid = 1063] [serial = 2794] [outer = 0x0] 17:07:15 INFO - ++DOMWINDOW == 45 (0x120594400) [pid = 1063] [serial = 2795] [outer = 0x12019e400] 17:07:15 INFO - 468 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_persist.js 17:07:15 INFO - ++DOCSHELL 0x128580b00 == 14 [pid = 1063] [id = 1185] 17:07:15 INFO - ++DOMWINDOW == 46 (0x1205f8400) [pid = 1063] [serial = 2796] [outer = 0x0] 17:07:15 INFO - ++DOMWINDOW == 47 (0x121c1cc00) [pid = 1063] [serial = 2797] [outer = 0x1205f8400] 17:07:15 INFO - ++DOCSHELL 0x12737f600 == 15 [pid = 1063] [id = 1186] 17:07:15 INFO - ++DOMWINDOW == 48 (0x11f94a800) [pid = 1063] [serial = 2798] [outer = 0x0] 17:07:15 INFO - ++DOMWINDOW == 49 (0x1217d5000) [pid = 1063] [serial = 2799] [outer = 0x11f94a800] 17:07:15 INFO - ++DOMWINDOW == 50 (0x127e67c00) [pid = 1063] [serial = 2800] [outer = 0x11f94a800] 17:07:16 INFO - ++DOCSHELL 0x12de60c00 == 16 [pid = 1063] [id = 1187] 17:07:16 INFO - ++DOMWINDOW == 51 (0x1367ed800) [pid = 1063] [serial = 2801] [outer = 0x0] 17:07:16 INFO - ++DOMWINDOW == 52 (0x1367edc00) [pid = 1063] [serial = 2802] [outer = 0x1367ed800] 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - ++DOCSHELL 0x131a44b00 == 17 [pid = 1063] [id = 1188] 17:07:16 INFO - ++DOMWINDOW == 53 (0x15bbf3800) [pid = 1063] [serial = 2803] [outer = 0x0] 17:07:16 INFO - ++DOMWINDOW == 54 (0x15bf80c00) [pid = 1063] [serial = 2804] [outer = 0x15bbf3800] 17:07:16 INFO - ++DOCSHELL 0x131b29800 == 18 [pid = 1063] [id = 1189] 17:07:16 INFO - ++DOMWINDOW == 55 (0x1316cf000) [pid = 1063] [serial = 2805] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x1332bdf00 == 19 [pid = 1063] [id = 1190] 17:07:16 INFO - ++DOMWINDOW == 56 (0x1316cf400) [pid = 1063] [serial = 2806] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x1332be900 == 20 [pid = 1063] [id = 1191] 17:07:16 INFO - ++DOMWINDOW == 57 (0x1316cf800) [pid = 1063] [serial = 2807] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x1332bf300 == 21 [pid = 1063] [id = 1192] 17:07:16 INFO - ++DOMWINDOW == 58 (0x1316cfc00) [pid = 1063] [serial = 2808] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x1332bf800 == 22 [pid = 1063] [id = 1193] 17:07:16 INFO - ++DOMWINDOW == 59 (0x1332e9000) [pid = 1063] [serial = 2809] [outer = 0x0] 17:07:16 INFO - ++DOMWINDOW == 60 (0x1332e9800) [pid = 1063] [serial = 2810] [outer = 0x1316cf000] 17:07:16 INFO - ++DOMWINDOW == 61 (0x15bbf3000) [pid = 1063] [serial = 2811] [outer = 0x1316cf400] 17:07:16 INFO - ++DOMWINDOW == 62 (0x133506400) [pid = 1063] [serial = 2812] [outer = 0x1316cf800] 17:07:16 INFO - ++DOMWINDOW == 63 (0x133506c00) [pid = 1063] [serial = 2813] [outer = 0x1316cfc00] 17:07:16 INFO - ++DOMWINDOW == 64 (0x13483b400) [pid = 1063] [serial = 2814] [outer = 0x1332e9000] 17:07:16 INFO - ++DOCSHELL 0x121730200 == 23 [pid = 1063] [id = 1194] 17:07:16 INFO - ++DOMWINDOW == 65 (0x12f10a800) [pid = 1063] [serial = 2815] [outer = 0x0] 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - ++DOCSHELL 0x12de5f800 == 24 [pid = 1063] [id = 1195] 17:07:16 INFO - ++DOMWINDOW == 66 (0x13760d000) [pid = 1063] [serial = 2816] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x12de60700 == 25 [pid = 1063] [id = 1196] 17:07:16 INFO - ++DOMWINDOW == 67 (0x137674c00) [pid = 1063] [serial = 2817] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x12de61100 == 26 [pid = 1063] [id = 1197] 17:07:16 INFO - ++DOMWINDOW == 68 (0x1376bdc00) [pid = 1063] [serial = 2818] [outer = 0x0] 17:07:16 INFO - ++DOCSHELL 0x12de61b00 == 27 [pid = 1063] [id = 1198] 17:07:16 INFO - ++DOMWINDOW == 69 (0x1376be400) [pid = 1063] [serial = 2819] [outer = 0x0] 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - ++DOCSHELL 0x12e035a00 == 28 [pid = 1063] [id = 1199] 17:07:16 INFO - ++DOMWINDOW == 70 (0x135473000) [pid = 1063] [serial = 2820] [outer = 0x0] 17:07:16 INFO - ++DOMWINDOW == 71 (0x135473400) [pid = 1063] [serial = 2821] [outer = 0x135473000] 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - ++DOCSHELL 0x131a99900 == 29 [pid = 1063] [id = 1200] 17:07:16 INFO - ++DOMWINDOW == 72 (0x135473c00) [pid = 1063] [serial = 2822] [outer = 0x0] 17:07:16 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:16 INFO - ++DOMWINDOW == 73 (0x13709a800) [pid = 1063] [serial = 2823] [outer = 0x12f10a800] 17:07:16 INFO - ++DOMWINDOW == 74 (0x1332e9400) [pid = 1063] [serial = 2824] [outer = 0x13760d000] 17:07:16 INFO - ++DOMWINDOW == 75 (0x133506000) [pid = 1063] [serial = 2825] [outer = 0x137674c00] 17:07:17 INFO - ++DOMWINDOW == 76 (0x153860400) [pid = 1063] [serial = 2826] [outer = 0x1376bdc00] 17:07:17 INFO - ++DOMWINDOW == 77 (0x153860c00) [pid = 1063] [serial = 2827] [outer = 0x1376be400] 17:07:17 INFO - ++DOMWINDOW == 78 (0x155961400) [pid = 1063] [serial = 2828] [outer = 0x135473000] 17:07:17 INFO - ++DOMWINDOW == 79 (0x15817b000) [pid = 1063] [serial = 2829] [outer = 0x135473c00] 17:07:17 INFO - ++DOCSHELL 0x13542b900 == 30 [pid = 1063] [id = 1201] 17:07:17 INFO - ++DOMWINDOW == 80 (0x13630f800) [pid = 1063] [serial = 2830] [outer = 0x0] 17:07:17 INFO - ++DOMWINDOW == 81 (0x13630fc00) [pid = 1063] [serial = 2831] [outer = 0x13630f800] 17:07:17 INFO - --DOCSHELL 0x131a99900 == 29 [pid = 1063] [id = 1200] 17:07:17 INFO - --DOCSHELL 0x12de61b00 == 28 [pid = 1063] [id = 1198] 17:07:17 INFO - --DOCSHELL 0x12de61100 == 27 [pid = 1063] [id = 1197] 17:07:17 INFO - --DOCSHELL 0x12de60700 == 26 [pid = 1063] [id = 1196] 17:07:17 INFO - --DOCSHELL 0x12de5f800 == 25 [pid = 1063] [id = 1195] 17:07:18 INFO - --DOCSHELL 0x1201f9f00 == 24 [pid = 1063] [id = 1168] 17:07:18 INFO - --DOCSHELL 0x12de60c00 == 23 [pid = 1063] [id = 1187] 17:07:18 INFO - --DOCSHELL 0x121642f00 == 22 [pid = 1063] [id = 1166] 17:07:18 INFO - --DOCSHELL 0x127b32100 == 21 [pid = 1063] [id = 1167] 17:07:18 INFO - --DOCSHELL 0x131a44b00 == 20 [pid = 1063] [id = 1188] 17:07:18 INFO - --DOCSHELL 0x131b29800 == 19 [pid = 1063] [id = 1189] 17:07:18 INFO - --DOCSHELL 0x1332bdf00 == 18 [pid = 1063] [id = 1190] 17:07:18 INFO - --DOCSHELL 0x1332be900 == 17 [pid = 1063] [id = 1191] 17:07:18 INFO - --DOCSHELL 0x1332bf300 == 16 [pid = 1063] [id = 1192] 17:07:18 INFO - --DOCSHELL 0x130928400 == 15 [pid = 1063] [id = 1175] 17:07:18 INFO - --DOMWINDOW == 80 (0x12666b000) [pid = 1063] [serial = 2720] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:18 INFO - --DOMWINDOW == 79 (0x1563cd800) [pid = 1063] [serial = 2740] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 78 (0x1585bf000) [pid = 1063] [serial = 2755] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 17:07:18 INFO - --DOCSHELL 0x121730200 == 14 [pid = 1063] [id = 1194] 17:07:18 INFO - --DOMWINDOW == 77 (0x127f0b400) [pid = 1063] [serial = 2789] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 76 (0x120547800) [pid = 1063] [serial = 2780] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 75 (0x137629400) [pid = 1063] [serial = 2779] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:18 INFO - --DOMWINDOW == 74 (0x12987f800) [pid = 1063] [serial = 2773] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:18 INFO - --DOMWINDOW == 73 (0x1297a0800) [pid = 1063] [serial = 2772] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:18 INFO - --DOMWINDOW == 72 (0x1585bfc00) [pid = 1063] [serial = 2792] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 71 (0x12e376c00) [pid = 1063] [serial = 2790] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 70 (0x12e824400) [pid = 1063] [serial = 2775] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:18 INFO - --DOMWINDOW == 69 (0x133506000) [pid = 1063] [serial = 2825] [outer = 0x137674c00] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 68 (0x153860400) [pid = 1063] [serial = 2826] [outer = 0x1376bdc00] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 67 (0x1332e9400) [pid = 1063] [serial = 2824] [outer = 0x13760d000] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 66 (0x153860c00) [pid = 1063] [serial = 2827] [outer = 0x1376be400] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 65 (0x15817b000) [pid = 1063] [serial = 2829] [outer = 0x135473c00] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 64 (0x13709a800) [pid = 1063] [serial = 2823] [outer = 0x12f10a800] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:18 INFO - --DOCSHELL 0x12e035a00 == 13 [pid = 1063] [id = 1199] 17:07:18 INFO - --DOMWINDOW == 63 (0x12f10a800) [pid = 1063] [serial = 2815] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:18 INFO - --DOMWINDOW == 62 (0x135473c00) [pid = 1063] [serial = 2822] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 61 (0x1376be400) [pid = 1063] [serial = 2819] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 60 (0x13760d000) [pid = 1063] [serial = 2816] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 59 (0x1376bdc00) [pid = 1063] [serial = 2818] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 58 (0x137674c00) [pid = 1063] [serial = 2817] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:18 INFO - ++DOCSHELL 0x11f52bc00 == 14 [pid = 1063] [id = 1202] 17:07:18 INFO - ++DOMWINDOW == 59 (0x10a467000) [pid = 1063] [serial = 2832] [outer = 0x0] 17:07:18 INFO - ++DOMWINDOW == 60 (0x11f80f000) [pid = 1063] [serial = 2833] [outer = 0x10a467000] 17:07:18 INFO - --DOMWINDOW == 59 (0x12054bc00) [pid = 1063] [serial = 2758] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 17:07:18 INFO - --DOMWINDOW == 58 (0x12036d400) [pid = 1063] [serial = 2756] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 57 (0x12965a800) [pid = 1063] [serial = 2771] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:18 INFO - --DOMWINDOW == 56 (0x1316cf800) [pid = 1063] [serial = 2807] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:18 INFO - --DOMWINDOW == 55 (0x1316cfc00) [pid = 1063] [serial = 2808] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:18 INFO - --DOMWINDOW == 54 (0x1316cf000) [pid = 1063] [serial = 2805] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:18 INFO - --DOMWINDOW == 53 (0x1316cf400) [pid = 1063] [serial = 2806] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:18 INFO - --DOMWINDOW == 52 (0x1538d8c00) [pid = 1063] [serial = 2783] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:18 INFO - --DOMWINDOW == 51 (0x128696c00) [pid = 1063] [serial = 2765] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:18 INFO - --DOMWINDOW == 50 (0x121763000) [pid = 1063] [serial = 2759] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 49 (0x120594800) [pid = 1063] [serial = 2757] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 48 (0x135473400) [pid = 1063] [serial = 2821] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 47 (0x135473000) [pid = 1063] [serial = 2820] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:18 INFO - --DOMWINDOW == 46 (0x1217d5000) [pid = 1063] [serial = 2799] [outer = 0x0] [url = about:blank] 17:07:18 INFO - --DOMWINDOW == 45 (0x1332e9000) [pid = 1063] [serial = 2809] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:18 INFO - --DOMWINDOW == 44 (0x133506c00) [pid = 1063] [serial = 2813] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:18 INFO - --DOMWINDOW == 43 (0x1332e9800) [pid = 1063] [serial = 2810] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:18 INFO - --DOMWINDOW == 42 (0x158527c00) [pid = 1063] [serial = 2787] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:18 INFO - --DOMWINDOW == 41 (0x1216c6c00) [pid = 1063] [serial = 2760] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:18 INFO - --DOMWINDOW == 40 (0x127e48000) [pid = 1063] [serial = 2763] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:18 INFO - --DOMWINDOW == 39 (0x12e902c00) [pid = 1063] [serial = 2776] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:18 INFO - --DOMWINDOW == 38 (0x13483b400) [pid = 1063] [serial = 2814] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:18 INFO - --DOMWINDOW == 37 (0x133506400) [pid = 1063] [serial = 2812] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:18 INFO - ++DOCSHELL 0x11f882d00 == 15 [pid = 1063] [id = 1203] 17:07:18 INFO - ++DOMWINDOW == 38 (0x11f4c0800) [pid = 1063] [serial = 2834] [outer = 0x0] 17:07:18 INFO - ++DOMWINDOW == 39 (0x11fbc3c00) [pid = 1063] [serial = 2835] [outer = 0x11f4c0800] 17:07:18 INFO - ++DOMWINDOW == 40 (0x12036d400) [pid = 1063] [serial = 2836] [outer = 0x11f4c0800] 17:07:19 INFO - ++DOCSHELL 0x12bb2f300 == 16 [pid = 1063] [id = 1204] 17:07:19 INFO - ++DOMWINDOW == 41 (0x13630f400) [pid = 1063] [serial = 2837] [outer = 0x0] 17:07:19 INFO - ++DOMWINDOW == 42 (0x1367be400) [pid = 1063] [serial = 2838] [outer = 0x13630f400] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOCSHELL 0x12d4c1100 == 17 [pid = 1063] [id = 1205] 17:07:19 INFO - ++DOMWINDOW == 43 (0x120594c00) [pid = 1063] [serial = 2839] [outer = 0x0] 17:07:19 INFO - ++DOMWINDOW == 44 (0x121747c00) [pid = 1063] [serial = 2840] [outer = 0x120594c00] 17:07:19 INFO - ++DOCSHELL 0x12de60200 == 18 [pid = 1063] [id = 1206] 17:07:19 INFO - ++DOMWINDOW == 45 (0x121763000) [pid = 1063] [serial = 2841] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x12de61100 == 19 [pid = 1063] [id = 1207] 17:07:19 INFO - ++DOMWINDOW == 46 (0x1217d5000) [pid = 1063] [serial = 2842] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x12de61600 == 20 [pid = 1063] [id = 1208] 17:07:19 INFO - ++DOMWINDOW == 47 (0x121ddb400) [pid = 1063] [serial = 2843] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x12de61b00 == 21 [pid = 1063] [id = 1209] 17:07:19 INFO - ++DOMWINDOW == 48 (0x12666b000) [pid = 1063] [serial = 2844] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x12e035a00 == 22 [pid = 1063] [id = 1210] 17:07:19 INFO - ++DOMWINDOW == 49 (0x126671000) [pid = 1063] [serial = 2845] [outer = 0x0] 17:07:19 INFO - ++DOMWINDOW == 50 (0x1272a0800) [pid = 1063] [serial = 2846] [outer = 0x121763000] 17:07:19 INFO - ++DOMWINDOW == 51 (0x1276eb400) [pid = 1063] [serial = 2847] [outer = 0x1217d5000] 17:07:19 INFO - ++DOMWINDOW == 52 (0x127e48000) [pid = 1063] [serial = 2848] [outer = 0x121ddb400] 17:07:19 INFO - ++DOMWINDOW == 53 (0x127f0b400) [pid = 1063] [serial = 2849] [outer = 0x12666b000] 17:07:19 INFO - ++DOMWINDOW == 54 (0x12a01ec00) [pid = 1063] [serial = 2850] [outer = 0x126671000] 17:07:19 INFO - ++DOCSHELL 0x13092bb00 == 23 [pid = 1063] [id = 1211] 17:07:19 INFO - ++DOMWINDOW == 55 (0x131a67000) [pid = 1063] [serial = 2851] [outer = 0x0] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOCSHELL 0x131a40000 == 24 [pid = 1063] [id = 1212] 17:07:19 INFO - ++DOMWINDOW == 56 (0x120961000) [pid = 1063] [serial = 2852] [outer = 0x0] 17:07:19 INFO - ++DOMWINDOW == 57 (0x131a67800) [pid = 1063] [serial = 2853] [outer = 0x120961000] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOCSHELL 0x131a42d00 == 25 [pid = 1063] [id = 1213] 17:07:19 INFO - ++DOMWINDOW == 58 (0x133360400) [pid = 1063] [serial = 2854] [outer = 0x0] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOMWINDOW == 59 (0x1366cd400) [pid = 1063] [serial = 2855] [outer = 0x131a67000] 17:07:19 INFO - ++DOMWINDOW == 60 (0x137367c00) [pid = 1063] [serial = 2856] [outer = 0x133360400] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOCSHELL 0x1332be900 == 26 [pid = 1063] [id = 1214] 17:07:19 INFO - ++DOMWINDOW == 61 (0x120594800) [pid = 1063] [serial = 2857] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x1332bf300 == 27 [pid = 1063] [id = 1215] 17:07:19 INFO - ++DOMWINDOW == 62 (0x127b8b000) [pid = 1063] [serial = 2858] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x1332bfd00 == 28 [pid = 1063] [id = 1216] 17:07:19 INFO - ++DOMWINDOW == 63 (0x1370a8800) [pid = 1063] [serial = 2859] [outer = 0x0] 17:07:19 INFO - ++DOCSHELL 0x1332c1600 == 29 [pid = 1063] [id = 1217] 17:07:19 INFO - ++DOMWINDOW == 64 (0x1370a8c00) [pid = 1063] [serial = 2860] [outer = 0x0] 17:07:19 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:19 INFO - ++DOCSHELL 0x1334de000 == 30 [pid = 1063] [id = 1218] 17:07:19 INFO - ++DOMWINDOW == 65 (0x1372f7400) [pid = 1063] [serial = 2861] [outer = 0x0] 17:07:19 INFO - ++DOMWINDOW == 66 (0x1372f7800) [pid = 1063] [serial = 2862] [outer = 0x1372f7400] 17:07:20 INFO - ++DOMWINDOW == 67 (0x130b72000) [pid = 1063] [serial = 2863] [outer = 0x120594800] 17:07:20 INFO - ++DOMWINDOW == 68 (0x133360800) [pid = 1063] [serial = 2864] [outer = 0x127b8b000] 17:07:20 INFO - ++DOMWINDOW == 69 (0x13480dc00) [pid = 1063] [serial = 2865] [outer = 0x1370a8800] 17:07:20 INFO - ++DOMWINDOW == 70 (0x15bbf3400) [pid = 1063] [serial = 2866] [outer = 0x1370a8c00] 17:07:20 INFO - ++DOMWINDOW == 71 (0x15bde6400) [pid = 1063] [serial = 2867] [outer = 0x1372f7400] 17:07:20 INFO - --DOCSHELL 0x1332bf300 == 29 [pid = 1063] [id = 1215] 17:07:20 INFO - --DOCSHELL 0x1332bfd00 == 28 [pid = 1063] [id = 1216] 17:07:20 INFO - --DOCSHELL 0x1332be900 == 27 [pid = 1063] [id = 1214] 17:07:20 INFO - --DOCSHELL 0x1332c1600 == 26 [pid = 1063] [id = 1217] 17:07:20 INFO - --DOCSHELL 0x131a42d00 == 25 [pid = 1063] [id = 1213] 17:07:20 INFO - --DOCSHELL 0x13092bb00 == 24 [pid = 1063] [id = 1211] 17:07:21 INFO - --DOCSHELL 0x1334de000 == 23 [pid = 1063] [id = 1218] 17:07:21 INFO - --DOCSHELL 0x12bb2f300 == 22 [pid = 1063] [id = 1204] 17:07:21 INFO - --DOCSHELL 0x12737f600 == 21 [pid = 1063] [id = 1186] 17:07:21 INFO - --DOCSHELL 0x12d4c1100 == 20 [pid = 1063] [id = 1205] 17:07:21 INFO - --DOCSHELL 0x131a40000 == 19 [pid = 1063] [id = 1212] 17:07:21 INFO - --DOCSHELL 0x1332bf800 == 18 [pid = 1063] [id = 1193] 17:07:21 INFO - --DOCSHELL 0x12de60200 == 17 [pid = 1063] [id = 1206] 17:07:21 INFO - --DOCSHELL 0x12de61100 == 16 [pid = 1063] [id = 1207] 17:07:21 INFO - --DOCSHELL 0x12de61600 == 15 [pid = 1063] [id = 1208] 17:07:21 INFO - --DOCSHELL 0x12de61b00 == 14 [pid = 1063] [id = 1209] 17:07:21 INFO - --DOMWINDOW == 70 (0x127274800) [pid = 1063] [serial = 2762] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:21 INFO - --DOMWINDOW == 69 (0x127e48c00) [pid = 1063] [serial = 2764] [outer = 0x0] [url = about:blank] 17:07:21 INFO - --DOMWINDOW == 68 (0x15bbf3000) [pid = 1063] [serial = 2811] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:21 INFO - --DOMWINDOW == 67 (0x128e94000) [pid = 1063] [serial = 2766] [outer = 0x0] [url = about:blank] 17:07:21 INFO - --DOMWINDOW == 66 (0x158531800) [pid = 1063] [serial = 2788] [outer = 0x0] [url = about:blank] 17:07:21 INFO - --DOMWINDOW == 65 (0x1373a1800) [pid = 1063] [serial = 2791] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:21 INFO - --DOMWINDOW == 64 (0x155961400) [pid = 1063] [serial = 2828] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:21 INFO - ++DOCSHELL 0x11fbdf000 == 15 [pid = 1063] [id = 1219] 17:07:21 INFO - ++DOMWINDOW == 65 (0x11fab8c00) [pid = 1063] [serial = 2868] [outer = 0x0] 17:07:21 INFO - ++DOMWINDOW == 66 (0x120538c00) [pid = 1063] [serial = 2869] [outer = 0x11fab8c00] 17:07:22 INFO - --DOMWINDOW == 65 (0x13630f800) [pid = 1063] [serial = 2830] [outer = 0x0] [url = about:blank] 17:07:22 INFO - --DOMWINDOW == 64 (0x15bbf3800) [pid = 1063] [serial = 2803] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:22 INFO - --DOMWINDOW == 63 (0x11f94a800) [pid = 1063] [serial = 2798] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:22 INFO - --DOMWINDOW == 62 (0x1367ed800) [pid = 1063] [serial = 2801] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:22 INFO - --DOMWINDOW == 61 (0x1372f7400) [pid = 1063] [serial = 2861] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:22 INFO - --DOMWINDOW == 60 (0x127b8b000) [pid = 1063] [serial = 2858] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:22 INFO - --DOMWINDOW == 59 (0x120594800) [pid = 1063] [serial = 2857] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:22 INFO - --DOMWINDOW == 58 (0x1370a8c00) [pid = 1063] [serial = 2860] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:22 INFO - --DOMWINDOW == 57 (0x133360400) [pid = 1063] [serial = 2854] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:22 INFO - --DOMWINDOW == 56 (0x131a67000) [pid = 1063] [serial = 2851] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:22 INFO - --DOMWINDOW == 55 (0x121763000) [pid = 1063] [serial = 2841] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:22 INFO - --DOMWINDOW == 54 (0x1217d5000) [pid = 1063] [serial = 2842] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:22 INFO - --DOMWINDOW == 53 (0x121ddb400) [pid = 1063] [serial = 2843] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:22 INFO - --DOMWINDOW == 52 (0x12666b000) [pid = 1063] [serial = 2844] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:22 INFO - --DOMWINDOW == 51 (0x11fbc3c00) [pid = 1063] [serial = 2835] [outer = 0x0] [url = about:blank] 17:07:22 INFO - --DOMWINDOW == 50 (0x15bde6400) [pid = 1063] [serial = 2867] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:22 INFO - --DOMWINDOW == 49 (0x1372f7800) [pid = 1063] [serial = 2862] [outer = 0x0] [url = about:blank] 17:07:22 INFO - --DOMWINDOW == 48 (0x127e48000) [pid = 1063] [serial = 2848] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:22 INFO - ++DOCSHELL 0x1201fdb00 == 16 [pid = 1063] [id = 1220] 17:07:22 INFO - ++DOMWINDOW == 49 (0x11fbc3800) [pid = 1063] [serial = 2870] [outer = 0x0] 17:07:22 INFO - ++DOMWINDOW == 50 (0x120594800) [pid = 1063] [serial = 2871] [outer = 0x11fbc3800] 17:07:22 INFO - ++DOMWINDOW == 51 (0x11fbc3c00) [pid = 1063] [serial = 2872] [outer = 0x11fbc3800] 17:07:22 INFO - ++DOCSHELL 0x12de5da00 == 17 [pid = 1063] [id = 1221] 17:07:22 INFO - ++DOMWINDOW == 52 (0x136b8c800) [pid = 1063] [serial = 2873] [outer = 0x0] 17:07:22 INFO - ++DOMWINDOW == 53 (0x136ba7800) [pid = 1063] [serial = 2874] [outer = 0x136b8c800] 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - ++DOCSHELL 0x130927500 == 18 [pid = 1063] [id = 1222] 17:07:23 INFO - ++DOMWINDOW == 54 (0x15bde6800) [pid = 1063] [serial = 2875] [outer = 0x0] 17:07:23 INFO - ++DOMWINDOW == 55 (0x15bde6c00) [pid = 1063] [serial = 2876] [outer = 0x15bde6800] 17:07:23 INFO - ++DOCSHELL 0x13092bb00 == 19 [pid = 1063] [id = 1223] 17:07:23 INFO - ++DOMWINDOW == 56 (0x1316cf000) [pid = 1063] [serial = 2877] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x130ac8f00 == 20 [pid = 1063] [id = 1224] 17:07:23 INFO - ++DOMWINDOW == 57 (0x1316cf400) [pid = 1063] [serial = 2878] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x131a40000 == 21 [pid = 1063] [id = 1225] 17:07:23 INFO - ++DOMWINDOW == 58 (0x1316cf800) [pid = 1063] [serial = 2879] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x131a42800 == 22 [pid = 1063] [id = 1226] 17:07:23 INFO - ++DOMWINDOW == 59 (0x1316cfc00) [pid = 1063] [serial = 2880] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x131a42d00 == 23 [pid = 1063] [id = 1227] 17:07:23 INFO - ++DOMWINDOW == 60 (0x131bc7000) [pid = 1063] [serial = 2881] [outer = 0x0] 17:07:23 INFO - ++DOMWINDOW == 61 (0x131bc7800) [pid = 1063] [serial = 2882] [outer = 0x1316cf000] 17:07:23 INFO - ++DOMWINDOW == 62 (0x15bde6400) [pid = 1063] [serial = 2883] [outer = 0x1316cf400] 17:07:23 INFO - ++DOMWINDOW == 63 (0x133e7c400) [pid = 1063] [serial = 2884] [outer = 0x1316cf800] 17:07:23 INFO - ++DOMWINDOW == 64 (0x133e7cc00) [pid = 1063] [serial = 2885] [outer = 0x1316cfc00] 17:07:23 INFO - ++DOMWINDOW == 65 (0x135241400) [pid = 1063] [serial = 2886] [outer = 0x131bc7000] 17:07:23 INFO - ++DOCSHELL 0x121730200 == 24 [pid = 1063] [id = 1228] 17:07:23 INFO - ++DOMWINDOW == 66 (0x12bff8400) [pid = 1063] [serial = 2887] [outer = 0x0] 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - ++DOCSHELL 0x12bf3f600 == 25 [pid = 1063] [id = 1229] 17:07:23 INFO - ++DOMWINDOW == 67 (0x12e8d8800) [pid = 1063] [serial = 2888] [outer = 0x0] 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - ++DOMWINDOW == 68 (0x131bc7400) [pid = 1063] [serial = 2889] [outer = 0x12bff8400] 17:07:23 INFO - ++DOMWINDOW == 69 (0x131bc7c00) [pid = 1063] [serial = 2890] [outer = 0x12e8d8800] 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - ++DOCSHELL 0x12de61100 == 26 [pid = 1063] [id = 1230] 17:07:23 INFO - ++DOMWINDOW == 70 (0x137674c00) [pid = 1063] [serial = 2891] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x130927f00 == 27 [pid = 1063] [id = 1231] 17:07:23 INFO - ++DOMWINDOW == 71 (0x137629c00) [pid = 1063] [serial = 2892] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x1334de000 == 28 [pid = 1063] [id = 1232] 17:07:23 INFO - ++DOMWINDOW == 72 (0x1376be000) [pid = 1063] [serial = 2893] [outer = 0x0] 17:07:23 INFO - ++DOCSHELL 0x1334dea00 == 29 [pid = 1063] [id = 1233] 17:07:23 INFO - ++DOMWINDOW == 73 (0x1376be400) [pid = 1063] [serial = 2894] [outer = 0x0] 17:07:23 INFO - [1063] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 17:07:23 INFO - ++DOCSHELL 0x1334def00 == 30 [pid = 1063] [id = 1234] 17:07:23 INFO - ++DOMWINDOW == 74 (0x137e5dc00) [pid = 1063] [serial = 2895] [outer = 0x0] 17:07:23 INFO - ++DOMWINDOW == 75 (0x137e68400) [pid = 1063] [serial = 2896] [outer = 0x137e5dc00] 17:07:23 INFO - --DOCSHELL 0x12de61100 == 29 [pid = 1063] [id = 1230] 17:07:23 INFO - --DOCSHELL 0x130927f00 == 28 [pid = 1063] [id = 1231] 17:07:23 INFO - --DOCSHELL 0x1334de000 == 27 [pid = 1063] [id = 1232] 17:07:23 INFO - --DOCSHELL 0x1334dea00 == 26 [pid = 1063] [id = 1233] 17:07:23 INFO - ++DOMWINDOW == 76 (0x11f4fb000) [pid = 1063] [serial = 2897] [outer = 0x137e5dc00] 17:07:23 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:07:23 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:07:23 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:07:23 INFO - [1063] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8499 17:07:23 INFO - --DOCSHELL 0x12bf3f600 == 25 [pid = 1063] [id = 1229] 17:07:23 INFO - --DOMWINDOW == 75 (0x1376be400) [pid = 1063] [serial = 2894] [outer = 0x0] [url = ] 17:07:23 INFO - --DOMWINDOW == 74 (0x1376be000) [pid = 1063] [serial = 2893] [outer = 0x0] [url = ] 17:07:23 INFO - --DOMWINDOW == 73 (0x137629c00) [pid = 1063] [serial = 2892] [outer = 0x0] [url = ] 17:07:23 INFO - --DOMWINDOW == 72 (0x137674c00) [pid = 1063] [serial = 2891] [outer = 0x0] [url = ] 17:07:24 INFO - --DOCSHELL 0x13542b900 == 24 [pid = 1063] [id = 1201] 17:07:24 INFO - --DOCSHELL 0x11f882d00 == 23 [pid = 1063] [id = 1203] 17:07:24 INFO - --DOCSHELL 0x12de5da00 == 22 [pid = 1063] [id = 1221] 17:07:24 INFO - --DOCSHELL 0x130927500 == 21 [pid = 1063] [id = 1222] 17:07:24 INFO - --DOCSHELL 0x13092bb00 == 20 [pid = 1063] [id = 1223] 17:07:24 INFO - --DOCSHELL 0x130ac8f00 == 19 [pid = 1063] [id = 1224] 17:07:24 INFO - --DOCSHELL 0x131a40000 == 18 [pid = 1063] [id = 1225] 17:07:24 INFO - --DOCSHELL 0x131a42800 == 17 [pid = 1063] [id = 1226] 17:07:24 INFO - --DOCSHELL 0x12e035a00 == 16 [pid = 1063] [id = 1210] 17:07:24 INFO - --DOCSHELL 0x121730200 == 15 [pid = 1063] [id = 1228] 17:07:24 INFO - --DOMWINDOW == 71 (0x130b72000) [pid = 1063] [serial = 2863] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 70 (0x137367c00) [pid = 1063] [serial = 2856] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 69 (0x1366cd400) [pid = 1063] [serial = 2855] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:24 INFO - --DOMWINDOW == 68 (0x1276eb400) [pid = 1063] [serial = 2847] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:24 INFO - --DOMWINDOW == 67 (0x1272a0800) [pid = 1063] [serial = 2846] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:24 INFO - --DOMWINDOW == 66 (0x15bf80c00) [pid = 1063] [serial = 2804] [outer = 0x0] [url = about:blank] 17:07:24 INFO - --DOMWINDOW == 65 (0x1367edc00) [pid = 1063] [serial = 2802] [outer = 0x0] [url = about:blank] 17:07:24 INFO - --DOMWINDOW == 64 (0x127e67c00) [pid = 1063] [serial = 2800] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:24 INFO - --DOMWINDOW == 63 (0x13630fc00) [pid = 1063] [serial = 2831] [outer = 0x0] [url = about:blank] 17:07:24 INFO - --DOMWINDOW == 62 (0x133360800) [pid = 1063] [serial = 2864] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 61 (0x15bbf3400) [pid = 1063] [serial = 2866] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 60 (0x127f0b400) [pid = 1063] [serial = 2849] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:24 INFO - --DOMWINDOW == 59 (0x131bc7c00) [pid = 1063] [serial = 2890] [outer = 0x12e8d8800] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 58 (0x131bc7400) [pid = 1063] [serial = 2889] [outer = 0x12bff8400] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:24 INFO - --DOCSHELL 0x1334def00 == 14 [pid = 1063] [id = 1234] 17:07:24 INFO - --DOMWINDOW == 57 (0x12bff8400) [pid = 1063] [serial = 2887] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:24 INFO - --DOMWINDOW == 56 (0x12e8d8800) [pid = 1063] [serial = 2888] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 55 (0x1370a8800) [pid = 1063] [serial = 2859] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:24 INFO - --DOMWINDOW == 54 (0x120594c00) [pid = 1063] [serial = 2839] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:24 INFO - --DOMWINDOW == 53 (0x120594800) [pid = 1063] [serial = 2871] [outer = 0x0] [url = about:blank] 17:07:24 INFO - --DOMWINDOW == 52 (0x131bc7800) [pid = 1063] [serial = 2882] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:24 INFO - --DOMWINDOW == 51 (0x133e7cc00) [pid = 1063] [serial = 2885] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:24 INFO - --DOMWINDOW == 50 (0x13630f400) [pid = 1063] [serial = 2837] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:24 INFO - --DOMWINDOW == 49 (0x126671000) [pid = 1063] [serial = 2845] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:24 INFO - --DOMWINDOW == 48 (0x131bc7000) [pid = 1063] [serial = 2881] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:24 INFO - --DOMWINDOW == 47 (0x1316cf400) [pid = 1063] [serial = 2878] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:24 INFO - --DOMWINDOW == 46 (0x1316cf000) [pid = 1063] [serial = 2877] [outer = 0x0] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 17:07:24 INFO - --DOMWINDOW == 45 (0x1316cf800) [pid = 1063] [serial = 2879] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:24 INFO - --DOMWINDOW == 44 (0x1316cfc00) [pid = 1063] [serial = 2880] [outer = 0x0] [url = chrome://devtools/content/layoutview/view.xhtml] 17:07:24 INFO - --DOMWINDOW == 43 (0x12a01ec00) [pid = 1063] [serial = 2850] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:24 INFO - --DOMWINDOW == 42 (0x135241400) [pid = 1063] [serial = 2886] [outer = 0x0] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 17:07:24 INFO - --DOMWINDOW == 41 (0x133e7c400) [pid = 1063] [serial = 2884] [outer = 0x0] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 17:07:25 INFO - MEMORY STAT | vsize 3791MB | residentFast 415MB | heapAllocated 129MB 17:07:25 INFO - 469 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_persist.js | took 9717ms 17:07:25 INFO - ++DOCSHELL 0x121730200 == 15 [pid = 1063] [id = 1235] 17:07:25 INFO - ++DOMWINDOW == 42 (0x1216bac00) [pid = 1063] [serial = 2898] [outer = 0x0] 17:07:25 INFO - ++DOMWINDOW == 43 (0x1217d5000) [pid = 1063] [serial = 2899] [outer = 0x1216bac00] 17:07:25 INFO - 470 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js 17:07:25 INFO - ++DOCSHELL 0x127e64300 == 16 [pid = 1063] [id = 1236] 17:07:25 INFO - ++DOMWINDOW == 44 (0x121cbac00) [pid = 1063] [serial = 2900] [outer = 0x0] 17:07:25 INFO - ++DOMWINDOW == 45 (0x1272a0800) [pid = 1063] [serial = 2901] [outer = 0x121cbac00] 17:07:25 INFO - ++DOCSHELL 0x1266a6e00 == 17 [pid = 1063] [id = 1237] 17:07:25 INFO - ++DOMWINDOW == 46 (0x127274800) [pid = 1063] [serial = 2902] [outer = 0x0] 17:07:25 INFO - ++DOMWINDOW == 47 (0x127e48000) [pid = 1063] [serial = 2903] [outer = 0x127274800] 17:07:25 INFO - ++DOMWINDOW == 48 (0x127e48c00) [pid = 1063] [serial = 2904] [outer = 0x127274800] 17:07:25 INFO - ++DOCSHELL 0x12c6dd300 == 18 [pid = 1063] [id = 1238] 17:07:25 INFO - ++DOMWINDOW == 49 (0x12df59000) [pid = 1063] [serial = 2905] [outer = 0x0] 17:07:25 INFO - ++DOMWINDOW == 50 (0x12df86800) [pid = 1063] [serial = 2906] [outer = 0x12df59000] 17:07:27 INFO - --DOCSHELL 0x11f52bc00 == 17 [pid = 1063] [id = 1202] 17:07:27 INFO - --DOCSHELL 0x12c6dd300 == 16 [pid = 1063] [id = 1238] 17:07:27 INFO - --DOCSHELL 0x11fbdf000 == 15 [pid = 1063] [id = 1219] 17:07:27 INFO - --DOCSHELL 0x1201fdb00 == 14 [pid = 1063] [id = 1220] 17:07:27 INFO - --DOCSHELL 0x131a42d00 == 13 [pid = 1063] [id = 1227] 17:07:27 INFO - --DOMWINDOW == 49 (0x1367be400) [pid = 1063] [serial = 2838] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 48 (0x15bde6400) [pid = 1063] [serial = 2883] [outer = 0x0] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 17:07:27 INFO - --DOMWINDOW == 47 (0x13480dc00) [pid = 1063] [serial = 2865] [outer = 0x0] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 17:07:27 INFO - --DOMWINDOW == 46 (0x121747c00) [pid = 1063] [serial = 2840] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 45 (0x11f4fb000) [pid = 1063] [serial = 2897] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:27 INFO - --DOMWINDOW == 44 (0x137e68400) [pid = 1063] [serial = 2896] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 43 (0x137e5dc00) [pid = 1063] [serial = 2895] [outer = 0x0] [url = data:text/html,<html></html>] 17:07:27 INFO - --DOMWINDOW == 42 (0x120538c00) [pid = 1063] [serial = 2869] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 41 (0x11f80f000) [pid = 1063] [serial = 2833] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 40 (0x121c1cc00) [pid = 1063] [serial = 2797] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 39 (0x120594400) [pid = 1063] [serial = 2795] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 38 (0x15bde6800) [pid = 1063] [serial = 2875] [outer = 0x0] [url = chrome://devtools/content/markupview/markup-view.xhtml] 17:07:27 INFO - --DOMWINDOW == 37 (0x11fbc3800) [pid = 1063] [serial = 2870] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:27 INFO - --DOMWINDOW == 36 (0x127e48000) [pid = 1063] [serial = 2903] [outer = 0x0] [url = about:blank] 17:07:27 INFO - --DOMWINDOW == 35 (0x136b8c800) [pid = 1063] [serial = 2873] [outer = 0x0] [url = chrome://devtools/content/inspector/inspector.xul] 17:07:27 INFO - --DOMWINDOW == 34 (0x11f4c0800) [pid = 1063] [serial = 2834] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:27 INFO - --DOMWINDOW == 33 (0x120961000) [pid = 1063] [serial = 2852] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:27 INFO - --DOMWINDOW == 32 (0x11fab8c00) [pid = 1063] [serial = 2868] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 17:07:27 INFO - --DOMWINDOW == 31 (0x10a467000) [pid = 1063] [serial = 2832] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 17:07:27 INFO - --DOMWINDOW == 30 (0x1205f8400) [pid = 1063] [serial = 2796] [outer = 0x0] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 17:07:27 INFO - --DOMWINDOW == 29 (0x12019e400) [pid = 1063] [serial = 2794] [outer = 0x0] [url = about:blank] 17:07:27 INFO - MEMORY STAT | vsize 3791MB | residentFast 410MB | heapAllocated 128MB 17:07:27 INFO - 471 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js | took 2457ms 17:07:27 INFO - ++DOCSHELL 0x11fbe2700 == 14 [pid = 1063] [id = 1239] 17:07:27 INFO - ++DOMWINDOW == 30 (0x120343c00) [pid = 1063] [serial = 2907] [outer = 0x0] 17:07:27 INFO - ++DOMWINDOW == 31 (0x120547800) [pid = 1063] [serial = 2908] [outer = 0x120343c00] 17:07:27 INFO - 472 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js 17:07:27 INFO - ++DOCSHELL 0x1285b6100 == 15 [pid = 1063] [id = 1240] 17:07:27 INFO - ++DOMWINDOW == 32 (0x127e48000) [pid = 1063] [serial = 2909] [outer = 0x0] 17:07:27 INFO - ++DOMWINDOW == 33 (0x127ed2000) [pid = 1063] [serial = 2910] [outer = 0x127e48000] 17:07:28 INFO - ++DOMWINDOW == 34 (0x128c2ac00) [pid = 1063] [serial = 2911] [outer = 0x127e48000] 17:07:28 INFO - ++DOCSHELL 0x12c6df100 == 16 [pid = 1063] [id = 1241] 17:07:28 INFO - ++DOMWINDOW == 35 (0x1299ea800) [pid = 1063] [serial = 2912] [outer = 0x0] 17:07:28 INFO - ++DOMWINDOW == 36 (0x1299fe000) [pid = 1063] [serial = 2913] [outer = 0x1299ea800] 17:07:28 INFO - ++DOCSHELL 0x12d25b500 == 17 [pid = 1063] [id = 1242] 17:07:28 INFO - ++DOMWINDOW == 37 (0x129aa6c00) [pid = 1063] [serial = 2914] [outer = 0x0] 17:07:28 INFO - ++DOMWINDOW == 38 (0x129f83800) [pid = 1063] [serial = 2915] [outer = 0x129aa6c00] 17:07:28 INFO - [1063] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 17:07:28 INFO - [1063] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 17:07:28 INFO - [1063] WARNING: RasterImage::Init failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/image/ImageFactory.cpp, line 109 17:07:28 INFO - [1063] WARNING: Image width or height is non-positive: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6314 17:07:28 INFO - ++DOMWINDOW == 39 (0x129a2a800) [pid = 1063] [serial = 2916] [outer = 0x129aa6c00] 17:07:28 INFO - ++DOCSHELL 0x12de60c00 == 18 [pid = 1063] [id = 1243] 17:07:28 INFO - ++DOMWINDOW == 40 (0x1371bf000) [pid = 1063] [serial = 2917] [outer = 0x0] 17:07:28 INFO - ++DOMWINDOW == 41 (0x1371bf400) [pid = 1063] [serial = 2918] [outer = 0x1371bf000] 17:07:29 INFO - MEMORY STAT | vsize 3792MB | residentFast 414MB | heapAllocated 135MB 17:07:29 INFO - 473 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js | took 1910ms 17:07:29 INFO - ++DOCSHELL 0x130928400 == 19 [pid = 1063] [id = 1244] 17:07:29 INFO - ++DOMWINDOW == 42 (0x131a67000) [pid = 1063] [serial = 2919] [outer = 0x0] 17:07:29 INFO - ++DOMWINDOW == 43 (0x133e7cc00) [pid = 1063] [serial = 2920] [outer = 0x131a67000] 17:07:29 INFO - 474 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_view_source.js 17:07:29 INFO - ++DOCSHELL 0x130927500 == 20 [pid = 1063] [id = 1245] 17:07:29 INFO - ++DOMWINDOW == 44 (0x134857800) [pid = 1063] [serial = 2921] [outer = 0x0] 17:07:29 INFO - ++DOMWINDOW == 45 (0x1351cc400) [pid = 1063] [serial = 2922] [outer = 0x134857800] 17:07:29 INFO - ++DOMWINDOW == 46 (0x12775d000) [pid = 1063] [serial = 2923] [outer = 0x134857800] 17:07:30 INFO - ++DOCSHELL 0x11fbe0900 == 21 [pid = 1063] [id = 1246] 17:07:30 INFO - ++DOMWINDOW == 47 (0x135172c00) [pid = 1063] [serial = 2924] [outer = 0x0] 17:07:30 INFO - ++DOMWINDOW == 48 (0x1367f0000) [pid = 1063] [serial = 2925] [outer = 0x135172c00] 17:07:30 INFO - ++DOMWINDOW == 49 (0x1216a2800) [pid = 1063] [serial = 2926] [outer = 0x135172c00] 17:07:30 INFO - ++DOCSHELL 0x1355f1f00 == 22 [pid = 1063] [id = 1247] 17:07:30 INFO - ++DOMWINDOW == 50 (0x133e24000) [pid = 1063] [serial = 2927] [outer = 0x0] 17:07:30 INFO - ++DOMWINDOW == 51 (0x133e24400) [pid = 1063] [serial = 2928] [outer = 0x133e24000] 17:07:31 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 17:07:31 INFO - ++DOCSHELL 0x1332c1600 == 23 [pid = 1063] [id = 1248] 17:07:31 INFO - ++DOMWINDOW == 52 (0x133447000) [pid = 1063] [serial = 2929] [outer = 0x0] 17:07:31 INFO - ++DOMWINDOW == 53 (0x133e25800) [pid = 1063] [serial = 2930] [outer = 0x133447000] 17:07:31 INFO - ++DOCSHELL 0x137080d00 == 24 [pid = 1063] [id = 1249] 17:07:31 INFO - ++DOMWINDOW == 54 (0x136b56400) [pid = 1063] [serial = 2931] [outer = 0x0] 17:07:31 INFO - [1063] WARNING: No inner window available!: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9246 17:07:31 INFO - ++DOMWINDOW == 55 (0x11f80f000) [pid = 1063] [serial = 2932] [outer = 0x136b56400] 17:07:32 INFO - --DOCSHELL 0x120929200 == 23 [pid = 1063] [id = 1184] 17:07:32 INFO - --DOCSHELL 0x11fbe2700 == 22 [pid = 1063] [id = 1239] 17:07:32 INFO - --DOCSHELL 0x127e64300 == 21 [pid = 1063] [id = 1236] 17:07:32 INFO - --DOCSHELL 0x1285b6100 == 20 [pid = 1063] [id = 1240] 17:07:32 INFO - --DOCSHELL 0x12c6df100 == 19 [pid = 1063] [id = 1241] 17:07:32 INFO - --DOCSHELL 0x12d25b500 == 18 [pid = 1063] [id = 1242] 17:07:32 INFO - --DOCSHELL 0x121730200 == 17 [pid = 1063] [id = 1235] 17:07:32 INFO - --DOCSHELL 0x12de60c00 == 16 [pid = 1063] [id = 1243] 17:07:32 INFO - --DOCSHELL 0x1266a6e00 == 15 [pid = 1063] [id = 1237] 17:07:33 INFO - --DOCSHELL 0x128580b00 == 14 [pid = 1063] [id = 1185] 17:07:33 INFO - --DOMWINDOW == 54 (0x136ba7800) [pid = 1063] [serial = 2874] [outer = 0x0] [url = about:blank] 17:07:33 INFO - --DOMWINDOW == 53 (0x12036d400) [pid = 1063] [serial = 2836] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:33 INFO - --DOMWINDOW == 52 (0x131a67800) [pid = 1063] [serial = 2853] [outer = 0x0] [url = about:blank] 17:07:33 INFO - --DOMWINDOW == 51 (0x15bde6c00) [pid = 1063] [serial = 2876] [outer = 0x0] [url = about:blank] 17:07:33 INFO - --DOMWINDOW == 50 (0x11fbc3c00) [pid = 1063] [serial = 2872] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:33 INFO - ++DOCSHELL 0x11f9a8800 == 15 [pid = 1063] [id = 1250] 17:07:33 INFO - ++DOMWINDOW == 51 (0x12014b400) [pid = 1063] [serial = 2933] [outer = 0x0] 17:07:33 INFO - ++DOMWINDOW == 52 (0x12036d400) [pid = 1063] [serial = 2934] [outer = 0x12014b400] 17:07:33 INFO - ++DOMWINDOW == 53 (0x12c52b400) [pid = 1063] [serial = 2935] [outer = 0x12014b400] 17:07:33 INFO - ++DOMWINDOW == 54 (0x12c6b9800) [pid = 1063] [serial = 2936] [outer = 0x12014b400] 17:07:33 INFO - [1063] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 17:07:33 INFO - --DOCSHELL 0x137080d00 == 14 [pid = 1063] [id = 1249] 17:07:33 INFO - --DOCSHELL 0x1332c1600 == 13 [pid = 1063] [id = 1248] 17:07:33 INFO - --DOCSHELL 0x1355f1f00 == 12 [pid = 1063] [id = 1247] 17:07:34 INFO - MEMORY STAT | vsize 3783MB | residentFast 407MB | heapAllocated 134MB 17:07:34 INFO - 475 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_view_source.js | took 4397ms 17:07:34 INFO - ++DOCSHELL 0x12bb2f300 == 13 [pid = 1063] [id = 1251] 17:07:34 INFO - ++DOMWINDOW == 55 (0x128fcf800) [pid = 1063] [serial = 2937] [outer = 0x0] 17:07:34 INFO - ++DOMWINDOW == 56 (0x12963d400) [pid = 1063] [serial = 2938] [outer = 0x128fcf800] 17:07:34 INFO - ++DOMWINDOW == 57 (0x12976b400) [pid = 1063] [serial = 2939] [outer = 0x129aaf000] 17:07:34 INFO - ++DOMWINDOW == 58 (0x12988f400) [pid = 1063] [serial = 2940] [outer = 0x129aaf400] 17:07:34 INFO - --DOCSHELL 0x15389bf00 == 12 [pid = 1063] [id = 12] 17:07:34 INFO - ++DOMWINDOW == 59 (0x128ffb000) [pid = 1063] [serial = 2941] [outer = 0x129aaf000] 17:07:34 INFO - ++DOMWINDOW == 60 (0x129f3e400) [pid = 1063] [serial = 2942] [outer = 0x129aaf400] 17:07:35 INFO - --DOCSHELL 0x11f52b700 == 11 [pid = 1063] [id = 13] 17:07:35 INFO - --DOCSHELL 0x1334e0d00 == 10 [pid = 1063] [id = 8] 17:07:36 INFO - --DOCSHELL 0x11fbe0900 == 9 [pid = 1063] [id = 1246] 17:07:36 INFO - --DOCSHELL 0x130928400 == 8 [pid = 1063] [id = 1244] 17:07:36 INFO - --DOCSHELL 0x130927500 == 7 [pid = 1063] [id = 1245] 17:07:36 INFO - --DOMWINDOW == 59 (0x12988f400) [pid = 1063] [serial = 2940] [outer = 0x129aaf400] [url = about:blank] 17:07:36 INFO - --DOMWINDOW == 58 (0x12cbf1c00) [pid = 1063] [serial = 10] [outer = 0x129aaf400] [url = about:blank] 17:07:36 INFO - --DOMWINDOW == 57 (0x12976b400) [pid = 1063] [serial = 2939] [outer = 0x129aaf000] [url = about:blank] 17:07:36 INFO - --DOMWINDOW == 56 (0x12cbf1800) [pid = 1063] [serial = 9] [outer = 0x129aaf000] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 55 (0x133e24400) [pid = 1063] [serial = 2928] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 54 (0x12df86800) [pid = 1063] [serial = 2906] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 53 (0x127e48c00) [pid = 1063] [serial = 2904] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 52 (0x1216a2800) [pid = 1063] [serial = 2926] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 51 (0x129a2a800) [pid = 1063] [serial = 2916] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 50 (0x12014b400) [pid = 1063] [serial = 2933] [outer = 0x0] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 17:07:37 INFO - --DOMWINDOW == 49 (0x136b56400) [pid = 1063] [serial = 2931] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:37 INFO - --DOMWINDOW == 48 (0x133447000) [pid = 1063] [serial = 2929] [outer = 0x0] [url = chrome://devtools/content/debugger/debugger.xul] 17:07:37 INFO - --DOMWINDOW == 47 (0x133e24000) [pid = 1063] [serial = 2927] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:37 INFO - --DOMWINDOW == 46 (0x11f80f000) [pid = 1063] [serial = 2932] [outer = 0x0] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/themes/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 17:07:37 INFO - --DOMWINDOW == 45 (0x134857800) [pid = 1063] [serial = 2921] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 17:07:37 INFO - --DOMWINDOW == 44 (0x133e25800) [pid = 1063] [serial = 2930] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 43 (0x131a67000) [pid = 1063] [serial = 2919] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 42 (0x133e7cc00) [pid = 1063] [serial = 2920] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 41 (0x12df59000) [pid = 1063] [serial = 2905] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:37 INFO - --DOMWINDOW == 40 (0x127274800) [pid = 1063] [serial = 2902] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 39 (0x135172c00) [pid = 1063] [serial = 2924] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 38 (0x129aa6c00) [pid = 1063] [serial = 2914] [outer = 0x0] [url = chrome://devtools/content/framework/toolbox.xul] 17:07:37 INFO - --DOMWINDOW == 37 (0x1371bf000) [pid = 1063] [serial = 2917] [outer = 0x0] [url = chrome://devtools/content/webconsole/webconsole.xul] 17:07:37 INFO - --DOMWINDOW == 36 (0x1216bac00) [pid = 1063] [serial = 2898] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 35 (0x121cbac00) [pid = 1063] [serial = 2900] [outer = 0x0] [url = data:text/html;charset=utf8,<p>hello] 17:07:37 INFO - --DOMWINDOW == 34 (0x120343c00) [pid = 1063] [serial = 2907] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 33 (0x127e48000) [pid = 1063] [serial = 2909] [outer = 0x0] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 17:07:37 INFO - --DOMWINDOW == 32 (0x1299ea800) [pid = 1063] [serial = 2912] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 31 (0x1538a5c00) [pid = 1063] [serial = 28] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 17:07:37 INFO - --DOMWINDOW == 30 (0x11f982c00) [pid = 1063] [serial = 32] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 29 (0x12c6b9800) [pid = 1063] [serial = 2936] [outer = 0x0] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 17:07:37 INFO - --DOMWINDOW == 28 (0x12c52b400) [pid = 1063] [serial = 2935] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 27 (0x12036d400) [pid = 1063] [serial = 2934] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 26 (0x11f8ccc00) [pid = 1063] [serial = 31] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 25 (0x13544f400) [pid = 1063] [serial = 30] [outer = 0x0] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 17:07:37 INFO - --DOMWINDOW == 24 (0x129f83800) [pid = 1063] [serial = 2915] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 23 (0x1367f0000) [pid = 1063] [serial = 2925] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 22 (0x1217d5000) [pid = 1063] [serial = 2899] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 21 (0x1272a0800) [pid = 1063] [serial = 2901] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 20 (0x120547800) [pid = 1063] [serial = 2908] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 19 (0x127ed2000) [pid = 1063] [serial = 2910] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 18 (0x1299fe000) [pid = 1063] [serial = 2913] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 17 (0x1351cc400) [pid = 1063] [serial = 2922] [outer = 0x0] [url = about:blank] 17:07:37 INFO - --DOMWINDOW == 16 (0x12ae58400) [pid = 1063] [serial = 21] [outer = 0x0] [url = about:newtab] 17:07:37 INFO - --DOMWINDOW == 15 (0x12988f800) [pid = 1063] [serial = 17] [outer = 0x0] [url = about:newtab] 17:07:37 INFO - --DOMWINDOW == 14 (0x1371bf400) [pid = 1063] [serial = 2918] [outer = 0x0] [url = about:blank] 17:07:38 INFO - --DOMWINDOW == 13 (0x12775d000) [pid = 1063] [serial = 2923] [outer = 0x0] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 17:07:38 INFO - --DOMWINDOW == 12 (0x128c2ac00) [pid = 1063] [serial = 2911] [outer = 0x0] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 17:07:38 INFO - --DOCSHELL 0x11f9a8800 == 6 [pid = 1063] [id = 1250] 17:07:40 INFO - Completed ShutdownLeaks collections in process 1063 17:07:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:07:40 INFO - --DOCSHELL 0x12cb87800 == 5 [pid = 1063] [id = 6] 17:07:40 INFO - --DOCSHELL 0x121c8e400 == 4 [pid = 1063] [id = 1] 17:07:41 INFO - --DOCSHELL 0x12a059500 == 3 [pid = 1063] [id = 3] 17:07:41 INFO - --DOCSHELL 0x12a059a00 == 2 [pid = 1063] [id = 4] 17:07:41 INFO - --DOCSHELL 0x12bb2f300 == 1 [pid = 1063] [id = 1251] 17:07:41 INFO - --DOCSHELL 0x127a9e300 == 0 [pid = 1063] [id = 2] 17:07:41 INFO - [1063] WARNING: NS_ENSURE_TRUE(mTextInputHandler) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsChildView.mm, line 5375 17:07:41 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:07:41 INFO - [1063] WARNING: nsAppShell::Exit() called redundantly: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/widget/cocoa/nsAppShell.mm, line 679 17:07:41 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:07:41 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:07:41 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 17:07:42 INFO - [1063] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/fx-team-m64-d-0000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 17:07:43 INFO - --DOMWINDOW == 11 (0x129f3e400) [pid = 1063] [serial = 2942] [outer = 0x129aaf400] [url = about:blank] 17:07:43 INFO - --DOMWINDOW == 10 (0x128ffb000) [pid = 1063] [serial = 2941] [outer = 0x129aaf000] [url = about:blank] 17:07:43 INFO - --DOMWINDOW == 9 (0x129aaf400) [pid = 1063] [serial = 6] [outer = 0x0] [url = about:blank] 17:07:43 INFO - --DOMWINDOW == 8 (0x129aaf000) [pid = 1063] [serial = 5] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 7 (0x127b62c00) [pid = 1063] [serial = 4] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 6 (0x121d4d000) [pid = 1063] [serial = 2] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 5 (0x12048f800) [pid = 1063] [serial = 1] [outer = 0x0] [url = chrome://browser/content/hiddenWindow.xul] 17:07:44 INFO - --DOMWINDOW == 4 (0x12d4f4400) [pid = 1063] [serial = 14] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 3 (0x12963d400) [pid = 1063] [serial = 2938] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 2 (0x128fcf800) [pid = 1063] [serial = 2937] [outer = 0x0] [url = about:blank] 17:07:44 INFO - --DOMWINDOW == 1 (0x12d4f4000) [pid = 1063] [serial = 13] [outer = 0x0] [url = chrome://mochikit/content/browser-harness.xul] 17:07:44 INFO - --DOMWINDOW == 0 (0x127b62800) [pid = 1063] [serial = 3] [outer = 0x0] [url = chrome://browser/content/browser.xul] 17:07:44 INFO - [1063] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/fx-team-m64-d-0000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 17:07:44 INFO - nsStringStats 17:07:44 INFO - => mAllocCount: 3368922 17:07:44 INFO - => mReallocCount: 246227 17:07:44 INFO - => mFreeCount: 3368922 17:07:44 INFO - => mShareCount: 5077598 17:07:44 INFO - => mAdoptCount: 216683 17:07:44 INFO - => mAdoptFreeCount: 216683 17:07:44 INFO - => Process ID: 1063, Thread ID: 140735084678336 17:07:44 INFO - TEST-INFO | Main app process: exit 0 17:07:44 INFO - runtests.py | Application ran for: 0:12:58.106562 17:07:44 INFO - zombiecheck | Reading PID log: /var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/tmpRRjwdrpidlog 17:07:44 INFO - Stopping web server 17:07:44 INFO - Stopping web socket server 17:07:44 INFO - Stopping ssltunnel 17:07:44 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 17:07:44 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 17:07:44 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 17:07:44 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 17:07:44 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1063 17:07:44 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 17:07:44 INFO - | | Per-Inst Leaked| Total Rem| 17:07:44 INFO - 0 |TOTAL | 21 0|236686658 0| 17:07:44 INFO - nsTraceRefcnt::DumpStatistics: 1563 entries 17:07:44 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 17:07:44 INFO - runtests.py | Running tests: end. 17:07:44 INFO - 476 INFO checking window state 17:07:44 INFO - 477 INFO TEST-START | Shutdown 17:07:44 INFO - 478 INFO Browser Chrome Test Summary 17:07:44 INFO - 479 INFO Passed: 2993 17:07:44 INFO - 480 INFO Failed: 0 17:07:44 INFO - 481 INFO Todo: 1 17:07:44 INFO - 482 INFO *** End BrowserChrome Test Results *** 17:07:44 INFO - TEST-INFO | checking window state 17:07:44 INFO - Browser Chrome Test Summary 17:07:44 INFO - Passed: 3729 17:07:44 INFO - Failed: 0 17:07:44 INFO - Todo: 1 17:07:44 INFO - *** End BrowserChrome Test Results *** 17:07:44 INFO - SUITE-END | took 924s 17:07:44 INFO - Return code: 0 17:07:44 INFO - TinderboxPrint: mochitest-mochitest-devtools-chrome-chunked<br/>3729/0/1 17:07:44 INFO - # TBPL SUCCESS # 17:07:44 INFO - The mochitest suite: mochitest-devtools-chrome-chunked ran with return status: SUCCESS 17:07:44 INFO - Running post-action listener: _package_coverage_data 17:07:44 INFO - Running post-action listener: _resource_record_post_action 17:07:44 INFO - Running post-run listener: _resource_record_post_run 17:07:45 INFO - Total resource usage - Wall time: 945s; CPU: 60.0%; Read bytes: 35417600; Write bytes: 430854144; Read time: 4805; Write time: 20530 17:07:45 INFO - install - Wall time: 20s; CPU: 49.0%; Read bytes: 783872; Write bytes: 145547264; Read time: 183; Write time: 6549 17:07:45 INFO - run-tests - Wall time: 926s; CPU: 60.0%; Read bytes: 33449984; Write bytes: 282535936; Read time: 4463; Write time: 12834 17:07:45 INFO - Running post-run listener: _upload_blobber_files 17:07:45 INFO - Blob upload gear active. 17:07:45 INFO - Preparing to upload files from /builds/slave/test/build/blobber_upload_dir. 17:07:45 INFO - Files from /builds/slave/test/build/blobber_upload_dir are to be uploaded with <fx-team> branch at the following location(s): https://blobupload.elasticbeanstalk.com 17:07:45 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '/builds/slave/test/build/venv/bin/blobberc.py', '-u', 'https://blobupload.elasticbeanstalk.com', '-a', '/builds/slave/test/oauth.txt', '-b', 'fx-team', '-d', '/builds/slave/test/build/blobber_upload_dir', '--output-manifest', '/builds/slave/test/build/uploaded_files.json'] 17:07:45 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python /builds/slave/test/build/venv/bin/blobberc.py -u https://blobupload.elasticbeanstalk.com -a /builds/slave/test/oauth.txt -b fx-team -d /builds/slave/test/build/blobber_upload_dir --output-manifest /builds/slave/test/build/uploaded_files.json 17:07:46 INFO - (blobuploader) - INFO - Open directory for files ... 17:07:46 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log ... 17:07:46 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 17:07:46 INFO - (blobuploader) - INFO - Uploading, attempt #1. 17:07:47 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/cbe343b640371aa512a9de7f4b06cb39e819c213f88b803198266f5a5147b17c7ea5b0d49095db1d452be70e6c57bc715d876558aba20670e456a60d197639d5'>mochitest-devtools-chrome-chunked_errorsummary.log</a>: uploaded 17:07:47 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 17:07:47 INFO - (blobuploader) - INFO - Done attempting. 17:07:47 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log ... 17:07:47 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 17:07:47 INFO - (blobuploader) - INFO - Uploading, attempt #1. 17:07:48 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/aafd860e254afb5c71db47daf0c9be594d42c14be226a769fe510a3df394805c44717b58060f33e8d41ba0d007034c42fc998630a1384844f3ee084de0690c85'>mochitest-devtools-chrome-chunked_raw.log</a>: uploaded 17:07:48 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 17:07:48 INFO - (blobuploader) - INFO - Done attempting. 17:07:48 INFO - (blobuploader) - INFO - Iteration through files over. 17:07:48 INFO - Return code: 0 17:07:48 INFO - rmtree: /builds/slave/test/build/uploaded_files.json 17:07:48 INFO - retry: Calling remove with args: ('/builds/slave/test/build/uploaded_files.json',), kwargs: {}, attempt #1 17:07:48 INFO - Setting buildbot property blobber_files to {"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/aafd860e254afb5c71db47daf0c9be594d42c14be226a769fe510a3df394805c44717b58060f33e8d41ba0d007034c42fc998630a1384844f3ee084de0690c85", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/cbe343b640371aa512a9de7f4b06cb39e819c213f88b803198266f5a5147b17c7ea5b0d49095db1d452be70e6c57bc715d876558aba20670e456a60d197639d5"} 17:07:48 INFO - Writing buildbot properties ['blobber_files'] to /builds/slave/test/properties/blobber_files 17:07:48 INFO - Writing to file /builds/slave/test/properties/blobber_files 17:07:48 INFO - Contents: 17:07:48 INFO - blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/aafd860e254afb5c71db47daf0c9be594d42c14be226a769fe510a3df394805c44717b58060f33e8d41ba0d007034c42fc998630a1384844f3ee084de0690c85", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/cbe343b640371aa512a9de7f4b06cb39e819c213f88b803198266f5a5147b17c7ea5b0d49095db1d452be70e6c57bc715d876558aba20670e456a60d197639d5"} 17:07:48 INFO - Copying logs to upload dir... 17:07:48 INFO - mkdir: /builds/slave/test/build/upload/logs program finished with exit code 0 elapsedTime=1033.840193 ========= Finished '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 17 mins, 14 secs) (at 2015-10-29 17:07:49.736294) ========= ========= Started set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2015-10-29 17:07:49.739714) ========= bash -c 'for file in `ls -1`; do cat $file; done' in dir /builds/slave/test/properties (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'for file in `ls -1`; do cat $file; done'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test/properties RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/aafd860e254afb5c71db47daf0c9be594d42c14be226a769fe510a3df394805c44717b58060f33e8d41ba0d007034c42fc998630a1384844f3ee084de0690c85", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/cbe343b640371aa512a9de7f4b06cb39e819c213f88b803198266f5a5147b17c7ea5b0d49095db1d452be70e6c57bc715d876558aba20670e456a60d197639d5"} build_url:https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg symbols_url:https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip program finished with exit code 0 elapsedTime=0.037510 build_url: 'https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.dmg' blobber_files: '{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/aafd860e254afb5c71db47daf0c9be594d42c14be226a769fe510a3df394805c44717b58060f33e8d41ba0d007034c42fc998630a1384844f3ee084de0690c85", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/fx-team/sha512/cbe343b640371aa512a9de7f4b06cb39e819c213f88b803198266f5a5147b17c7ea5b0d49095db1d452be70e6c57bc715d876558aba20670e456a60d197639d5"}' symbols_url: 'https://queue.taskcluster.net/v1/task/DOUGTyCASFmP-e0KQeDTRw/artifacts/public/build/firefox-45.0a1.en-US.mac64.crashreporter-symbols.zip' ========= Finished set props: build_url blobber_files symbols_url (results: 0, elapsed: 0 secs) (at 2015-10-29 17:07:50.078902) ========= ========= Started 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 17:07:50.079447) ========= rm -f oauth.txt in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-f', 'oauth.txt'] environment: Apple_PubSub_Socket_Render=/tmp/launch-nsq2bG/Render DISPLAY=/tmp/launch-6aJMsw/org.x:0 GIT_SHARE_BASE_DIR=/builds/git-shared HG_SHARE_BASE_DIR=/builds/hg-shared HOME=/Users/cltbld IDLEIZER_DISABLE_SHUTDOWN=true LOGNAME=cltbld PATH=/usr/local/sbin:/usr/local/bin:/usr/sbin:/usr/bin:/sbin:/bin:/usr/bin/X11 PWD=/builds/slave/test RUNNER_CONFIG_CMD=/opt/runner/bin/python2.7 /opt/runner/bin/runner -c /opt/runner/runner.cfg SHELL=/bin/bash SSH_AUTH_SOCK=/tmp/launch-nqOe0Q/Listeners TMPDIR=/var/folders/zG/zGHkqumEGdeCfyrrLxkykE+++-k/-Tmp-/ TWISTD_LOG_PATH=/builds/slave/twistd.log USER=cltbld VERSIONER_PYTHON_PREFER_32_BIT=no VERSIONER_PYTHON_VERSION=2.6 __CF_USER_TEXT_ENCODING=0x1C:0:0 using PTY: False program finished with exit code 0 elapsedTime=0.009111 ========= Finished 'rm -f ...' (results: 0, elapsed: 0 secs) (at 2015-10-29 17:07:50.366117) ========= ========= Started reboot slave lost (results: 0, elapsed: 12 secs) (at 2015-10-29 17:07:50.366531) ========= ========= Finished reboot slave lost (results: 0, elapsed: 12 secs) (at 2015-10-29 17:08:02.867438) =========